/* Start:/local/templates/dw/assets/css/snippets.css?17689893435812*/
.snippet-type-1 .snippet-line:first-child {
	margin-top: 0;
}

.snippet-type-1 .snippet-line {
	display: table;
	width: 100%;
	margin-top: 24px;
}

.snippet-type-1 .snippet-line-icon,
.snippet-type-1 .snippet-line-text {
	display: table-cell;
	line-height: normal;
	vertical-align: middle;
}

.snippet-type-1 .snippet-line-text {
	padding-left: 6px;
}

.snippet-type-1 .snippet-line-icon {
	width: 20px;
	line-height: 0;
}

.snippet-type-1 .snippet-line-icon .sprite {
	display: inline-block;
	vertical-align: middle;
}

.snippet-type-2 .snippet-line:first-child {
	margin-top: 0;
}

.snippet-type-2 .snippet-line {
	display: table;
	width: 100%;
	margin-top: 12px;
}

.snippet-type-2 .snippet-line-icon,
.snippet-type-2 .snippet-line-text {
	display: table-cell;
	line-height: normal;
	vertical-align: middle;
}

.snippet-type-2 .snippet-line-text {
	padding-left: 6px;
}

.snippet-type-2 .snippet-line-icon {
	width: 20px;
	line-height: 0;
}

.snippet-type-2 .snippet-line-icon .sprite {
	display: inline-block;
	vertical-align: middle;
}

.snippet-type-3 .snippet-line {
	display: table;
	width: 100%;
}

.snippet-type-3 .snippet-line-icon,
.snippet-type-3 .snippet-line-text {
	display: table-cell;
	line-height: normal;
	vertical-align: middle;
}

.snippet-type-3 .snippet-line-text {
	padding-left: 6px;
}

.snippet-type-3 .snippet-line-icon {
	width: 42px;
	line-height: 0;
}

.snippet-type-3 .snippet-line-icon img {
	display: inline-block;
	max-width: 100%;
	max-height: 100%;
	vertical-align: middle;
}

.snippet-type-3 .snippet-line-icon .sprite {
	display: inline-block;
	vertical-align: middle;
}

.snippet-type-4 {
	box-sizing: border-box;
	padding: 12px;
	border-radius: 40px;
}

.snippet-type-4 .snippet-line {
	display: table;
	width: 100%;
}

.snippet-type-4 .snippet-line-icon,
.snippet-type-4 .snippet-line-text {
	display: table-cell;
	line-height: normal;
	vertical-align: middle;
}

.snippet-type-4 .snippet-line-text {
	padding-left: 6px;
}

.snippet-type-4 .snippet-line-icon {
	width: 42px;
	line-height: 0;
}

.snippet-type-4 .snippet-line-icon img {
	display: inline-block;
	max-width: 100%;
	max-height: 100%;
	vertical-align: middle;
}

.snippet-type-4 .snippet-line-icon .sprite {
	display: inline-block;
	vertical-align: middle;
}

.snippet-type-5 .snippet-line:first-child {
	margin-top: 0;
}

.snippet-type-5 .snippet-line {
	display: table;
	width: 100%;
	margin-top: 24px;
}

.snippet-type-5 .snippet-line-icon,
.snippet-type-5 .snippet-line-text {
	display: table-cell;
	line-height: normal;
	vertical-align: middle;
}

.snippet-type-5 .snippet-line-text {
	padding-left: 6px;
}

.snippet-type-5 .snippet-line-icon {
	width: 42px;
	line-height: 0;
}

.snippet-type-5 .snippet-line-icon img {
	display: inline-block;
	max-width: 100%;
	max-height: 100%;
	vertical-align: middle;
}

.snippet-type-5 .snippet-line-icon .sprite {
	display: inline-block;
	vertical-align: middle;
}

.snippet-type-5 .snippet-line-table {
	display: table;
	width: 100%;
	overflow: hidden;
	table-layout: fixed;
}

.snippet-type-5 .snippet-line-table .snippet-line-column {
	position: relative;
	display: table-cell;
	width: 70%;
	vertical-align: middle;
}

.snippet-type-5 .snippet-line-table .snippet-line-column:first-child::after {
	position: absolute;
	width: 100%;
	height: 16px;
	margin-left: 12px;
	border-bottom: 1px dotted #cccccc;
	content: "";
}

.snippet-type-5 .snippet-line-table .snippet-line-column:last-child {
	position: relative;
	z-index: 1;
	width: 30%;
	padding-left: 12px;
}

.snippet-type-6 .snippet-circle-wrap {
	position: relative;
	width: 570px;
	height: 570px;
	overflow: hidden;
}

.snippet-type-6 .snippet-circle {
	position: absolute;
	top: 50%;
	left: 50%;
	width: 100%;
	height: 100%;
	background: url("/local/templates/dw/assets/css/../images/snippet-6-circle-1.png") no-repeat center / cover;
	transform: translate(-50%, -50%);
	transform-origin: top left;
	animation: circle 27s linear infinite;
}

.snippet-type-6 .snippet-circle-2 {
	width: 100%;
	height: 100%;
	background-image: url("/local/templates/dw/assets/css/../images/snippet-6-circle-2.png");
	animation: circle 25s linear infinite reverse;
}

.snippet-type-6 .snippet-circle-3 {
	width: 100%;
	height: 100%;
	background-image: url("/local/templates/dw/assets/css/../images/snippet-6-circle-3.png");
	animation: circle 20s linear infinite;
}

.snippet-type-7 .snippet-circle-wrap {
	position: relative;
	width: 570px;
	height: 570px;
}

.snippet-type-7 .snippet-circle {
	position: absolute;
	top: 50%;
	left: 50%;
	width: 100%;
	height: 100%;
	background: url("/local/templates/dw/assets/css/../images/snippet-7-circle-1.png") no-repeat center / cover;
	transform: translate(-50%, -50%);
	transform-origin: top left;
	animation: circle 27s linear infinite;
}

.snippet-type-7 .snippet-circle-2 {
	width: 100%;
	height: 100%;
	background-image: url("/local/templates/dw/assets/css/../images/snippet-7-circle-2.png");
	animation: circle 25s linear infinite reverse;
}

.snippet-type-7 .snippet-circle-3 {
	width: 100%;
	height: 100%;
	background-image: url("/local/templates/dw/assets/css/../images/snippet-7-circle-3.png");
	animation: circle 20s linear infinite;
}

.snippet-type-8 .snippet-circle-wrap {
	position: relative;
	width: 860px;
	height: 860px;
}

.snippet-type-8 .snippet-circle {
	position: absolute;
	top: 50%;
	left: 50%;
	width: 100%;
	height: 100%;
	background: url("/local/templates/dw/assets/css/../images/snippet-6-circle-1.png") no-repeat center / cover;
	transform: translate(-50%, -50%);
	transform-origin: top left;
	animation: circle 27s linear infinite;
}

.snippet-type-8 .snippet-circle-2 {
	width: 100%;
	height: 100%;
	background-image: url("/local/templates/dw/assets/css/../images/snippet-6-circle-2.png");
	animation: circle 25s linear infinite reverse;
}

.snippet-type-8 {
	width: 46px;
	height: 61px;
	background-image: url("/local/templates/dw/assets/css/../images/snippet-8-marker-map.png");
}

@keyframes circle {
	from {
		transform: rotate(0deg) translate(-50%, -50%);
	}

	to {
		transform: rotate(360deg) translate(-50%, -50%);
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/buttons.css?17690161661227*/
button {
	padding: 0;
	font: inherit;
	background-color: transparent;
	border: 0;
	outline: none;
	cursor: pointer;
}

button[disabled] {
	opacity: 0.5;
	pointer-events: none;
}

.button {
	display: inline-block;
	text-align: center;
	text-decoration: none;
	vertical-align: middle;
	border: 0;
	border-radius: 20px;
	outline: none;
	cursor: pointer;
	transition: all 0.2s ease-in-out;
}

.button:hover {
	opacity: 0.8;
}

.button:active {
	position: relative;
	top: 1px;
}

.button.large-size {
	height: 54px;
	padding: 0 60px;
	font-size: 0.8rem;
	line-height: 54px;
	border-radius: 80px / 80px;
}

.button.big-size {
	height: 48px;
	padding: 0 48px;
	line-height: 48px;
	border-radius: 60px / 60px;
}

.button.medium-size {
	height: 42px;
	padding: 0 24px;
	line-height: 42px;
	border-radius: 40px / 40px;
}

.button.small-size {
	height: 34px;
	padding: 0 18px;
	line-height: 34px;
	border-radius: 34px / 34px;
}

.button.low-size {
	height: 30px;
	padding: 0 12px;
	line-height: 30px;
	border-radius: 30px / 30px;
}

.button.outline {
	border: 1px solid rgb(255 255 255 / 50%);
}

.button.double-outline {
	border: 1px solid #ffffff;
}

@media all and (max-width: 1000px) {
	.button.large-size {
		font-size: 0.8rem;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/colors.css?17696147975739*/
/* gradient circle closest */
.bg-gradient-circle-red {
	background: radial-gradient(circle closest-corner at 35% 50%, #feb900, #ba141b);
}

.bg-gradient-circle-blue {
	background: radial-gradient(circle closest-corner at 35% 50%, #27b2fc, #004fce);
}

.bg-gradient-circle-blue-right {
	background: radial-gradient(circle closest-corner at 75% 50%, #27b2fc, #004fce);
}

.bg-gradient-circle-dark-blue {
	background: radial-gradient(circle closest-corner at 35% 50%, #29506e, #00213a);
}

.bg-gradient-circle-dark-blue-right {
	background: radial-gradient(circle closest-corner at 75% 50%, #29506e, #00213a);
}

.bg-gradient-circle-green-yellow-right {
	background: radial-gradient(circle closest-corner at 75% 50%, #ffea00, #8cae03);
}

.bg-gradient-circle-dark-red-right {
	background: radial-gradient(circle closest-corner at 75% 50%, #ffd400, #ce002f);
}

.bg-gradient-circle-black-gray-right {
	background: radial-gradient(circle closest-corner at 75% 50%, #4b4e5f, #141724);
}

.bg-gradient-circle-red-white {
	background: radial-gradient(circle closest-corner at 65% 50%, #f66e6e, #a92727);
}

/* gradient circle farthest */
.bg-gradient-circle-red-right {
	background: radial-gradient(circle farthest-corner at 65% 50%, #feb900, #ba141b);
}

.bg-gradient-circle-blue-center {
	background: radial-gradient(circle farthest-corner at 50% 50%, #27b2fc, #004fce);
}

.bg-gradient-line-white-grey {
	background: linear-gradient(to right, #ffffff 50%, #eef1f5 50%);
}

.bg-gradient-line-gray-yellow {
	background: linear-gradient(to right, #eef1f5 50%, #f2da0b 50%);
}

/* gradient linear */
.bg-gradient-line-black-grey {
	background: linear-gradient(45deg, #4b4e5f, #141724);
}

.bg-gradient-line-white-blue {
	background: linear-gradient(to right, #ffffff, #f2f8ff);
}

.bg-gradient-line-blue-purple {
	background: rgb(0 7 41);
	background: linear-gradient(
		27deg,
		rgb(0 7 41 / 100%) 0%,
		rgb(34 132 227 / 100%) 39%,
		rgb(73 1 232 / 100%) 52%,
		rgb(27 13 115 / 100%) 100%
	);
}

/* background */
.bg-black {
	color: #ffffff;
	background-color: #000000;
}

.bg-gray {
	color: #000000;
	background-color: #eff3f5;
}

.bg-light-gray {
	color: #000000;
	background-color: #f8fbff;
}

.bg-black-05 {
	color: #ffffff;
	background-color: rgb(0 0 0 / 5%);
}

.bg-black-10 {
	color: #ffffff;
	background-color: rgb(0 0 0 / 10%);
}

.bg-black-30 {
	color: #ffffff;
	background-color: rgb(0 0 0 / 30%);
}

.bg-violet {
	color: #ffffff;
	background-color: #0e0077;
}

.bg-purple {
	color: #ffffff;
	background-color: #551fe1;
}

.bg-green {
	color: #ffffff;
	background-color: #87d531;
}

.bg-red {
	color: #ffffff;
	background-color: #eb0556;
}

.bg-orange {
	color: #ffffff;
	background-color: #ff5200;
}

.bg-pink {
	background-color: #f25c8a;
}

.bg-brown {
	color: #ffffff;
	background-color: #b97e39;
}

.bg-blue {
	color: #ffffff;
	background-color: #0273e0;
}

.bg-black-blue {
	color: #ffffff;
	background-color: #141724;
}

.bg-arctic-blue {
	color: #ffffff;
	background-color: #004390;
}

.bg-blue-03 {
	color: #ffffff;
	background-color: rgb(2 115 224 / 3%);
}

.bg-blue-light {
	color: #000000;
	background: #dfe9ee;
}

.bg-white {
	color: #000000;
	background-color: #ffffff;
}

.bg-white-05 {
	color: #000000;
	background-color: rgb(255 255 255 / 5%);
}

.bg-white-10 {
	color: #ffffff;
	background-color: rgb(255 255 255 / 10%);
}

.bg-white-20 {
	color: #ffffff;
	background-color: rgb(255 255 255 / 20%);
}

.bg-white-30 {
	color: #ffffff;
	background-color: rgb(255 255 255 / 30%);
}

.bg-white-40 {
	color: #ffffff;
	background-color: rgb(255 255 255 / 40%);
}

.bg-white-50 {
	color: #ffffff;
	background-color: rgb(255 255 255 / 50%);
}

.bg-white-gray {
	color: #000000;
	background-color: #f5f5f5;
}

.bg-white-red {
	color: #000000;
	background-color: #fbedeb;
}

.bg-yellow {
	color: #000000;
	background-color: #f6ff00;
}

.bg-dark-yellow {
	color: #000000;
	background-color: #f2da0b;
}

.bg-dark-blue {
	color: #ffffff;
	background-color: #00213a;
}

/* text */
.text-green {
	color: #87d531;
}

.text-blue {
	color: #0273e0;
}

.text-orange {
	color: #ff5200;
}

.text-blue-light {
	color: rgb(2 115 224 / 6%);
}

.text-blue-ghost {
	color: rgb(2 115 224 / 15%);
}

.text-arctic {
	color: #5baeff;
}

.text-dark-yellow {
	color: #fedd00;
}

.text-yellow {
	color: #f6ff00;
}

.text-gray {
	color: #8b8b8b;
}

.text-light-gray {
	color: #bfc8d3;
}

.text-dark-gray {
	color: #4d5b6f;
}

.text-black {
	color: #000000;
}

.text-black-45 {
	color: rgb(0 0 0 / 45%);
}

.text-white {
	color: #ffffff;
}

.text-white-30 {
	color: rgb(255 255 255 / 30%);
}

.text-red {
	color: #eb0556;
}

.text-fuchsia {
	color: #f51a69;
}

.text-purple {
	color: #551fe1;
}

.text-pink {
	color: #f25c8a;
}

.text-brown {
	color: #b97e39;
}

.text-gray-blue {
	color: #555c69;
}

/* border */
.border-green {
	border-color: #87d531;
}

.border-green-20 {
	border-color: rgb(135 213 49 / 30%);
}

.border-blue {
	border-color: #0273e0;
}

.border-blue-10 {
	border-color: rgb(2 115 224 / 15%);
}

.border-blue-20 {
	border-color: rgb(2 115 224 / 30%);
}

.border-arctic {
	border-color: #5baeff;
}

.border-dark-yellow {
	border-color: #fedd00;
}

.border-yellow {
	border-color: #f6ff00;
}

.border-gray {
	border-color: #8b8b8b;
}

.border-light-gray {
	border-color: #bfc8d3;
}

.border-soft-gray {
	border-color: #e9eef3;
}

.border-dark-gray {
	border-color: #4d5b6f;
}

.border-red {
	border-color: #eb0556;
}

.border-black {
	border-color: #000000;
}

.border-black-25 {
	border-color: rgb(0 0 0 / 25%);
}

.border-black-5 {
	border-color: rgb(0 0 0 / 5%);
}

.border-white {
	border-color: #ffffff;
}

.border-white-20 {
	border-color: rgb(255 255 255 / 30%);
}

.border-white-15 {
	border-color: rgb(255 255 255 / 15%);
}

/* End */


/* Start:/local/templates/dw/assets/css/forms.css?17690161075225*/
.textarea,
.input {
	display: inline-block;
	font-weight: normal;
	font-size: 0.8rem;
	text-align: left;
	text-decoration: none;
	vertical-align: middle;
	border: 1px solid transparent;
	border-radius: 20px;
	outline: none;
	cursor: pointer;
	transition: all 0.2s ease-in-out;
}

.textarea.error,
.input.error {
	border: 1px solid #ff0000;
}

.textarea {
	min-height: 125px;
	resize: none;
}

.textarea:active,
.input:active {
	position: relative;
}

/* type */
.textarea.type-1,
.input.type-1 {
	padding: 12px 24px;
}

.textarea.type-2,
.input.type-2 {
	padding: 12px 24px 12px 55px;
	background-repeat: no-repeat;
	background-position: 18px 50%;
}

.textarea.type-3,
.input.type-3 {
	padding: 24px;
}

.textarea.type-4,
.input.type-4 {
	height: 24px;
	padding: 12px 0;
	border-bottom: 1px solid rgb(0 110 254 / 100%);
	border-radius: 0;
	transition: 0.2s;
}

.textarea.type-4:focus,
.input.type-4:focus {
	border-bottom: 1px solid rgb(0 110 254 / 30%);
	transition: 0.2s;
}

/* colors */
.input-white {
	color: #ffffff;
	background-color: rgb(255 255 255 / 10%);
	transition: 0.2s;
}

.input-white:focus {
	background-color: rgb(255 255 255 / 20%);
}

.input-gray {
	color: #4d5b6f;
	background-color: rgb(245 245 245 / 100%);
}

.input-gray:focus {
	background-color: rgb(245 245 245 / 70%);
}

.input-blue-line {
	color: #0070fe;
	background: transparent;
}

/* placeholder */
.input-white::input-placeholder {
	color: #ffffff;
}

.input-white::placeholder {
	color: #ffffff;
}

.input-white:placeholder {
	color: #ffffff;
}

.input-white:input-placeholder {
	color: #ffffff;
}

.input-gray::input-placeholder {
	color: #4d5b6f;
}

.input-gray::placeholder {
	color: #4d5b6f;
}

.input-gray:placeholder {
	color: #4d5b6f;
}

.input-gray:input-placeholder {
	color: #4d5b6f;
}

.input-blue-line::input-placeholder {
	color: #4d5b6f;
}

.input-blue-line::placeholder {
	color: #4d5b6f;
}

.input-blue-line:placeholder {
	color: #4d5b6f;
}

.input-blue-line:input-placeholder {
	color: #4d5b6f;
}

/* button */
form .button {
	box-sizing: border-box;
	height: 42px;
	padding: 0 48px;
	font-size: 0.8rem;
	line-height: 42px;
	border-radius: 40px / 40px;
}

/* select */
.select-drop {
	position: relative;
	display: block;
	width: 100%;
	margin-top: 4px;
	font-size: 0.75rem;
	line-height: 0.75rem;
	background-color: #ffffff;
	border: 1px solid #e7e8ea;
	border-radius: 20px;
	user-select: none;
}

.select-checked-item {
	position: relative;
	display: block;
	padding: 10px 14px;
	color: #000000;
	border-radius: 4px;
	cursor: pointer;
}

.select-checked-item::before {
	position: absolute;
	top: 6px;
	right: 6px;
	display: inline-block;
	width: 20px;
	height: 20px;
	background: url("/local/templates/dw/assets/css/../images/sprite.svg") -20px -3260px no-repeat transparent;
	content: "";
}

.select-drop {
	font-size: 0.75rem;
	line-height: 0.75rem;
}

.select-drop-list {
	position: absolute;
	top: 42px;
	right: 0;
	left: 0;
	z-index: 2;
	margin: 0 -1px;
	padding: 0;
	list-style: none;
	background-color: #ffffff;
	border: 1px solid #e7e8ea;
	visibility: hidden;
	opacity: 0;
}

.select-list {
	overflow: hidden;
}

.select-drop-list .select-value:first-child {
	border-top: 0;
}

.select-drop-list .select-value {
	position: relative;
	display: block;
	border-top: 1px solid #e7e8ea;
}

.select .select-drop-list-item {
	float: none;
	box-sizing: content-box;
	min-width: auto;
	padding: 0;
	overflow: visible;
}

.select-drop-list .select-item-link {
	display: block;
	padding: 12px 8px !important;
	color: #000000;
	font-size: 0.75rem;
	line-height: 18px;
	text-align: left;
	text-decoration: none;
	border: 0;
}

.select-link {
	transition: all 0.2s ease-in-out;
}

.select-drop-list.opened {
	visibility: visible;
	opacity: 1;
}

/* radio checkbox */
.ui-17:disabled + label,
.ui-18:disabled + label {
	cursor: default;
}

.ui-17.error + label::before,
.ui-18.error + label::before {
	border: 1px solid #ff0000;
	border-radius: 8px;
}

.ui-17:not(:checked) + label::before {
	background-position: -20px -2440px;
}

.ui-17:not(:checked) + label:hover::before {
	background-position: -20px -2460px;
}

.ui-17:checked + label::before {
	background-position: -20px -2480px;
}

.ui-17:disabled + label::before {
	background-position: -20px -2500px;
}

.ui-17.type-2:not(:checked) + label::before {
	background-position: -60px -2440px;
}

.ui-17.type-2:not(:checked) + label:hover::before {
	background-position: -60px -2460px;
}

.ui-17.type-2:checked + label::before {
	background-position: -60px -2480px;
}

.ui-17.type-2:disabled + label::before {
	background-position: -60px -2500px;
}

.ui-18:not(:checked) + label::before {
	background-position: -100px -2440px;
}

.ui-18:not(:checked) + label:hover::before {
	background-position: -100px -2460px;
}

.ui-18:checked + label::before {
	background-position: -100px -2480px;
}

.ui-18:disabled + label::before {
	background-position: -100px -2500px;
}

.ui-18.type-2:not(:checked) + label::before {
	background-position: -140px -2440px;
}

.ui-18.type-2:not(:checked) + label:hover::before {
	background-position: -140px -2460px;
}

.ui-18.type-2:checked + label::before {
	background-position: -140px -2480px;
}

.ui-18.type-2:disabled + label::before {
	background-position: -140px -2500px;
}

/* End */


/* Start:/local/templates/dw/assets/css/reset.css?17690161071187*/
html {
	text-size-adjust: 100%;
	overflow-y: scroll;
	font-size: 16px;
}

body {
	margin: 0;
	color: #000000;
	font:
		normal normal 13px Montserrat,
		sans-serif;
	line-height: 21px;
	background-color: #ffffff;
	-webkit-font-smoothing: antialiased;
	font-variant-numeric: lining-nums;
	text-size-adjust: none;
}

input,
select,
textarea {
	font-family: inherit;
}

img {
	border: 0;
}

input {
	outline: none;
}

input[placeholder] {
	text-overflow: ellipsis;
}

input::placeholder {
	text-overflow: ellipsis;
}

input:placeholder {
	text-overflow: ellipsis;
}

input:input-placeholder {
	text-overflow: ellipsis;
}

hr {
	border: 1px solid #f3f3f3;
}

h1,
h2,
h3,
h4,
h5 {
	margin: 0;
}

select {
	padding: 6px 12px;
	outline: none;
}

a:not([href]) {
	cursor: default;
}

:focus::input-placeholder {
	color: transparent;
}

:focus::placeholder {
	color: transparent;
}

:focus:placeholder {
	color: transparent;
}

:focus:input-placeholder {
	color: transparent;
}

input:focus {
	outline: none;
}

a {
	text-decoration: none;
	outline: none;
	transition: all 0.2s ease-in-out;
}

a:hover:not(.no-hover) {
	opacity: 0.8;
}

a:active:not(.no-hover) {
	position: relative;
	top: 1px;
}

/* End */


/* Start:/local/templates/dw/assets/css/text.css?17693621916064*/
/* 95 */
.max-black-uppercase {
	font-weight: 900;
	font-size: 5.75rem;
	line-height: 72px;
	text-transform: uppercase;
}

/* 95 */
.max-bold {
	font-weight: 700;
	font-size: 5.75rem;
	line-height: 72px;
}

/* 85 */
.huge-black-uppercase {
	font-weight: 900;
	font-size: 5.1rem;
	line-height: 85px;
	text-transform: uppercase;
}

/* 85 */
.huge-bold {
	font-weight: 700;
	font-size: 5.1rem;
	line-height: 85px;
}

/* 85 */
.huge-bold-uppercase {
	font-weight: 700;
	font-size: 5.1rem;
	line-height: 85px;
	text-transform: uppercase;
}

/* 72 */
.big-black-uppercase {
	font-weight: 900;
	font-size: 4.25rem;
	line-height: 60px;
	text-transform: uppercase;
}

/* 72 */
.big-bold {
	font-weight: 700;
	font-size: 4.25rem;
	line-height: 60px;
}

/* 60 */
.large-bold {
	font-weight: 700;
	font-size: 3.2rem;
	line-height: 50px;
}

/* 60 */
.large-black-uppercase {
	font-weight: 900;
	font-size: 3.2rem;
	line-height: 50px;
	text-transform: uppercase;
}

/* 48 */
.high-bold {
	font-weight: 700;
	font-size: 2.75rem;
	line-height: 48px;
}

/* 48 */
.high-black-uppercase {
	font-weight: 900;
	font-size: 2.75rem;
	line-height: 48px;
	text-transform: uppercase;
}

/* 40 */
.x-medium-bold {
	font-weight: 700;
	font-size: 2.3rem;
	line-height: 40px;
}

/* 40 */
.x-medium-black-uppercase {
	font-weight: 900;
	font-size: 2.3rem;
	line-height: 40px;
	text-transform: uppercase;
}

/* 40 */
.x-medium-regular {
	font-weight: normal;
	font-size: 2.3rem;
	line-height: 40px;
}

.x-medium-black {
	font-weight: 900;
	font-size: 2.3rem;
	line-height: 40px;
}

/* 40 */
.x-medium-black-uppercase {
	font-weight: 900;
	font-size: 2.3rem;
	line-height: 40px;
	text-transform: uppercase;
}

/* 36 */
.medium-bold {
	font-weight: 700;
	font-size: 2.1rem;
	line-height: 36px;
}

/* 36 */
.medium-regular {
	font-weight: normal;
	font-size: 2.1rem;
	line-height: 36px;
}

/* 36 */
.medium-black-uppercase {
	font-weight: 900;
	font-size: 2.1rem;
	line-height: 36px;
	text-transform: uppercase;
}

/* 30 */
.wide-bold {
	font-weight: 700;
	font-size: 1.75rem;
	line-height: 30px;
}

/* 30 */
.wide-regular {
	font-weight: normal;
	font-size: 1.75rem;
	line-height: 30px;
}

/* 30 */
.wide-black-uppercase {
	font-weight: 900;
	font-size: 1.75rem;
	line-height: 30px;
	text-transform: uppercase;
}

/* 28 */
.near-bold {
	font-weight: 700;
	font-size: 1.56rem;
	line-height: 28px;
}

/* 28 */
.near-regular {
	font-weight: normal;
	font-size: 1.56rem;
	line-height: 28px;
}

/* 28 */
.near-black-uppercase {
	font-weight: 900;
	font-size: 1.56rem;
	line-height: 28px;
	text-transform: uppercase;
}

/* 24 */
.normal-bold {
	font-weight: 700;
	font-size: 1.375rem;
	line-height: 28px;
}

/* 24 */
.normal-regular {
	font-weight: normal;
	font-size: 1.375rem;
	line-height: 28px;
}

/* 24 */
.normal-black {
	font-weight: 900;
	font-size: 1.375rem;
	line-height: 28px;
}

/* 24 */
.normal-black-uppercase {
	font-weight: 900;
	font-size: 1.375rem;
	line-height: 28px;
	text-transform: uppercase;
}

/* 24 */
.normal-light {
	font-weight: 300;
	font-size: 1.375rem;
	line-height: 28px;
}

/* 22 */
.deep-bold {
	font-weight: 700;
	font-size: 1.2rem;
	line-height: 26px;
}

/* 22 */
.deep-regular {
	font-weight: normal;
	font-size: 1.2rem;
	line-height: 26px;
}

/* 22 */
.deep-black-uppercase {
	font-weight: 900;
	font-size: 1.2rem;
	line-height: 26px;
	text-transform: uppercase;
}

/* 22 */
.deep-light {
	font-weight: 300;
	font-size: 1.2rem;
	line-height: 26px;
}

/* 18 */
.low-bold {
	font-weight: 700;
	font-size: 1rem;
	line-height: 21px;
}

/* 18 */
.low-regular {
	font-weight: normal;
	font-size: 1rem;
	line-height: 21px;
}

/* 18 */
.low-light {
	font-weight: 300;
	font-size: 1rem;
	line-height: 24px;
}

/* 18 */
.low-black-uppercase {
	font-weight: 900;
	font-size: 1rem;
	line-height: 21px;
	text-transform: uppercase;
}

/* 16 */
.small-bold {
	font-weight: 700;
	font-weight: bold;
	font-size: 0.9rem;
	line-height: 21px;
}

/* 16 */
.small-regular {
	font-weight: normal;
	font-size: 0.9rem;
	line-height: 21px;
}

/* 16 */
.small-black-uppercase {
	font-weight: 900;
	font-size: 0.9rem;
	line-height: 21px;
	text-transform: uppercase;
}

/* 16 */
.small-light {
	font-weight: 300;
	font-size: 0.9rem;
	line-height: 21px;
}

/* 14 */
.default-bold {
	font-weight: 700;
	font-size: 0.8rem;
	line-height: 21px;
}

/* 14 */
.default-regular {
	font-weight: normal;
	font-size: 0.8rem;
	line-height: 21px;
}

/* 14 */
.default-black-uppercase {
	font-weight: 900;
	font-size: 0.8rem;
	line-height: 21px;
	text-transform: uppercase;
}

/* 14 */
.default-light {
	font-weight: 300;
	font-size: 0.8rem;
	line-height: 21px;
}

/* 14 */
.default-thin {
	font-weight: 200;
	font-size: 0.8rem;
	line-height: 21px;
}

/* 14 */
.default-bold-tall {
	font-weight: 700;
	font-size: 0.8rem;
	line-height: 18px;
}

/* 14 */
.default-regular-tall {
	font-weight: normal;
	font-size: 0.8rem;
	line-height: 18px;
}

/* 14 */
.default-light-tall {
	font-weight: 300;
	font-size: 0.8rem;
	line-height: 18px;
}

/* 14 */
.default-thin-tall {
	font-weight: 200;
	font-size: 0.8rem;
	line-height: 18px;
}

/* 13 */
.xsmall-bold {
	font-weight: 700;
	font-size: 0.75rem;
	line-height: 21px;
}

/* 13 */
.xsmall-regular {
	font-weight: normal;
	font-size: 0.75rem;
	line-height: 21px;
}

/* 13 */
.xsmall-black {
	font-weight: 900;
	font-size: 0.75rem;
	line-height: 21px;
}

/* 13 */
.xsmall-black-uppercase {
	font-weight: 900;
	font-size: 0.75rem;
	line-height: 21px;
	text-transform: uppercase;
}

/* 13 */
.xsmall-light {
	font-weight: 300;
	font-size: 0.75rem;
	line-height: 21px;
}

/* 13 */
.xsmall-thin {
	font-weight: 200;
	font-size: 0.75rem;
	line-height: 21px;
}

/* 13 */
.xsmall-bold-tall {
	font-weight: 700;
	font-size: 0.75rem;
	line-height: 18px;
}

/* 13 */
.xsmall-regular-tall {
	font-weight: normal;
	font-size: 0.75rem;
	line-height: 18px;
}

/* 13 */
.xsmall-light-tall {
	font-weight: 300;
	font-size: 0.75rem;
	line-height: 18px;
}

/* 13 */
.xsmall-thin-tall {
	font-weight: 200;
	font-size: 0.75rem;
	line-height: 18px;
}

.text-nowrap {
	white-space: nowrap;
}

/* End */


/* Start:/local/templates/dw/assets/css/util.css?176901616659203*/
.border-double {
	border-style: solid;
	border-width: 2px;
}

.border-min {
	border-style: solid;
	border-width: 1px;
}

.border-dashed {
	border-style: dashed;
	border-width: 1px;
}

.border-t-b {
	border-style: solid;
	border-width: 1px 0;
}

.border-bottom {
	border-style: solid;
	border-width: 0 0 1px;
}

.border-top {
	border-style: solid;
	border-width: 1px 0 0;
}

.border-left {
	border-style: solid;
	border-width: 0 0 0 1px;
}

.border-right {
	border-style: solid;
	border-width: 0 1px 0 0;
}

.border-bottom-dashed {
	border-style: dashed;
	border-width: 0 0 1px;
}

.border-top-dashed {
	border-style: dashed;
	border-width: 1px 0 0;
}

.border-left-dashed {
	border-style: dashed;
	border-width: 0 0 0 1px;
}

.border-right-dashed {
	border-style: dashed;
	border-width: 0 1px 0 0;
}

.border-radius {
	border-radius: 2px;
}

.border-radius-10 {
	border-radius: 10%;
}

.border-radius-20 {
	border-radius: 20%;
}

.border-radius-30 {
	border-radius: 30%;
}

.border-radius-40 {
	border-radius: 30%;
}

.border-radius-50 {
	border-radius: 50%;
}

.padding-12,
.p-12 {
	padding: 12px;
}

.padding-24,
.p-24 {
	padding: 24px;
}

.padding-36,
.p-36 {
	padding: 36px;
}

.padding-48,
.p-48 {
	padding: 48px;
}

.padding-60,
.p-60 {
	padding: 60px;
}

.padding-72,
.p-72 {
	padding: 72px;
}

.padding-right-12,
.p-r-12 {
	padding-right: 12px;
}

.padding-right-24,
.p-r-24 {
	padding-right: 24px;
}

.padding-right-36,
.p-r-36 {
	padding-right: 36px;
}

.padding-right-48,
.p-r-48 {
	padding-right: 48px;
}

.padding-right-60,
.p-r-60 {
	padding-right: 60px;
}

.padding-right-72,
.p-r-72 {
	padding-right: 72px;
}

.padding-right-84,
.p-r-84 {
	padding-right: 84px;
}

.padding-right-96,
.p-r-96 {
	padding-right: 96px;
}

.padding-right-108,
.p-r-108 {
	padding-right: 108px;
}

.padding-right-216,
.p-r-216 {
	padding-right: 216px;
}

.padding-right-324,
.p-r-324 {
	padding-right: 324px;
}

.padding-left-12,
.p-l-12 {
	padding-left: 12px;
}

.padding-left-24,
.p-l-24 {
	padding-left: 24px;
}

.padding-left-36,
.p-l-36 {
	padding-left: 36px;
}

.padding-left-48,
.p-l-48 {
	padding-left: 48px;
}

.padding-left-60,
.p-l-60 {
	padding-left: 60px;
}

.padding-left-72,
.p-l-72 {
	padding-left: 72px;
}

.padding-left-84,
.p-l-84 {
	padding-left: 84px;
}

.padding-left-96,
.p-l-96 {
	padding-left: 96px;
}

.padding-left-108,
.p-l-108 {
	padding-left: 108px;
}

.padding-left-216,
.p-l-216 {
	padding-left: 216px;
}

.padding-left-324,
.p-l-324 {
	padding-left: 324px;
}

.padding-top-12,
.p-t-12 {
	padding-top: 12px;
}

.padding-top-24,
.p-t-24 {
	padding-top: 24px;
}

.padding-top-36,
.p-t-36 {
	padding-top: 36px;
}

.padding-top-48,
.p-t-48 {
	padding-top: 48px;
}

.padding-top-60,
.p-t-60 {
	padding-top: 60px;
}

.padding-top-72,
.p-t-72 {
	padding-top: 72px;
}

.padding-top-84,
.p-t-84 {
	padding-top: 84px;
}

.padding-top-96,
.p-t-96 {
	padding-top: 96px;
}

.padding-top-108,
.p-t-108 {
	padding-top: 108px;
}

.padding-top-120,
.p-t-120 {
	padding-top: 120px;
}

.padding-top-132,
.p-t-132 {
	padding-top: 132px;
}

.padding-top-144,
.p-t-144 {
	padding-top: 144px;
}

.padding-top-156,
.p-t-156 {
	padding-top: 156px;
}

.padding-top-168,
.p-t-168 {
	padding-top: 168px;
}

.padding-top-180,
.p-t-180 {
	padding-top: 180px;
}

.padding-top-192,
.p-t-192 {
	padding-top: 192px;
}

.padding-top-216,
.p-t-216 {
	padding-top: 216px;
}

.padding-top-324,
.p-t-324 {
	padding-top: 324px;
}

.padding-bottom-12,
.p-b-12 {
	padding-bottom: 12px;
}

.padding-bottom-24,
.p-b-24 {
	padding-bottom: 24px;
}

.padding-bottom-36,
.p-b-36 {
	padding-bottom: 36px;
}

.padding-bottom-48,
.p-b-48 {
	padding-bottom: 48px;
}

.padding-bottom-60,
.p-b-60 {
	padding-bottom: 60px;
}

.padding-bottom-72,
.p-b-72 {
	padding-bottom: 72px;
}

.padding-bottom-84,
.p-b-84 {
	padding-bottom: 84px;
}

.padding-bottom-96,
.p-b-96 {
	padding-bottom: 96px;
}

.padding-bottom-108,
.p-b-108 {
	padding-bottom: 108px;
}

.padding-bottom-120,
.p-b-120 {
	padding-bottom: 120px;
}

.padding-bottom-132,
.p-b-132 {
	padding-bottom: 132px;
}

.padding-bottom-144,
.p-b-144 {
	padding-bottom: 144px;
}

.padding-bottom-156,
.p-b-156 {
	padding-bottom: 156px;
}

.padding-bottom-168,
.p-b-168 {
	padding-bottom: 168px;
}

.padding-bottom-180,
.p-b-180 {
	padding-bottom: 180px;
}

.padding-top-bottom-12,
.p-t-b-12 {
	padding-top: 12px;
	padding-bottom: 12px;
}

.padding-top-bottom-24,
.p-t-b-24 {
	padding-top: 24px;
	padding-bottom: 24px;
}

.padding-top-bottom-36,
.p-t-b-36 {
	padding-top: 36px;
	padding-bottom: 36px;
}

.padding-top-bottom-48,
.p-t-b-48 {
	padding-top: 48px;
	padding-bottom: 48px;
}

.padding-top-bottom-60,
.p-t-b-60 {
	padding-top: 60px;
	padding-bottom: 60px;
}

.padding-top-bottom-72,
.p-t-b-72 {
	padding-top: 72px;
	padding-bottom: 72px;
}

.padding-top-bottom-84,
.p-t-b-84 {
	padding-top: 84px;
	padding-bottom: 84px;
}

.padding-top-bottom-96,
.p-t-b-96 {
	padding-top: 96px;
	padding-bottom: 96px;
}

.padding-top-bottom-108,
.p-t-b-108 {
	padding-top: 108px;
	padding-bottom: 108px;
}

.margin-12,
.m-12 {
	margin: 12px;
}

.margin-18,
.m-18 {
	margin: 18px;
}

.margin-24,
.m-24 {
	margin: 24px;
}

.margin-36,
.m-36 {
	margin: 36px;
}

.margin-48,
.m-48 {
	margin: 48px;
}

.margin-60,
.m-60 {
	margin: 60px;
}

.margin-72,
.m-72 {
	margin: 72px;
}

.margin-top-bottom-12,
.m-t-b-12 {
	margin-top: 12px;
	margin-bottom: 12px;
}

.margin-top-bottom-18,
.m-t-b-18 {
	margin-top: 18px;
	margin-bottom: 18px;
}

.margin-top-bottom-24,
.m-t-b-24 {
	margin-top: 24px;
	margin-bottom: 24px;
}

.margin-top-bottom-36,
.m-t-b-36 {
	margin-top: 36px;
	margin-bottom: 36px;
}

.margin-top-bottom-48,
.m-t-b-48 {
	margin-top: 48px;
	margin-bottom: 48px;
}

.margin-top-bottom-60,
.m-t-b-60 {
	margin-top: 60px;
	margin-bottom: 60px;
}

.margin-top-bottom-72,
.m-t-b-72 {
	margin-top: 72px;
	margin-bottom: 72px;
}

.margin-left-right-12,
.m-l-r-12 {
	margin-right: 12px;
	margin-left: 12px;
}

.margin-left-right-18,
.m-l-r-18 {
	margin-right: 18px;
	margin-left: 18px;
}

.margin-left-right-24,
.m-l-r-24 {
	margin-right: 24px;
	margin-left: 24px;
}

.margin-left-right-36,
.m-l-r-36 {
	margin-right: 36px;
	margin-left: 36px;
}

.margin-left-right-48,
.m-l-r-48 {
	margin-right: 48px;
	margin-left: 48px;
}

.margin-left-right-60,
.m-l-r-60 {
	margin-right: 60px;
	margin-left: 60px;
}

.margin-left-right-72,
.m-l-r-72 {
	margin-right: 72px;
	margin-left: 72px;
}

.margin-top-6,
.m-t-6 {
	margin-top: 6px;
}

.margin-top-12,
.m-t-12 {
	margin-top: 12px;
}

.margin-top-18,
.m-t-18 {
	margin-top: 18px;
}

.margin-top-24,
.m-t-24 {
	margin-top: 24px;
}

.margin-top-36,
.m-t-36 {
	margin-top: 36px;
}

.margin-top-48,
.m-t-48 {
	margin-top: 48px;
}

.margin-top-60,
.m-t-60 {
	margin-top: 60px;
}

.margin-top-72,
.m-t-72 {
	margin-top: 72px;
}

.margin-top-84,
.m-t-84 {
	margin-top: 84px;
}

.margin-top-96,
.m-t-96 {
	margin-top: 96px;
}

.margin-top-108,
.m-t-108 {
	margin-top: 108px;
}

.margin-top-120,
.m-t-120 {
	margin-top: 120px;
}

.margin-top-132,
.m-t-132 {
	margin-top: 132px;
}

.margin-top-144,
.m-t-144 {
	margin-top: 144px;
}

.margin-top-156,
.m-t-156 {
	margin-top: 156px;
}

.margin-top-168,
.m-t-168 {
	margin-top: 168px;
}

.margin-top-180,
.m-t-180 {
	margin-top: 180px;
}

.margin-top-264,
.m-t-264 {
	margin-top: 264px;
}

.margin-bottom-6,
.m-b-6 {
	margin-bottom: 6px;
}

.margin-bottom-12,
.m-b-12 {
	margin-bottom: 12px;
}

.margin-bottom-18,
.m-b-18 {
	margin-bottom: 18px;
}

.margin-bottom-24,
.m-b-24 {
	margin-bottom: 24px;
}

.margin-bottom-36,
.m-b-36 {
	margin-bottom: 36px;
}

.margin-bottom-48,
.m-b-48 {
	margin-bottom: 48px;
}

.margin-bottom-60,
.m-b-60 {
	margin-bottom: 60px;
}

.margin-bottom-72,
.m-b-72 {
	margin-bottom: 72px;
}

.margin-bottom-84,
.m-b-84 {
	margin-bottom: 84px;
}

.margin-bottom-96,
.m-b-96 {
	margin-bottom: 96px;
}

.margin-bottom-108,
.m-b-108 {
	margin-bottom: 108px;
}

.margin-bottom-120,
.m-b-120 {
	margin-bottom: 120px;
}

.margin-bottom-132,
.m-b-132 {
	margin-bottom: 132px;
}

.margin-bottom-144,
.m-b-144 {
	margin-bottom: 144px;
}

.margin-left-6,
.m-l-6 {
	margin-left: 6px;
}

.margin-left-12,
.m-l-12 {
	margin-left: 12px;
}

.margin-left-18,
.m-l-18 {
	margin-left: 18px;
}

.margin-left-24,
.m-l-24 {
	margin-left: 24px;
}

.margin-left-36,
.m-l-36 {
	margin-left: 36px;
}

.margin-left-48,
.m-l-48 {
	margin-left: 48px;
}

.margin-left-60,
.m-l-60 {
	margin-left: 60px;
}

.margin-left-72,
.m-l-72 {
	margin-left: 72px;
}

.margin-right-6,
.m-r-6 {
	margin-right: 6px;
}

.margin-right-12,
.m-r-12 {
	margin-right: 12px;
}

.margin-right-18,
.m-r-18 {
	margin-right: 18px;
}

.margin-right-24,
.m-r-24 {
	margin-right: 24px;
}

.margin-right-36,
.m-r-36 {
	margin-right: 36px;
}

.margin-right-48,
.m-r-48 {
	margin-right: 48px;
}

.margin-right-60,
.m-r-60 {
	margin-right: 60px;
}

.margin-right-72,
.m-r-72 {
	margin-right: 72px;
}

.opacity-100,
.op-100 {
	opacity: 1;
}

.opacity-90,
.op-90 {
	opacity: 0.9;
}

.opacity-80,
.op-80 {
	opacity: 0.8;
}

.opacity-70,
.op-70 {
	opacity: 0.7;
}

.opacity-60,
.op-60 {
	opacity: 0.6;
}

.opacity-50,
.op-50 {
	opacity: 0.5;
}

.opacity-40,
.op-40 {
	opacity: 0.4;
}

.opacity-30,
.op-30 {
	opacity: 0.3;
}

.opacity-20,
.op-20 {
	opacity: 0.2;
}

.opacity-10,
.op-10 {
	opacity: 0.1;
}

.uppercase,
.upp {
	text-transform: uppercase;
}

.tgc,
.t-a-c {
	text-align: center;
}

.tgr,
.t-a-r {
	text-align: right;
}

.tgl,
.t-a-l {
	text-align: left;
}

.tlf {
	table-layout: fixed;
}

.no-margin,
.n-m {
	margin: 0;
}

.tb {
	display: table;
	width: 100%;
}

.tc {
	display: table-cell;
	vertical-align: middle;
}

.d-i-b {
	display: inline-block;
}

.flx {
	display: flex;
	flex-wrap: wrap;
	gap: 18px;
	align-items: center;
}

.mw-100 {
	max-width: 100%;
}

.mw-90 {
	max-width: 90%;
}

.mw-80 {
	max-width: 80%;
}

.mw-70 {
	max-width: 70%;
}

.mw-60 {
	max-width: 60%;
}

.mw-50 {
	max-width: 50%;
}

.mw-40 {
	max-width: 40%;
}

.mw-30 {
	max-width: 30%;
}

.mw-20 {
	max-width: 20%;
}

.mw-10 {
	max-width: 10%;
}

.bs-bb {
	box-sizing: border-box;
}

.bs-cb {
	box-sizing: content-box;
}

.type-table-link,
.type-table-link > span {
	display: inline-block;
	line-height: normal;
	vertical-align: middle;
}

.type-table-link > span:last-child {
	margin-left: 6px;
}

.items-row {
	font-size: 0;
	line-height: normal;
	letter-spacing: -0.36em;
}

.items-row > div {
	display: inline-block;
	font-size: 0.75rem;
	letter-spacing: normal;
	vertical-align: top;
}

.max-wrapper {
	max-width: 1780px;
	margin: 0 auto;
}

.middle-wrapper {
	max-width: 1472px;
	margin: 0 auto;
}

.small-wrapper {
	max-width: 876px;
	margin: 0 auto;
}

.bg-full {
	background-repeat: no-repeat;
	background-position: center center;
	background-size: cover;
}

.auto-center {
	margin: 0 auto;
}

.v-a-m {
	vertical-align: middle;
}

.v-a-b {
	vertical-align: bottom;
}

.v-a-t {
	vertical-align: top;
}

.line-through,
.thr {
	text-decoration: line-through;
}

.line-underline,
.under {
	text-decoration: underline;
}

.relative,
.pr {
	position: relative;
}

.clear {
	clear: both;
}

/* media section */
@media screen and (max-width: 1880px) {
	.max-wrapper {
		max-width: 1472px;
	}
}

@media screen and (max-width: 1650px) {
	.max-wrapper,
	.middle-wrapper {
		max-width: 1280px;
	}

	.xl-hide {
		display: none;
	}

	.xl-margin-12,
	.xl-m-12 {
		margin: 12px;
	}

	.xl-margin-18,
	.xl-m-18 {
		margin: 18px;
	}

	.xl-margin-24,
	.xl-m-24 {
		margin: 24px;
	}

	.xl-margin-36,
	.xl-m-36 {
		margin: 36px;
	}

	.xl-margin-48,
	.xl-m-48 {
		margin: 48px;
	}

	.xl-margin-60,
	.xl-m-60 {
		margin: 60px;
	}

	.xl-margin-72,
	.xl-m-72 {
		margin: 72px;
	}

	.xl-margin-top-bottom-12,
	.xl-m-t-b-12 {
		margin-top: 12px;
		margin-bottom: 12px;
	}

	.xl-margin-top-bottom-18,
	.xl-m-t-b-18 {
		margin-top: 18px;
		margin-bottom: 18px;
	}

	.xl-margin-top-bottom-24,
	.xl-m-t-b-24 {
		margin-top: 24px;
		margin-bottom: 24px;
	}

	.xl-margin-top-bottom-36,
	.xl-m-t-b-36 {
		margin-top: 36px;
		margin-bottom: 36px;
	}

	.xl-margin-top-bottom-48,
	.xl-m-t-b-48 {
		margin-top: 48px;
		margin-bottom: 48px;
	}

	.xl-margin-top-bottom-60,
	.xl-m-t-b-60 {
		margin-top: 60px;
		margin-bottom: 60px;
	}

	.xl-margin-top-bottom-72,
	.xl-m-t-b-72 {
		margin-top: 72px;
		margin-bottom: 72px;
	}

	.xl-margin-left-right-12,
	.xl-m-l-r-12 {
		margin-right: 12px;
		margin-left: 12px;
	}

	.xl-margin-left-right-18,
	.xl-m-l-r-18 {
		margin-right: 18px;
		margin-left: 18px;
	}

	.xl-margin-left-right-24,
	.xl-m-l-r-24 {
		margin-right: 24px;
		margin-left: 24px;
	}

	.xl-margin-left-right-36,
	.xl-m-l-r-36 {
		margin-right: 36px;
		margin-left: 36px;
	}

	.xl-margin-left-right-48,
	.xl-m-l-r-48 {
		margin-right: 48px;
		margin-left: 48px;
	}

	.xl-margin-left-right-60,
	.xl-m-l-r-60 {
		margin-right: 60px;
		margin-left: 60px;
	}

	.xl-margin-left-right-72,
	.xl-m-l-r-72 {
		margin-right: 72px;
		margin-left: 72px;
	}

	.xl-margin-top-6,
	.xl-m-t-6 {
		margin-top: 6px;
	}

	.xl-margin-top-12,
	.xl-m-t-12 {
		margin-top: 12px;
	}

	.xl-margin-top-18,
	.xl-m-t-18 {
		margin-top: 18px;
	}

	.xl-margin-top-24,
	.xl-m-t-24 {
		margin-top: 24px;
	}

	.xl-margin-top-36,
	.xl-m-t-36 {
		margin-top: 36px;
	}

	.xl-margin-top-48,
	.xl-m-t-48 {
		margin-top: 48px;
	}

	.xl-margin-top-60,
	.xl-m-t-60 {
		margin-top: 60px;
	}

	.xl-margin-top-72,
	.xl-m-t-72 {
		margin-top: 72px;
	}

	.xl-padding-12,
	.xl-p-12 {
		padding: 12px;
	}

	.xl-padding-24,
	.xl-p-24 {
		padding: 24px;
	}

	.xl-padding-36,
	.xl-p-36 {
		padding: 36px;
	}

	.xl-padding-48,
	.xl-p-48 {
		padding: 48px;
	}

	.xl-padding-60,
	.xl-p-60 {
		padding: 60px;
	}

	.xl-padding-72,
	.xl-p-72 {
		padding: 72px;
	}

	.xl-padding-right-12,
	.xl-p-r-12 {
		padding-right: 12px;
	}

	.xl-padding-right-24,
	.xl-p-r-24 {
		padding-right: 24px;
	}

	.xl-padding-right-36,
	.xl-p-r-36 {
		padding-right: 36px;
	}

	.xl-padding-right-48,
	.xl-p-r-48 {
		padding-right: 48px;
	}

	.xl-padding-right-60,
	.xl-p-r-60 {
		padding-right: 60px;
	}

	.xl-padding-right-72,
	.xl-p-r-72 {
		padding-right: 72px;
	}

	.xl-padding-right-84,
	.xl-p-r-84 {
		padding-right: 84px;
	}

	.xl-padding-right-96,
	.xl-p-r-96 {
		padding-right: 96px;
	}

	.xl-padding-right-108,
	.xl-p-r-108 {
		padding-right: 108px;
	}

	.xl-padding-right-216,
	.xl-p-r-216 {
		padding-right: 216px;
	}

	.xl-padding-right-324,
	.xl-p-r-324 {
		padding-right: 324px;
	}

	.xl-padding-left-12,
	.xl-p-l-12 {
		padding-left: 12px;
	}

	.xl-padding-left-24,
	.xl-p-l-24 {
		padding-left: 24px;
	}

	.xl-padding-left-36,
	.xl-p-l-36 {
		padding-left: 36px;
	}

	.xl-padding-left-48,
	.xl-p-l-48 {
		padding-left: 48px;
	}

	.xl-padding-left-60,
	.xl-p-l-60 {
		padding-left: 60px;
	}

	.xl-padding-left-72,
	.xl-p-l-72 {
		padding-left: 72px;
	}

	.xl-padding-left-84,
	.xl-p-l-84 {
		padding-left: 84px;
	}

	.xl-padding-left-96,
	.xl-p-l-96 {
		padding-left: 96px;
	}

	.xl-padding-left-108,
	.xl-p-l-108 {
		padding-left: 108px;
	}

	.xl-padding-left-216,
	.xl-p-l-216 {
		padding-left: 216px;
	}

	.xl-padding-left-324,
	.xl-p-l-324 {
		padding-left: 324px;
	}

	.xl-padding-top-12,
	.xl-p-t-12 {
		padding-top: 12px;
	}

	.xl-padding-top-24,
	.xl-p-t-24 {
		padding-top: 24px;
	}

	.xl-padding-top-36,
	.xl-p-t-36 {
		padding-top: 36px;
	}

	.xl-padding-top-48,
	.xl-p-t-48 {
		padding-top: 48px;
	}

	.xl-padding-top-60,
	.xl-p-t-60 {
		padding-top: 60px;
	}

	.xl-padding-top-72,
	.xl-p-t-72 {
		padding-top: 72px;
	}

	.xl-padding-top-84,
	.xl-p-t-84 {
		padding-top: 84px;
	}

	.xl-padding-top-96,
	.xl-p-t-96 {
		padding-top: 96px;
	}

	.xl-padding-top-108,
	.xl-p-t-108 {
		padding-top: 108px;
	}

	.xl-padding-top-120,
	.xl-p-t-120 {
		padding-top: 120px;
	}

	.xl-padding-top-132,
	.xl-p-t-132 {
		padding-top: 132px;
	}

	.xl-padding-top-144,
	.xl-p-t-144 {
		padding-top: 144px;
	}

	.xl-padding-top-156,
	.xl-p-t-156 {
		padding-top: 156px;
	}

	.xl-padding-top-168,
	.xl-p-t-168 {
		padding-top: 168px;
	}

	.xl-padding-top-180,
	.xl-p-t-180 {
		padding-top: 180px;
	}

	.xl-padding-top-192,
	.xl-p-t-192 {
		padding-top: 192px;
	}

	.xl-padding-top-216,
	.xl-p-t-216 {
		padding-top: 216px;
	}

	.xl-padding-top-324,
	.xl-p-t-324 {
		padding-top: 324px;
	}

	.xl-padding-bottom-12,
	.xl-p-b-12 {
		padding-bottom: 12px;
	}

	.xl-padding-bottom-24,
	.xl-p-b-24 {
		padding-bottom: 24px;
	}

	.xl-padding-bottom-36,
	.xl-p-b-36 {
		padding-bottom: 36px;
	}

	.xl-padding-bottom-48,
	.xl-p-b-48 {
		padding-bottom: 48px;
	}

	.xl-padding-bottom-60,
	.xl-p-b-60 {
		padding-bottom: 60px;
	}

	.xl-padding-bottom-72,
	.xl-p-b-72 {
		padding-bottom: 72px;
	}

	.xl-padding-bottom-84,
	.xl-p-b-84 {
		padding-bottom: 84px;
	}

	.xl-padding-bottom-96,
	.xl-p-b-96 {
		padding-bottom: 96px;
	}

	.xl-padding-bottom-108,
	.xl-p-b-108 {
		padding-bottom: 108px;
	}

	.xl-padding-bottom-120,
	.xl-p-b-120 {
		padding-bottom: 120px;
	}

	.xl-padding-bottom-132,
	.xl-p-b-132 {
		padding-bottom: 132px;
	}

	.xl-padding-bottom-144,
	.xl-p-b-144 {
		padding-bottom: 144px;
	}

	.xl-padding-bottom-156,
	.xl-p-b-156 {
		padding-bottom: 156px;
	}

	.xl-padding-bottom-168,
	.xl-p-b-168 {
		padding-bottom: 168px;
	}

	.xl-padding-bottom-180,
	.xl-p-b-180 {
		padding-bottom: 180px;
	}

	.xl-padding-top-bottom-12,
	.xl-p-t-b-12 {
		padding-top: 12px;
		padding-bottom: 12px;
	}

	.xl-padding-top-bottom-24,
	.xl-p-t-b-24 {
		padding-top: 24px;
		padding-bottom: 24px;
	}

	.xl-padding-top-bottom-36,
	.xl-p-t-b-36 {
		padding-top: 36px;
		padding-bottom: 36px;
	}

	.xl-padding-top-bottom-48,
	.xl-p-t-b-48 {
		padding-top: 48px;
		padding-bottom: 48px;
	}

	.xl-padding-top-bottom-60,
	.xl-p-t-b-60 {
		padding-top: 60px;
		padding-bottom: 60px;
	}

	.xl-padding-top-bottom-72,
	.xl-p-t-b-72 {
		padding-top: 72px;
		padding-bottom: 72px;
	}

	.xl-padding-top-bottom-84,
	.xl-p-t-b-84 {
		padding-top: 84px;
		padding-bottom: 84px;
	}

	.xl-padding-top-bottom-96,
	.xl-p-t-b-96 {
		padding-top: 96px;
		padding-bottom: 96px;
	}

	.xl-padding-top-bottom-108,
	.xl-p-t-b-108 {
		padding-top: 108px;
		padding-bottom: 108px;
	}
}

@media screen and (max-width: 1425px) {
	.max-wrapper,
	.middle-wrapper {
		max-width: 1170px;
	}

	.l-hide {
		display: none;
	}

	.l-margin-12,
	.l-m-12 {
		margin: 12px;
	}

	.l-margin-18,
	.l-m-18 {
		margin: 18px;
	}

	.l-margin-24,
	.l-m-24 {
		margin: 24px;
	}

	.l-margin-36,
	.l-m-36 {
		margin: 36px;
	}

	.l-margin-48,
	.l-m-48 {
		margin: 48px;
	}

	.l-margin-60,
	.l-m-60 {
		margin: 60px;
	}

	.l-margin-72,
	.l-m-72 {
		margin: 72px;
	}

	.l-margin-top-bottom-12,
	.l-m-t-b-12 {
		margin-top: 12px;
		margin-bottom: 12px;
	}

	.l-margin-top-bottom-18,
	.l-m-t-b-18 {
		margin-top: 18px;
		margin-bottom: 18px;
	}

	.l-margin-top-bottom-24,
	.l-m-t-b-24 {
		margin-top: 24px;
		margin-bottom: 24px;
	}

	.l-margin-top-bottom-36,
	.l-m-t-b-36 {
		margin-top: 36px;
		margin-bottom: 36px;
	}

	.l-margin-top-bottom-48,
	.l-m-t-b-48 {
		margin-top: 48px;
		margin-bottom: 48px;
	}

	.l-margin-top-bottom-60,
	.l-m-t-b-60 {
		margin-top: 60px;
		margin-bottom: 60px;
	}

	.l-margin-top-bottom-72,
	.l-m-t-b-72 {
		margin-top: 72px;
		margin-bottom: 72px;
	}

	.l-margin-left-right-12,
	.l-m-l-r-12 {
		margin-right: 12px;
		margin-left: 12px;
	}

	.l-margin-left-right-18,
	.l-m-l-r-18 {
		margin-right: 18px;
		margin-left: 18px;
	}

	.l-margin-left-right-24,
	.l-m-l-r-24 {
		margin-right: 24px;
		margin-left: 24px;
	}

	.l-margin-left-right-36,
	.l-m-l-r-36 {
		margin-right: 36px;
		margin-left: 36px;
	}

	.l-margin-left-right-48,
	.l-m-l-r-48 {
		margin-right: 48px;
		margin-left: 48px;
	}

	.l-margin-left-right-60,
	.l-m-l-r-60 {
		margin-right: 60px;
		margin-left: 60px;
	}

	.l-margin-left-right-72,
	.l-m-l-r-72 {
		margin-right: 72px;
		margin-left: 72px;
	}

	.l-margin-top-6,
	.l-m-t-6 {
		margin-top: 6px;
	}

	.l-margin-top-12,
	.l-m-t-12 {
		margin-top: 12px;
	}

	.l-margin-top-18,
	.l-m-t-18 {
		margin-top: 18px;
	}

	.l-margin-top-24,
	.l-m-t-24 {
		margin-top: 24px;
	}

	.l-margin-top-36,
	.l-m-t-36 {
		margin-top: 36px;
	}

	.l-margin-top-48,
	.l-m-t-48 {
		margin-top: 48px;
	}

	.l-margin-top-60,
	.l-m-t-60 {
		margin-top: 60px;
	}

	.l-margin-top-72,
	.l-m-t-72 {
		margin-top: 72px;
	}

	.l-padding-12,
	.l-p-12 {
		padding: 12px;
	}

	.l-padding-24,
	.l-p-24 {
		padding: 24px;
	}

	.l-padding-36,
	.l-p-36 {
		padding: 36px;
	}

	.l-padding-48,
	.l-p-48 {
		padding: 48px;
	}

	.l-padding-60,
	.l-p-60 {
		padding: 60px;
	}

	.l-padding-72,
	.l-p-72 {
		padding: 72px;
	}

	.l-padding-right-12,
	.l-p-r-12 {
		padding-right: 12px;
	}

	.l-padding-right-24,
	.l-p-r-24 {
		padding-right: 24px;
	}

	.l-padding-right-36,
	.l-p-r-36 {
		padding-right: 36px;
	}

	.l-padding-right-48,
	.l-p-r-48 {
		padding-right: 48px;
	}

	.l-padding-right-60,
	.l-p-r-60 {
		padding-right: 60px;
	}

	.l-padding-right-72,
	.l-p-r-72 {
		padding-right: 72px;
	}

	.l-padding-right-84,
	.l-p-r-84 {
		padding-right: 84px;
	}

	.l-padding-right-96,
	.l-p-r-96 {
		padding-right: 96px;
	}

	.l-padding-right-108,
	.l-p-r-108 {
		padding-right: 108px;
	}

	.l-padding-right-216,
	.l-p-r-216 {
		padding-right: 216px;
	}

	.l-padding-right-324,
	.l-p-r-324 {
		padding-right: 324px;
	}

	.l-padding-left-12,
	.l-p-l-12 {
		padding-left: 12px;
	}

	.l-padding-left-24,
	.l-p-l-24 {
		padding-left: 24px;
	}

	.l-padding-left-36,
	.l-p-l-36 {
		padding-left: 36px;
	}

	.l-padding-left-48,
	.l-p-l-48 {
		padding-left: 48px;
	}

	.l-padding-left-60,
	.l-p-l-60 {
		padding-left: 60px;
	}

	.l-padding-left-72,
	.l-p-l-72 {
		padding-left: 72px;
	}

	.l-padding-left-84,
	.l-p-l-84 {
		padding-left: 84px;
	}

	.l-padding-left-96,
	.l-p-l-96 {
		padding-left: 96px;
	}

	.l-padding-left-108,
	.l-p-l-108 {
		padding-left: 108px;
	}

	.l-padding-left-216,
	.l-p-l-216 {
		padding-left: 216px;
	}

	.l-padding-left-324,
	.l-p-l-324 {
		padding-left: 324px;
	}

	.l-padding-top-12,
	.l-p-t-12 {
		padding-top: 12px;
	}

	.l-padding-top-24,
	.l-p-t-24 {
		padding-top: 24px;
	}

	.l-padding-top-36,
	.l-p-t-36 {
		padding-top: 36px;
	}

	.l-padding-top-48,
	.l-p-t-48 {
		padding-top: 48px;
	}

	.l-padding-top-60,
	.l-p-t-60 {
		padding-top: 60px;
	}

	.l-padding-top-72,
	.l-p-t-72 {
		padding-top: 72px;
	}

	.l-padding-top-84,
	.l-p-t-84 {
		padding-top: 84px;
	}

	.l-padding-top-96,
	.l-p-t-96 {
		padding-top: 96px;
	}

	.l-padding-top-108,
	.l-p-t-108 {
		padding-top: 108px;
	}

	.l-padding-top-120,
	.l-p-t-120 {
		padding-top: 120px;
	}

	.l-padding-top-132,
	.l-p-t-132 {
		padding-top: 132px;
	}

	.l-padding-top-144,
	.l-p-t-144 {
		padding-top: 144px;
	}

	.l-padding-top-156,
	.l-p-t-156 {
		padding-top: 156px;
	}

	.l-padding-top-168,
	.l-p-t-168 {
		padding-top: 168px;
	}

	.l-padding-top-180,
	.l-p-t-180 {
		padding-top: 180px;
	}

	.l-padding-top-192,
	.l-p-t-192 {
		padding-top: 192px;
	}

	.l-padding-top-216,
	.l-p-t-216 {
		padding-top: 216px;
	}

	.l-padding-top-324,
	.l-p-t-324 {
		padding-top: 324px;
	}

	.l-padding-bottom-12,
	.l-p-b-12 {
		padding-bottom: 12px;
	}

	.l-padding-bottom-24,
	.l-p-b-24 {
		padding-bottom: 24px;
	}

	.l-padding-bottom-36,
	.l-p-b-36 {
		padding-bottom: 36px;
	}

	.l-padding-bottom-48,
	.l-p-b-48 {
		padding-bottom: 48px;
	}

	.l-padding-bottom-60,
	.l-p-b-60 {
		padding-bottom: 60px;
	}

	.l-padding-bottom-72,
	.l-p-b-72 {
		padding-bottom: 72px;
	}

	.l-padding-bottom-84,
	.l-p-b-84 {
		padding-bottom: 84px;
	}

	.l-padding-bottom-96,
	.l-p-b-96 {
		padding-bottom: 96px;
	}

	.l-padding-bottom-108,
	.l-p-b-108 {
		padding-bottom: 108px;
	}

	.l-padding-bottom-120,
	.l-p-b-120 {
		padding-bottom: 120px;
	}

	.l-padding-bottom-132,
	.l-p-b-132 {
		padding-bottom: 132px;
	}

	.l-padding-bottom-144,
	.l-p-b-144 {
		padding-bottom: 144px;
	}

	.l-padding-bottom-156,
	.l-p-b-156 {
		padding-bottom: 156px;
	}

	.l-padding-bottom-168,
	.l-p-b-168 {
		padding-bottom: 168px;
	}

	.l-padding-bottom-180,
	.l-p-b-180 {
		padding-bottom: 180px;
	}

	.l-padding-top-bottom-12,
	.l-p-t-b-12 {
		padding-top: 12px;
		padding-bottom: 12px;
	}

	.l-padding-top-bottom-24,
	.l-p-t-b-24 {
		padding-top: 24px;
		padding-bottom: 24px;
	}

	.l-padding-top-bottom-36,
	.l-p-t-b-36 {
		padding-top: 36px;
		padding-bottom: 36px;
	}

	.l-padding-top-bottom-48,
	.l-p-t-b-48 {
		padding-top: 48px;
		padding-bottom: 48px;
	}

	.l-padding-top-bottom-60,
	.l-p-t-b-60 {
		padding-top: 60px;
		padding-bottom: 60px;
	}

	.l-padding-top-bottom-72,
	.l-p-t-b-72 {
		padding-top: 72px;
		padding-bottom: 72px;
	}

	.l-padding-top-bottom-84,
	.l-p-t-b-84 {
		padding-top: 84px;
		padding-bottom: 84px;
	}

	.l-padding-top-bottom-96,
	.l-p-t-b-96 {
		padding-top: 96px;
		padding-bottom: 96px;
	}

	.l-padding-top-bottom-108,
	.l-p-t-b-108 {
		padding-top: 108px;
		padding-bottom: 108px;
	}
}

@media screen and (max-width: 1250px) {
	.max-wrapper,
	.middle-wrapper {
		max-width: 960px;
	}

	.m-hide {
		display: none;
	}

	.m-margin-12,
	.m-m-12 {
		margin: 12px;
	}

	.m-margin-18,
	.m-m-18 {
		margin: 18px;
	}

	.m-margin-24,
	.m-m-24 {
		margin: 24px;
	}

	.m-margin-36,
	.m-m-36 {
		margin: 36px;
	}

	.m-margin-48,
	.m-m-48 {
		margin: 48px;
	}

	.m-margin-60,
	.m-m-60 {
		margin: 60px;
	}

	.m-margin-72,
	.m-m-72 {
		margin: 72px;
	}

	.m-margin-top-bottom-12,
	.m-m-t-b-12 {
		margin-top: 12px;
		margin-bottom: 12px;
	}

	.m-margin-top-bottom-18,
	.m-m-t-b-18 {
		margin-top: 18px;
		margin-bottom: 18px;
	}

	.m-margin-top-bottom-24,
	.m-m-t-b-24 {
		margin-top: 24px;
		margin-bottom: 24px;
	}

	.m-margin-top-bottom-36,
	.m-m-t-b-36 {
		margin-top: 36px;
		margin-bottom: 36px;
	}

	.m-margin-top-bottom-48,
	.m-m-t-b-48 {
		margin-top: 48px;
		margin-bottom: 48px;
	}

	.m-margin-top-bottom-60,
	.m-m-t-b-60 {
		margin-top: 60px;
		margin-bottom: 60px;
	}

	.m-margin-top-bottom-72,
	.m-m-t-b-72 {
		margin-top: 72px;
		margin-bottom: 72px;
	}

	.m-margin-left-right-12,
	.m-m-l-r-12 {
		margin-right: 12px;
		margin-left: 12px;
	}

	.m-margin-left-right-18,
	.m-m-l-r-18 {
		margin-right: 18px;
		margin-left: 18px;
	}

	.m-margin-left-right-24,
	.m-m-l-r-24 {
		margin-right: 24px;
		margin-left: 24px;
	}

	.m-margin-left-right-36,
	.m-m-l-r-36 {
		margin-right: 36px;
		margin-left: 36px;
	}

	.m-margin-left-right-48,
	.m-m-l-r-48 {
		margin-right: 48px;
		margin-left: 48px;
	}

	.m-margin-left-right-60,
	.m-m-l-r-60 {
		margin-right: 60px;
		margin-left: 60px;
	}

	.m-margin-left-right-72,
	.m-m-l-r-72 {
		margin-right: 72px;
		margin-left: 72px;
	}

	.m-margin-top-6,
	.m-m-t-6 {
		margin-top: 6px;
	}

	.m-margin-top-12,
	.m-m-t-12 {
		margin-top: 12px;
	}

	.m-margin-top-18,
	.m-m-t-18 {
		margin-top: 18px;
	}

	.m-margin-top-24,
	.m-m-t-24 {
		margin-top: 24px;
	}

	.m-margin-top-36,
	.m-m-t-36 {
		margin-top: 36px;
	}

	.m-margin-top-48,
	.m-m-t-48 {
		margin-top: 48px;
	}

	.m-margin-top-60,
	.m-m-t-60 {
		margin-top: 60px;
	}

	.m-margin-top-72,
	.m-m-t-72 {
		margin-top: 72px;
	}

	.m-padding-12,
	.m-p-12 {
		padding: 12px;
	}

	.m-padding-24,
	.m-p-24 {
		padding: 24px;
	}

	.m-padding-36,
	.m-p-36 {
		padding: 36px;
	}

	.m-padding-48,
	.m-p-48 {
		padding: 48px;
	}

	.m-padding-60,
	.m-p-60 {
		padding: 60px;
	}

	.m-padding-72,
	.m-p-72 {
		padding: 72px;
	}

	.m-padding-right-12,
	.m-p-r-12 {
		padding-right: 12px;
	}

	.m-padding-right-24,
	.m-p-r-24 {
		padding-right: 24px;
	}

	.m-padding-right-36,
	.m-p-r-36 {
		padding-right: 36px;
	}

	.m-padding-right-48,
	.m-p-r-48 {
		padding-right: 48px;
	}

	.m-padding-right-60,
	.m-p-r-60 {
		padding-right: 60px;
	}

	.m-padding-right-72,
	.m-p-r-72 {
		padding-right: 72px;
	}

	.m-padding-right-84,
	.m-p-r-84 {
		padding-right: 84px;
	}

	.m-padding-right-96,
	.m-p-r-96 {
		padding-right: 96px;
	}

	.m-padding-right-108,
	.m-p-r-108 {
		padding-right: 108px;
	}

	.m-padding-right-216,
	.m-p-r-216 {
		padding-right: 216px;
	}

	.m-padding-right-324,
	.m-p-r-324 {
		padding-right: 324px;
	}

	.m-padding-left-12,
	.m-p-l-12 {
		padding-left: 12px;
	}

	.m-padding-left-24,
	.m-p-l-24 {
		padding-left: 24px;
	}

	.m-padding-left-36,
	.m-p-l-36 {
		padding-left: 36px;
	}

	.m-padding-left-48,
	.m-p-l-48 {
		padding-left: 48px;
	}

	.m-padding-left-60,
	.m-p-l-60 {
		padding-left: 60px;
	}

	.m-padding-left-72,
	.m-p-l-72 {
		padding-left: 72px;
	}

	.m-padding-left-84,
	.m-p-l-84 {
		padding-left: 84px;
	}

	.m-padding-left-96,
	.m-p-l-96 {
		padding-left: 96px;
	}

	.m-padding-left-108,
	.m-p-l-108 {
		padding-left: 108px;
	}

	.m-padding-left-216,
	.m-p-l-216 {
		padding-left: 216px;
	}

	.m-padding-left-324,
	.m-p-l-324 {
		padding-left: 324px;
	}

	.m-padding-top-12,
	.m-p-t-12 {
		padding-top: 12px;
	}

	.m-padding-top-24,
	.m-p-t-24 {
		padding-top: 24px;
	}

	.m-padding-top-36,
	.m-p-t-36 {
		padding-top: 36px;
	}

	.m-padding-top-48,
	.m-p-t-48 {
		padding-top: 48px;
	}

	.m-padding-top-60,
	.m-p-t-60 {
		padding-top: 60px;
	}

	.m-padding-top-72,
	.m-p-t-72 {
		padding-top: 72px;
	}

	.m-padding-top-84,
	.m-p-t-84 {
		padding-top: 84px;
	}

	.m-padding-top-96,
	.m-p-t-96 {
		padding-top: 96px;
	}

	.m-padding-top-108,
	.m-p-t-108 {
		padding-top: 108px;
	}

	.m-padding-top-120,
	.m-p-t-120 {
		padding-top: 120px;
	}

	.m-padding-top-132,
	.m-p-t-132 {
		padding-top: 132px;
	}

	.m-padding-top-144,
	.m-p-t-144 {
		padding-top: 144px;
	}

	.m-padding-top-156,
	.m-p-t-156 {
		padding-top: 156px;
	}

	.m-padding-top-168,
	.m-p-t-168 {
		padding-top: 168px;
	}

	.m-padding-top-180,
	.m-p-t-180 {
		padding-top: 180px;
	}

	.m-padding-top-192,
	.m-p-t-192 {
		padding-top: 192px;
	}

	.m-padding-top-216,
	.m-p-t-216 {
		padding-top: 216px;
	}

	.m-padding-top-324,
	.m-p-t-324 {
		padding-top: 324px;
	}

	.m-padding-bottom-12,
	.m-p-b-12 {
		padding-bottom: 12px;
	}

	.m-padding-bottom-24,
	.m-p-b-24 {
		padding-bottom: 24px;
	}

	.m-padding-bottom-36,
	.m-p-b-36 {
		padding-bottom: 36px;
	}

	.m-padding-bottom-48,
	.m-p-b-48 {
		padding-bottom: 48px;
	}

	.m-padding-bottom-60,
	.m-p-b-60 {
		padding-bottom: 60px;
	}

	.m-padding-bottom-72,
	.m-p-b-72 {
		padding-bottom: 72px;
	}

	.m-padding-bottom-84,
	.m-p-b-84 {
		padding-bottom: 84px;
	}

	.m-padding-bottom-96,
	.m-p-b-96 {
		padding-bottom: 96px;
	}

	.m-padding-bottom-108,
	.m-p-b-108 {
		padding-bottom: 108px;
	}

	.m-padding-bottom-120,
	.m-p-b-120 {
		padding-bottom: 120px;
	}

	.m-padding-bottom-132,
	.m-p-b-132 {
		padding-bottom: 132px;
	}

	.m-padding-bottom-144,
	.m-p-b-144 {
		padding-bottom: 144px;
	}

	.m-padding-bottom-156,
	.m-p-b-156 {
		padding-bottom: 156px;
	}

	.m-padding-bottom-168,
	.m-p-b-168 {
		padding-bottom: 168px;
	}

	.m-padding-bottom-180,
	.m-p-b-180 {
		padding-bottom: 180px;
	}

	.m-padding-top-bottom-12,
	.m-p-t-b-12 {
		padding-top: 12px;
		padding-bottom: 12px;
	}

	.m-padding-top-bottom-24,
	.m-p-t-b-24 {
		padding-top: 24px;
		padding-bottom: 24px;
	}

	.m-padding-top-bottom-36,
	.m-p-t-b-36 {
		padding-top: 36px;
		padding-bottom: 36px;
	}

	.m-padding-top-bottom-48,
	.m-p-t-b-48 {
		padding-top: 48px;
		padding-bottom: 48px;
	}

	.m-padding-top-bottom-60,
	.m-p-t-b-60 {
		padding-top: 60px;
		padding-bottom: 60px;
	}

	.m-padding-top-bottom-72,
	.m-p-t-b-72 {
		padding-top: 72px;
		padding-bottom: 72px;
	}

	.m-padding-top-bottom-84,
	.m-p-t-b-84 {
		padding-top: 84px;
		padding-bottom: 84px;
	}

	.m-padding-top-bottom-96,
	.m-p-t-b-96 {
		padding-top: 96px;
		padding-bottom: 96px;
	}

	.m-padding-top-bottom-108,
	.m-p-t-b-108 {
		padding-top: 108px;
		padding-bottom: 108px;
	}
}

@media screen and (max-width: 1000px) {
	.max-wrapper,
	.small-wrapper,
	.middle-wrapper {
		max-width: 700px;

		/* 740 */
	}

	.s-hide {
		display: none;
	}

	.s-margin-12,
	.s-m-12 {
		margin: 12px;
	}

	.s-margin-18,
	.s-m-18 {
		margin: 18px;
	}

	.s-margin-24,
	.s-m-24 {
		margin: 24px;
	}

	.s-margin-36,
	.s-m-36 {
		margin: 36px;
	}

	.s-margin-48,
	.s-m-48 {
		margin: 48px;
	}

	.s-margin-60,
	.s-m-60 {
		margin: 60px;
	}

	.s-margin-72,
	.s-m-72 {
		margin: 72px;
	}

	.s-margin-top-bottom-12,
	.s-m-t-b-12 {
		margin-top: 12px;
		margin-bottom: 12px;
	}

	.s-margin-top-bottom-18,
	.s-m-t-b-18 {
		margin-top: 18px;
		margin-bottom: 18px;
	}

	.s-margin-top-bottom-24,
	.s-m-t-b-24 {
		margin-top: 24px;
		margin-bottom: 24px;
	}

	.s-margin-top-bottom-36,
	.s-m-t-b-36 {
		margin-top: 36px;
		margin-bottom: 36px;
	}

	.s-margin-top-bottom-48,
	.s-m-t-b-48 {
		margin-top: 48px;
		margin-bottom: 48px;
	}

	.s-margin-top-bottom-60,
	.s-m-t-b-60 {
		margin-top: 60px;
		margin-bottom: 60px;
	}

	.s-margin-top-bottom-72,
	.s-m-t-b-72 {
		margin-top: 72px;
		margin-bottom: 72px;
	}

	.s-margin-left-right-12,
	.s-m-l-r-12 {
		margin-right: 12px;
		margin-left: 12px;
	}

	.s-margin-left-right-18,
	.s-m-l-r-18 {
		margin-right: 18px;
		margin-left: 18px;
	}

	.s-margin-left-right-24,
	.s-m-l-r-24 {
		margin-right: 24px;
		margin-left: 24px;
	}

	.s-margin-left-right-36,
	.s-m-l-r-36 {
		margin-right: 36px;
		margin-left: 36px;
	}

	.s-margin-left-right-48,
	.s-m-l-r-48 {
		margin-right: 48px;
		margin-left: 48px;
	}

	.s-margin-left-right-60,
	.s-m-l-r-60 {
		margin-right: 60px;
		margin-left: 60px;
	}

	.s-margin-left-right-72,
	.s-m-l-r-72 {
		margin-right: 72px;
		margin-left: 72px;
	}

	.s-margin-top-6,
	.s-m-t-6 {
		margin-top: 6px;
	}

	.s-margin-top-12,
	.s-m-t-12 {
		margin-top: 12px;
	}

	.s-margin-top-18,
	.s-m-t-18 {
		margin-top: 18px;
	}

	.s-margin-top-24,
	.s-m-t-24 {
		margin-top: 24px;
	}

	.s-margin-top-36,
	.s-m-t-36 {
		margin-top: 36px;
	}

	.s-margin-top-48,
	.s-m-t-48 {
		margin-top: 48px;
	}

	.s-margin-top-60,
	.s-m-t-60 {
		margin-top: 60px;
	}

	.s-margin-top-72,
	.s-m-t-72 {
		margin-top: 72px;
	}

	.s-padding-12,
	.s-p-12 {
		padding: 12px;
	}

	.s-padding-24,
	.s-p-24 {
		padding: 24px;
	}

	.s-padding-36,
	.s-p-36 {
		padding: 36px;
	}

	.s-padding-48,
	.s-p-48 {
		padding: 48px;
	}

	.s-padding-60,
	.s-p-60 {
		padding: 60px;
	}

	.s-padding-72,
	.s-p-72 {
		padding: 72px;
	}

	.s-padding-right-12,
	.s-p-r-12 {
		padding-right: 12px;
	}

	.s-padding-right-24,
	.s-p-r-24 {
		padding-right: 24px;
	}

	.s-padding-right-36,
	.s-p-r-36 {
		padding-right: 36px;
	}

	.s-padding-right-48,
	.s-p-r-48 {
		padding-right: 48px;
	}

	.s-padding-right-60,
	.s-p-r-60 {
		padding-right: 60px;
	}

	.s-padding-right-72,
	.s-p-r-72 {
		padding-right: 72px;
	}

	.s-padding-right-84,
	.s-p-r-84 {
		padding-right: 84px;
	}

	.s-padding-right-96,
	.s-p-r-96 {
		padding-right: 96px;
	}

	.s-padding-right-108,
	.s-p-r-108 {
		padding-right: 108px;
	}

	.s-padding-right-216,
	.s-p-r-216 {
		padding-right: 216px;
	}

	.s-padding-right-324,
	.s-p-r-324 {
		padding-right: 324px;
	}

	.s-padding-left-12,
	.s-p-l-12 {
		padding-left: 12px;
	}

	.s-padding-left-24,
	.s-p-l-24 {
		padding-left: 24px;
	}

	.s-padding-left-36,
	.s-p-l-36 {
		padding-left: 36px;
	}

	.s-padding-left-48,
	.s-p-l-48 {
		padding-left: 48px;
	}

	.s-padding-left-60,
	.s-p-l-60 {
		padding-left: 60px;
	}

	.s-padding-left-72,
	.s-p-l-72 {
		padding-left: 72px;
	}

	.s-padding-left-84,
	.s-p-l-84 {
		padding-left: 84px;
	}

	.s-padding-left-96,
	.s-p-l-96 {
		padding-left: 96px;
	}

	.s-padding-left-108,
	.s-p-l-108 {
		padding-left: 108px;
	}

	.s-padding-left-216,
	.s-p-l-216 {
		padding-left: 216px;
	}

	.s-padding-left-324,
	.s-p-l-324 {
		padding-left: 324px;
	}

	.s-padding-top-12,
	.s-p-t-12 {
		padding-top: 12px;
	}

	.s-padding-top-24,
	.s-p-t-24 {
		padding-top: 24px;
	}

	.s-padding-top-36,
	.s-p-t-36 {
		padding-top: 36px;
	}

	.s-padding-top-48,
	.s-p-t-48 {
		padding-top: 48px;
	}

	.s-padding-top-60,
	.s-p-t-60 {
		padding-top: 60px;
	}

	.s-padding-top-72,
	.s-p-t-72 {
		padding-top: 72px;
	}

	.s-padding-top-84,
	.s-p-t-84 {
		padding-top: 84px;
	}

	.s-padding-top-96,
	.s-p-t-96 {
		padding-top: 96px;
	}

	.s-padding-top-108,
	.s-p-t-108 {
		padding-top: 108px;
	}

	.s-padding-top-120,
	.s-p-t-120 {
		padding-top: 120px;
	}

	.s-padding-top-132,
	.s-p-t-132 {
		padding-top: 132px;
	}

	.s-padding-top-144,
	.s-p-t-144 {
		padding-top: 144px;
	}

	.s-padding-top-156,
	.s-p-t-156 {
		padding-top: 156px;
	}

	.s-padding-top-168,
	.s-p-t-168 {
		padding-top: 168px;
	}

	.s-padding-top-180,
	.s-p-t-180 {
		padding-top: 180px;
	}

	.s-padding-top-192,
	.s-p-t-192 {
		padding-top: 192px;
	}

	.s-padding-top-216,
	.s-p-t-216 {
		padding-top: 216px;
	}

	.s-padding-top-324,
	.s-p-t-324 {
		padding-top: 324px;
	}

	.s-padding-bottom-12,
	.s-p-b-12 {
		padding-bottom: 12px;
	}

	.s-padding-bottom-24,
	.s-p-b-24 {
		padding-bottom: 24px;
	}

	.s-padding-bottom-36,
	.s-p-b-36 {
		padding-bottom: 36px;
	}

	.s-padding-bottom-48,
	.s-p-b-48 {
		padding-bottom: 48px;
	}

	.s-padding-bottom-60,
	.s-p-b-60 {
		padding-bottom: 60px;
	}

	.s-padding-bottom-72,
	.s-p-b-72 {
		padding-bottom: 72px;
	}

	.s-padding-bottom-84,
	.s-p-b-84 {
		padding-bottom: 84px;
	}

	.s-padding-bottom-96,
	.s-p-b-96 {
		padding-bottom: 96px;
	}

	.s-padding-bottom-108,
	.s-p-b-108 {
		padding-bottom: 108px;
	}

	.s-padding-bottom-120,
	.s-p-b-120 {
		padding-bottom: 120px;
	}

	.s-padding-bottom-132,
	.s-p-b-132 {
		padding-bottom: 132px;
	}

	.s-padding-bottom-144,
	.s-p-b-144 {
		padding-bottom: 144px;
	}

	.s-padding-bottom-156,
	.s-p-b-156 {
		padding-bottom: 156px;
	}

	.s-padding-bottom-168,
	.s-p-b-168 {
		padding-bottom: 168px;
	}

	.s-padding-bottom-180,
	.s-p-b-180 {
		padding-bottom: 180px;
	}

	.s-padding-top-bottom-12,
	.s-p-t-b-12 {
		padding-top: 12px;
		padding-bottom: 12px;
	}

	.s-padding-top-bottom-24,
	.s-p-t-b-24 {
		padding-top: 24px;
		padding-bottom: 24px;
	}

	.s-padding-top-bottom-36,
	.s-p-t-b-36 {
		padding-top: 36px;
		padding-bottom: 36px;
	}

	.s-padding-top-bottom-48,
	.s-p-t-b-48 {
		padding-top: 48px;
		padding-bottom: 48px;
	}

	.s-padding-top-bottom-60,
	.s-p-t-b-60 {
		padding-top: 60px;
		padding-bottom: 60px;
	}

	.s-padding-top-bottom-72,
	.s-p-t-b-72 {
		padding-top: 72px;
		padding-bottom: 72px;
	}

	.s-padding-top-bottom-84,
	.s-p-t-b-84 {
		padding-top: 84px;
		padding-bottom: 84px;
	}

	.s-padding-top-bottom-96,
	.s-p-t-b-96 {
		padding-top: 96px;
		padding-bottom: 96px;
	}

	.s-padding-top-bottom-108,
	.s-p-t-b-108 {
		padding-top: 108px;
		padding-bottom: 108px;
	}
}

@media screen and (max-width: 760px) {
	.max-wrapper,
	.small-wrapper,
	.middle-wrapper {
		max-width: 440px;
	}

	.xs-hide {
		display: none;
	}

	.xs-margin-12,
	.xs-m-12 {
		margin: 12px;
	}

	.xs-margin-18,
	.xs-m-18 {
		margin: 18px;
	}

	.xs-margin-24,
	.xs-m-24 {
		margin: 24px;
	}

	.xs-margin-36,
	.xs-m-36 {
		margin: 36px;
	}

	.xs-margin-48,
	.xs-m-48 {
		margin: 48px;
	}

	.xs-margin-60,
	.xs-m-60 {
		margin: 60px;
	}

	.xs-margin-72,
	.xs-m-72 {
		margin: 72px;
	}

	.xs-margin-top-bottom-12,
	.xs-m-t-b-12 {
		margin-top: 12px;
		margin-bottom: 12px;
	}

	.xs-margin-top-bottom-18,
	.xs-m-t-b-18 {
		margin-top: 18px;
		margin-bottom: 18px;
	}

	.xs-margin-top-bottom-24,
	.xs-m-t-b-24 {
		margin-top: 24px;
		margin-bottom: 24px;
	}

	.xs-margin-top-bottom-36,
	.xs-m-t-b-36 {
		margin-top: 36px;
		margin-bottom: 36px;
	}

	.xs-margin-top-bottom-48,
	.xs-m-t-b-48 {
		margin-top: 48px;
		margin-bottom: 48px;
	}

	.xs-margin-top-bottom-60,
	.xs-m-t-b-60 {
		margin-top: 60px;
		margin-bottom: 60px;
	}

	.xs-margin-top-bottom-72,
	.xs-m-t-b-72 {
		margin-top: 72px;
		margin-bottom: 72px;
	}

	.xs-margin-left-right-12,
	.xs-m-l-r-12 {
		margin-right: 12px;
		margin-left: 12px;
	}

	.xs-margin-left-right-18,
	.xs-m-l-r-18 {
		margin-right: 18px;
		margin-left: 18px;
	}

	.xs-margin-left-right-24,
	.xs-m-l-r-24 {
		margin-right: 24px;
		margin-left: 24px;
	}

	.xs-margin-left-right-36,
	.xs-m-l-r-36 {
		margin-right: 36px;
		margin-left: 36px;
	}

	.xs-margin-left-right-48,
	.xs-m-l-r-48 {
		margin-right: 48px;
		margin-left: 48px;
	}

	.xs-margin-left-right-60,
	.xs-m-l-r-60 {
		margin-right: 60px;
		margin-left: 60px;
	}

	.xs-margin-left-right-72,
	.xs-m-l-r-72 {
		margin-right: 72px;
		margin-left: 72px;
	}

	.xs-margin-top-6,
	.xs-m-t-6 {
		margin-top: 6px;
	}

	.xs-margin-top-12,
	.xs-m-t-12 {
		margin-top: 12px;
	}

	.xs-margin-top-18,
	.xs-m-t-18 {
		margin-top: 18px;
	}

	.xs-margin-top-24,
	.xs-m-t-24 {
		margin-top: 24px;
	}

	.xs-margin-top-36,
	.xs-m-t-36 {
		margin-top: 36px;
	}

	.xs-margin-top-48,
	.xs-m-t-48 {
		margin-top: 48px;
	}

	.xs-margin-top-60,
	.xs-m-t-60 {
		margin-top: 60px;
	}

	.xs-margin-top-72,
	.xs-m-t-72 {
		margin-top: 72px;
	}

	.xs-padding-12,
	.xs-p-12 {
		padding: 12px;
	}

	.xs-padding-24,
	.xs-p-24 {
		padding: 24px;
	}

	.xs-padding-36,
	.xs-p-36 {
		padding: 36px;
	}

	.xs-padding-48,
	.xs-p-48 {
		padding: 48px;
	}

	.xs-padding-60,
	.xs-p-60 {
		padding: 60px;
	}

	.xs-padding-72,
	.xs-p-72 {
		padding: 72px;
	}

	.xs-padding-right-12,
	.xs-p-r-12 {
		padding-right: 12px;
	}

	.xs-padding-right-24,
	.xs-p-r-24 {
		padding-right: 24px;
	}

	.xs-padding-right-36,
	.xs-p-r-36 {
		padding-right: 36px;
	}

	.xs-padding-right-48,
	.xs-p-r-48 {
		padding-right: 48px;
	}

	.xs-padding-right-60,
	.xs-p-r-60 {
		padding-right: 60px;
	}

	.xs-padding-right-72,
	.xs-p-r-72 {
		padding-right: 72px;
	}

	.xs-padding-right-84,
	.xs-p-r-84 {
		padding-right: 84px;
	}

	.xs-padding-right-96,
	.xs-p-r-96 {
		padding-right: 96px;
	}

	.xs-padding-right-108,
	.xs-p-r-108 {
		padding-right: 108px;
	}

	.xs-padding-right-216,
	.xs-p-r-216 {
		padding-right: 216px;
	}

	.xs-padding-right-324,
	.xs-p-r-324 {
		padding-right: 324px;
	}

	.xs-padding-left-12,
	.xs-p-l-12 {
		padding-left: 12px;
	}

	.xs-padding-left-24,
	.xs-p-l-24 {
		padding-left: 24px;
	}

	.xs-padding-left-36,
	.xs-p-l-36 {
		padding-left: 36px;
	}

	.xs-padding-left-48,
	.xs-p-l-48 {
		padding-left: 48px;
	}

	.xs-padding-left-60,
	.xs-p-l-60 {
		padding-left: 60px;
	}

	.xs-padding-left-72,
	.xs-p-l-72 {
		padding-left: 72px;
	}

	.xs-padding-left-84,
	.xs-p-l-84 {
		padding-left: 84px;
	}

	.xs-padding-left-96,
	.xs-p-l-96 {
		padding-left: 96px;
	}

	.xs-padding-left-108,
	.xs-p-l-108 {
		padding-left: 108px;
	}

	.xs-padding-left-216,
	.xs-p-l-216 {
		padding-left: 216px;
	}

	.xs-padding-left-324,
	.xs-p-l-324 {
		padding-left: 324px;
	}

	.xs-padding-top-12,
	.xs-p-t-12 {
		padding-top: 12px;
	}

	.xs-padding-top-24,
	.xs-p-t-24 {
		padding-top: 24px;
	}

	.xs-padding-top-36,
	.xs-p-t-36 {
		padding-top: 36px;
	}

	.xs-padding-top-48,
	.xs-p-t-48 {
		padding-top: 48px;
	}

	.xs-padding-top-60,
	.xs-p-t-60 {
		padding-top: 60px;
	}

	.xs-padding-top-72,
	.xs-p-t-72 {
		padding-top: 72px;
	}

	.xs-padding-top-84,
	.xs-p-t-84 {
		padding-top: 84px;
	}

	.xs-padding-top-96,
	.xs-p-t-96 {
		padding-top: 96px;
	}

	.xs-padding-top-108,
	.xs-p-t-108 {
		padding-top: 108px;
	}

	.xs-padding-top-120,
	.xs-p-t-120 {
		padding-top: 120px;
	}

	.xs-padding-top-132,
	.xs-p-t-132 {
		padding-top: 132px;
	}

	.xs-padding-top-144,
	.xs-p-t-144 {
		padding-top: 144px;
	}

	.xs-padding-top-156,
	.xs-p-t-156 {
		padding-top: 156px;
	}

	.xs-padding-top-168,
	.xs-p-t-168 {
		padding-top: 168px;
	}

	.xs-padding-top-180,
	.xs-p-t-180 {
		padding-top: 180px;
	}

	.xs-padding-top-192,
	.xs-p-t-192 {
		padding-top: 192px;
	}

	.xs-padding-top-216,
	.xs-p-t-216 {
		padding-top: 216px;
	}

	.xs-padding-top-324,
	.xs-p-t-324 {
		padding-top: 324px;
	}

	.xs-padding-bottom-12,
	.xs-p-b-12 {
		padding-bottom: 12px;
	}

	.xs-padding-bottom-24,
	.xs-p-b-24 {
		padding-bottom: 24px;
	}

	.xs-padding-bottom-36,
	.xs-p-b-36 {
		padding-bottom: 36px;
	}

	.xs-padding-bottom-48,
	.xs-p-b-48 {
		padding-bottom: 48px;
	}

	.xs-padding-bottom-60,
	.xs-p-b-60 {
		padding-bottom: 60px;
	}

	.xs-padding-bottom-72,
	.xs-p-b-72 {
		padding-bottom: 72px;
	}

	.xs-padding-bottom-84,
	.xs-p-b-84 {
		padding-bottom: 84px;
	}

	.xs-padding-bottom-96,
	.xs-p-b-96 {
		padding-bottom: 96px;
	}

	.xs-padding-bottom-108,
	.xs-p-b-108 {
		padding-bottom: 108px;
	}

	.xs-padding-bottom-120,
	.xs-p-b-120 {
		padding-bottom: 120px;
	}

	.xs-padding-bottom-132,
	.xs-p-b-132 {
		padding-bottom: 132px;
	}

	.xs-padding-bottom-144,
	.xs-p-b-144 {
		padding-bottom: 144px;
	}

	.xs-padding-bottom-156,
	.xs-p-b-156 {
		padding-bottom: 156px;
	}

	.xs-padding-bottom-168,
	.xs-p-b-168 {
		padding-bottom: 168px;
	}

	.xs-padding-bottom-180,
	.xs-p-b-180 {
		padding-bottom: 180px;
	}

	.xs-padding-top-bottom-12,
	.xs-p-t-b-12 {
		padding-top: 12px;
		padding-bottom: 12px;
	}

	.xs-padding-top-bottom-24,
	.xs-p-t-b-24 {
		padding-top: 24px;
		padding-bottom: 24px;
	}

	.xs-padding-top-bottom-36,
	.xs-p-t-b-36 {
		padding-top: 36px;
		padding-bottom: 36px;
	}

	.xs-padding-top-bottom-48,
	.xs-p-t-b-48 {
		padding-top: 48px;
		padding-bottom: 48px;
	}

	.xs-padding-top-bottom-60,
	.xs-p-t-b-60 {
		padding-top: 60px;
		padding-bottom: 60px;
	}

	.xs-padding-top-bottom-72,
	.xs-p-t-b-72 {
		padding-top: 72px;
		padding-bottom: 72px;
	}

	.xs-padding-top-bottom-84,
	.xs-p-t-b-84 {
		padding-top: 84px;
		padding-bottom: 84px;
	}

	.xs-padding-top-bottom-96,
	.xs-p-t-b-96 {
		padding-top: 96px;
		padding-bottom: 96px;
	}

	.xs-padding-top-bottom-108,
	.xs-p-t-b-108 {
		padding-top: 108px;
		padding-bottom: 108px;
	}
}

@media screen and (max-width: 460px) {
	.max-wrapper,
	.small-wrapper,
	.middle-wrapper {
		max-width: 330px;
	}

	.xxs-hide {
		display: none;
	}

	.xxs-margin-12,
	.xxs-m-12 {
		margin: 12px;
	}

	.xxs-margin-18,
	.xxs-m-18 {
		margin: 18px;
	}

	.xxs-margin-24,
	.xxs-m-24 {
		margin: 24px;
	}

	.xxs-margin-36,
	.xxs-m-36 {
		margin: 36px;
	}

	.xxs-margin-48,
	.xxs-m-48 {
		margin: 48px;
	}

	.xxs-margin-60,
	.xxs-m-60 {
		margin: 60px;
	}

	.xxs-margin-72,
	.xxs-m-72 {
		margin: 72px;
	}

	.xxs-margin-top-bottom-12,
	.xxs-m-t-b-12 {
		margin-top: 12px;
		margin-bottom: 12px;
	}

	.xxs-margin-top-bottom-18,
	.xxs-m-t-b-18 {
		margin-top: 18px;
		margin-bottom: 18px;
	}

	.xxs-margin-top-bottom-24,
	.xxs-m-t-b-24 {
		margin-top: 24px;
		margin-bottom: 24px;
	}

	.xxs-margin-top-bottom-36,
	.xxs-m-t-b-36 {
		margin-top: 36px;
		margin-bottom: 36px;
	}

	.xxs-margin-top-bottom-48,
	.xxs-m-t-b-48 {
		margin-top: 48px;
		margin-bottom: 48px;
	}

	.xxs-margin-top-bottom-60,
	.xxs-m-t-b-60 {
		margin-top: 60px;
		margin-bottom: 60px;
	}

	.xxs-margin-top-bottom-72,
	.xxs-m-t-b-72 {
		margin-top: 72px;
		margin-bottom: 72px;
	}

	.xxs-margin-left-right-12,
	.xxs-m-l-r-12 {
		margin-right: 12px;
		margin-left: 12px;
	}

	.xxs-margin-left-right-18,
	.xxs-m-l-r-18 {
		margin-right: 18px;
		margin-left: 18px;
	}

	.xxs-margin-left-right-24,
	.xxs-m-l-r-24 {
		margin-right: 24px;
		margin-left: 24px;
	}

	.xxs-margin-left-right-36,
	.xxs-m-l-r-36 {
		margin-right: 36px;
		margin-left: 36px;
	}

	.xxs-margin-left-right-48,
	.xxs-m-l-r-48 {
		margin-right: 48px;
		margin-left: 48px;
	}

	.xxs-margin-left-right-60,
	.xxs-m-l-r-60 {
		margin-right: 60px;
		margin-left: 60px;
	}

	.xxs-margin-left-right-72,
	.xxs-m-l-r-72 {
		margin-right: 72px;
		margin-left: 72px;
	}

	.xxs-margin-top-6,
	.xxs-m-t-6 {
		margin-top: 6px;
	}

	.xxs-margin-top-12,
	.xxs-m-t-12 {
		margin-top: 12px;
	}

	.xxs-margin-top-18,
	.xxs-m-t-18 {
		margin-top: 18px;
	}

	.xxs-margin-top-24,
	.xxs-m-t-24 {
		margin-top: 24px;
	}

	.xxs-margin-top-36,
	.xxs-m-t-36 {
		margin-top: 36px;
	}

	.xxs-margin-top-48,
	.xxs-m-t-48 {
		margin-top: 48px;
	}

	.xxs-margin-top-60,
	.xxs-m-t-60 {
		margin-top: 60px;
	}

	.xxs-margin-top-72,
	.xxs-m-t-72 {
		margin-top: 72px;
	}

	.xxs-padding-12,
	.xxs-p-12 {
		padding: 12px;
	}

	.xxs-padding-24,
	.xxs-p-24 {
		padding: 24px;
	}

	.xxs-padding-36,
	.xxs-p-36 {
		padding: 36px;
	}

	.xxs-padding-48,
	.xxs-p-48 {
		padding: 48px;
	}

	.xxs-padding-60,
	.xxs-p-60 {
		padding: 60px;
	}

	.xxs-padding-72,
	.xxs-p-72 {
		padding: 72px;
	}

	.xxs-padding-right-12,
	.xxs-p-r-12 {
		padding-right: 12px;
	}

	.xxs-padding-right-24,
	.xxs-p-r-24 {
		padding-right: 24px;
	}

	.xxs-padding-right-36,
	.xxs-p-r-36 {
		padding-right: 36px;
	}

	.xxs-padding-right-48,
	.xxs-p-r-48 {
		padding-right: 48px;
	}

	.xxs-padding-right-60,
	.xxs-p-r-60 {
		padding-right: 60px;
	}

	.xxs-padding-right-72,
	.xxs-p-r-72 {
		padding-right: 72px;
	}

	.xxs-padding-right-84,
	.xxs-p-r-84 {
		padding-right: 84px;
	}

	.xxs-padding-right-96,
	.xxs-p-r-96 {
		padding-right: 96px;
	}

	.xxs-padding-right-108,
	.xxs-p-r-108 {
		padding-right: 108px;
	}

	.xxs-padding-right-216,
	.xxs-p-r-216 {
		padding-right: 216px;
	}

	.xxs-padding-right-324,
	.xxs-p-r-324 {
		padding-right: 324px;
	}

	.xxs-padding-left-12,
	.xxs-p-l-12 {
		padding-left: 12px;
	}

	.xxs-padding-left-24,
	.xxs-p-l-24 {
		padding-left: 24px;
	}

	.xxs-padding-left-36,
	.xxs-p-l-36 {
		padding-left: 36px;
	}

	.xxs-padding-left-48,
	.xxs-p-l-48 {
		padding-left: 48px;
	}

	.xxs-padding-left-60,
	.xxs-p-l-60 {
		padding-left: 60px;
	}

	.xxs-padding-left-72,
	.xxs-p-l-72 {
		padding-left: 72px;
	}

	.xxs-padding-left-84,
	.xxs-p-l-84 {
		padding-left: 84px;
	}

	.xxs-padding-left-96,
	.xxs-p-l-96 {
		padding-left: 96px;
	}

	.xxs-padding-left-108,
	.xxs-p-l-108 {
		padding-left: 108px;
	}

	.xxs-padding-left-216,
	.xxs-p-l-216 {
		padding-left: 216px;
	}

	.xxs-padding-left-324,
	.xxs-p-l-324 {
		padding-left: 324px;
	}

	.xxs-padding-top-12,
	.xxs-p-t-12 {
		padding-top: 12px;
	}

	.xxs-padding-top-24,
	.xxs-p-t-24 {
		padding-top: 24px;
	}

	.xxs-padding-top-36,
	.xxs-p-t-36 {
		padding-top: 36px;
	}

	.xxs-padding-top-48,
	.xxs-p-t-48 {
		padding-top: 48px;
	}

	.xxs-padding-top-60,
	.xxs-p-t-60 {
		padding-top: 60px;
	}

	.xxs-padding-top-72,
	.xxs-p-t-72 {
		padding-top: 72px;
	}

	.xxs-padding-top-84,
	.xxs-p-t-84 {
		padding-top: 84px;
	}

	.xxs-padding-top-96,
	.xxs-p-t-96 {
		padding-top: 96px;
	}

	.xxs-padding-top-108,
	.xxs-p-t-108 {
		padding-top: 108px;
	}

	.xxs-padding-top-120,
	.xxs-p-t-120 {
		padding-top: 120px;
	}

	.xxs-padding-top-132,
	.xxs-p-t-132 {
		padding-top: 132px;
	}

	.xxs-padding-top-144,
	.xxs-p-t-144 {
		padding-top: 144px;
	}

	.xxs-padding-top-156,
	.xxs-p-t-156 {
		padding-top: 156px;
	}

	.xxs-padding-top-168,
	.xxs-p-t-168 {
		padding-top: 168px;
	}

	.xxs-padding-top-180,
	.xxs-p-t-180 {
		padding-top: 180px;
	}

	.xxs-padding-top-192,
	.xxs-p-t-192 {
		padding-top: 192px;
	}

	.xxs-padding-top-216,
	.xxs-p-t-216 {
		padding-top: 216px;
	}

	.xxs-padding-top-324,
	.xxs-p-t-324 {
		padding-top: 324px;
	}

	.xxs-padding-bottom-12,
	.xxs-p-b-12 {
		padding-bottom: 12px;
	}

	.xxs-padding-bottom-24,
	.xxs-p-b-24 {
		padding-bottom: 24px;
	}

	.xxs-padding-bottom-36,
	.xxs-p-b-36 {
		padding-bottom: 36px;
	}

	.xxs-padding-bottom-48,
	.xxs-p-b-48 {
		padding-bottom: 48px;
	}

	.xxs-padding-bottom-60,
	.xxs-p-b-60 {
		padding-bottom: 60px;
	}

	.xxs-padding-bottom-72,
	.xxs-p-b-72 {
		padding-bottom: 72px;
	}

	.xxs-padding-bottom-84,
	.xxs-p-b-84 {
		padding-bottom: 84px;
	}

	.xxs-padding-bottom-96,
	.xxs-p-b-96 {
		padding-bottom: 96px;
	}

	.xxs-padding-bottom-108,
	.xxs-p-b-108 {
		padding-bottom: 108px;
	}

	.xxs-padding-bottom-120,
	.xxs-p-b-120 {
		padding-bottom: 120px;
	}

	.xxs-padding-bottom-132,
	.xxs-p-b-132 {
		padding-bottom: 132px;
	}

	.xxs-padding-bottom-144,
	.xxs-p-b-144 {
		padding-bottom: 144px;
	}

	.xxs-padding-bottom-156,
	.xxs-p-b-156 {
		padding-bottom: 156px;
	}

	.xxs-padding-bottom-168,
	.xxs-p-b-168 {
		padding-bottom: 168px;
	}

	.xxs-padding-bottom-180,
	.xxs-p-b-180 {
		padding-bottom: 180px;
	}

	.xxs-padding-top-bottom-12,
	.xxs-p-t-b-12 {
		padding-top: 12px;
		padding-bottom: 12px;
	}

	.xxs-padding-top-bottom-24,
	.xxs-p-t-b-24 {
		padding-top: 24px;
		padding-bottom: 24px;
	}

	.xxs-padding-top-bottom-36,
	.xxs-p-t-b-36 {
		padding-top: 36px;
		padding-bottom: 36px;
	}

	.xxs-padding-top-bottom-48,
	.xxs-p-t-b-48 {
		padding-top: 48px;
		padding-bottom: 48px;
	}

	.xxs-padding-top-bottom-60,
	.xxs-p-t-b-60 {
		padding-top: 60px;
		padding-bottom: 60px;
	}

	.xxs-padding-top-bottom-72,
	.xxs-p-t-b-72 {
		padding-top: 72px;
		padding-bottom: 72px;
	}

	.xxs-padding-top-bottom-84,
	.xxs-p-t-b-84 {
		padding-top: 84px;
		padding-bottom: 84px;
	}

	.xxs-padding-top-bottom-96,
	.xxs-p-t-b-96 {
		padding-top: 96px;
		padding-bottom: 96px;
	}

	.xxs-padding-top-bottom-108,
	.xxs-p-t-b-108 {
		padding-top: 108px;
		padding-bottom: 108px;
	}
}

@media screen and (max-width: 350px) {
	.max-wrapper,
	.small-wrapper,
	.middle-wrapper {
		max-width: 285px;
	}

	.xxxs-hide {
		display: none;
	}

	.xxxs-margin-12,
	.xxxs-m-12 {
		margin: 12px;
	}

	.xxxs-margin-18,
	.xxxs-m-18 {
		margin: 18px;
	}

	.xxxs-margin-24,
	.xxxs-m-24 {
		margin: 24px;
	}

	.xxxs-margin-36,
	.xxxs-m-36 {
		margin: 36px;
	}

	.xxxs-margin-48,
	.xxxs-m-48 {
		margin: 48px;
	}

	.xxxs-margin-60,
	.xxxs-m-60 {
		margin: 60px;
	}

	.xxxs-margin-72,
	.xxxs-m-72 {
		margin: 72px;
	}

	.xxxs-margin-top-bottom-12,
	.xxxs-m-t-b-12 {
		margin-top: 12px;
		margin-bottom: 12px;
	}

	.xxxs-margin-top-bottom-18,
	.xxxs-m-t-b-18 {
		margin-top: 18px;
		margin-bottom: 18px;
	}

	.xxxs-margin-top-bottom-24,
	.xxxs-m-t-b-24 {
		margin-top: 24px;
		margin-bottom: 24px;
	}

	.xxxs-margin-top-bottom-36,
	.xxxs-m-t-b-36 {
		margin-top: 36px;
		margin-bottom: 36px;
	}

	.xxxs-margin-top-bottom-48,
	.xxxs-m-t-b-48 {
		margin-top: 48px;
		margin-bottom: 48px;
	}

	.xxxs-margin-top-bottom-60,
	.xxxs-m-t-b-60 {
		margin-top: 60px;
		margin-bottom: 60px;
	}

	.xxxs-margin-top-bottom-72,
	.xxxs-m-t-b-72 {
		margin-top: 72px;
		margin-bottom: 72px;
	}

	.xxxs-margin-left-right-12,
	.xxxs-m-l-r-12 {
		margin-right: 12px;
		margin-left: 12px;
	}

	.xxxs-margin-left-right-18,
	.xxxs-m-l-r-18 {
		margin-right: 18px;
		margin-left: 18px;
	}

	.xxxs-margin-left-right-24,
	.xxxs-m-l-r-24 {
		margin-right: 24px;
		margin-left: 24px;
	}

	.xxxs-margin-left-right-36,
	.xxxs-m-l-r-36 {
		margin-right: 36px;
		margin-left: 36px;
	}

	.xxxs-margin-left-right-48,
	.xxxs-m-l-r-48 {
		margin-right: 48px;
		margin-left: 48px;
	}

	.xxxs-margin-left-right-60,
	.xxxs-m-l-r-60 {
		margin-right: 60px;
		margin-left: 60px;
	}

	.xxxs-margin-left-right-72,
	.xxxs-m-l-r-72 {
		margin-right: 72px;
		margin-left: 72px;
	}

	.xxxs-margin-top-6,
	.xxxs-m-t-6 {
		margin-top: 6px;
	}

	.xxxs-margin-top-12,
	.xxxs-m-t-12 {
		margin-top: 12px;
	}

	.xxxs-margin-top-18,
	.xxxs-m-t-18 {
		margin-top: 18px;
	}

	.xxxs-margin-top-24,
	.xxxs-m-t-24 {
		margin-top: 24px;
	}

	.xxxs-margin-top-36,
	.xxxs-m-t-36 {
		margin-top: 36px;
	}

	.xxxs-margin-top-48,
	.xxxs-m-t-48 {
		margin-top: 48px;
	}

	.xxxs-margin-top-60,
	.xxxs-m-t-60 {
		margin-top: 60px;
	}

	.xxxs-margin-top-72,
	.xxxs-m-t-72 {
		margin-top: 72px;
	}

	.xxxs-padding-12,
	.xxxs-p-12 {
		padding: 12px;
	}

	.xxxs-padding-24,
	.xxxs-p-24 {
		padding: 24px;
	}

	.xxxs-padding-36,
	.xxxs-p-36 {
		padding: 36px;
	}

	.xxxs-padding-48,
	.xxxs-p-48 {
		padding: 48px;
	}

	.xxxs-padding-60,
	.xxxs-p-60 {
		padding: 60px;
	}

	.xxxs-padding-72,
	.xxxs-p-72 {
		padding: 72px;
	}

	.xxxs-padding-right-12,
	.xxxs-p-r-12 {
		padding-right: 12px;
	}

	.xxxs-padding-right-24,
	.xxxs-p-r-24 {
		padding-right: 24px;
	}

	.xxxs-padding-right-36,
	.xxxs-p-r-36 {
		padding-right: 36px;
	}

	.xxxs-padding-right-48,
	.xxxs-p-r-48 {
		padding-right: 48px;
	}

	.xxxs-padding-right-60,
	.xxxs-p-r-60 {
		padding-right: 60px;
	}

	.xxxs-padding-right-72,
	.xxxs-p-r-72 {
		padding-right: 72px;
	}

	.xxxs-padding-right-84,
	.xxxs-p-r-84 {
		padding-right: 84px;
	}

	.xxxs-padding-right-96,
	.xxxs-p-r-96 {
		padding-right: 96px;
	}

	.xxxs-padding-right-108,
	.xxxs-p-r-108 {
		padding-right: 108px;
	}

	.xxxs-padding-right-216,
	.xxxs-p-r-216 {
		padding-right: 216px;
	}

	.xxxs-padding-right-324,
	.xxxs-p-r-324 {
		padding-right: 324px;
	}

	.xxxs-padding-left-12,
	.xxxs-p-l-12 {
		padding-left: 12px;
	}

	.xxxs-padding-left-24,
	.xxxs-p-l-24 {
		padding-left: 24px;
	}

	.xxxs-padding-left-36,
	.xxxs-p-l-36 {
		padding-left: 36px;
	}

	.xxxs-padding-left-48,
	.xxxs-p-l-48 {
		padding-left: 48px;
	}

	.xxxs-padding-left-60,
	.xxxs-p-l-60 {
		padding-left: 60px;
	}

	.xxxs-padding-left-72,
	.xxxs-p-l-72 {
		padding-left: 72px;
	}

	.xxxs-padding-left-84,
	.xxxs-p-l-84 {
		padding-left: 84px;
	}

	.xxxs-padding-left-96,
	.xxxs-p-l-96 {
		padding-left: 96px;
	}

	.xxxs-padding-left-108,
	.xxxs-p-l-108 {
		padding-left: 108px;
	}

	.xxxs-padding-left-216,
	.xxxs-p-l-216 {
		padding-left: 216px;
	}

	.xxxs-padding-left-324,
	.xxxs-p-l-324 {
		padding-left: 324px;
	}

	.xxxs-padding-top-12,
	.xxxs-p-t-12 {
		padding-top: 12px;
	}

	.xxxs-padding-top-24,
	.xxxs-p-t-24 {
		padding-top: 24px;
	}

	.xxxs-padding-top-36,
	.xxxs-p-t-36 {
		padding-top: 36px;
	}

	.xxxs-padding-top-48,
	.xxxs-p-t-48 {
		padding-top: 48px;
	}

	.xxxs-padding-top-60,
	.xxxs-p-t-60 {
		padding-top: 60px;
	}

	.xxxs-padding-top-72,
	.xxxs-p-t-72 {
		padding-top: 72px;
	}

	.xxxs-padding-top-84,
	.xxxs-p-t-84 {
		padding-top: 84px;
	}

	.xxxs-padding-top-96,
	.xxxs-p-t-96 {
		padding-top: 96px;
	}

	.xxxs-padding-top-108,
	.xxxs-p-t-108 {
		padding-top: 108px;
	}

	.xxxs-padding-top-120,
	.xxxs-p-t-120 {
		padding-top: 120px;
	}

	.xxxs-padding-top-132,
	.xxxs-p-t-132 {
		padding-top: 132px;
	}

	.xxxs-padding-top-144,
	.xxxs-p-t-144 {
		padding-top: 144px;
	}

	.xxxs-padding-top-156,
	.xxxs-p-t-156 {
		padding-top: 156px;
	}

	.xxxs-padding-top-168,
	.xxxs-p-t-168 {
		padding-top: 168px;
	}

	.xxxs-padding-top-180,
	.xxxs-p-t-180 {
		padding-top: 180px;
	}

	.xxxs-padding-top-192,
	.xxxs-p-t-192 {
		padding-top: 192px;
	}

	.xxxs-padding-top-216,
	.xxxs-p-t-216 {
		padding-top: 216px;
	}

	.xxxs-padding-top-324,
	.xxxs-p-t-324 {
		padding-top: 324px;
	}

	.xxxs-padding-bottom-12,
	.xxxs-p-b-12 {
		padding-bottom: 12px;
	}

	.xxxs-padding-bottom-24,
	.xxxs-p-b-24 {
		padding-bottom: 24px;
	}

	.xxxs-padding-bottom-36,
	.xxxs-p-b-36 {
		padding-bottom: 36px;
	}

	.xxxs-padding-bottom-48,
	.xxxs-p-b-48 {
		padding-bottom: 48px;
	}

	.xxxs-padding-bottom-60,
	.xxxs-p-b-60 {
		padding-bottom: 60px;
	}

	.xxxs-padding-bottom-72,
	.xxxs-p-b-72 {
		padding-bottom: 72px;
	}

	.xxxs-padding-bottom-84,
	.xxxs-p-b-84 {
		padding-bottom: 84px;
	}

	.xxxs-padding-bottom-96,
	.xxxs-p-b-96 {
		padding-bottom: 96px;
	}

	.xxxs-padding-bottom-108,
	.xxxs-p-b-108 {
		padding-bottom: 108px;
	}

	.xxxs-padding-bottom-120,
	.xxxs-p-b-120 {
		padding-bottom: 120px;
	}

	.xxxs-padding-bottom-132,
	.xxxs-p-b-132 {
		padding-bottom: 132px;
	}

	.xxxs-padding-bottom-144,
	.xxxs-p-b-144 {
		padding-bottom: 144px;
	}

	.xxxs-padding-bottom-156,
	.xxxs-p-b-156 {
		padding-bottom: 156px;
	}

	.xxxs-padding-bottom-168,
	.xxxs-p-b-168 {
		padding-bottom: 168px;
	}

	.xxxs-padding-bottom-180,
	.xxxs-p-b-180 {
		padding-bottom: 180px;
	}

	.xxxs-padding-top-bottom-12,
	.xxxs-p-t-b-12 {
		padding-top: 12px;
		padding-bottom: 12px;
	}

	.xxxs-padding-top-bottom-24,
	.xxxs-p-t-b-24 {
		padding-top: 24px;
		padding-bottom: 24px;
	}

	.xxxs-padding-top-bottom-36,
	.xxxs-p-t-b-36 {
		padding-top: 36px;
		padding-bottom: 36px;
	}

	.xxxs-padding-top-bottom-48,
	.xxxs-p-t-b-48 {
		padding-top: 48px;
		padding-bottom: 48px;
	}

	.xxxs-padding-top-bottom-60,
	.xxxs-p-t-b-60 {
		padding-top: 60px;
		padding-bottom: 60px;
	}

	.xxxs-padding-top-bottom-72,
	.xxxs-p-t-b-72 {
		padding-top: 72px;
		padding-bottom: 72px;
	}

	.xxxs-padding-top-bottom-84,
	.xxxs-p-t-b-84 {
		padding-top: 84px;
		padding-bottom: 84px;
	}

	.xxxs-padding-top-bottom-96,
	.xxxs-p-t-b-96 {
		padding-top: 96px;
		padding-bottom: 96px;
	}

	.xxxs-padding-top-bottom-108,
	.xxxs-p-t-b-108 {
		padding-top: 108px;
		padding-bottom: 108px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/grid.css?17690163084718*/
.w-100 {
	width: 100%;
}

.w-90 {
	width: 90%;
}

.w-85 {
	width: 85%;
}

.w-80 {
	width: 80%;
}

.w-75 {
	width: 75%;
}

.w-70 {
	width: 70%;
}

.w-66 {
	width: 66%;
}

.w-60 {
	width: 60%;
}

.w-55 {
	width: 55%;
}

.w-50 {
	width: 50%;
}

.w-45 {
	width: 45%;
}

.w-40 {
	width: 40%;
}

.w-33 {
	width: 33.33333333333333%;
}

.w-30 {
	width: 30%;
}

.w-25 {
	width: 25%;
}

.w-20 {
	width: 20%;
}

.w-16 {
	width: 16.66666666666667%;
}

.w-15 {
	width: 15%;
}

.w-10 {
	width: 10%;
}

/* media section */
@media screen and (max-width: 1880px) {
	.xxl-w-100 {
		width: 100%;
	}

	.xxl-w-70 {
		width: 70%;
	}

	.xxl-w-66 {
		width: 66%;
	}

	.xxl-w-60 {
		width: 60%;
	}

	.xxl-w-55 {
		width: 55%;
	}

	.xxl-w-50 {
		width: 50%;
	}

	.xxl-w-45 {
		width: 45%;
	}

	.xxl-w-40 {
		width: 40%;
	}

	.xxl-w-33 {
		width: 33.33333333333333%;
	}

	.xxl-w-30 {
		width: 30%;
	}

	.xxl-w-25 {
		width: 25%;
	}

	.xxl-w-20 {
		width: 20%;
	}

	.xxl-w-16 {
		width: 16.66666666666667%;
	}

	.xxl-w-10 {
		width: 10%;
	}
}

@media screen and (max-width: 1650px) {
	.xl-w-100 {
		width: 100%;
	}

	.xl-w-90 {
		width: 90%;
	}

	.xl-w-80 {
		width: 80%;
	}

	.xl-w-70 {
		width: 70%;
	}

	.xl-w-60 {
		width: 60%;
	}

	.xl-w-66 {
		width: 66%;
	}

	.xl-w-55 {
		width: 55%;
	}

	.xl-w-50 {
		width: 50%;
	}

	.xl-w-45 {
		width: 45%;
	}

	.xl-w-40 {
		width: 40%;
	}

	.xl-w-33 {
		width: 33.33333333333333%;
	}

	.xl-w-30 {
		width: 30%;
	}

	.xl-w-25 {
		width: 25%;
	}

	.xl-w-20 {
		width: 20%;
	}

	.xl-w-16 {
		width: 16.66666666666667%;
	}

	.xl-w-10 {
		width: 10%;
	}

	.xl-w-5 {
		width: 5%;
	}
}

@media screen and (max-width: 1425px) {
	.l-w-100 {
		width: 100%;
	}

	.l-w-90 {
		width: 90%;
	}

	.l-w-80 {
		width: 80%;
	}

	.l-w-70 {
		width: 70%;
	}

	.l-w-60 {
		width: 60%;
	}

	.l-w-55 {
		width: 55%;
	}

	.l-w-50 {
		width: 50%;
	}

	.l-w-45 {
		width: 45%;
	}

	.l-w-40 {
		width: 40%;
	}

	.l-w-33 {
		width: 33.33333333333333%;
	}

	.l-w-30 {
		width: 30%;
	}

	.l-w-25 {
		width: 25%;
	}

	.l-w-20 {
		width: 20%;
	}

	.l-w-16 {
		width: 16.66666666666667%;
	}

	.l-w-10 {
		width: 10%;
	}
}

@media screen and (max-width: 1250px) {
	.m-w-100 {
		width: 100%;
	}

	.m-w-90 {
		width: 90%;
	}

	.m-w-80 {
		width: 80%;
	}

	.m-w-70 {
		width: 70%;
	}

	.m-w-66 {
		width: 66.66666666666666%;
	}

	.m-w-60 {
		width: 60%;
	}

	.m-w-55 {
		width: 55%;
	}

	.m-w-50 {
		width: 50%;
	}

	.m-w-45 {
		width: 45%;
	}

	.m-w-40 {
		width: 40%;
	}

	.m-w-33 {
		width: 33.33333333333333%;
	}

	.m-w-30 {
		width: 30%;
	}

	.m-w-25 {
		width: 25%;
	}

	.m-w-20 {
		width: 20%;
	}

	.m-w-16 {
		width: 16.66666666666667%;
	}

	.m-w-10 {
		width: 10%;
	}
}

@media screen and (max-width: 1000px) {
	.s-w-100 {
		width: 100%;
	}

	.s-w-90 {
		width: 90%;
	}

	.s-w-80 {
		width: 80%;
	}

	.s-w-70 {
		width: 70%;
	}

	.s-w-60 {
		width: 60%;
	}

	.s-w-55 {
		width: 55%;
	}

	.s-w-50 {
		width: 50%;
	}

	.s-w-45 {
		width: 45%;
	}

	.s-w-40 {
		width: 40%;
	}

	.s-w-33 {
		width: 33.33333333333333%;
	}

	.s-w-30 {
		width: 30%;
	}

	.s-w-25 {
		width: 25%;
	}

	.s-w-20 {
		width: 20%;
	}

	.s-w-16 {
		width: 16.66666666666667%;
	}

	.s-w-10 {
		width: 10%;
	}
}

@media screen and (max-width: 760px) {
	.xs-w-100 {
		width: 100%;
	}

	.xs-w-80 {
		width: 80%;
	}

	.xs-w-70 {
		width: 70%;
	}

	.xs-w-60 {
		width: 60%;
	}

	.xs-w-55 {
		width: 55%;
	}

	.xs-w-50 {
		width: 50%;
	}

	.xs-w-45 {
		width: 45%;
	}

	.xs-w-40 {
		width: 40%;
	}

	.xs-w-33 {
		width: 33.33333333333333%;
	}

	.xs-w-30 {
		width: 30%;
	}

	.xs-w-25 {
		width: 25%;
	}

	.xs-w-20 {
		width: 20%;
	}

	.xs-w-16 {
		width: 16.66666666666667%;
	}

	.xs-w-10 {
		width: 16.66666666666667%;
	}
}

@media screen and (max-width: 460px) {
	.xxs-w-100 {
		width: 100%;
	}

	.xxs-w-80 {
		width: 80%;
	}

	.xxs-w-70 {
		width: 70%;
	}

	.xxs-w-66 {
		width: 66.66666666666666%;
	}

	.xxs-w-60 {
		width: 60%;
	}

	.xxs-w-55 {
		width: 55%;
	}

	.xxs-w-50 {
		width: 50%;
	}

	.xxs-w-45 {
		width: 45%;
	}

	.xxs-w-40 {
		width: 40%;
	}

	.xxs-w-33 {
		width: 33.33333333333333%;
	}

	.xxs-w-30 {
		width: 30%;
	}

	.xxs-w-25 {
		width: 25%;
	}

	.xxs-w-20 {
		width: 20%;
	}

	.xxs-w-16 {
		width: 16.66666666666667%;
	}

	.xxs-w-10 {
		width: 10%;
	}
}

@media screen and (max-width: 350px) {
	.xxxs-w-100 {
		width: 100%;
	}

	.xxxs-w-70 {
		width: 70%;
	}

	.xxxs-w-60 {
		width: 60%;
	}

	.xxxs-w-55 {
		width: 55%;
	}

	.xxxs-w-50 {
		width: 50%;
	}

	.xxxs-w-45 {
		width: 45%;
	}

	.xxxs-w-40 {
		width: 40%;
	}

	.xxxs-w-33 {
		width: 33.33333333333333%;
	}

	.xxxs-w-30 {
		width: 30%;
	}

	.xxxs-w-25 {
		width: 25%;
	}

	.xxxs-w-20 {
		width: 20%;
	}

	.xxxs-w-16 {
		width: 16.66666666666667%;
	}

	.xxxs-w-10 {
		width: 10%;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/ui.css?176901209417750*/
.block {
	display: block;
}

.sprite {
	background-image: url("/local/templates/dw/assets/css/../images/sprite.svg");
}

a.sprite,
div.sprite,
span.sprite {
	transition: none;
}

.ui-1 {
	display: inline-block;
	width: 30px;
	height: 32px;
	text-align: center;
}

.ui-1.type-1 {
	background-position: -20px -19px;
}

.ui-1.type-2 {
	background-position: -60px -20px;
}

.ui-1.type-3 {
	background-position: -100px -19px;
}

.ui-1.type-4 {
	background-position: -140px -19px;
}

.ui-1.type-5 {
	background-position: -180px -19px;
}

.ui-1.type-6 {
	background-position: -220px -19px;
}

.ui-1.type-7 {
	background-position: -260px -19px;
}

.ui-1.type-8 {
	background-position: -300px -19px;
}

.ui-1.type-9 {
	background-position: -340px -19px;
}

.ui-1.type-10 {
	background-position: -380px -19px;
}

.ui-1.type-11 {
	background-position: -420px -19px;
}

.ui-1.type-12 {
	background-position: -460px -19px;
}

.ui-2 {
	display: inline-block;
	width: 34px;
	height: 34px;
	text-align: center;
}

.ui-2.type-1 {
	background-position: -20px -80px;
}

.ui-2.type-2 {
	background-position: -60px -80px;
}

.ui-2.type-3 {
	background-position: -100px -80px;
}

.ui-2.type-4 {
	background-position: -140px -80px;
}

.ui-2.type-5 {
	background-position: -180px -80px;
}

.ui-2.type-6 {
	background-position: -220px -80px;
}

.ui-2.type-7 {
	width: 40px;
	height: 40px;
	background-position: -260px -78px;
}

.ui-3 {
	display: inline-block;
	width: 38px;
	height: 38px;
	text-align: center;
}

.ui-3.type-1 {
	background-position: -20px -140px;
}

.ui-3.type-2 {
	background-position: -80px -140px;
}

.ui-3.type-3 {
	width: 32px;
	height: 32px;
	background-position: -140px -140px;
}

.ui-4 {
	display: inline-block;
	width: 18px;
	height: 18px;
	text-align: center;
}

.ui-4.type-1 {
	background-position: -20px -200px;
}

.ui-4.type-2 {
	background-position: -60px -200px;
}

.ui-4.type-3 {
	background-position: -100px -200px;
}

.ui-4.type-4 {
	background-position: -140px -200px;
}

.ui-4.type-5 {
	background-position: -180px -200px;
}

.ui-4.type-6 {
	background-position: -220px -200px;
}

.ui-4.type-7 {
	background-position: -260px -200px;
}

.ui-4.type-8 {
	background-position: -300px -200px;
}

.ui-4.type-9 {
	background-position: -340px -200px;
}

.ui-4.type-10 {
	background-position: -380px -200px;
}

.ui-4.type-11 {
	background-position: -420px -200px;
}

.ui-4.type-12 {
	background-position: -460px -200px;
}

.ui-4.type-13 {
	background-position: -500px -200px;
}

.ui-4.type-14 {
	background-position: -540px -200px;
}

.ui-4.type-15 {
	background-position: -580px -200px;
}

.ui-5 {
	display: inline-block;
	width: 80px;
	height: 43px;
	text-align: center;
}

.ui-5.type-1 {
	background-position: -20px -240px;
}

.ui-5.type-1:hover {
	background-position: -120px -240px;
}

.ui-5.type-1:active {
	background-position: -220px -240px;
}

.ui-5.type-2 {
	background-position: -20px -300px;
}

.ui-5.type-2:hover {
	background-position: -120px -300px;
}

.ui-5.type-2:active {
	background-position: -220px -300px;
}

.ui-5.type-3 {
	background-position: -320px -240px;
}

.ui-5.type-3:hover {
	background-position: -420px -240px;
}

.ui-5.type-3:active {
	background-position: -520px -240px;
}

.ui-5.type-4 {
	background-position: -320px -300px;
}

.ui-5.type-4:hover {
	background-position: -420px -300px;
}

.ui-5.type-4:active {
	background-position: -520px -300px;
}

.ui-6 {
	display: inline-block;
	width: 66px;
	height: 36px;
	text-align: center;
}

.ui-6.type-1 {
	background-position: -20px -360px;
}

.ui-6.type-1:hover {
	background-position: -100px -360px;
}

.ui-6.type-1:active {
	background-position: -180px -360px;
}

.ui-6.type-2 {
	background-position: -20px -420px;
}

.ui-6.type-2:hover {
	background-position: -100px -420px;
}

.ui-6.type-2:active {
	background-position: -180px -420px;
}

.ui-6.type-3 {
	background-position: -265px -420px;
}

.ui-6.type-3:hover {
	background-position: -345px -420px;
}

.ui-6.type-3:active {
	background-position: -425px -420px;
}

.ui-6.type-4 {
	background-position: -265px -360px;
}

.ui-6.type-4:hover {
	background-position: -345px -360px;
}

.ui-6.type-4:active {
	background-position: -425px -360px;
}

.ui-7 {
	display: inline-block;
	width: 48px;
	height: 26px;
	text-align: center;
}

.ui-7.type-1 {
	background-position: -20px -480px;
}

.ui-7.type-1:hover {
	background-position: -80px -480px;
}

.ui-7.type-1:active {
	background-position: -140px -480px;
}

.ui-7.type-2 {
	background-position: -20px -520px;
}

.ui-7.type-2:hover {
	background-position: -80px -520px;
}

.ui-7.type-2:active {
	background-position: -140px -520px;
}

.ui-8 {
	display: inline-block;
	width: 33px;
	height: 33px;
	text-align: center;
}

.ui-8.type-1 {
	background-position: -20px -560px;
}

.ui-8.type-1:hover {
	background-position: -60px -560px;
}

.ui-8.type-1:active {
	background-position: -100px -560px;
}

.ui-8.type-2 {
	background-position: -20px -600px;
}

.ui-8.type-2:hover {
	background-position: -60px -600px;
}

.ui-8.type-2:active {
	background-position: -100px -600px;
}

.ui-8.type-3 {
	background-position: -160px -560px;
}

.ui-8.type-3:hover {
	background-position: -200px -560px;
}

.ui-8.type-3:active {
	background-position: -240px -560px;
}

.ui-8.type-4 {
	background-position: -160px -600px;
}

.ui-8.type-4:hover {
	background-position: -200px -600px;
}

.ui-8.type-4:active {
	background-position: -240px -600px;
}

.ui-8.type-5 {
	background-position: -20px -640px;
}

.ui-8.type-5:hover {
	background-position: -60px -640px;
}

.ui-8.type-5:active {
	background-position: -100px -640px;
}

.ui-8.type-6 {
	background-position: -20px -680px;
}

.ui-8.type-6:hover {
	background-position: -60px -680px;
}

.ui-8.type-6:active {
	background-position: -100px -680px;
}

.ui-8.type-7 {
	background-position: -160px -640px;
}

.ui-8.type-7:hover {
	background-position: -200px -640px;
}

.ui-8.type-7:active {
	background-position: -240px -640px;
}

.ui-8.type-8 {
	background-position: -160px -680px;
}

.ui-8.type-8:hover {
	background-position: -200px -680px;
}

.ui-8.type-8:active {
	background-position: -240px -680px;
}

.ui-8.type-9 {
	background-position: -20px -720px;
}

.ui-8.type-9:hover {
	background-position: -60px -720px;
}

.ui-8.type-9:active {
	background-position: -100px -720px;
}

.ui-8.type-10 {
	background-position: -20px -760px;
}

.ui-8.type-10:hover {
	background-position: -60px -760px;
}

.ui-8.type-10:active {
	background-position: -100px -760px;
}

.ui-8.type-11 {
	background-position: -160px -720px;
}

.ui-8.type-11:hover {
	background-position: -200px -720px;
}

.ui-8.type-11:active {
	background-position: -240px -720px;
}

.ui-8.type-12 {
	background-position: -160px -760px;
}

.ui-8.type-12:hover {
	background-position: -200px -760px;
}

.ui-8.type-12:active {
	background-position: -240px -760px;
}

.ui-8.type-13 {
	background-position: -20px -800px;
}

.ui-8.type-13:hover {
	background-position: -60px -800px;
}

.ui-8.type-13:active {
	background-position: -100px -800px;
}

.ui-8.type-14 {
	background-position: -20px -840px;
}

.ui-8.type-14:hover {
	background-position: -60px -840px;
}

.ui-8.type-14:active {
	background-position: -100px -840px;
}

.ui-8.type-15 {
	background-position: -160px -800px;
}

.ui-8.type-15:hover {
	background-position: -200px -800px;
}

.ui-8.type-15:active {
	background-position: -240px -800px;
}

.ui-8.type-16 {
	background-position: -160px -840px;
}

.ui-8.type-16:hover {
	background-position: -200px -840px;
}

.ui-8.type-16:active {
	background-position: -240px -840px;
}

.ui-9 {
	display: inline-block;
	width: 52px;
	height: 52px;
	text-align: center;
}

.ui-9.type-1 {
	background-position: -20px -900px;
}

.ui-9.type-1:hover {
	background-position: -80px -900px;
}

.ui-9.type-1:active {
	background-position: -140px -900px;
}

.ui-9.type-2 {
	background-position: -20px -960px;
}

.ui-9.type-2:hover {
	background-position: -80px -960px;
}

.ui-9.type-2:active {
	background-position: -140px -960px;
}

.ui-9.type-3 {
	background-position: -20px -1020px;
}

.ui-9.type-3:hover {
	background-position: -80px -1020px;
}

.ui-9.type-3:active {
	background-position: -140px -1020px;
}

.ui-9.type-4 {
	background-position: -20px -1080px;
}

.ui-9.type-4:hover {
	background-position: -80px -1080px;
}

.ui-9.type-4:active {
	background-position: -140px -1080px;
}

.ui-9.type-5 {
	background-position: -20px -1140px;
}

.ui-9.type-5:hover {
	background-position: -80px -1140px;
}

.ui-9.type-5:active {
	background-position: -140px -1140px;
}

.ui-9.type-6 {
	background-position: -20px -1200px;
}

.ui-9.type-6:hover {
	background-position: -80px -1200px;
}

.ui-9.type-6:active {
	background-position: -140px -1200px;
}

.ui-9.type-7 {
	background-position: -200px -1020px;
}

.ui-9.type-7:hover {
	background-position: -260px -1020px;
}

.ui-9.type-7:active {
	background-position: -320px -1020px;
}

.ui-9.type-8 {
	background-position: -200px -1080px;
}

.ui-9.type-8:hover {
	background-position: -260px -1080px;
}

.ui-9.type-8:active {
	background-position: -320px -1080px;
}

.ui-10 {
	display: inline-block;
	width: 55px;
	height: 55px;
	text-align: center;
}

.ui-10.type-1 {
	background-position: -20px -1280px;
}

.ui-10.type-1:hover {
	background-position: -80px -1280px;
}

.ui-10.type-1:active {
	background-position: -140px -1280px;
}

.ui-10.type-2 {
	background-position: -20px -1340px;
}

.ui-10.type-2:hover {
	background-position: -80px -1340px;
}

.ui-10.type-2:active {
	background-position: -140px -1340px;
}

.ui-11 {
	display: inline-block;
	width: 91px;
	height: 91px;
	text-align: center;
}

.ui-11.type-1 {
	background-position: -20px -1420px;
}

.ui-11.type-1:hover {
	background-position: -120px -1420px;
}

.ui-11.type-1:active {
	background-position: -220px -1420px;
}

.ui-11.type-2 {
	background-position: -20px -1520px;
}

.ui-11.type-2:hover {
	background-position: -120px -1520px;
}

.ui-11.type-2:active {
	background-position: -220px -1520px;
}

.ui-12 {
	display: inline-block;
	width: 28px;
	height: 44px;
	text-align: center;
}

.ui-12.type-1 {
	background-position: -20px -1640px;
}

.ui-12.type-1:hover {
	background-position: -60px -1640px;
}

.ui-12.type-1:active {
	background-position: -100px -1640px;
}

.ui-12.type-2 {
	background-position: -20px -1700px;
}

.ui-12.type-2:hover {
	background-position: -60px -1700px;
}

.ui-12.type-2:active {
	background-position: -100px -1700px;
}

.ui-12.type-3 {
	background-position: -20px -1760px;
}

.ui-12.type-3:hover {
	background-position: -60px -1760px;
}

.ui-12.type-3:active {
	background-position: -100px -1760px;
}

.ui-12.type-4 {
	background-position: -20px -1820px;
}

.ui-12.type-4:hover {
	background-position: -60px -1820px;
}

.ui-12.type-4:active {
	background-position: -100px -1820px;
}

.ui-12.type-5 {
	background-position: -20px -1880px;
}

.ui-12.type-5:hover {
	background-position: -60px -1880px;
}

.ui-12.type-5:active {
	background-position: -100px -1880px;
}

.ui-12.type-6 {
	background-position: -20px -1940px;
}

.ui-12.type-6:hover {
	background-position: -60px -1940px;
}

.ui-12.type-6:active {
	background-position: -100px -1940px;
}

.ui-13 {
	display: inline-block;
	width: 93px;
	height: 57px;
	text-align: center;
}

.ui-13.type-1 {
	background-position: -20px -2000px;
}

.ui-13.type-1:hover {
	background-position: -120px -2000px;
}

.ui-13.type-1:active {
	background-position: -220px -2000px;
}

.ui-13.type-2 {
	background-position: -20px -2080px;
}

.ui-13.type-2:hover {
	background-position: -120px -2080px;
}

.ui-13.type-2:active {
	background-position: -220px -2080px;
}

.ui-14 {
	display: inline-block;
	width: 59px;
	height: 57px;
	text-align: center;
}

.ui-14.type-1 {
	background-position: -20px -2160px;
}

.ui-14.type-1:hover {
	background-position: -100px -2160px;
}

.ui-14.type-1:active {
	background-position: -180px -2160px;
}

.ui-14.type-2 {
	background-position: -20px -2240px;
}

.ui-14.type-2:hover {
	background-position: -100px -2240px;
}

.ui-14.type-2:active {
	background-position: -180px -2240px;
}

.ui-15 {
	display: inline-block;
	width: 14px;
	height: 6px;
	text-align: center;
}

.ui-15.type-1 {
	background-position: -20px -2340px;
}

.ui-15.type-1:hover {
	background-position: -40px -2340px;
}

.ui-15.type-1.selected {
	width: 25px;
	background-position: -60px -2340px;
}

.ui-15.type-2 {
	width: 37px;
	height: 14px;
	background-position: -98px -2338px;
}

.ui-15.type-2:hover {
	background-position: -135px -2338px;
}

.ui-15.type-2.selected {
	width: 45px;
	height: 18px;
	background-position: -172px -2334px;
}

.ui-16 {
	display: inline-block;
	width: 6px;
	height: 14px;
	text-align: center;
}

.ui-16.type-1 {
	background-position: -20px -2380px;
}

.ui-16.type-1:hover {
	background-position: -40px -2380px;
}

.ui-16.type-1.selected,
.ui-16.type-1.is-active {
	height: 25px;
	background-position: -60px -2380px;
}

.ui-16.type-2 {
	background-position: -100px -2380px;
}

.ui-16.type-2:hover {
	background-position: -120px -2380px;
}

.ui-16.type-2.selected {
	height: 25px;
	background-position: -140px -2380px;
}

.ui-17 + label,
.ui-18 + label {
	cursor: pointer;
}

.ui-17:not(checked),
.ui-18:not(checked) {
	position: absolute;
	opacity: 0;
}

.ui-17:not(checked) + label,
.ui-18:not(checked) + label {
	position: relative;
	padding-left: 22px;
	vertical-align: middle;
}

.ui-17 + label::before,
.ui-18 + label::before {
	background-image: url("/local/templates/dw/assets/css/../images/sprite.svg");
}

.ui-17:not(checked) + label::before,
.ui-18:not(checked) + label::before {
	position: absolute;
	top: 1px;
	left: 0;
	width: 15px;
	height: 15px;
	content: " ";
}

.ui-19 {
	display: inline-block;
	width: 150px;
	height: 150px;
	text-align: center;
}

.ui-19.type-1 {
	background-position: -20px -2560px;
}

.ui-19.type-1:hover {
	background-position: -180px -2560px;
}

.ui-19.type-1:active {
	background-position: -340px -2560px;
}

.ui-19.type-2 {
	background-position: -20px -2720px;
}

.ui-19.type-2:hover {
	background-position: -180px -2720px;
}

.ui-19.type-2:active {
	background-position: -340px -2720px;
}

.ui-19.type-3 {
	background-position: -20px -2880px;
}

.ui-19.type-3:hover {
	background-position: -180px -2880px;
}

.ui-19.type-3:active {
	background-position: -340px -2880px;
}

.ui-20 {
	display: inline-block;
	width: 50px;
	height: 50px;
	text-align: center;
}

.ui-20.type-1 {
	background-position: -20px -3040px;
}

.ui-20.type-1:hover {
	background-position: -80px -3040px;
}

.ui-20.type-1:active {
	background-position: -140px -3040px;
}

.ui-20.type-2 {
	background-position: -200px -3040px;
}

.ui-20.type-2:hover {
	background-position: -260px -3040px;
}

.ui-20.type-2:active {
	background-position: -320px -3040px;
}

.ui-20.type-3 {
	background-position: -380px -3040px;
}

.ui-20.type-3:hover {
	background-position: -440px -3040px;
}

.ui-20.type-3:active {
	background-position: -500px -3040px;
}

.ui-21 {
	display: inline-block;
	width: 20px;
	height: 20px;
	text-align: center;
}

.ui-21.type-1 {
	background-position: -20px -3120px;
}

.ui-21.type-2 {
	background-position: -60px -3120px;
}

.ui-21.type-3 {
	width: 17px;
	height: 15px;
	background-position: -100px -3120px;
}

.ui-21.type-5 {
	width: 19px;
	height: 19px;
	background-position: -195px -3120px;
}

.ui-21.type-6 {
	width: 26px;
	height: 18px;
	background-position: -238px -3120px;
}

.ui-21.type-7 {
	width: 15px;
	height: 15px;
	background-position: -280px -3120px;
}

.ui-21.type-8 {
	width: 19px;
	height: 11px;
	background-position: -320px -3120px;
}

.ui-21.type-9 {
	width: 15px;
	height: 15px;
	background-position: -360px -3120px;
}

.ui-21.type-10 {
	width: 11px;
	height: 16px;
	background-position: -404px -3120px;
}

.ui-21.type-11 {
	width: 11px;
	height: 11px;
	background-position: -444px -3120px;
}

.ui-21.type-12 {
	width: 12px;
	height: 6px;
	background-position: -484px -3120px;
}

.ui-21.type-13 {
	width: 16px;
	height: 16px;
	background-position: -522px -3120px;
}

.ui-21.type-14 {
	width: 8px;
	height: 12px;
	background-position: -566px -3120px;
}

.ui-21.type-15 {
	background-position: -600px -3120px;
}

.ui-22 {
	display: inline-block;
	width: 80px;
	height: 80px;
	text-align: center;
}

.ui-22.type-1 {
	background-position: -20px -3160px;
}

.ui-22.type-2 {
	background-position: -120px -3160px;
}

.ui-23 {
	display: inline-block;
	width: 20px;
	height: 20px;
	text-align: center;
}

.ui-23.type-1 {
	background-position: -20px -3260px;
}

.ui-23.type-2 {
	background-position: -60px -3260px;
}

.ui-23.type-2:hover {
	background-position: -60px -3300px;
}

.ui-23.type-2:active {
	background-position: -60px -3340px;
}

.ui-23.type-3 {
	background-position: -100px -3260px;
}

.ui-23.type-3:hover {
	background-position: -100px -3300px;
}

.ui-23.type-3:active {
	background-position: -100px -3340px;
}

.ui-23.type-4 {
	width: 28px;
	height: 28px;
	background-position: -140px -3260px;
}

.ui-23.type-4:hover {
	background-position: -140px -3300px;
}

.ui-23.type-4:active {
	background-position: -140px -3340px;
}

.ui-23.type-5 {
	width: 28px;
	height: 28px;
	background-position: -188px -3260px;
}

.ui-23.type-5:hover {
	background-position: -188px -3300px;
}

.ui-23.type-5:active {
	background-position: -188px -3340px;
}

.ui-24 {
	display: inline-block;
	width: 22px;
	height: 25px;
	text-align: center;
}

.ui-24.type-1 {
	background-position: -20px -3380px;
}

.ui-24.type-1:hover {
	background-position: -60px -3380px;
}

.ui-24.type-1:active {
	background-position: -100px -3380px;
}

.ui-25 {
	display: inline-block;
	width: 28px;
	height: 28px;
	text-align: center;
}

.ui-25.type-1 {
	background-position: -140px -3116px;
}

.ui-26 {
	display: inline-block;
	width: 24px;
	height: 24px;
	text-align: center;
}

.ui-26.type-1 {
	background-position: -20px -3420px;
}

/* End */


/* Start:/local/templates/dw/assets/css/parts/1.css?17690164362127*/
.block-parts-1-items {
	margin: 0 -12px;
}

.block-parts-1-item {
	box-sizing: border-box;
	height: 380px;
	padding: 0 12px;
	line-height: 380px;
}

.block-parts-1-item-full-height {
	box-shadow: 0 0 10px 0 rgb(0 0 0 / 10%);
}

.block-parts-1-item-container {
	display: inline-block;
	box-sizing: border-box;
	padding: 30px;
	line-height: 21px;
	vertical-align: middle;
}

.block-parts-1-item-picture {
	margin-bottom: 12px;
}

.block-parts-1-item-heading {
	margin-bottom: 12px;
}

@media screen and (max-width: 1650px) {
	.block-parts-1-item {
		height: 340px;
		line-height: 340px;
	}
}

@media screen and (max-width: 1425px) {
	.block-parts-1-item {
		height: 320px;
		line-height: 320px;
	}

	.block-parts-1-item-container {
		padding: 24px;
	}

	.block-parts-1-item-heading h4 {
		font-size: 20px;
		line-height: 22px;
	}
}

@media screen and (max-width: 1250px) {
	.block-parts-1-item-container {
		line-height: 18px;
	}

	.block-parts-1-item-full-height {
		box-sizing: border-box;
		border: 1px solid rgb(0 0 0 / 10%);
		box-shadow: none;
	}

	.block-parts-1-item {
		width: 35%;
		height: 270px;
		line-height: 270px;
		white-space: normal;
	}

	.block-parts-1-container {
		position: relative;
		height: 274px;
		overflow: hidden;
	}

	.block-parts-1-items {
		height: 330px;
		overflow: auto;
		white-space: nowrap;
	}

	.block-parts-1-item:last-child {
		position: relative;
		z-index: 2;
	}
}

@media screen and (max-width: 1000px) {
	.block-parts-1-item {
		width: 40%;
	}
}

@media screen and (max-width: 760px) {
	.block-parts-1-item-container {
		padding: 12px;
	}

	.block-parts-1-item {
		width: 70%;
		margin-top: 0;
	}

	.block-parts-1-item-picture {
		margin-bottom: 6px;
	}

	.block-parts-1-item-heading h4 {
		font-size: 18px;
		line-height: 20px;
	}

	.block-parts-1-item-heading {
		margin-bottom: 6px;
	}

	.block-parts-1-item {
		padding: 0 6px;
	}

	.block-parts-1-items {
		margin: 0 -6px;
	}
}

@media screen and (max-width: 460px) {
	.block-parts-1-container {
		height: 310px;
	}

	.block-parts-1-items {
		height: 330px;
	}

	.block-parts-1-item {
		height: 300px;
		line-height: 300px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/parts/2.css?17690164091752*/
.block-parts-2-item {
	box-sizing: border-box;
	height: 200px;
	line-height: 200px;
	text-align: center;
	border-right: 1px dashed rgb(255 255 255 / 20%);
}

.block-parts-2-item-container {
	display: inline-block;
	box-sizing: border-box;
	padding: 24px 30px;
	line-height: 21px;
	vertical-align: middle;
}

.block-parts-2-item:first-child {
	border-left: 1px dashed rgb(255 255 255 / 20%);
}

.block-parts-2-item-picture {
	margin-bottom: 12px;
}

.block-parts-2-item-heading {
	margin-bottom: 6px;
}

@media screen and (max-width: 1650px) {
	.block-parts-2-item-container {
		padding: 12px 18px;
	}

	.block-parts-2-item-heading h4 {
		font-size: 16px;
		line-height: 18px;
	}
}

@media screen and (max-width: 1425px) {
	.block-parts-2-item,
	.block-parts-2-item:first-child {
		border: 0;
	}

	.block-parts-2-item-container {
		padding: 0 6px;
	}
}

@media screen and (max-width: 1250px) {
	.block-parts-2-item-container {
		padding: 0;
	}

	.block-parts-2-items {
		margin: 0 -30px;
	}

	.block-parts-2-item {
		width: 35%;
		height: 200px;
		padding: 0 30px;
		line-height: 200px;
		white-space: normal;
		text-align: left;
	}

	.block-parts-2-container {
		position: relative;
		height: 200px;
		overflow: hidden;
	}

	.block-parts-2-items {
		height: 230px;
		overflow: auto;
		white-space: nowrap;
	}

	.block-parts-2-item:last-child {
		position: relative;
		z-index: 2;
	}
}

@media screen and (max-width: 1000px) {
	.block-parts-2-item {
		width: 40%;
	}
}

@media screen and (max-width: 760px) {
	.block-parts-2-item {
		width: 70%;
		height: 200px;
		padding: 0 30px;
		line-height: 200px;
		white-space: normal;
		text-align: left;
	}
}

@media screen and (max-width: 460px) {
	.block-parts-2-item-container {
		vertical-align: top;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/parts/3.css?17690164011644*/
.block-parts-3-item {
	box-sizing: border-box;
	height: 200px;
	line-height: 200px;
	text-align: center;
}

@media screen and (width >= 1251px) {
	.block-parts-3-item:nth-child(5) {
		margin-left: 12.5%;
	}
}

.block-parts-3-item-container {
	display: inline-block;
	box-sizing: border-box;
	padding: 24px 30px;
	line-height: 21px;
	vertical-align: middle;
}

.block-parts-3-item-picture {
	margin-bottom: 12px;
}

.block-parts-3-item-heading {
	margin-bottom: 6px;
}

@media screen and (max-width: 1650px) {
	.block-parts-3-item-container {
		padding: 12px 18px;
	}

	.block-parts-3-item-heading h4 {
		font-size: 16px;
		line-height: 18px;
	}
}

@media screen and (max-width: 1425px) {
	.block-parts-3-item-container {
		padding: 0 6px;
	}
}

@media screen and (max-width: 1250px) {
	.block-parts-3-item-container {
		padding: 0;
	}

	.block-parts-3-items {
		margin: 0 -30px;
	}

	.block-parts-3-item {
		width: 35%;
		height: 200px;
		padding: 0 30px;
		line-height: 200px;
		white-space: normal;
		text-align: left;
	}

	.block-parts-3-container {
		position: relative;
		height: 200px;
		overflow: hidden;
	}

	.block-parts-3-items {
		height: 230px;
		overflow: auto;
		white-space: nowrap;
	}

	.block-parts-3-item:last-child {
		position: relative;
		z-index: 2;
	}
}

@media screen and (max-width: 1000px) {
	.block-parts-3-item {
		width: 40%;
	}
}

@media screen and (max-width: 760px) {
	.block-parts-3-item {
		width: 70%;
		height: 200px;
		padding: 0 30px;
		line-height: 200px;
		white-space: normal;
		text-align: left;
	}
}

@media screen and (max-width: 460px) {
	.block-parts-3-item-container {
		vertical-align: top;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/parts/4.css?17690164012082*/
.block-parts-4-item {
	box-sizing: border-box;
	height: 100px;
	line-height: 100px;
	border-right: 1px dashed rgb(0 0 0 / 20%);
}

.block-parts-4-item:first-child {
	border-left: 1px dashed rgb(0 0 0 / 20%);
}

.block-parts-4-item-full-height {
	display: inline-block;
	box-sizing: border-box;
	padding: 0;
	line-height: 21px;
	text-align: center;
	vertical-align: middle;
}

.block-parts-4-item-container {
	display: table;
	width: 70%;
	margin: 0 auto;
	table-layout: fixed;
	border: 0;
	border-collapse: collapse;
}

.block-parts-4-item-picture,
.block-parts-4-item-text {
	display: table-cell;
	vertical-align: middle;
}

.block-parts-4-item-picture {
	width: 48px;
	padding-right: 12px;
	text-align: left;
}

.block-parts-4-item-picture img {
	display: inline-block;
	max-width: 100%;
	vertical-align: middle;
}

.block-parts-4-item-text {
	text-align: left;
}

@media screen and (max-width: 1650px) {
	.block-parts-4-item-container {
		width: 80%;
	}
}

@media screen and (max-width: 1425px) {
	.block-parts-4-item,
	.block-parts-4-item:first-child {
		border: 0;
	}

	.block-parts-4-item-container {
		padding: 0 6px;
	}
}

@media screen and (max-width: 1250px) {
	.block-parts-4-item-container {
		width: 100%;
		padding: 0;
	}

	.block-parts-4-items {
		margin: 0 -30px;
	}

	.block-parts-4-item {
		width: 35%;
		height: 160px;
		padding: 0 30px;
		line-height: 160px;
		white-space: normal;
		text-align: left;
	}

	.block-parts-4-container {
		position: relative;
		height: 160px;
		overflow: hidden;
	}

	.block-parts-4-items {
		height: 200px;
		overflow: auto;
		white-space: nowrap;
	}

	.block-parts-4-item:last-child {
		position: relative;
		z-index: 2;
	}

	.block-parts-4-item-picture {
		margin-bottom: 12px;
	}
}

@media screen and (max-width: 1000px) {
	.block-parts-4-item {
		width: 40%;
	}

	.block-parts-4-item-picture,
	.block-parts-4-item-text {
		display: block;
	}
}

@media screen and (max-width: 760px) {
	.block-parts-4-item {
		width: 70%;
		height: 130px;
		padding: 0 30px;
		line-height: 130px;
		white-space: normal;
		text-align: left;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/parts/5.css?17690164372049*/
.block-parts-5-item {
	box-sizing: border-box;
	height: 100px;
	line-height: 100px;
	border-right: 1px dashed rgb(255 255 255 / 20%);
}

.block-parts-5-item.black {
	border-right: 1px dashed rgb(0 0 0 / 20%);
}

.block-parts-5-item:first-child {
	border-left: 1px dashed rgb(255 255 255 / 20%);
}

.block-parts-5-item.black:first-child {
	border-left: 1px dashed rgb(0 0 0 / 20%);
}

.block-parts-5-item-full-height {
	display: inline-block;
	box-sizing: border-box;
	padding: 0;
	line-height: 21px;
	text-align: center;
	vertical-align: middle;
}

.block-parts-5-item-container {
	display: table;
	width: 90%;
	margin: 0 auto;
	table-layout: fixed;
	border: 0;
	border-collapse: collapse;
}

.block-parts-5-item-text {
	display: table-cell;
	vertical-align: middle;
}

.block-parts-5-item-title {
	margin-bottom: 6px;
}

@media screen and (max-width: 1425px) {
	.block-parts-5-item-container {
		width: 70%;
	}

	.block-parts-5-item,
	.block-parts-5-item:first-child,
	.block-parts-5-item.black,
	.block-parts-5-item.black:first-child {
		border: 0;
	}

	.block-parts-5-item-container {
		padding: 0 6px;
	}

	.block-parts-5-item-title {
		font-size: 30px;
	}
}

@media screen and (max-width: 1250px) {
	.block-parts-5-item-container {
		width: 100%;
		padding: 0;
		text-align: left;
	}

	.block-parts-5-items {
		margin: 0 -30px;
	}

	.block-parts-5-item {
		width: 35%;
		height: 120px;
		padding: 0 30px;
		line-height: 120px;
		white-space: normal;
		text-align: left;
	}

	.block-parts-5-container {
		position: relative;
		height: 120px;
		overflow: hidden;
	}

	.block-parts-5-items {
		height: 140px;
		overflow-x: auto;
		white-space: nowrap;
	}

	.block-parts-5-item:last-child {
		position: relative;
		z-index: 2;
	}
}

@media screen and (max-width: 1000px) {
	.block-parts-5-item {
		width: 40%;
	}

	.block-parts-5-item-text {
		display: block;
	}
}

@media screen and (max-width: 760px) {
	.block-parts-5-item {
		width: 70%;
		height: 120px;
		padding: 0 30px;
		line-height: 120px;
		white-space: normal;
		text-align: left;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/parts/6.css?17690164351968*/
.block-parts-6-item {
	box-sizing: border-box;
	height: 100px;
	padding-right: 48px;
	line-height: 100px;
}

.block-parts-6-item-full-height {
	display: inline-block;
	box-sizing: border-box;
	padding: 0;
	line-height: 21px;
	text-align: left;
	vertical-align: middle;
}

.block-parts-6-item-container {
	display: table;
	width: 100%;
	margin: 0 auto;
	table-layout: fixed;
	border: 0;
	border-collapse: collapse;
}

.block-parts-6-item-picture,
.block-parts-6-item-text {
	display: table-cell;
	vertical-align: middle;
}

.block-parts-6-item-picture {
	width: 48px;
	padding-right: 12px;
	text-align: left;
}

.block-parts-6-item-picture img {
	display: inline-block;
	vertical-align: middle;
}

.block-parts-6-item-text {
	text-align: left;
}

@media screen and (max-width: 1425px) {
	.block-parts-6-item,
	.block-parts-6-item:first-child {
		border: 0;
	}

	.block-parts-6-item-container {
		padding: 0 6px;
	}

	.block-parts-6-item {
		padding-right: 24px;
	}

	.block-parts-6-item-picture {
		width: 42px;
	}
}

@media screen and (max-width: 1250px) {
	.block-parts-6-item-container {
		width: 100%;
		padding: 0;
	}

	.block-parts-6-items {
		margin: 0 -30px;
	}

	.block-parts-6-item {
		width: 35%;
		height: 160px;
		padding: 0 30px;
		line-height: 160px;
		white-space: normal;
		text-align: left;
	}

	.block-parts-6-container {
		position: relative;
		height: 160px;
		overflow: hidden;
	}

	.block-parts-6-items {
		height: 200px;
		overflow: auto;
		white-space: nowrap;
	}

	.block-parts-6-item:last-child {
		position: relative;
		z-index: 2;
	}

	.block-parts-6-item-picture {
		margin-bottom: 12px;
	}
}

@media screen and (max-width: 1000px) {
	.block-parts-6-item {
		width: 40%;
	}

	.block-parts-6-item-picture,
	.block-parts-6-item-text {
		display: block;
	}
}

@media screen and (max-width: 760px) {
	.block-parts-6-item {
		width: 70%;
		height: 160px;
		padding: 0 30px;
		line-height: 160px;
		white-space: normal;
		text-align: left;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/parts/7.css?17690164011624*/
.block-parts-7-item {
	box-sizing: border-box;
	height: 100px;
	padding-right: 48px;
	line-height: 100px;
	text-align: left;
}

.block-parts-7-item-full-height {
	display: inline-block;
	box-sizing: border-box;
	padding: 0;
	line-height: 21px;
	vertical-align: middle;
}

.block-parts-7-item-container {
	display: table;
	width: 100%;
	margin: 0 auto;
	table-layout: fixed;
	border: 0;
	border-collapse: collapse;
}

.block-parts-7-item-picture {
	margin-bottom: 6px;
}

.block-parts-7-item-picture img {
	max-width: 100%;
}

@media screen and (max-width: 1425px) {
	.block-parts-7-item-container {
		padding: 0 6px;
	}

	.block-parts-7-item {
		padding-right: 24px;
	}
}

@media screen and (max-width: 1250px) {
	.block-parts-7-item-container {
		width: 100%;
		padding: 0;
	}

	.block-parts-7-items {
		margin: 0 -30px;
	}

	.block-parts-7-item {
		width: 35%;
		height: 160px;
		padding: 0 30px;
		line-height: 160px;
		white-space: normal;
		text-align: left;
	}

	.block-parts-7-container {
		position: relative;
		height: 160px;
		overflow: hidden;
	}

	.block-parts-7-items {
		height: 200px;
		overflow: auto;
		white-space: nowrap;
	}

	.block-parts-7-item:last-child {
		position: relative;
		z-index: 2;
	}

	.block-parts-7-item-picture,
	.block-parts-7-item-text {
		display: block;
	}

	.block-parts-7-item-picture {
		margin-bottom: 12px;
	}
}

@media screen and (max-width: 1000px) {
	.block-parts-7-item {
		width: 40%;
	}
}

@media screen and (max-width: 760px) {
	.block-parts-7-item {
		width: 70%;
		height: 160px;
		padding: 0 30px;
		line-height: 160px;
		white-space: normal;
		text-align: left;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/parts/8.css?17690164362147*/
.block-parts-8-item {
	box-sizing: border-box;
	height: 100px;
	padding-right: 48px;
	line-height: 100px;
	text-align: left;
}

.block-parts-8-item-full-height {
	display: inline-block;
	box-sizing: border-box;
	padding: 0;
	line-height: 21px;
	vertical-align: middle;
}

.block-parts-8-item-container {
	display: table;
	width: 100%;
	margin: 0 auto;
	table-layout: fixed;
	border: 0;
	border-collapse: collapse;
}

.block-parts-8-item-picture,
.block-parts-8-item-text {
	display: table-cell;
	vertical-align: middle;
}

.block-parts-8-item-picture {
	width: 48px;
	padding-right: 12px;
	text-align: left;
}

.block-parts-8-item-picture img {
	display: inline-block;
	max-width: 100%;
	vertical-align: middle;
}

@media screen and (max-width: 1650px) {
	.block-parts-8-item {
		padding-right: 36px;
	}
}

@media screen and (max-width: 1425px) {
	.block-parts-8-item-container {
		padding: 0 6px;
	}

	.block-parts-8-item {
		padding-right: 24px;
	}
}

@media (max-width: 1424px) and (width >= 1251px) {
	.block-parts-8-item-picture,
	.block-parts-8-item-text {
		display: block;
		width: 100%;
		padding: 0;
		text-align: center;
	}

	.block-parts-8-item-picture {
		margin-bottom: 12px;
	}
}

@media screen and (max-width: 1250px) {
	.block-parts-8-item-container {
		width: 100%;
		padding: 0;
	}

	.block-parts-8-items {
		margin: 0 -30px;
	}

	.block-parts-8-item {
		width: 27%;
		height: 160px;
		padding: 0 30px;
		line-height: 160px;
		white-space: normal;
		text-align: left;
	}

	.block-parts-8-container {
		position: relative;
		height: 160px;
		overflow: hidden;
	}

	.block-parts-8-items {
		height: 200px;
		overflow: auto;
		white-space: nowrap;
	}

	.block-parts-8-item:last-child {
		position: relative;
		z-index: 2;
	}

	.block-parts-8-item-picture {
		margin-bottom: 12px;
	}
}

@media screen and (max-width: 1000px) {
	.block-parts-8-item {
		width: 40%;
	}

	.block-parts-8-item-picture,
	.block-parts-8-item-text {
		display: block;
	}
}

@media screen and (max-width: 760px) {
	.block-parts-8-item {
		width: 70%;
		height: 160px;
		padding: 0 30px;
		line-height: 160px;
		white-space: normal;
		text-align: left;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/parts/9.css?17690164012280*/
.block-parts-9-item {
	box-sizing: border-box;
	height: 100px;
	padding-right: 48px;
	line-height: 100px;
	text-align: left;
}

.block-parts-9-item-full-height {
	display: inline-block;
	box-sizing: border-box;
	padding: 0;
	line-height: 21px;
	vertical-align: middle;
}

.block-parts-9-item-container {
	display: table;
	width: 100%;
	margin: 0 auto;
	table-layout: fixed;
	border: 0;
	border-collapse: collapse;
}

.block-parts-9-item-picture,
.block-parts-9-item-text {
	display: table-cell;
	vertical-align: middle;
}

.block-parts-9-item-title {
	line-height: 21px;
}

.block-parts-9-item-picture {
	width: 48px;
	padding-right: 12px;
	text-align: left;
}

.block-parts-9-item-picture img {
	display: inline-block;
	max-width: 100%;
	vertical-align: middle;
}

@media screen and (max-width: 1650px) {
	.block-parts-9-item {
		padding-right: 36px;
	}
}

@media screen and (max-width: 1425px) {
	.block-parts-9-item-container {
		padding: 0 6px;
	}

	.block-parts-9-item {
		padding-right: 24px;
	}
}

@media (max-width: 1424px) and (width >= 1251px) {
	.block-parts-9-item-picture,
	.block-parts-9-item-text {
		display: block;
		width: 100%;
		padding: 0;
		text-align: center;
	}

	.block-parts-9-item-picture {
		margin-bottom: 12px;
	}
}

@media screen and (max-width: 1250px) {
	.block-parts-9-item-container {
		width: 100%;
		padding: 0;
	}

	.block-parts-9-items {
		margin: 0 -30px;
	}

	.block-parts-9-item {
		width: 27%;
		height: 160px;
		padding: 0 30px;
		line-height: 160px;
		white-space: normal;
		text-align: left;
	}

	.block-parts-9-container {
		position: relative;
		height: 160px;
		overflow: hidden;
	}

	.block-parts-9-items {
		height: 200px;
		overflow: auto;
		white-space: nowrap;
	}

	.block-parts-9-item:last-child {
		position: relative;
		z-index: 2;
	}

	.block-parts-9-item-picture {
		margin-bottom: 12px;
	}
}

@media screen and (max-width: 1000px) {
	.block-parts-9-item {
		width: 40%;
	}

	.block-parts-9-item-picture,
	.block-parts-9-item-text {
		display: block;
	}
}

@media screen and (max-width: 760px) {
	.block-parts-9-item {
		width: 45%;
		height: 160px;
		padding: 0 30px;
		line-height: 160px;
		white-space: normal;
		text-align: left;
	}
}

@media screen and (max-width: 460px) {
	.block-parts-9-item {
		width: 60%;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/parts/11.css?17690164021782*/
.block-parts-11-item {
	box-sizing: border-box;
	height: 200px;
	padding-right: 48px;
	line-height: 200px;
	text-align: left;
}

.block-parts-11-item-full-height {
	display: inline-block;
	box-sizing: border-box;
	padding: 0;
	line-height: 21px;
	vertical-align: middle;
}

.block-parts-11-item-container {
	display: table;
	width: 100%;
	margin: 0 auto;
	table-layout: fixed;
	border: 0;
	border-collapse: collapse;
}

.block-parts-11-item-picture,
.block-parts-11-item-title {
	margin-bottom: 12px;
}

.block-parts-11-item-picture img {
	max-width: 100%;
}

@media screen and (max-width: 1425px) {
	.block-parts-11-item-container {
		padding: 0 6px;
	}

	.block-parts-11-item {
		padding-right: 24px;
	}
}

@media screen and (max-width: 1250px) {
	.block-parts-11-item-container {
		width: 100%;
		padding: 0;
	}

	.block-parts-11-items {
		margin: 0 -30px;
	}

	.block-parts-11-item {
		width: 35%;
		height: 200px;
		padding: 0 30px;
		line-height: 200px;
		white-space: normal;
		text-align: left;
	}

	.block-parts-11-container {
		position: relative;
		height: 200px;
		overflow: hidden;
	}

	.block-parts-11-items {
		height: 260px;
		overflow: auto;
		white-space: nowrap;
	}

	.block-parts-11-item:last-child {
		position: relative;
		z-index: 2;
	}

	.block-parts-11-item-picture,
	.block-parts-11-item-text {
		display: block;
	}

	.block-parts-11-item-picture,
	.block-parts-11-item-title {
		margin-bottom: 6px;
	}
}

@media screen and (max-width: 1000px) {
	.block-parts-11-item {
		width: 40%;
	}
}

@media screen and (max-width: 760px) {
	.block-parts-11-item {
		width: 60%;
		height: 200px;
		padding: 0 30px;
		line-height: 200px;
		white-space: normal;
		text-align: left;
	}
}

@media screen and (max-width: 460px) {
	.block-parts-11-item {
		width: 75%;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/parts/12.css?17690164021786*/
.block-parts-12-item {
	box-sizing: border-box;
	height: 200px;
	padding-right: 48px;
	line-height: 200px;
	text-align: center;
}

.block-parts-12-item-full-height {
	display: inline-block;
	box-sizing: border-box;
	padding: 0;
	line-height: 21px;
	vertical-align: middle;
}

.block-parts-12-item-container {
	display: table;
	width: 100%;
	margin: 0 auto;
	table-layout: fixed;
	border: 0;
	border-collapse: collapse;
}

.block-parts-12-item-picture,
.block-parts-12-item-title {
	margin-bottom: 12px;
}

.block-parts-12-item-picture img {
	max-width: 100%;
}

@media screen and (max-width: 1425px) {
	.block-parts-12-item-container {
		padding: 0 6px;
	}

	.block-parts-12-item {
		padding-right: 24px;
	}
}

@media screen and (max-width: 1250px) {
	.block-parts-12-item-container {
		width: 100%;
		padding: 0;
	}

	.block-parts-12-items {
		margin: 0 -30px;
	}

	.block-parts-12-item {
		width: 35%;
		height: 200px;
		padding: 0 30px;
		line-height: 200px;
		white-space: normal;
		text-align: left;
	}

	.block-parts-12-container {
		position: relative;
		height: 200px;
		overflow: hidden;
	}

	.block-parts-12-items {
		height: 260px;
		overflow: auto;
		white-space: nowrap;
	}

	.block-parts-12-item:last-child {
		position: relative;
		z-index: 2;
	}

	.block-parts-12-item-picture,
	.block-parts-12-item-text {
		display: block;
	}

	.block-parts-12-item-picture,
	.block-parts-12-item-title {
		margin-bottom: 6px;
	}
}

@media screen and (max-width: 1000px) {
	.block-parts-12-item {
		width: 40%;
	}
}

@media screen and (max-width: 760px) {
	.block-parts-12-item {
		width: 60%;
		height: 200px;
		padding: 0 30px;
		line-height: 200px;
		white-space: normal;
		text-align: center;
	}
}

@media screen and (max-width: 460px) {
	.block-parts-12-item {
		width: 75%;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/parts/13.css?17690164361814*/
.block-parts-13-item {
	box-sizing: border-box;
	height: 150px;
	padding-right: 48px;
	line-height: 150px;
	text-align: left;
}

.block-parts-13-item-full-height {
	display: inline-block;
	box-sizing: border-box;
	padding: 0;
	line-height: 21px;
	vertical-align: middle;
}

.block-parts-13-item-container {
	display: table;
	width: 100%;
	margin: 0 auto;
	table-layout: fixed;
	border: 0;
	border-collapse: collapse;
}

.block-parts-13-item-title {
	margin-bottom: 18px;
}

@media screen and (max-width: 1425px) {
	.block-parts-13-item-container {
		padding: 0 6px;
	}

	.block-parts-13-item {
		padding-right: 24px;
	}

	.block-parts-13-item-title {
		margin-bottom: 12px;
		font-size: 18px;
		line-height: 21px;
	}
}

@media (max-width: 1250px) {
	.block-parts-13-container {
		position: relative;
		height: 150px;
		overflow: hidden;
	}

	.block-parts-13-item-container {
		width: 100%;
		padding: 0;
	}

	.block-parts-13-items {
		height: 260px;
		margin: 0 -30px;
		overflow: auto;
		white-space: nowrap;
	}

	.block-parts-13-item {
		width: 35%;
		height: 150px;
		padding: 0 30px;
		line-height: 150px;
		white-space: normal;
		text-align: left;
	}

	.block-parts-13-item:nth-child(1),
	.block-parts-13-item:nth-child(2) {
		margin-top: 0;
	}

	.block-parts-13-item:nth-child(5) {
		display: none;
	}

	.block-parts-13-item:last-child {
		position: relative;
		z-index: 2;
	}

	.block-parts-13-item-container {
		width: 100%;
	}

	.block-parts-13-item-text {
		display: block;
	}

	.block-parts-13-item-title {
		margin-bottom: 12px;
	}
}

@media screen and (max-width: 1000px) {
	.block-parts-13-item {
		width: 40%;
	}
}

@media screen and (max-width: 760px) {
	.block-parts-13-item {
		width: 70%;
		height: 150px;
		padding: 0 30px;
		line-height: 150px;
		white-space: normal;
		text-align: left;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/parts/14.css?17690164371971*/
.block-parts-14-item {
	box-sizing: border-box;
	height: 150px;
	line-height: 150px;
	text-align: center;
	border-right: 1px dashed rgb(255 255 255 / 20%);
}

.block-parts-14-item:first-child {
	border-left: 1px dashed rgb(255 255 255 / 20%);
}

.block-parts-14-item-full-height {
	display: inline-block;
	box-sizing: border-box;
	padding: 0;
	line-height: 21px;
	vertical-align: middle;
}

.block-parts-14-item-container {
	display: table;
	width: 50%;
	margin: 0 auto;
	table-layout: fixed;
	border: 0;
	border-collapse: collapse;
}

.block-parts-14-item-title {
	margin-bottom: 18px;
}

@media screen and (max-width: 1425px) {
	.block-parts-14-item-container {
		padding: 0 6px;
	}

	.block-parts-14-item-title {
		margin-bottom: 12px;
		font-size: 18px;
		line-height: 21px;
	}

	.block-parts-14-item-container {
		width: 70%;
	}
}

@media (max-width: 1250px) {
	.block-parts-14-container {
		position: relative;
		width: 100%;
		height: 150px;
		overflow: hidden;
	}

	.block-parts-14-items {
		margin: 0 -12px;
	}

	.block-parts-14-item {
		width: 20%;
		height: 150px;
		padding: 0 12px;
		line-height: 150px;
		white-space: normal;
		border: 0;
	}

	.block-parts-14-item-container {
		width: 80%;
		margin: 0;
		padding: 0;
	}

	.block-parts-14-items {
		height: 180px;
		overflow: auto;
		white-space: nowrap;
	}

	.block-parts-14-item:first-child {
		border: 0;
	}

	.block-parts-14-item:last-child {
		position: relative;
		z-index: 2;
	}

	.block-parts-14-item-text {
		display: block;
	}

	.block-parts-14-item-title {
		margin-bottom: 12px;
	}
}

@media screen and (max-width: 1000px) {
	.block-parts-14-item {
		width: 25%;
	}
}

@media screen and (max-width: 760px) {
	.block-parts-14-item {
		width: 35%;
		height: 150px;
		padding: 0 30px;
		line-height: 150px;
		white-space: normal;
	}

	.block-parts-14-item-container {
		width: 100%;
		margin: 0;
		padding: 0;
	}
}

@media screen and (max-width: 460px) {
	.block-parts-14-item {
		width: 45%;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/parts/15.css?17690164171709*/
.block-parts-15-item {
	box-sizing: border-box;
	height: 200px;
	line-height: 200px;
	text-align: left;
}

.block-parts-15-item-container {
	display: inline-block;
	box-sizing: border-box;
	padding: 24px 30px;
	line-height: 21px;
	vertical-align: middle;
}

.block-parts-15-item-picture {
	margin-bottom: 12px;
}

.block-parts-15-item-picture img {
	padding-right: 60px;
	background-image: url("/local/templates/dw/assets/css/parts/service-images/15.png");
	background-repeat: no-repeat;
	background-position: 100% 50%;
}

.block-parts-15-item-heading {
	margin-bottom: 6px;
}

@media screen and (max-width: 1650px) {
	.block-parts-15-item-container {
		padding: 12px 18px;
	}

	.block-parts-15-item-heading h4 {
		font-size: 16px;
		line-height: 18px;
	}
}

@media screen and (max-width: 1425px) {
	.block-parts-15-item-container {
		padding: 0 6px;
	}
}

@media screen and (max-width: 1250px) {
	.block-parts-15-item-container {
		padding: 0;
	}

	.block-parts-15-items {
		margin: 0 -30px;
	}

	.block-parts-15-item {
		width: 35%;
		height: 200px;
		padding: 0 30px;
		line-height: 200px;
		white-space: normal;
		text-align: left;
	}

	.block-parts-15-container {
		position: relative;
		height: 200px;
		overflow: hidden;
	}

	.block-parts-15-items {
		height: 230px;
		overflow: auto;
		white-space: nowrap;
	}

	.block-parts-15-item:last-child {
		position: relative;
		z-index: 2;
	}
}

@media screen and (max-width: 1000px) {
	.block-parts-15-item {
		width: 40%;
	}
}

@media screen and (max-width: 760px) {
	.block-parts-15-item {
		width: 60%;
		height: 200px;
		padding: 0 30px;
		line-height: 200px;
		white-space: normal;
		text-align: left;
	}
}

@media screen and (max-width: 460px) {
	.block-parts-15-item {
		width: 75%;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block9.css?17690162723773*/
.block-type-9 {
	background-repeat: no-repeat;
	background-position: 50% 50%;
	background-size: cover;
}

.block-type-9 .block-heading {
	width: 900px;
}

.block-type-9 .block-info-column-picture img {
	max-width: 100%;
	max-height: 100%;
}

.block-type-9 .block-info-buttons {
	line-height: normal;
}

.block-type-9 .info-left-button,
.block-type-9 .info-right-button {
	display: inline-block;
	vertical-align: middle;
}

.block-type-9 .block-info-title {
	display: none;
}

@media screen and (max-width: 1650px) {
	.block-type-9 {
		padding-top: 60px;
	}

	.block-type-9 .block-heading {
		font-size: 50px;
		line-height: 50px;
	}

	.block-type-9 .block-info-column-picture {
		margin-top: 84px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-9 {
		background: radial-gradient(circle closest-corner at 75% 20%, #0096e6, #0459d3) !important;
	}

	.block-type-9 .block-info-columns {
		position: relative;
	}

	.block-type-9 .block-info-column:first-child {
		padding-bottom: 200px;
	}

	.block-type-9 .block-info-container {
		padding-bottom: 48px;
	}

	.block-type-9 .block-info-list {
		position: absolute;
		bottom: 0;
		width: 100%;
	}

	.block-type-9 .block-heading {
		width: 100%;
		font-size: 34px;
		line-height: 34px;
	}

	.block-type-9 .block-info-column-picture {
		margin-top: 0;
		text-align: right;
	}

	.block-type-9 .block-adv-container {
		margin-top: 0;
		padding-top: 12px;
		padding-bottom: 12px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-9 .block-info-column:first-child {
		padding-bottom: 0;
	}

	.block-type-9 .block-heading {
		font-size: 28px;
		line-height: 28px;
	}

	.block-type-9 .block-info-list {
		position: relative;
		bottom: auto;
		width: 100%;
	}
}

@media screen and (max-width: 760px) {
	.block-type-9 {
		padding-top: 36px;
	}

	.block-type-9 .block-heading {
		width: 100%;
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-9 .block-adv-container {
		margin-top: 24px;
		padding-top: 0;
		padding-bottom: 0;
	}

	.block-type-9 .block-description {
		margin-top: 12px;
		font-size: 14px;
		line-height: 18px;
	}

	.block-type-9 .block-info-list {
		margin-top: 6px;
	}

	.block-type-9 .block-info-list-item {
		margin-bottom: 0;
	}

	.block-type-9 .snippet-type-1 .snippet-line {
		margin-top: 12px;
	}

	.block-type-9 .block-info-buttons {
		margin-top: 24px;
	}

	.block-type-9 .block-info-column-picture {
		margin-top: 12px;
	}

	.block-type-9 .block-info-container {
		padding-bottom: 0;
	}

	.block-type-9 .block-parts-7-item {
		margin-top: 0;
	}

	.block-type-9 .block-parts-7-item:nth-child(4) {
		margin-left: 0;
	}
}

@media screen and (width >= 461px) {
	.block-type-9 .block-info-list {
		display: block !important;
	}
}

@media screen and (max-width: 460px) {
	.block-type-9 .info-right-button {
		margin-top: 12px;
	}

	.block-type-9 .block-info-buttons {
		margin-top: 12px;
	}

	.block-type-9 .block-info-title {
		position: relative;
		display: block;
		width: 106px;
		margin-top: 12px;
		padding: 12px 24px;
		color: #0265dc;
		font-weight: bold;
		font-size: 14px;
		background-color: #ffffff;
		border-radius: 25px;
		box-shadow: 0 0 25px rgb(0 0 0 / 10%);
		cursor: pointer;
	}

	.block-type-9 .block-info-title .sprite {
		position: absolute;
		top: 30%;
		right: 12px;
		display: block;
	}

	.block-type-9 .block-info-title.opened .sprite {
		background-position: -340px -200px;
	}

	.block-type-9 .block-info-list {
		margin-bottom: 24px;
		margin-left: 12px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-9 .block-info-title {
		width: auto;
	}

	.block-type-9 .info-left-button,
	.block-type-9 .info-right-button {
		width: 100%;
	}

	.block-type-9 .info-left-button .button,
	.block-type-9 .info-right-button .button {
		width: 100%;
		padding: 0;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block10.css?17690162854058*/
.block-type-10 {
	background-repeat: no-repeat;
	background-position: 50% 50%;
	background-size: cover;
}

.block-type-10 .block-info-picture-container {
	position: relative;
	height: 460px;
}

.block-type-10 .block-info-column-picture {
	position: absolute;
	right: 0;
	width: 1100px;
	text-align: right;
}

.block-type-10 .block-info-column-picture img {
	max-width: 100%;
	max-height: 100%;
	vertical-align: middle;
}

@media screen and (max-width: 1650px) {
	.block-type-10 {
		padding-top: 60px;
	}

	.block-type-10 .block-heading {
		font-size: 50px;
		line-height: 50px;
	}

	.block-type-10 .block-info-column-picture img {
		max-width: 80%;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-10 .block-info-column-picture {
		margin-top: 84px;
	}

	.block-type-10 .block-info-column-picture img {
		max-width: 70%;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-10 .block-info-picture-container {
		position: relative;
		height: 260px;
	}

	.block-type-10 .block-info-columns {
		position: relative;
	}

	.block-type-10 .block-info-column:first-child {
		padding-bottom: 80px;
	}

	.block-type-10 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-10 .block-sub-heading {
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-10 .block-info-list {
		position: absolute;
		bottom: 0;
		width: 100%;
	}

	.block-type-10 .snippet-type-2 .snippet-line {
		display: inline-block;
		width: 23%;
		margin-top: 0;
		padding-left: 12px;
	}

	.block-type-10 .snippet-type-2 .snippet-line:first-child {
		padding-left: 0;
	}

	.block-type-10 .snippet-type-2 .snippet-line-icon {
		vertical-align: top;
	}

	.block-type-10 .block-info-column-picture {
		position: relative;
		width: auto;
		margin-top: 0;
	}

	.block-type-10 .block-info-column-picture img {
		max-width: 100%;
	}

	.block-type-10 .block-description,
	.block-type-10 .block-info-button {
		margin-top: 12px;
	}

	.block-type-10 .block-adv-container {
		margin-top: 0;
		padding-top: 12px;
		padding-bottom: 12px;
	}

	.block-type-10 .block-adv-container .block-parts-11-item {
		width: 40%;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-10 .block-info-columns {
		position: relative;
		padding-bottom: 100px;
	}

	.block-type-10 .block-info-column:first-child {
		position: relative;
		padding-bottom: 132px;
	}

	.block-type-10 .block-info-picture-container {
		height: 220px;
	}

	.block-type-10 .block-info-button .button {
		height: 42px;
		padding: 0 24px;
		line-height: 42px;
		border-radius: 40px / 40px;
	}

	.block-type-10 .block-info-column-picture {
		position: absolute;
	}

	.block-type-10 .block-info-list {
		bottom: 24px;
	}

	.block-type-10 .snippet-type-2 .snippet-line {
		width: 48%;
		margin-top: 24px;
		padding-left: 0;
		vertical-align: top;
	}

	.block-type-10 .snippet-type-2 .snippet-line:nth-child(2n) {
		padding-left: 12px;
	}
}

@media screen and (max-width: 760px) {
	.block-type-10 {
		padding-top: 36px;
	}

	.block-type-10 .block-info-columns {
		padding-bottom: 0;
	}

	.block-type-10 .block-info-column:first-child {
		padding-bottom: 192px;
	}

	.block-type-10 .block-heading {
		width: 100%;
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-10 .snippet-type-2 .snippet-line {
		width: 100%;
		padding-left: 0;
	}

	.block-type-10 .snippet-type-2 .snippet-line:nth-child(2n) {
		padding-left: 0;
	}

	.block-type-10 .block-sub-heading {
		font-size: 20px;
		line-height: 20px;
	}

	.block-type-10 .block-adv-container {
		padding-top: 36px;
		padding-bottom: 36px;
	}

	.block-type-10 .block-parts-11-item {
		margin-top: 0;
	}

	.block-type-10 .block-parts-11-item:nth-child(4) {
		margin-left: 0;
	}

	.block-type-10 .block-adv-container .block-parts-11-item {
		width: 70%;
	}
}

@media screen and (max-width: 460px) {
	.block-type-10 .block-info-column:first-child {
		padding-bottom: 230px;
	}

	.block-type-10 .block-info-picture-container {
		height: 170px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-10 .block-info-column:first-child {
		padding-bottom: 260px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block11.css?17690164034003*/
.block-type-11 {
	background-repeat: no-repeat;
	background-position: 50% 50%;
	background-size: cover;
}

.block-type-11 .block-info-picture-container {
	position: relative;
	height: 460px;
}

.block-type-11 .block-info-column-picture {
	position: absolute;
	right: 0;
	width: 1100px;
	text-align: right;
}

.block-type-11 .block-info-column-picture img {
	max-width: 100%;
	max-height: 100%;
	vertical-align: middle;
}

.block-type-11 .block-info-buttons {
	line-height: normal;
}

.block-type-11 .info-left-button,
.block-type-11 .info-right-button {
	display: inline-block;
	vertical-align: middle;
}

@media screen and (max-width: 1650px) {
	.block-type-11 {
		padding-top: 60px;
	}

	.block-type-11 .block-heading {
		font-size: 50px;
		line-height: 50px;
	}

	.block-type-11 .block-info-column-picture img {
		max-width: 60%;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-11 .block-info-column-picture {
		margin-top: 84px;
	}

	.block-type-11 .block-info-column-picture img {
		max-width: 50%;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-11 .block-info-picture-container {
		height: 590px;
	}

	.block-type-11 .block-info-column-picture {
		margin-top: 0;
	}

	.block-type-11 .block-info-column-picture img {
		max-width: 100%;
	}

	.block-type-11 .block-info-columns {
		position: relative;
	}

	.block-type-11 .block-info-column:first-child {
		padding-bottom: 80px;
	}

	.block-type-11 .block-info-list {
		position: absolute;
		bottom: 0;
		width: 100%;
	}

	.block-type-11 .snippet-type-2 .snippet-line {
		display: inline-block;
		width: 23%;
		margin-top: 0;
		padding-left: 12px;
	}

	.block-type-11 .snippet-type-2 .snippet-line:first-child {
		padding-left: 0;
	}

	.block-type-11 .snippet-type-2 .snippet-line-icon {
		vertical-align: top;
	}

	.block-type-11 .block-adv-container {
		margin-top: 0;
		padding-top: 12px;
		padding-bottom: 24px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-11 .block-info-picture-container {
		height: 500px;
		line-height: 500px;
		vertical-align: middle;
	}

	.block-type-11 .block-info-column-picture {
		width: auto;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-11 .block-heading {
		font-size: 32px;
		line-height: 32px;
	}

	.block-type-11 .block-info-columns {
		position: relative;
		padding-bottom: 132px;
	}

	.block-type-11 .block-info-column:first-child {
		padding-bottom: 0;
	}

	.block-type-11 .block-info-picture-container {
		height: 440px;
		line-height: 440px;
	}

	.block-type-11 .block-info-column-picture {
		text-align: center;
	}

	.block-type-11 .block-info-column-picture img {
		max-width: 70%;
	}

	.block-type-11 .block-info-list {
		bottom: 72px;
	}

	.block-type-11 .block-info-buttons {
		position: absolute;
		bottom: 0;
		width: 100%;
	}

	.block-type-11 .snippet-type-2 .snippet-line {
		width: 48%;
		margin-top: 24px;
		padding-left: 0;
		vertical-align: top;
	}

	.block-type-11 .snippet-type-2 .snippet-line:nth-child(2n) {
		padding-left: 12px;
	}
}

@media screen and (max-width: 760px) {
	.block-type-11 {
		padding-top: 36px;
	}

	.block-type-11 .block-info-picture-container {
		height: 320px;
		line-height: 320px;
	}

	.block-type-11 .block-heading {
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-11 .block-info-column-picture img {
		max-width: 100%;
	}

	.block-type-11 .block-info-list {
		display: none;
	}

	.block-type-11 .snippet-type-2 .snippet-line {
		width: 100%;
		padding-left: 0;
	}

	.block-type-11 .snippet-type-2 .snippet-line:nth-child(2n) {
		padding-left: 0;
	}

	.block-type-11 .block-description {
		margin-top: 12px;
	}

	.block-type-11 .info-right-button {
		margin-top: 24px;
	}

	.block-type-11 .block-adv-container {
		padding-top: 12px;
		padding-bottom: 24px;
	}

	.block-type-11 .info-left-button {
		width: 100%;
		margin-right: 0;
	}

	.block-type-11 .type-table-link span {
		font-size: 13px;
	}
}

@media screen and (max-width: 450px) {
	.block-type-11 .block-info-columns {
		padding-bottom: 24px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block12.css?17690163012528*/
.block-type-12 {
	background-repeat: no-repeat;
	background-position: 50% 50%;
	background-size: cover;
}

.block-type-12 .block-info-text-container {
	position: relative;
	z-index: 2;
	vertical-align: middle;
}

.block-type-12 .block-heading {
	position: relative;
	width: 800px;
}

.block-type-12 .block-info-picture-container {
	position: relative;
	height: 660px;
	vertical-align: middle;
}

.block-type-12 .block-info-column-picture {
	position: absolute;
	right: 0;
	width: 1100px;
	text-align: right;
}

.block-type-12 .block-info-column-picture img {
	max-width: 100%;
	max-height: 100%;
	vertical-align: middle;
}

.block-type-12 .block-info-buttons {
	line-height: normal;
}

.block-type-12 .info-left-button,
.block-type-12 .info-right-button {
	display: inline-block;
	vertical-align: middle;
}

@media screen and (max-width: 1650px) {
	.block-type-12 {
		padding-top: 48px;
		padding-bottom: 48px;
	}

	.block-type-12 .block-heading {
		margin-top: 0;
		font-size: 46px;
		line-height: 46px;
	}

	.block-type-12 .block-info-column-picture {
		width: auto;
	}

	.block-type-12 .block-info-column-picture img {
		max-width: 85%;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-12 .block-info-column-picture {
		bottom: 100px;
	}

	.block-type-12 .block-info-column-picture img {
		max-width: 80%;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-12 .block-info-picture-container {
		height: 520px;
	}

	.block-type-12 .block-sub-heading {
		font-size: 32px;
		line-height: 32px;
	}

	.block-type-12 .block-heading {
		width: 100%;
		margin-top: 12px;
		font-size: 32px;
		line-height: 32px;
	}

	.block-type-12 .block-sub-heading {
		height: 28px;
		line-height: 28px;
	}

	.block-type-12 .block-description {
		margin-top: 12px;
	}

	.block-type-12 .block-info-button {
		margin-top: 12px;
	}

	.block-type-12 .block-info-column-picture {
		width: auto;
	}

	.block-type-12 .block-info-column-picture img {
		max-width: 100%;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-12 {
		padding-top: 36px;
		padding-bottom: 36px;
	}

	.block-type-12 .block-info-picture-container {
		display: none;
	}

	.block-type-12 .block-heading {
		width: 100%;
	}

	.block-type-12 .block-info-button .button {
		height: 42px;
		padding: 0 24px;
		line-height: 42px;
		border-radius: 40px / 40px;
	}
}

@media screen and (max-width: 760px) {
	.block-type-12 .block-sub-heading {
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-12 .block-heading {
		font-size: 24px;
		line-height: 24px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block13.css?17690164012618*/
.block-type-13 {
	background-repeat: no-repeat;
	background-position: 50% 0;
	background-size: cover;
}

.block-type-13 .block-info-text-container {
	position: relative;
	z-index: 2;
	vertical-align: middle;
}

.block-type-13 .block-heading {
	position: relative;
	width: 800px;
}

.block-type-13 .block-info-picture-container {
	position: relative;
	height: 660px;
	vertical-align: middle;
}

.block-type-13 .block-info-column-picture {
	position: absolute;
	right: 0;
	width: 1100px;
	text-align: right;
}

.block-type-13 .block-info-column-picture img {
	max-width: 100%;
	max-height: 100%;
	vertical-align: middle;
}

.block-type-13 .block-info-buttons {
	line-height: normal;
}

.block-type-13 .info-left-button,
.block-type-13 .info-right-button {
	display: inline-block;
	vertical-align: middle;
}

@media screen and (max-width: 1650px) {
	.block-type-13 {
		padding-top: 60px;
	}

	.block-type-13 .block-heading {
		margin-top: 0;
	}
}

@media (max-width: 1250px) and (width >= 1001px) {
	.block-type-13 .block-parts-1-item-full-height {
		background: #ffffff;
	}

	.block-type-13 .block-parts-1-item:nth-child(3) .block-parts-1-item-full-height,
	.block-type-13 .block-parts-1-item:nth-last-child(3) .block-parts-1-item-full-height {
		background-color: #00213a;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-13 {
		padding-top: 48px;
	}

	.block-type-13 .block-sub-heading {
		font-size: 32px;
		line-height: 32px;
	}

	.block-type-13 .block-heading {
		width: 100%;
		margin-top: 12px;
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-13 .block-parts-1-item {
		margin-top: 0;
	}

	.block-type-13 .block-description {
		margin-top: 12px;
	}

	.block-type-13 .block-adv-container {
		margin-top: 0;
		padding-top: 24px;
		padding-bottom: 48px;
	}

	.block-type-13 .block-parts-1-item:nth-child(4),
	.block-type-13 .block-parts-1-item:nth-last-child(4) {
		display: none;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-13 .block-info-button,
	.block-type-13 .block-text {
		margin-top: 12px;
	}

	.block-type-13 .block-info-button .button {
		height: 42px;
		padding: 0 24px;
		line-height: 42px;
		border-radius: 40px / 40px;
	}

	.block-parts-1-container {
		height: 310px;
	}

	.block-type-13 .block-parts-1-items {
		height: 340px;
	}

	.block-type-13 .block-parts-1-item {
		height: 310px;
		line-height: 310px;
	}
}

@media screen and (max-width: 760px) {
	.block-type-13 {
		padding-top: 36px;
	}

	.block-type-13 .block-heading {
		font-size: 24px;
		line-height: 24px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-13 {
		background-position: 60% 0;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block14.css?17690162892773*/
.block-type-14 {
	background-repeat: no-repeat;
	background-position: 50% 50%;
	background-size: cover;
}

.block-type-14 .block-info-text-container {
	position: relative;
	z-index: 2;
	vertical-align: middle;
}

.block-type-14 .block-heading {
	position: relative;
	width: 800px;
}

.block-type-14 .block-info-picture-container {
	position: relative;
	height: 570px;
	vertical-align: middle;
}

.block-type-14 .block-info-column-picture {
	position: absolute;
	right: 0;
	width: 1100px;
	text-align: right;
}

.block-type-14 .block-info-column-picture img {
	max-width: 100%;
	max-height: 100%;
	vertical-align: middle;
}

.block-type-14 .block-info-buttons {
	line-height: normal;
}

.block-type-14 .info-left-button,
.block-type-14 .info-right-button {
	display: inline-block;
	vertical-align: middle;
}

@media screen and (max-width: 1650px) {
	.block-type-14 {
		padding-top: 60px;
	}

	.block-type-14 .block-heading {
		margin-top: 0;
	}

	.block-type-14 .block-info-column-picture img {
		max-width: 60%;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-14 .block-info-column-picture img {
		max-width: 50%;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-14 .block-info-picture-container {
		height: 430px;
	}

	.block-type-14 .block-sub-adv {
		display: none;
	}

	.block-type-14 .block-info-column-picture {
		width: auto;
	}

	.block-type-14 .block-info-column-picture img {
		max-width: 100%;
	}

	.block-type-14 .block-sub-heading {
		font-size: 32px;
		line-height: 32px;
	}

	.block-type-14 .block-heading {
		width: 100%;
		margin-top: 12px;
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-14 .block-description {
		margin-top: 12px;
	}

	.block-type-14 .block-adv-container {
		margin-top: 0;
		padding-top: 0;
		padding-bottom: 48px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-14 .block-heading {
		font-size: 28px;
		line-height: 28px;
	}

	.block-type-14 .block-info-button {
		margin-top: 12px;
	}

	.block-type-14 .block-info-button .button {
		height: 42px;
		padding: 0 24px;
		line-height: 42px;
		border-radius: 40px / 40px;
	}

	.block-type-14 .block-info-column-picture img {
		max-width: 85%;
	}
}

@media screen and (max-width: 760px) {
	.block-type-14 {
		padding-top: 24px;
	}

	.block-type-14 .block-heading {
		width: 100%;
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-14 .block-info-picture-container {
		height: 350px;
		line-height: 350px;
	}

	.block-type-14 .block-info-picture-container img {
		max-width: 100%;
	}

	.block-type-14 .block-adv-container {
		padding-bottom: 12px;
	}

	.block-type-14 .block-parts-6-item {
		margin-top: 0;
	}
}

@media screen and (max-width: 460px) {
	.block-type-14 .block-info-picture-container {
		height: 320px;
		line-height: 320px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block15.css?17690164982660*/
.block-type-15 {
	background-repeat: no-repeat;
	background-position: 50% 50%;
	background-size: cover;
}

.block-type-15 .block-info-text-container {
	position: relative;
	z-index: 2;
	vertical-align: middle;
}

.block-type-15 .block-heading {
	position: relative;
	width: 800px;
}

.block-type-15 .block-info-picture-container {
	position: relative;
	height: 550px;
	vertical-align: middle;
}

.block-type-15 .block-info-column-picture {
	position: absolute;
	right: 0;
	width: 1100px;
	text-align: right;
}

.block-type-15 .block-info-column-picture img {
	max-width: 100%;
	max-height: 100%;
	vertical-align: middle;
}

.block-type-15 .block-info-buttons {
	line-height: normal;
}

.block-type-15 .info-left-button,
.block-type-15 .info-right-button {
	display: inline-block;
	vertical-align: middle;
}

@media screen and (max-width: 1650px) {
	.block-type-15 {
		padding-top: 60px;
		padding-bottom: 60px;
	}

	.block-type-15 .block-heading {
		margin-top: 0;
	}

	.block-type-15 .block-info-column-picture img {
		max-width: 70%;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-15 .block-info-column-picture img {
		max-width: 40%;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-15 .block-info-picture-container {
		display: none;
	}

	.block-type-15 .block-heading {
		width: 100%;
		margin-top: 12px;
		font-size: 34px;
		line-height: 34px;
	}

	.block-type-15 .block-description {
		margin-top: 12px;
	}

	.block-type-15 .block-info-column-picture img {
		max-width: 33%;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-15 .block-heading {
		font-size: 28px;
		line-height: 28px;
	}

	.block-type-15 .sub-info-container {
		margin-top: 24px;
	}

	.block-type-15 .block-info-button,
	.block-type-15 .snippet-type-4 {
		margin-top: 12px;
	}

	.block-type-15 .block-info-button .button {
		height: 42px;
		padding: 0 24px;
		line-height: 42px;
		border-radius: 40px / 40px;
	}
}

@media screen and (max-width: 760px) {
	.block-type-15 {
		padding-top: 24px;
		padding-bottom: 0;
	}

	.block-type-15 .block-heading {
		width: 100%;
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-15 .block-parts-8-container {
		position: relative;
		height: 130px;
		overflow: hidden;
	}

	.block-type-15 .snippet-type-4 .snippet-line-icon {
		display: none;
	}

	.block-type-15 .block-parts-8-container .block-parts-8-items {
		height: 200px;
		overflow: auto;
		white-space: nowrap;
	}

	.block-type-15 .block-parts-8-container .block-parts-8-items .block-parts-8-item {
		margin-top: 0;
	}

	.block-type-15
		.block-parts-8-container
		.block-parts-8-items
		.block-parts-8-item:not(:first-child) {
		margin-left: 48px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block3.css?17690164977002*/
.block-type-3 {
	position: relative;
	padding-bottom: 92px;
}

.block-type-3 .block-content-container {
	position: relative;
	height: 610px;
}

.block-type-3 .slider-container,
.block-type-3 .dw-fast-slider {
	position: relative;
}

.block-type-3 .block-type-3-items,
.block-type-3 .slider-container,
.block-type-3 .middle-wrapper,
.block-type-3 .dw-fast-slider {
	height: 100%;
}

.block-type-3 .block-type-3-items {
	display: table;
	width: 100%;
}

.block-type-3 .block-type-3-item:first-child {
	position: relative;
	overflow: hidden;
}

.block-type-3 .block-type-3-item {
	display: table-cell;
	vertical-align: middle;
}

.block-type-3 .dw-fast-slider {
	position: relative;
	z-index: 2;
}

.block-type-3 .block-heading-container {
	padding: 60px 0;
	text-align: center;
}

.block-type-3 .block-description {
	max-width: 1000px;
	margin-right: auto;
	margin-left: auto;
}

.block-type-3 .item-heading .item-no-limit {
	width: 500px;
}

.block-type-3 .item-text {
	padding-right: 120px;
}

.block-type-3 .empty-container {
	width: 0;
	height: 0;
}

.block-type-3 .dw-fast-slider .block-type-3-switchers {
	position: relative;
}

.block-type-3 .item-list-row:first-child {
	border-top: 2px dashed rgb(0 0 0 / 10%);
}

.block-type-3 .item-list-row {
	padding: 36px 0;
	text-align: center;
	border-bottom: 2px dashed rgb(0 0 0 / 10%);
}

.block-type-3 .second-dots-item {
	cursor: pointer;
}

.block-type-3 .item-list-row .snippet-type-3 {
	display: inline-block;
	padding: 0 60px;
	text-align: left;
	vertical-align: middle;
}

.block-type-3 .selected .snippet-line-text {
	font-weight: 600;
}

.block-type-3 .slider-bottom-button,
.block-type-3 .slider-top-button {
	position: absolute;
	left: 50%;
	transform: translate(-50%, 0%);
}

.block-type-3 .slider-bottom-button {
	bottom: -26px;
}

.block-type-3 .slider-top-button {
	top: -26px;
}

.block-type-3 .block-content-container .background-figure {
	position: absolute;
	top: 0;
	right: 0;
	z-index: 0;
	width: 45vw;
	height: 100%;
	margin: auto;
}

.block-type-3 .block-content-container .background-substrate {
	position: absolute;
	top: 0;
	left: 50%;
	z-index: 1;
	width: 900px;
	height: 100%;
	border-top-left-radius: 750px;
	border-bottom-left-radius: 750px;
	transform: translate(-320px, 0%);
	-moz-border-radius-topleft: 750px;
	-moz-border-radius-bottomleft: 750px;
}

.block-type-3 .block-content-container .background-round {
	position: absolute;
	top: 50%;
	left: 36px;
	z-index: 2;
	width: 40%;
	height: 350px;
	border: 100px solid #ffffff;
	border-radius: 50%;
	transform: translate(0%, -50%);
}

.block-type-3 .item-image-container {
	position: absolute;
	top: 50%;
	left: 50%;
	z-index: 4;
	transform: translate(-50%, -50%);
}

.block-type-3 .pager {
	display: none;
}

@media screen and (max-width: 1650px) {
	.block-type-3 .block-content-container {
		height: 560px;
	}

	.block-type-3 .block-content-container .background-substrate {
		transform: translate(-314px, 0%);
	}

	.block-type-3 .block-content-container .background-round {
		width: 34%;
		height: 300px;
	}

	.block-type-3 .item-image-container img {
		max-width: 560px;
	}

	.block-type-3 .item-list-row .snippet-type-3 {
		padding: 0 24px;
	}
}

@media screen and (max-width: 1450px) {
	.block-type-3 .block-content-container {
		height: 460px;
	}

	.block-type-3 .item-heading .item-no-limit {
		width: 400px;
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-3 .item-text {
		padding-right: 70px;
	}

	.block-type-3 .block-content-container .background-substrate {
		width: 700px;
		transform: translate(-245px, 0%);
	}

	.block-type-3 .block-content-container .background-round {
		width: 30%;
		height: 210px;
	}

	.block-type-3 .item-image-container img {
		max-width: 460px;
	}

	.block-type-3 .item-list-row {
		padding: 24px 0;
	}

	.block-type-3 .item-list-row .snippet-type-3 {
		padding: 0 12px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-3 {
		padding-bottom: 80px;
		overflow: hidden;
	}

	.block-type-3 .block-content-container {
		height: 370px;
	}

	.block-type-3 .block-heading {
		font-size: 40px;
		line-height: 40px;
	}

	.block-type-3 .block-description {
		max-width: 750px;
	}

	.block-type-3 .item-heading .item-no-limit {
		width: 440px;
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-3 .block-heading-container {
		padding: 48px 0;
	}

	.block-type-3 .dw-fast-slider .block-type-3-switchers {
		display: none;
	}

	.block-type-3 .block-content-container .background-substrate {
		left: 0;
		width: 100%;
		transform: translate(45%, 0%);
	}

	.block-type-3 .block-content-container .background-figure {
		display: none;
	}

	.block-type-3 .block-content-container .background-round {
		width: 11%;
		height: 120px;
	}

	.block-type-3 .item-image-container img {
		max-width: 370px;
	}

	.block-type-3 .block-description {
		margin-top: 12px;
		font-size: 14px;
		line-height: 18px;
	}

	.block-type-3 .item-text {
		padding-right: 92px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-3 {
		padding-bottom: 50px;
	}

	.block-type-3 .block-content-container .background-substrate {
		transform: translate(50%, 0%);
	}

	.block-type-3 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-3 .block-heading-container {
		padding-top: 32px;
		padding-bottom: 32px;
	}
}

@media screen and (max-width: 760px) {
	.block-type-3 {
		padding: 24px 0;
	}

	.block-type-3 .block-heading-container {
		height: 200px;
		padding: 0;
		line-height: 200px;
		text-align: left;
	}

	.block-type-3 .block-heading {
		position: relative;
		z-index: 2;
		display: inline-block;
		width: 50%;
		font-size: 30px;
		line-height: 30px;
		text-align: left;
		vertical-align: middle;
	}

	.block-type-3 .block-content-container {
		position: static;
		height: auto;
	}

	.block-type-3 .item-heading .item-no-limit {
		width: auto;
		font-size: 18px;
		line-height: 18px;
	}

	.block-type-3 .item-text,
	.block-type-3 .item-button {
		margin-top: 12px;
		padding-right: 0;
	}

	.block-type-3 .block-type-3-items,
	.block-type-3 .slider-container,
	.block-type-3 .middle-wrapper,
	.block-type-3 .dw-fast-slider {
		height: auto;
	}

	.block-type-3 .block-description {
		display: none;
	}

	.block-type-3 .dw-fast-slider {
		position: static;
		width: 100%;
		height: auto;
	}

	.block-type-3 .block-content-container .background-round {
		left: 12px;
		width: 8%;
		height: 60px;
		border: 60px solid #ffffff;
	}

	.block-type-3 .block-content-container .background-substrate {
		top: 24px;
		height: 200px;
	}

	.block-type-3 .item-image-container img {
		max-width: 155px;
	}

	.block-type-3 .block-type-3-items {
		padding-top: 24px;
	}

	.block-type-3 .block-type-3-item:first-child,
	.block-type-3 .block-type-3-items {
		display: block;
		width: 100%;
	}
}

@media screen and (max-width: 520px) {
	.block-type-3 .block-content-container .background-round {
		width: 12%;
	}
}

@media screen and (max-width: 400px) {
	.block-type-3 .block-content-container .background-round {
		width: 15%;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block4.css?17690164613842*/
.block-type-4 {
	background: url("/local/templates/dw/assets/css/blocks/images/block4/round.jpg") 50% 50% no-repeat transparent;
}

.block-type-4 .slider-container {
	position: relative;
	height: 100%;
	overflow: hidden;
}

.block-type-4 .dw-slider {
	position: relative;
	height: 960px;
}

.block-type-4 .dw-slider .dw-slide-box {
	display: table;
	height: 100%;
	margin: auto;
}

.block-type-4 .dw-slider .dw-slide-item {
	display: table-cell;
	float: none !important;
	vertical-align: middle;
}

.block-type-4 .block-type-4-item {
	vertical-align: middle;
}

.block-type-4 .block-type-4-item:last-child {
	margin-top: 12px;
}

.block-type-4 .item-heading {
	position: relative;
}

.block-type-4 .item-no-limit {
	position: relative;
	z-index: 1;
	width: 470px;
}

.block-type-4 .snippet-type-3 {
	margin-top: 24px;
}

.block-type-4 .item-text-container {
	height: 100%;
	text-align: center;
}

.block-type-4 .item-center-link a {
	line-height: normal;
}

.block-type-4 .item-center-icon img {
	max-width: 100%;
}

.block-type-4 .snippet-type-2 .snippet-line {
	margin-top: 18px;
}

.block-type-4 .snippet-type-2 .snippet-line:first-child {
	margin-top: 0;
}

@media screen and (max-width: 1650px) {
	.block-type-4 {
		background: url("/local/templates/dw/assets/css/blocks/images/block4/round-min.jpg") 50% 50% no-repeat transparent;
	}

	.block-type-4 .dw-slider {
		height: 850px;
	}

	.block-type-4 .block-type-4-item .large-bold {
		font-weight: bold;
		font-size: 48px;
		line-height: 40px;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-4 .dw-slider {
		height: 740px;
	}

	.block-type-4 .item-text-heading .wide-bold {
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-4 .block-type-4-item .large-bold {
		font-size: 42px;
		line-height: 38px;
	}

	.block-type-4 .item-text .default-light {
		line-height: 18px;
	}

	.block-type-4 .snippet-type-2 .snippet-line {
		margin-top: 12px;
	}

	.block-type-4 .snippet-type-2 .snippet-line:first-child {
		margin-top: 0;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-4 {
		background-image: none;
	}

	.block-type-4 .dw-slider {
		height: 600px;
	}

	.block-type-4 .block-type-4-items {
		position: relative;
	}

	.block-type-4 .item-text-column::after {
		position: absolute;
		top: 50%;
		right: 0;
		z-index: -1;
		width: 420px;
		height: 420px;
		background-color: #8eba10;
		border-radius: 210px;
		transform: translate(0%, -50%);
		content: "";
	}

	.block-type-4-items .block-type-4-item:last-child {
		display: none;
	}

	.block-type-4-items .block-type-4-item .item-text-container {
		padding-left: 60px;
	}

	.block-type-4 .dw-slider .buttons-container {
		bottom: 32px;
	}

	.block-type-4 .item-text .normal-light {
		font-size: 21px;
		line-height: 24px;
	}

	.block-type-4 .item-no-limit {
		width: 500px;
		font-size: 42px;
		line-height: 38px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-4 {
		padding: 48px 0;
		background-image: none;
	}

	.block-type-4 .dw-slider {
		height: auto;
	}

	.block-type-4 .item-text-column::after {
		width: 350px;
		height: 350px;
		border-radius: 175px;
	}

	.block-type-4-items .block-type-4-item .item-text-container {
		padding-left: 20px;
	}

	.block-type-4 .block-type-4-item .large-bold {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-4 .slider-container {
		overflow: visible;
	}

	.block-type-4 .item-center-link a {
		font-size: 28px;
		line-height: normal;
	}

	.block-type-4 .item-no-limit {
		width: 380px;
	}

	.block-type-4 .item-text .normal-light {
		font-size: 18px;
		line-height: 21px;
	}

	.block-type-4 .item-text {
		margin-top: 12px;
	}
}

@media screen and (max-width: 760px) {
	.block-type-4 {
		padding: 24px 0;
	}

	.block-type-4 .slider-container {
		overflow: hidden;
	}

	.block-type-4 .item-text-column {
		display: none;
	}
}

@media screen and (max-width: 460px) {
	.block-type-4 .item-center-link a {
		font-size: 24px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block5.css?17690163856067*/
.block-type-5 {
	position: relative;
	padding: 48px 0;
}

.block-type-5 .block-heading-container {
	margin-bottom: 48px;
	text-align: center;
}

.block-type-5 .block-image-container {
	display: none;
}

.block-type-5 .slider-container {
	position: relative;
	height: 100%;
	overflow: hidden;
}

.block-type-5 .dw-slider {
	position: relative;
}

.block-type-5 .dw-slider .dw-slide-box {
	display: table;
	height: 100%;
	margin: auto;
}

.block-type-5 .dw-slider .dw-slide-item {
	display: table-cell;
	float: none !important;
	vertical-align: middle;
}

.block-type-5 .block-type-5-item {
	vertical-align: middle;
}

.block-type-5 .item-image-container,
.block-type-5 .item-button {
	text-align: center;
}

.block-type-5 .block-type-5-item:last-child .item-line {
	text-align: right;
}

.block-type-5 .block-type-5-item:last-child .snippet-line-text {
	padding-right: 6px;
	padding-left: 0;
}

.block-type-5 .item-line:first-child {
	border-top: 2px dashed rgb(0 0 0 / 10%);
}

.block-type-5 .item-line {
	padding: 24px 0;
	border-bottom: 2px dashed rgb(0 0 0 / 10%);
}

@media screen and (max-width: 1650px) {
	.block-type-5 .item-image-container img {
		max-width: 90%;
		max-height: 90%;
	}

	.block-type-5 .snippet-type-3 .low-bold {
		font-size: 16px;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-5 .item-line:last-child,
	.block-type-5 .item-button {
		display: none;
	}

	.block-type-5 .block-heading-container {
		margin-bottom: 36px;
	}

	.block-type-5 .block-heading {
		font-size: 50px;
	}

	.block-type-5 .block-text {
		margin-top: 6px;
		font-size: 24px;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-5 .block-heading {
		font-size: 40px;
		line-height: 36px;
	}

	.block-type-5 .block-text {
		margin-top: 6px;
		font-size: 18px;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-5 {
		padding: 36px 0;
	}

	.block-type-5 .block-heading-container {
		margin-bottom: 24px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-5 {
		padding: 0 0 24px;
		background: none;
	}

	.block-type-5 .block-heading {
		font-size: 36px;
	}

	.block-type-5 .block-heading-background {
		padding: 24px 0;
		background-color: #eef1f5;
	}

	.block-type-5 .block-heading-background .middle-wrapper {
		font-size: 0;
		line-height: normal;
		letter-spacing: -0.36em;
	}

	.block-type-5 .block-heading-container {
		display: inline-block;
		width: 50%;
		margin-bottom: 0;
		text-align: left;
		vertical-align: middle;
	}

	.block-type-5 .block-heading-wrap {
		display: inline-block;
		line-height: normal;
		vertical-align: middle;
	}

	.block-type-5 .block-image-container {
		display: inline-block;
		width: 50%;
		text-align: center;
		vertical-align: middle;
	}

	.block-type-5 .block-image-container img {
		max-width: 100%;
		max-height: 100%;
	}

	.block-type-5 .block-type-5-item.item-image-column {
		display: none;
	}

	.block-type-5 .dw-slider,
	.block-type-5 .slider-container {
		position: static;
	}

	.block-type-5-item {
		box-sizing: border-box;
	}

	.block-type-5-item:first-child {
		border-right: 1px solid rgb(0 0 0 / 7%);
	}

	.block-type-5 .snippet-type-3 {
		height: 38px;
	}

	.block-type-5-item:first-child .item-line {
		padding-right: 24px;
	}

	.block-type-5-item:last-child .item-line {
		padding-left: 24px;
	}

	.block-type-5 .item-line:first-child {
		border-top: none;
	}

	.block-type-5 .item-line:nth-child(3) {
		border-bottom: none;
	}

	.block-type-5 .item-line {
		border-bottom: 1px solid rgb(0 0 0 / 7%);
	}

	.block-type-5 .item-text {
		color: #555c69;
	}
}

@media screen and (max-width: 760px) {
	.block-type-5 .block-heading {
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-5 .block-text {
		font-size: 14px;
		line-height: 18px;
	}

	.block-type-5 .block-type-5-item {
		height: 154px;
		overflow: hidden;
		border: 0;
	}

	.block-type-5 .block-type-5-item-wrap {
		height: 300px;
		overflow: auto;
		white-space: nowrap;
	}

	.block-type-5-item:last-child .item-line {
		padding-right: 24px;
		padding-left: 0;
	}

	.block-type-5 .item-line:last-child {
		display: inline-block;
	}

	.block-type-5 .block-type-5-item:last-child .item-line {
		text-align: left;
	}

	.block-type-5 .item-line {
		display: inline-block;
		width: 60%;
		padding: 24px 0;
		white-space: normal;
		text-align: left;
		vertical-align: top;
		border: 0;
	}

	.snippet-type-3 .snippet-line {
		position: relative;
	}

	.block-type-5 .block-type-5-item:last-child .snippet-line-icon {
		position: absolute;
		top: 50%;
		left: 0;
		transform: translate(0%, -50%);
	}

	.block-type-5 .block-type-5-item:last-child .snippet-line-text {
		height: 40px;
		padding-left: 48px;
	}

	.block-type-5 .block-image-container img {
		max-width: 80%;
	}
}

@media screen and (max-width: 460px) {
	.block-type-5 .item-line {
		width: 60%;
	}

	.block-type-5 .snippet-type-3 .low-bold {
		font-size: 16px;
		line-height: 18px;
	}

	.block-type-5 .block-heading {
		font-size: 21px;
		line-height: 21px;
	}

	.block-type-5 .block-text {
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-5 .snippet-type-3 .snippet-line-icon {
		display: none;
	}

	.block-type-5 .block-type-5-item:first-child .snippet-line-text {
		color: #8eba10;
	}

	.block-type-5 .block-type-5-item:last-child .snippet-line-text {
		color: #cc0949;
	}

	.block-type-5 .block-type-5-item:last-child .snippet-line-text,
	.block-type-5 .snippet-type-3 .snippet-line-text {
		padding-left: 0;
	}

	.block-type-5 .item-text {
		margin-top: 6px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-5 .item-line {
		width: 70%;
		padding: 18px 0;
	}

	.block-type-5-item:first-child .item-line {
		padding-right: 18px;
	}

	.block-type-5-item:last-child .item-line {
		padding-right: 18px;
	}

	.block-type-5 .snippet-type-3 .low-bold {
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-5 .block-text {
		font-weight: normal;
	}

	.block-type-5 .block-heading {
		font-size: 18px;
		line-height: 21px;
	}

	.block-type-5 .snippet-type-3 {
		height: 34px;
	}

	.block-type-5 .block-image-container img {
		max-width: 85%;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block6.css?17690163004055*/
.block-type-6 {
	background: url("/local/templates/dw/assets/css/blocks/images/block6/round.jpg") 50% 50% no-repeat transparent;
}

.block-type-6 .slider-container {
	position: relative;
	height: 100%;
	overflow: hidden;
}

.block-type-6 .dw-slider {
	position: relative;
	height: 800px;
}

.block-type-6 .dw-slider .dw-slide-box {
	display: table;
	height: 100%;
	margin: auto;
}

.block-type-6 .dw-slider .dw-slide-item {
	display: table-cell;
	float: none !important;
	vertical-align: middle;
}

.block-type-6 .block-type-6-item {
	vertical-align: middle;
}

.block-type-6 .item-heading {
	position: relative;
}

.block-type-6 .item-no-limit {
	position: relative;
	z-index: 1;
	width: 600px;
}

.block-type-6 .item-image-container {
	height: 100%;
	text-align: center;
}

.block-type-6 .item-image-container img {
	display: inline-block;
	max-width: 100%;
	max-height: 100%;
	vertical-align: middle;
}

.block-type-6 .block-image-container {
	display: none;
}

@media screen and (max-width: 1650px) and (width >= 1251px) {
	.block-type-6 .item-image-container img {
		max-width: 90%;
		max-height: 90%;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-6 {
		background: url("/local/templates/dw/assets/css/blocks/images/block6/round-min.jpg") 50% 50% no-repeat transparent !important;
	}

	.block-type-6 .dw-slider {
		height: 740px;
	}

	.block-type-6 .item-no-limit {
		width: 440px;
		font-size: 40px;
		line-height: 36px;
	}

	.block-type-6 .item-image-container img {
		max-width: 95%;
		max-height: 95%;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-6 {
		background-image: none !important;
	}

	.block-type-6 .dw-slider {
		height: 640px;
	}

	.block-type-6 .item-image-container {
		position: relative;
		text-align: right;
	}

	.block-type-6 .item-image-container::after {
		position: absolute;
		top: 0;
		right: -60px;
		z-index: -1;
		width: 600px;
		height: 600px;
		background: url("/local/templates/dw/assets/css/blocks/images/block6/round-min.jpg") bottom 50% right 0 no-repeat transparent !important;
		content: "";
	}

	.block-type-6-items .block-type-6-item:last-child {
		display: none;
	}

	.block-type-6 .item-text .normal-light {
		font-size: 21px;
		line-height: 24px;
	}

	.block-type-6 .item-no-limit {
		width: 540px;
		font-size: 42px;
		line-height: 38px;
	}

	.block-type-6 .item-image-container img {
		max-width: 80%;
		max-height: 80%;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-6 {
		padding: 24px 0;
	}

	.block-type-6 .dw-slider {
		height: auto;
	}

	.block-type-6 .item-no-limit {
		width: 350px;
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-6 .item-text .normal-light {
		font-size: 18px;
		line-height: 21px;
	}

	.block-type-6 .item-text,
	.block-type-6 .snippet-type-2 {
		margin-top: 12px;
	}

	.block-type-6 .item-buttons {
		margin-top: 12px;
	}

	.block-type-6 .item-image-container img {
		max-width: 95%;
		max-height: 95%;
	}

	.block-type-6 .item-image-container::after {
		top: -48px;
		width: 500px;
		height: 500px;
		background-position: top 0% right 0 !important;
		background-size: contain !important;
	}
}

@media screen and (max-width: 760px) {
	.block-type-6 .dw-slider .dw-slide-item {
		position: relative;
	}

	.block-type-6 .item-image-container::after,
	.block-type-6 .item-image-container {
		display: none;
	}

	.block-type-6 .item-no-limit {
		width: auto;
		font-size: 28px;
		line-height: 30px;
	}

	.block-type-6 .item-heading {
		width: 60%;
	}

	.block-type-6 .block-image-container {
		width: 40%;
		text-align: center;
	}

	.block-type-6 .block-heading-container {
		font-size: 0;
		line-height: normal;
		letter-spacing: -0.36em;
	}

	.block-type-6 .block-image-container,
	.block-type-6 .item-heading {
		display: inline-block;
		vertical-align: middle;
	}

	.block-type-6 .block-image-container img {
		max-width: 100%;
		max-height: 100%;
		vertical-align: middle;
	}
}

@media screen and (max-width: 460px) {
	.block-type-6 .item-no-limit {
		min-width: 200px;
		font-size: 20px;
		line-height: 24px;
	}

	.block-type-6 .item-heading {
		width: 50%;
	}

	.block-type-6 .block-image-container {
		width: 50%;
		text-align: center;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block7.css?17690163014373*/
.block-type-7 {
	background: url("/local/templates/dw/assets/css/blocks/images/block7/round.jpg") 50% 50% no-repeat transparent;
}

.block-type-7 .slider-container {
	position: relative;
	height: 100%;
	overflow: hidden;
}

.block-type-7 .dw-slider {
	position: relative;
	height: 800px;
}

.block-type-7 .dw-slider .dw-slide-box {
	display: table;
	height: 100%;
	margin: auto;
}

.block-type-7 .dw-slider .dw-slide-item {
	display: table-cell;
	float: none !important;
	vertical-align: middle;
}

.block-type-7 .block-type-7-item {
	vertical-align: middle;
}

.block-type-7 .item-heading {
	position: relative;
}

.block-type-7 .item-no-limit {
	position: relative;
	z-index: 1;
	width: 640px;
}

.block-type-7 .item-image-container {
	height: 100%;
	text-align: center;
}

.block-type-7 .item-image-container img {
	display: inline-block;
	max-width: 100%;
	max-height: 100%;
	vertical-align: middle;
}

.block-type-7 .item-image-container .item-video {
	position: absolute;
	top: 50%;
	left: 50%;
	transform: translate(-50%, -50%);
}

.block-type-7 .block-image-container {
	display: none;
}

@media screen and (max-width: 1650px) {
	.block-type-7 .item-no-limit {
		width: 600px;
	}
}

@media screen and (max-width: 1650px) and (width >= 1251px) {
	.block-type-7 .item-image-container img {
		max-width: 90%;
		max-height: 90%;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-7 {
		background: url("/local/templates/dw/assets/css/blocks/images/block7/round-min.jpg") 50% 50% no-repeat transparent;
	}

	.block-type-7 .dw-slider {
		height: 740px;
	}

	.block-type-7 .item-no-limit {
		width: 440px;
		font-size: 40px;
		line-height: 36px;
	}

	.block-type-7 .item-image-container img {
		max-width: 95%;
		max-height: 95%;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-7 {
		background-image: none;
	}

	.block-type-7 .dw-slider {
		height: 640px;
	}

	.block-type-7 .item-image-container {
		position: relative;
		text-align: center;
	}

	.block-type-7 .item-image-container::after {
		position: absolute;
		top: 50%;
		left: 50%;
		z-index: -1;
		width: 600px;
		height: 600px;
		background: url("/local/templates/dw/assets/css/blocks/images/block7/round-min.jpg") bottom 50% right 0 no-repeat transparent;
		transform: translate(-50%, -50%);
		content: "";
	}

	.block-type-7-items .block-type-7-item:last-child {
		display: none;
	}

	.block-type-7 .item-text .normal-light {
		font-size: 21px;
		line-height: 24px;
	}

	.block-type-7 .item-no-limit {
		width: 540px;
		font-size: 42px;
		line-height: 38px;
	}

	.block-type-7 .item-image-container img {
		max-width: 80%;
		max-height: 80%;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-7 {
		padding: 24px 0;
	}

	.block-type-7 .dw-slider {
		height: auto;
	}

	.block-type-7 .item-no-limit {
		width: 350px;
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-7 .item-text .normal-light {
		font-size: 18px;
		line-height: 21px;
	}

	.block-type-7 .item-text,
	.block-type-7 .snippet-type-2 {
		margin-top: 12px;
	}

	.block-type-7 .item-buttons {
		margin-top: 12px;
	}

	.block-type-7 .item-image-container img {
		max-width: 95%;
		max-height: 95%;
	}

	.block-type-7 .normal-light {
		margin-top: 12px;
		font-size: 18px;
		line-height: 21px;
	}

	.block-type-7 .item-image-container::after {
		width: 350px;
		height: 350px;

		/* background-position: top 0% right 0px; */
		background-size: contain;

		/* top: -48px; */
	}
}

@media screen and (max-width: 760px) {
	.block-type-7 .dw-slider .dw-slide-item {
		position: relative;
	}

	.block-type-7 .item-image-container::after,
	.block-type-7 .item-image-container {
		display: none;
	}

	.block-type-7 .item-no-limit {
		width: auto;
		font-size: 28px;
		line-height: 30px;
	}

	.block-type-7 .item-heading {
		width: 60%;
	}

	.block-type-7 .block-image-container {
		width: 40%;
		text-align: center;
	}

	.block-type-7 .block-heading-container {
		font-size: 0;
		line-height: normal;
		letter-spacing: -0.36em;
	}

	.block-type-7 .block-image-container,
	.block-type-7 .item-heading {
		display: inline-block;
		vertical-align: middle;
	}

	.block-type-7 .block-image-container img {
		max-width: 100%;
		max-height: 100%;
		vertical-align: middle;
	}
}

@media screen and (max-width: 460px) {
	.block-type-7 .item-no-limit {
		min-width: 200px;
		font-size: 20px;
		line-height: 24px;
	}

	.block-type-7 .item-heading {
		width: 50%;
	}

	.block-type-7 .block-image-container {
		width: 50%;
		text-align: center;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block16.css?17690163811850*/
.block-type-16 {
	background-color: #f5f5f5;
}

.block-type-16 .block-info-list-item {
	position: relative;
}

.block-type-16 .block-info-list-item:nth-child(1),
.block-type-16 .block-info-list-item:nth-child(2) {
	margin-top: 0;
	border-top: 1px solid #ffffff;
}

.block-type-16 .block-item-heading {
	position: relative;
	z-index: 1;
}

.block-type-16 .block-item-description {
	position: relative;
	z-index: 1;
}

.block-type-16 .block-item-container {
	position: relative;
	box-sizing: border-box;
	padding-left: 30px;
}

.block-type-16 .block-item-round {
	position: absolute;
	top: -2px;
	left: 0;
}

@media screen and (max-width: 1650px) {
	.block-type-16 .block-heading {
		font-size: 42px;
		line-height: 42px;
	}

	.block-type-16 .block-video-link img {
		width: 100%;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-16 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-16 .block-video {
		text-align: center;
	}

	.block-type-16 .block-video img {
		max-width: 100%;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-16 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-16 .block-item-heading {
		font-size: 16px;
		line-height: 20px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-16 {
		padding-top: 36px;
		padding-bottom: 36px;
	}

	.block-type-16 .block-heading {
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-16 .block-description {
		margin-top: 12px;
	}

	.block-type-16 .block-video {
		margin-top: 12px;
		margin-bottom: 12px;
	}

	.block-type-16 .block-video img {
		max-width: 70%;
	}

	.block-type-16 .block-info-list-item {
		padding-top: 24px;
		padding-bottom: 24px;
	}
}

@media screen and (max-width: 760px) {
}

@media screen and (max-width: 460px) {
	.block-type-16 .block-heading {
		font-size: 24px;
		line-height: 24px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block17.css?17690163003599*/
.block-type-17 {
	position: relative;
	background-repeat: no-repeat;
	background-position: center center;
	background-size: cover;
}

.block-type-17 .block-heading {
	max-width: 60%;
}

.block-type-17 .block-description {
	max-width: 80%;
}

.block-type-17 .block-info-list {
	margin: 0 -12px;
}

.block-type-17 .block-info-list-item {
	position: relative;
	box-sizing: border-box;
	height: 170px;
	margin-top: 24px;
	padding-right: 12px;
	padding-left: 12px;
	line-height: 170px;
}

.block-type-17 .block-info-list-item:nth-child(1),
.block-type-17 .block-info-list-item:nth-child(2) {
	margin-top: 0;
}

.block-type-17 .block-item-fixer {
	height: 100%;
}

.block-type-17 .block-item-container {
	display: inline-block;
	box-sizing: border-box;
	padding: 0 24px;
	line-height: 21px;
	vertical-align: middle;
}

.block-type-17 .block-item-heading {
	position: relative;
	z-index: 1;
}

.block-type-17 .block-item-description {
	position: relative;
	z-index: 1;
}

.block-type-17 .epilog-buttons {
	text-align: right;
}

.block-type-17 .block-epilog-column {
	vertical-align: middle;
}

@media screen and (max-width: 1650px) {
	.block-type-17 {
		padding-top: 48px;
	}

	.block-type-17 .block-heading {
		margin-bottom: 24px;
		font-size: 48px;
		line-height: 48px;
	}

	.block-type-17 .block-epilog-content {
		margin-top: 24px;
		padding-top: 36px;
		padding-bottom: 36px;
	}

	.block-type-17 .epilog-heading {
		margin-bottom: 12px;
	}

	.block-type-17 .block-info-list-item {
		margin-top: 12px;
		padding-right: 6px;
		padding-left: 6px;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-17 .block-heading {
		margin-bottom: 24px;
		font-size: 32px;
		line-height: 32px;
	}

	.block-type-17 .block-item-heading {
		font-size: 18px;
		line-height: 18px;
	}

	.block-type-17 .block-item-description {
		line-height: 18px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-17 .block-item-heading {
		font-size: 15px;
		line-height: 16px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-17 {
		padding-top: 36px;
		padding-bottom: 0;
	}

	.block-type-17 .block-epilog-content {
		padding-top: 24px;
		padding-bottom: 24px;
	}

	.block-type-17 .block-heading {
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-17 .block-info-list-item {
		height: 130px;
		line-height: 130px;
	}

	.block-type-17 .epilog-heading {
		margin-bottom: 12px;
		font-size: 20px;
		line-height: 20px;
	}

	.block-type-17 .epilog-description {
		margin-bottom: 12px;
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-17 .epilog-buttons {
		text-align: left;
	}

	.block-type-17 .epilog-buttons .button {
		height: 40px;
		padding: 0 40px;
		line-height: 40px;
		border-radius: 40px / 40px;
	}

	.block-type-17 .block-heading,
	.block-type-17 .block-description {
		max-width: 100%;
	}

	.block-type-17 .block-video {
		margin-top: 24px;
		margin-bottom: 24px;
		text-align: center;
	}

	.block-type-17 .block-video img {
		max-width: 70%;
	}
}

@media screen and (max-width: 760px) {
	.block-type-17 .block-info-list-item,
	.block-type-17 .block-info-list-item:nth-child(1),
	.block-type-17 .block-info-list-item:nth-child(2) {
		height: 130px;
		margin-top: 12px;
		line-height: 130px;
	}

	.block-type-17 .block-info-list-item:nth-child(1) {
		margin-top: 0;
	}

	.block-type-17 .block-heading {
		margin-bottom: 0;
	}

	.block-type-17 .block-description {
		margin-top: 12px;
	}

	.block-type-17 .block-video {
		margin-top: 12px;
		margin-bottom: 12px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-17 .block-heading {
		font-size: 24px;
		line-height: 24px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block20.css?17690161651503*/
.block-type-20 .block-info-column {
	vertical-align: middle;
}

.block-type-20 .block-info-column:last-child {
	box-sizing: border-box;
	padding-left: 24px;
}

@media screen and (max-width: 1650px) {
	.block-type-20 {
		padding-top: 72px;
		padding-bottom: 72px;
	}

	.block-type-20 .block-info-picture img {
		max-width: 90%;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-20 .block-heading {
		margin-bottom: 12px;
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-20 .block-sub-heading {
		margin-bottom: 12px;
		font-size: 26px;
		line-height: 26px;
	}

	.block-type-20 .block-info-picture img {
		width: 100%;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-20 {
		padding-top: 60px;
		padding-bottom: 60px;
	}

	.block-type-20 .block-heading {
		margin-top: 0;
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-20 .block-links,
	.block-type-20 .block-description {
		margin-top: 12px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-20 {
		padding-top: 36px;
		padding-bottom: 36px;
	}

	.block-type-20 .block-info-picture {
		display: none;
	}

	.block-type-20 .block-info-column:last-child {
		padding-left: 0;
	}
}

@media screen and (max-width: 760px) {
	.block-type-20 .block-heading {
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-20 .block-sub-heading {
		font-size: 18px;
		line-height: 18px;
	}

	.block-type-20 .block-parts-7-item {
		margin-top: 0;
	}

	.block-type-20 .block-parts-7-item:nth-child(4) {
		margin-left: 0;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block21.css?17690164991867*/
.block-type-21 .block-info-column {
	vertical-align: middle;
}

.block-type-21 .block-info-column:last-child {
	box-sizing: border-box;
	padding-left: 24px;
}

.block-type-21 .block-parts-10-item-container {
	line-height: 12px;
}

@media screen and (max-width: 1425px) {
	.block-type-21 .block-heading {
		margin-bottom: 12px;
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-21 .block-sub-heading {
		margin-bottom: 12px;
		font-size: 26px;
		line-height: 26px;
	}

	.block-type-21 .block-info-picture img {
		width: 100%;
	}

	.block-parts-10-items {
		margin: 0;
	}

	.block-type-21 .block-parts-10-item {
		padding: 0;
	}

	.block-type-21 .block-parts-10-item-picture,
	.block-type-21 .block-parts-10-item-text {
		display: table-cell;
		text-align: left;
		vertical-align: middle;
	}

	.block-type-21 .block-parts-10-item-picture {
		width: 32px;
		padding-right: 12px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-21 {
		padding-top: 60px;
		padding-bottom: 60px;
	}

	.block-type-21 .block-heading {
		margin-top: 0;
	}

	.block-type-21 .block-links,
	.block-type-21 .block-description {
		margin-top: 12px;
	}

	.block-type-21 .block-parts-10-item {
		width: 40%;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-21 {
		padding-top: 36px;
		padding-bottom: 36px;
	}

	.block-type-21 .block-heading {
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-21 .block-info-picture {
		display: none;
	}

	.block-type-21 .block-info-column:last-child {
		padding-left: 0;
	}

	.block-type-22 .first-slider-button-left,
	.block-type-22 .first-slider-button-right {
		display: none;
	}
}

@media screen and (max-width: 760px) {
	.block-type-21 .block-sub-heading {
		font-size: 18px;
		line-height: 18px;
	}

	.block-type-21 .block-info-buttons {
		text-align: center;
	}

	.block-type-21 .block-parts-10-item {
		width: 70%;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block23.css?17690164021659*/
.block-type-23 .block-info-column {
	vertical-align: middle;
}

.block-type-23 .block-info-picture {
	max-width: 100%;
	max-height: 100%;
	vertical-align: middle;
}

.block-type-23 .block-info-buttons .button:last-child {
	margin-left: 24px;
}

.block-type-23 .block-description {
	text-align: justify;
}

.block-type-23 .last-picture {
	text-align: right;
}

@media screen and (max-width: 1425px) {
	.block-type-23 .block-heading {
		margin-bottom: 12px;
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-23 .block-info-picture img {
		width: 90%;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-23 {
		padding-top: 60px;
		padding-bottom: 60px;
	}

	.block-type-23 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-23 .block-info-buttons .button {
		padding: 0 18px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-23 {
		padding-top: 36px;
		padding-bottom: 36px;
	}

	.block-type-23 .block-heading {
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-23 .block-info-column:first-child {
		display: none;
	}

	.block-type-23 .block-info-column:last-child .block-info-picture {
		padding-left: 24px;
	}
}

@media screen and (max-width: 760px) {
	.block-type-23 .block-info-column:last-child {
		display: none;
	}

	.block-type-23 .block-description {
		margin-top: 12px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-23 .block-info-buttons {
		text-align: center;
	}

	.block-type-23 .block-info-buttons .button:last-child {
		margin-top: 12px;
		margin-left: 0;
	}
}

@media screen and (max-width: 350px) {
	.block-type-23 .block-heading {
		font-size: 24px;
		line-height: 24px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block24.css?17690163802832*/
.block-type-24 .block-info-column {
	vertical-align: middle;
}

.block-type-24 .block-info-picture {
	max-width: 100%;
	max-height: 100%;
	vertical-align: middle;
}

.block-type-24 .block-info-buttons .button:last-child {
	margin-left: 24px;
}

.block-type-24 .block-description {
	text-align: justify;
}

.block-type-24 .block-info-list {
	box-sizing: border-box;
	padding-left: 48px;
}

.block-type-24 .block-info-list-item:first-child {
	border-top: 2px dashed #f6f6f6;
}

.block-type-24 .block-info-list-item {
	line-height: normal;
	text-align: center;
	border-bottom: 2px dashed #f1f1f1;
}

.block-type-24 .block-info-list-item-container {
	display: inline-block;
	width: 65%;
	font-size: 0;
	text-align: left;
}

.block-type-24 .block-info-list-item .block-list-item-icon,
.block-type-24 .block-info-list-item .block-list-item-text {
	display: inline-block;
	font-size: 14px;
	vertical-align: middle;
}

.block-type-24 .block-info-list-item .block-list-item-text span {
	display: block;
	padding-left: 24px;
}

.block-type-24 .block-info-list-item .block-list-item-icon {
	line-height: 0px;
	text-align: right;
}

@media screen and (max-width: 1425px) {
	.block-type-24 .block-heading {
		margin-bottom: 12px;
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-24 .block-info-column:first-child .block-info-picture {
		padding-right: 24px;
	}

	.block-type-24 .block-info-picture img {
		width: 90%;
	}

	.block-type-24 .block-info-list-item-container {
		width: 90%;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-24 {
		padding-top: 60px;
		padding-bottom: 60px;
	}

	.block-type-24 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-24 .block-info-column:first-child {
		display: none;
	}

	.block-type-24 .block-info-list-item {
		padding-top: 18px;
		padding-bottom: 18px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-24 {
		padding-top: 36px;
		padding-bottom: 36px;
	}

	.block-type-24 .block-heading {
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-24 .block-info-list-item-container {
		width: 100%;
	}

	.block-type-24 .block-info-list-item {
		padding-top: 24px;
		padding-bottom: 24px;
	}
}

@media screen and (max-width: 760px) {
	.block-type-24 .block-info-column:last-child {
		display: none;
	}

	.block-type-24 .block-info-list {
		padding-left: 0;
	}

	.block-type-24 .block-info-list .block-info-list-item {
		padding-top: 12px;
		padding-bottom: 12px;
	}

	.block-type-24 .block-description {
		margin-top: 12px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-24 .block-info-buttons {
		text-align: center;
	}

	.block-type-24 .block-info-buttons .button:last-child {
		margin-top: 12px;
		margin-left: 0;
	}
}

@media screen and (max-width: 350px) {
	.block-type-24 .block-heading {
		font-size: 24px;
		line-height: 24px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block45.css?17690161663479*/
.block-type-45 {
}

.block-type-45 .tab-sector-items .tab-sector-item:not(:last-child) {
	margin-right: 12px;
}

.block-type-45 .block-tools-container {
	text-align: right;
}

.block-type-45 .tab-sector-item.selected .button {
	background-color: transparent;
	border: 2px solid rgb(255 255 255 / 40%);
	pointer-events: none;
}

.block-type-45 .tab-sector-item .button {
	color: #ffffff;
	background-color: #87d531;
}

.block-type-45 .block-timer-container {
	display: inline-block;
	text-align: center;
}

.block-type-45 .block-special-timer {
	box-sizing: border-box;
	min-width: 360px;
	padding: 18px 24px;
	border-top: 1px solid rgb(255 255 255 / 20%);
	border-bottom: 1px solid rgb(255 255 255 / 20%);
}

.block-type-45 .special-timer-item-label {
	margin-top: 6px;
}

.block-type-45 .special-timer-delimiter-label {
	box-sizing: border-box;
	padding: 0 12px;
}

.block-type-45 .rate-tabs-item {
	position: relative;
	display: none;
	height: auto;
}

.block-type-45 .rate-tabs-item.selected {
	display: block;
}

.block-type-45 .slide-box {
	left: -24px;
	box-sizing: border-box;
}

.block-type-45 .slide-box-item {
	float: left;
	box-sizing: border-box;
	margin-right: 24px;
}

.block-type-45 .rate-item-sub-heading {
}

.block-type-45 .rate-tabs-item-button-left,
.block-type-45 .rate-tabs-item-button-right {
	position: absolute;
	top: auto;
	bottom: 0;
	z-index: 2;
	transform: translate(0%, -50%);
}

.block-type-45 .rate-tabs-item-button-left:active,
.block-type-45 .rate-tabs-item-button-right:active {
	position: absolute;
	top: auto;
}

.block-type-45 .rate-tabs-item-button-left {
	left: 45%;
}

.block-type-45 .rate-tabs-item-button-right {
	right: 45%;
}

.block-type-45 .block-brief-container {
	text-align: center;
}

@media screen and (max-width: 2100px) {
}

@media screen and (max-width: 1880px) {
	.block-type-45 {
		padding-top: 48px;
		padding-bottom: 48px;
	}

	.block-type-45 .slide-box-item .rate-item-container .item-picture img {
		max-width: 100%;
	}

	.block-type-45 .rate-tabs-item-button-left {
		left: 44%;
	}

	.block-type-45 .rate-tabs-item-button-right {
		right: 44%;
	}
}

@media screen and (max-width: 1650px) {
	.block-type-45 .slide-box-item {
		margin: 0 7px;
	}

	.block-type-45 .rate-tabs-item-button-left {
		left: 43%;
	}

	.block-type-45 .rate-tabs-item-button-right {
		right: 43%;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-45 .rate-tabs-item-button-left {
		left: 42.5%;
	}

	.block-type-45 .rate-tabs-item-button-right {
		right: 42.5%;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-45 .rate-tabs-item-button-left {
		left: 41%;
	}

	.block-type-45 .rate-tabs-item-button-right {
		right: 41%;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-45 {
		padding-top: 24px;
		padding-bottom: 24px;
	}

	.block-type-45 .rate-tabs-item-button-left {
		left: 37.5%;
	}

	.block-type-45 .rate-tabs-item-button-right {
		right: 37.5%;
	}
}

@media screen and (max-width: 760px) {
	.block-type-45 .slide-box-item {
		margin: 0;
	}

	.block-type-45 .rate-tabs-item-button-left {
		left: 30%;
	}

	.block-type-45 .rate-tabs-item-button-right {
		right: 30%;
	}
}

@media screen and (max-width: 460px) {
	.block-type-45 .rate-tabs-item-button-left {
		left: 24%;
	}

	.block-type-45 .rate-tabs-item-button-right {
		right: 24%;
	}
}

@media screen and (max-width: 350px) {
	.block-type-45 .rate-tabs-item-button-left {
		left: 20%;
	}

	.block-type-45 .rate-tabs-item-button-right {
		right: 20%;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block49.css?17690162993302*/
.block-type-49 {
	background-color: #f5f5f5;
	background-size: no-repeat;
}

.block-type-49 .rate-item {
	/* line-height: 450px;
	height: 450px; */
	font-size: 0;
}

.block-type-49 .rate-item-container {
	display: inline-block;
	color: #000000;
	font-size: 14px;
	line-height: normal;
	vertical-align: middle;
}

.block-type-49 .rate-tabs-item-carousel {
	margin: 0 -12px;
}

.block-type-49 .item-picture {
	box-shadow: 2px 2px 16px rgb(0 0 0 / 11%);
}

.block-type-49 .item-picture img {
	max-width: 100%;
}

.block-type-49 .rate-tabs-item {
	position: relative;
	display: none;
	height: auto;
}

.block-type-49 .rate-tabs-item.selected {
	display: block;
}

.block-type-49 .slide-box {
	box-sizing: border-box;
}

.block-type-49 .slide-box-item {
	float: left;
	box-sizing: border-box;
	margin: 0 12px;
}

.block-type-49 .rate-tabs-item-button-left,
.block-type-49 .rate-tabs-item-button-right {
	position: absolute;
	top: auto;
	bottom: 0;
	z-index: 2;
	transform: translate(0%, -50%);
}

.block-type-49 .rate-tabs-item-button-left:active,
.block-type-49 .rate-tabs-item-button-right:active {
	position: absolute;
	top: auto;
}

.block-type-49 .rate-tabs-item-button-left {
	left: 45%;
}

.block-type-49 .rate-tabs-item-button-right {
	right: 45%;
}

.block-type-49 .block-brief-container {
	text-align: center;
}

@media screen and (max-width: 2100px) {
}

@media screen and (max-width: 1880px) {
	.block-type-49 {
		padding-top: 48px;
		padding-bottom: 48px;
	}

	.block-type-49 .rate-tabs-item-button-left {
		left: 44%;
	}

	.block-type-49 .rate-tabs-item-button-right {
		right: 44%;
	}
}

@media screen and (max-width: 1650px) {
	.block-type-49 .slide-box-item {
		margin: 0 6px;
	}

	.block-type-49 .rate-tabs-item-button-left {
		left: 43%;
	}

	.block-type-49 .rate-tabs-item-button-right {
		right: 43%;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-49 .rate-tabs-item-button-left {
		left: 42.5%;
	}

	.block-type-49 .rate-tabs-item-button-right {
		right: 42.5%;
	}

	.block-type-49 .slide-box-item .rate-item-container .item-picture img {
		max-width: 100%;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-49 .block-heading {
		margin-bottom: 12px;
		font-size: 26px;
		line-height: 26px;
	}

	.block-type-49 .block-rate-container {
		margin-top: 24px;
	}

	.block-type-49 .rate-tabs-item-button-left {
		left: 41%;
	}

	.block-type-49 .rate-tabs-item-button-right {
		right: 41%;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-49 {
		padding-top: 24px;
		padding-bottom: 24px;
	}

	.block-type-49 .slide-box-item {
		margin: 0;
	}

	.block-type-49 .rate-tabs-item-button-left {
		left: 37.5%;
	}

	.block-type-49 .rate-tabs-item-button-right {
		right: 37.5%;
	}
}

@media screen and (max-width: 760px) {
	.block-type-49 .block-heading {
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-49 .rate-tabs-item-button-left {
		left: 30%;
	}

	.block-type-49 .rate-tabs-item-button-right {
		right: 30%;
	}
}

@media screen and (max-width: 460px) {
	.block-type-49 .rate-tabs-item-button-left {
		left: 24%;
	}

	.block-type-49 .rate-tabs-item-button-right {
		right: 24%;
	}
}

@media screen and (max-width: 350px) {
	.block-type-49 .rate-tabs-item-button-left {
		left: 20%;
	}

	.block-type-49 .rate-tabs-item-button-right {
		right: 20%;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block53.css?17690163005543*/
.block-type-53 {
	margin-top: -162px;
	background-color: #f5f5f5;
	background-repeat: no-repeat;
	background-position: 50% 50%;
	background-size: cover;
}

.block-type-53 .dw-slider {
	position: relative;
	height: 840px;
}

.block-type-53 .slider-container {
	position: relative;
	height: 100%;
	overflow: hidden;
}

.block-type-53 .first-slider-button-left,
.block-type-53 .first-slider-button-right {
	position: absolute;
	top: 50%;
	transform: translate(0%, -50%);
	transition: opacity 0.1s ease-in-out;
}

.block-type-53 .first-slider-button-left {
	left: 0;
}

.block-type-53 .first-slider-button-right {
	right: 0;
}

.block-type-53 .dw-slider .buttons-container {
	position: relative;
	max-width: 1470px;
	margin: 0 auto;
	font-size: 0;
}

.block-type-53 .dw-slider .dw-slider-pager-container {
	position: absolute;
	bottom: 200px;
	display: inline-block;
	vertical-align: middle;
}

.block-type-53 .block-info-column {
	display: inline-block;
	font-size: 14px;
	vertical-align: top;
}

.block-type-53 .input {
	min-width: 175px;
	margin-right: 12px;
}

.block-type-53 .block-phone {
	width: 590px;
	height: 570px;
	line-height: 570px;
	background-repeat: no-repeat;
	background-position: 50% 50%;
	transition: all 0.3s;
}

.block-type-53 .block-phone:hover {
	opacity: 0.8;
}

.block-type-53 .block-image-mobile {
	display: none;
}

@media screen and (max-width: 1650px) {
	.block-type-53 {
		margin-top: -144px;
		padding-top: 144px;
	}

	.block-type-53 .block-info-column:first-child {
		margin-top: 0;
	}

	.block-type-53 .block-heading {
		font-size: 64px;
		line-height: 64px;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-53 .dw-slider {
		height: 840px;
	}

	.block-type-53 .block-info-column:first-child {
		margin-top: 96px;
	}

	.block-type-53 .block-heading {
		font-size: 50px;
		line-height: 50px;
	}

	.block-type-53 .block-heading-sub {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-53 .block-image img {
		max-width: 100%;
	}
}

@media screen and (max-width: 1366px) {
	.block-type-53 .block-heading {
		font-size: 48px;
		line-height: 48px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-53 {
		margin-top: -150px;
		padding-top: 150px;
	}

	.block-type-53 .dw-slider {
		height: 640px;
	}

	.block-type-53 .input {
		min-width: 282px;
		margin-right: 0;
		margin-bottom: 12px;
	}

	.block-type-53 form .button {
		min-width: 360px;
	}

	.block-type-53 .block-image {
		height: 620px;
		line-height: 620px;
	}

	.block-type-53 .block-image img {
		max-width: 100%;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-53 {
		margin-top: -150px;
		padding-top: 150px;
		padding-bottom: 24px;
	}

	.block-type-53 .block-image {
		height: 480px;
		line-height: 480px;
	}

	.block-type-53 .block-info-columns .block-info-column:first-child {
		margin-top: 40px;
	}

	.block-type-53 .dw-slider {
		height: 500px;
	}

	.block-type-53 .first-slider-button-left,
	.block-type-53 .first-slider-button-right {
		display: none;
	}

	.block-type-53 .block-heading {
		font-size: 40px;
		line-height: 40px;
	}

	.block-type-53 .block-heading-sub {
		margin-top: 12px;
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-53 .block-description {
		font-size: 14px;
		line-height: 18px;
	}

	.block-type-53 .block-description {
		margin-top: 12px;
	}
}

@media screen and (max-width: 760px) {
	.block-type-53 {
		margin-top: -164px;
		padding-top: 164px;
		background: radial-gradient(circle farthest-corner at 65% 50%, #00d1ff, #0265dc) !important;
	}

	.block-type-53 .dw-slider {
		height: 660px;
		margin-bottom: 0;
	}

	.block-type-53 .first-slider-button-left,
	.block-type-53 .first-slider-button-right {
		display: none;
	}

	.block-type-53 .slider-container .middle-wrapper {
		max-width: 100%;
	}

	.block-type-53 .block-info-columns {
		padding-right: 12px;
		padding-left: 12px;
	}

	.block-type-53 .block-info-columns .block-info-column:first-child {
		position: relative;
		z-index: 1;
		display: block;
		max-width: 440px;
		margin: 0 auto;
		margin-top: 24px;
	}

	.block-type-53 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-53 .block-image {
		display: none;
	}

	.block-type-53 .block-image-mobile {
		display: block;
		height: 310px;
		margin-top: -80px;
		line-height: 310px;
	}

	.block-type-53 .block-image-mobile img {
		max-width: 100%;
	}

	.block-type-53 form .input {
		width: 82%;
		min-width: auto;
	}

	.block-type-53 form .button {
		width: 100%;
		min-width: auto;
	}
}

@media screen and (max-width: 500px) {
	.block-type-53 {
		margin-top: -172px;
		padding-top: 172px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-53 {
		margin-top: -162px;
		padding-top: 162px;
	}

	.block-type-53 .dw-slider {
		height: 680px;
	}

	.block-type-53 .block-info-columns .block-info-column:first-child {
		max-width: 330px;
	}

	.block-type-53 .block-image-mobile {
		height: 240px;
		line-height: 240px;
	}

	.block-type-53 form .input {
		width: 75%;
	}
}

@media screen and (max-width: 400px) {
	.block-type-53 {
		margin-top: -152px;
		padding-top: 152px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-53 {
		margin-top: -150px;
		padding-top: 150px;
	}

	.block-type-53 .dw-slider {
		height: 780px;
	}

	.block-type-53 .block-info-columns .block-info-column:first-child {
		max-width: 285px;
	}

	.block-type-53 .block-form .input {
		width: 72%;
	}

	.block-type-53 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-53 .block-image-mobile {
		height: 280px;
		line-height: 280px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block58.css?17690162667982*/
.block-type-58 {
	position: relative;
	margin-top: -162px;
	background-color: #f5f5f5;
	background-position: top center;
	transition: all 0.3s ease-in-out;
}

.block-type-58 .block-background-container {
	position: absolute;
	top: 0;
	left: 0;
	z-index: 0;
	width: 100%;
	height: 100%;
	pointer-events: none;
}

.block-type-58 .background-container-item {
	position: relative;
	width: 0;
	height: 0;
	background-size: cover;
	visibility: hidden;
	pointer-events: none;
}

.block-type-58 .background-container-item.selected {
	width: 100%;
	height: 100%;
	visibility: visible;
}

.block-type-58 .block-adv-container {
	position: relative;
}

.block-type-58 .dw-slider {
	position: relative;
	height: 920px;
}

.block-type-58 .slider-container {
	position: relative;
	height: 100%;
	overflow: hidden;
}

.block-type-58 .first-slider-button-left,
.block-type-58 .first-slider-button-right {
	position: absolute;
	top: 50%;
	z-index: 10;
	transform: translate(0%, -50%);
	transition: opacity 0.1s ease-in-out;
}

.block-type-58 .first-slider-button-left {
	left: 0;
}

.block-type-58 .first-slider-button-right {
	right: 0;
}

.block-type-58 .dw-slider .buttons-container {
	position: relative;
	max-width: 1470px;
	margin: 0 auto;
	font-size: 0;
}

.block-type-58 .dw-slider .dw-slider-pager-container {
	position: absolute;
	bottom: 90px;
	display: inline-block;
	vertical-align: middle;
}

.block-type-58 .dw-slider .buttons-container li {
	cursor: pointer;
}

.block-type-58 .dw-slider .buttons-container li:last-child {
	width: 14px;
}

.block-type-58 .dw-slider .buttons-container li:last-child.selected {
	width: 20px;
}

.block-type-58 .dw-slider .buttons-container li.selected {
	pointer-events: none;
}

.block-type-58 .block-info-column {
	display: inline-block;
	font-size: 14px;
	vertical-align: middle;
}

.block-type-58 .block-video {
	position: relative;
	height: 919px;
	line-height: 919px;
	background-repeat: no-repeat;
	background-position: 100% 50%;
	transition: all 0.3s;
}

.block-type-58 .block-video:hover {
	opacity: 0.95;
}

.block-type-58 .block-video .item-video {
	position: absolute;
	top: 45%;
	left: 50%;
	z-index: 10;
	transform: translate(-50%, -50%);
}

.block-type-58 .block-image-mobile {
	display: none;
}

.block-type-58 .snippet-circle-wrap {
	margin-right: auto;
	margin-left: auto;
}

@media screen and (max-width: 1920px) {
	.block-type-58 .block-info-column:first-child {
		margin-top: -200px;
	}

	.block-type-58 .block-video {
		position: relative;
		height: 919px;
		line-height: 919px;
		background-repeat: no-repeat;
		background-position: 100% 20%;
		transition: all 0.3s;
	}

	.block-type-58 .first-slider-button-left,
	.block-type-58 .first-slider-button-right {
		top: 35%;
	}
}

@media screen and (max-width: 1650px) {
	.block-type-58 {
		margin-top: -146px;
		padding-top: 146px;
		padding-bottom: 48px;
	}

	.block-type-58 .dw-slider {
		height: 620px;
	}

	.block-type-58 .block-info-column:first-child {
		margin-top: -100px;
	}

	.block-type-58 .first-slider-button-left,
	.block-type-58 .first-slider-button-right {
		top: 45%;
	}

	.block-type-58 .block-heading {
		font-size: 64px;
		line-height: 64px;
	}

	.block-type-58 .block-spec .button {
		padding: 0 48px;
	}

	.block-type-58 .block-video {
		height: 620px;
		padding-top: 0;
		line-height: 620px;
		background-size: 75%;
	}

	.block-type-58 .dw-slider .buttons-container {
		max-width: 1280px;
	}

	.block-type-58 .dw-slider .dw-slider-pager-container {
		bottom: 10px;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-58 .block-video {
		background-size: 80%;
	}

	.block-type-58 .dw-slider .buttons-container {
		max-width: 1170px;
	}

	.block-type-58 .first-slider-button-left,
	.block-type-58 .first-slider-button-right {
		display: none;
	}
}

@media screen and (max-width: 1366px) {
	.block-type-58 .dw-slider {
		height: 630px;
	}

	.block-type-58 .block-video {
		height: 630px;
		line-height: 630px;
	}

	.block-type-58 .block-base-price span {
		font-size: 30px;
		line-height: 36px;
	}

	.block-type-58 .block-discount-price span {
		font-size: 18px;
		line-height: 22px;
	}

	.block-type-58 .block-heading-sub {
		font-size: 20px;
		line-height: 24px;
	}

	.block-type-58 .block-date {
		margin-top: 12px;
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-58 .block-spec .button {
		height: 48px;
		padding: 0 48px;
		line-height: 48px;
		border-radius: 40px / 40px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-58 .dw-slider .buttons-container {
		max-width: 960px;
	}

	.block-type-58 .block-video {
		background-size: 100%;
	}

	.block-type-58 .block-heading {
		font-size: 46px;
		line-height: 46px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-58 {
		margin-top: -164px;
		padding-top: 164px;
		padding-bottom: 24px;
		background: radial-gradient(circle farthest-corner at 65% 50%, #00d1ff, #0265dc) !important;
	}

	.block-type-58 .dw-slider {
		height: 440px;
	}

	.block-type-58 .block-info-column:first-child {
		margin-top: 0;
	}

	.block-type-58 .block-info-columns {
		margin-top: 48px;
	}

	.block-type-58 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-58 .block-base-price span {
		font-size: 18px;
		line-height: 22px;
	}

	.block-type-58 .block-discount-price span {
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-58 .snippet-type-6 .snippet-circle-wrap {
		width: 400px;
		height: 400px;
		margin-top: 0;
	}

	.block-type-58 .block-spec .button {
		height: 34px;
		padding: 0 18px;
		line-height: 34px;
		border-radius: 34px / 34px;
	}

	.block-type-58 .block-image-mobile {
		display: block;
		height: 330px;
		line-height: 330px;
	}

	.block-type-58 .block-image-mobile img {
		max-width: 100%;
		max-height: 100%;
	}

	.block-type-58 .block-video {
		display: none;
	}

	.block-type-58 .dw-slider .buttons-container,
	.block-type-58 .dw-slider .dw-slider-pager-container {
		display: none;
	}
}

@media screen and (max-width: 760px) {
	.block-type-58 {
		margin-top: -190px;
		padding-top: 190px;
	}

	.block-type-58 .dw-slider {
		height: 530px;
	}

	.block-type-58 .block-info-columns {
		margin-top: 30px;
		padding-left: 12px;
	}

	.block-type-58 .slider-container .middle-wrapper {
		max-width: 100%;
	}

	.block-type-58 .block-info-columns .block-info-column:first-child {
		position: relative;
		z-index: 1;
		display: block;
		max-width: 440px;
		margin: 0 auto;
		margin-top: 24px;
	}

	.block-type-58 .block-heading-sub {
		font-size: 18px;
		line-height: 22px;
	}

	.block-type-58 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-58 .block-price {
		margin-top: 6px;
	}

	.block-type-58 .block-base-price {
		display: inline-block;
		margin-right: 12px;
		font-size: 18px;
		line-height: 22px;
	}

	.block-type-58 .block-discount-price {
		display: inline-block;
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-58 .block-spec {
		margin-top: 12px;
	}

	.block-type-58 .block-spec > div {
		display: inline-block;
		margin-right: 12px;
	}

	.block-type-58 .block-image-mobile img {
		margin-top: -36px;
	}
}

@media screen and (max-width: 500px) {
	.block-type-58 {
		margin-top: -172px;
		padding-top: 172px;
	}

	.block-type-58 .dw-slider {
		height: 530px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-58 .block-info-columns .block-info-column:first-child {
		max-width: 330px;
	}

	.block-type-58 .block-heading {
		font-size: 21px;
		line-height: 21px;
	}

	.block-type-58 .block-heading-sub {
		font-size: 16px;
		line-height: 18px;
	}
}

@media screen and (max-width: 420px) {
	.block-type-58 {
		margin-top: -158px;
		padding-top: 158px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-58 .dw-slider {
		height: 470px;
	}

	.block-type-58 .block-info-columns .block-info-column:first-child {
		max-width: 285px;
	}

	.block-type-58 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-58 .block-image-mobile {
		height: 280px;
		line-height: 280px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block59.css?17690164367119*/
.block-type-59 {
	margin-top: -162px;
	background-color: #f5f5f5;
	background-repeat: no-repeat;
	background-position: 50% 50%;
	background-size: cover;
}

.block-type-59 .dw-slider {
	position: relative;
	height: 690px;
}

.block-type-59 .slider-container {
	position: relative;
	height: 100%;
	overflow: hidden;
}

.block-type-59 .first-slider-button-left,
.block-type-59 .first-slider-button-right {
	position: absolute;
	top: 50%;
	transform: translate(0%, -50%);
	transition: opacity 0.1s ease-in-out;
}

.block-type-59 .first-slider-button-left {
	left: 0;
}

.block-type-59 .first-slider-button-right {
	right: 0;
}

.block-type-59 .dw-slider .buttons-container {
	position: relative;
	max-width: 1470px;
	margin: 0 auto;
	font-size: 0;
}

.block-type-59 .dw-slider .dw-slider-pager-container {
	position: absolute;
	bottom: 0;
	display: inline-block;
	vertical-align: middle;
}

.block-type-59 .dw-slider .buttons-container li {
}

.block-type-59 .block-info-columns {
}

.block-type-59 .block-info-column {
	display: inline-block;
	font-size: 14px;
	vertical-align: top;
}

.block-type-59 .block-image-mobile,
.block-type-59 .block-image {
	position: relative;
}

.block-type-59 .block-image-mobile .item-video,
.block-type-59 .block-image .item-video {
	position: absolute;
	top: 75%;
	left: 80%;
	z-index: 10;
	transform: translate(-50%, -50%);
}

.block-type-59 .block-image .button {
	position: absolute;
	bottom: -64px;
	left: 80%;
	z-index: 10;
	transform: translate(-50%, -50%);
}

.block-type-59 .block-image-mobile {
	display: none;
}

@media screen and (max-width: 1650px) {
	.block-type-59 {
		margin-top: -144px;
		padding-top: 144px;
		padding-bottom: 48px;
	}

	.block-type-59 .dw-slider {
		height: 600px;
	}

	.block-type-59 .dw-slider .buttons-container {
		max-width: 1280px;
	}

	.block-type-59 .block-heading {
		font-size: 64px;
		line-height: 64px;
	}

	.block-type-59 .block-image {
	}

	.block-type-59 .block-image img {
		max-width: 90%;
	}

	.block-type-59 .block-spec .button {
		padding: 0 48px;
	}

	.block-type-59 .block-image .button,
	.block-type-59 .block-image .item-video {
		left: 75%;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-59 .dw-slider {
		height: 550px;
	}

	.block-type-59 .dw-slider .buttons-container {
		max-width: 1170px;
	}
}

@media screen and (max-width: 1366px) {
	.block-type-59 .block-video {
		height: 650px;
		line-height: 650px;
	}

	.block-type-59 .block-base-price span {
		font-size: 30px;
		line-height: 36px;
	}

	.block-type-59 .block-discount-price span {
		font-size: 18px;
		line-height: 22px;
	}

	.block-type-59 .block-heading-sub {
		font-size: 20px;
		line-height: 24px;
	}

	.block-type-59 .block-date {
		margin-top: 12px;
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-59 .block-spec .button {
		height: 48px;
		padding: 0 48px;
		line-height: 48px;
		border-radius: 40px / 40px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-59 {
	}

	.block-type-59 .dw-slider {
		height: 510px;
	}

	.block-type-59 .dw-slider .buttons-container {
		max-width: 960px;
	}

	.block-type-59 .block-image img {
		max-width: 100%;
	}

	.block-type-59 .block-heading {
		font-size: 46px;
		line-height: 46px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-59 {
		margin-top: -164px;
		padding-top: 164px;
		padding-bottom: 28px;
	}

	.block-type-59 .dw-slider {
		height: 410px;
	}

	.block-type-59.form-only .dw-slider {
		height: auto;
	}

	.block-type-59 .dw-slider .buttons-container {
		max-width: 700px;
	}

	.block-type-59 .dw-slider .buttons-container,
	.block-type-59 .dw-slider .dw-slider-pager-container,
	.block-type-59 .first-slider-button-left,
	.block-type-59 .first-slider-button-right {
		display: none;
	}

	.block-type-59 .block-info-column {
		vertical-align: middle;
	}

	.block-type-59 .block-info-columns .block-info-column:first-child {
		margin-top: 0;
	}

	.block-type-59 .block-video {
		display: block;
		height: 480px;
		line-height: 480px;
	}

	.block-type-59 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-59 .block-base-price span {
		font-size: 18px;
		line-height: 22px;
	}

	.block-type-59 .block-discount-price span {
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-59 .snippet-type-6 .snippet-circle-wrap {
		width: 400px;
		height: 400px;
		margin-top: 0;
	}

	.block-type-59 .block-spec .button {
		height: 34px;
		padding: 0 18px;
		line-height: 34px;
		border-radius: 34px / 34px;
	}

	.block-type-59 .block-image-mobile {
		display: block;
		height: 390px;
		margin-top: 0;
		line-height: 390px;
		text-align: center;
	}

	.block-type-59 .block-image-mobile img {
		max-width: 100%;
		max-height: 100%;
		margin-top: 0;
		vertical-align: middle;
	}

	.block-type-59 .block-image {
		display: none;
	}
}

@media screen and (max-width: 760px) {
	.block-type-59 {
		margin-top: -164px;
		padding-top: 164px;
	}

	.block-type-59 .dw-slider {
		height: 580px;
	}

	.block-type-59 .block-info-columns {
		padding-left: 12px;
	}

	.block-type-59 .block-info-columns .block-info-column:first-child {
		position: relative;
		z-index: 1;
		display: block;
		max-width: 440px;
		margin: 0 auto;
		margin-top: 24px;
	}

	.block-type-59 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-59 .block-heading-sub {
		font-size: 18px;
		line-height: 22px;
	}

	.block-type-59 .block-price {
		margin-top: 6px;
	}

	.block-type-59 .block-base-price {
		display: inline-block;
		margin-right: 12px;
		font-size: 18px;
		line-height: 22px;
	}

	.block-type-59 .block-discount-price {
		display: inline-block;
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-59 .block-spec {
		margin-top: 12px;
	}

	.block-type-59 .block-spec > div {
		display: inline-block;
		margin-right: 12px;
	}

	.block-type-59 .block-image-mobile .item-video {
		top: 33%;
		right: 60px;
		left: auto;
	}

	.block-type-59 .block-image-mobile .button {
		right: 36px;
		bottom: 0;
		left: auto;
	}
}

@media screen and (max-width: 500px) {
	.block-type-59 {
		margin-top: -172px;
		padding-top: 172px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-59 {
	}

	.block-type-59 .block-heading {
		font-size: 21px;
		line-height: 21px;
	}

	.block-type-59 .block-heading-sub {
		font-size: 16px;
		line-height: 18px;
	}

	.block-type-59 .block-info-columns .block-info-column:first-child {
		max-width: 330px;
	}

	.block-type-59 .block-image-mobile {
		height: 240px;
		line-height: 240px;
		text-align: center;
	}

	.block-type-59 .block-image-mobile .item-video {
		top: 33%;
		right: auto;
		left: 45%;
	}

	.block-type-59 .block-image-mobile .button {
		right: auto;
		bottom: 0;
		left: 45%;
	}
}

@media screen and (max-width: 420px) {
	.block-type-59 {
		margin-top: -158px;
		padding-top: 158px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-59 .block-info-columns .block-info-column:first-child {
		max-width: 285px;
	}

	.block-type-59 .dw-slider {
		height: 440px;
	}

	.block-type-59 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-59 .block-image-mobile .button {
		bottom: 44px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block60.css?17690163006067*/
.block-type-60 {
	margin-top: -162px;
	background-color: #f5f5f5;
}

.block-type-60 .dw-slider {
	position: relative;
	height: 1119px;
}

.block-type-60 .slider-container {
	position: relative;
	height: 100%;
	overflow: hidden;
}

.block-type-60 .first-slider-button-left,
.block-type-60 .first-slider-button-right {
	position: absolute;
	top: 50%;
	transform: translate(0%, -50%);
	transition: opacity 0.1s ease-in-out;
}

.block-type-60 .first-slider-button-left {
	left: 0;
}

.block-type-60 .first-slider-button-right {
	right: 0;
}

.block-type-60 .dw-slider .buttons-container {
	position: relative;
	max-width: 1470px;
	margin: 0 auto;
	font-size: 0;
}

.block-type-60 .dw-slider .dw-slider-pager-container {
	position: absolute;
	top: -350px;
	display: inline-block;
	vertical-align: middle;
}

.block-type-60 .dw-slider .buttons-container li {
}

.block-type-60 .block-breadcrumbs span,
.block-type-60 .block-breadcrumbs a {
	color: #ffffff;
}

.block-type-60 .block-breadcrumbs span::after,
.block-type-60 .block-breadcrumbs a::after {
	margin: 0 5px;
	color: #ffffff;
	content: "-";
}

.block-type-60 .block-breadcrumbs span:last-child::after {
	content: "";
}

.block-type-60 .block-info-columns {
}

.block-type-60 .block-info-column {
	display: inline-block;
	font-size: 14px;
	vertical-align: top;
}

.block-type-60 .block-image {
	height: 1119px;
	line-height: 1119px;
	background-repeat: no-repeat;
	background-position: 65% 24px;
	background-size: contain;
	transition: all 0.3s;
}

.block-type-60 .block-image-mobile {
	display: none;
}

@media screen and (max-width: 1650px) {
	.block-type-60 {
		margin-top: -144px;
		padding-top: 144px;
	}

	.block-type-60 .block-info-column {
		margin-top: 0;
		vertical-align: middle;
	}

	.block-type-60 .block-heading {
		font-size: 64px;
		line-height: 64px;
	}

	.block-type-60 .block-spec .button {
		padding: 0 48px;
	}

	.block-type-60 .dw-slider {
		height: 800px;
	}

	.block-type-60 .dw-slider .buttons-container {
		max-width: 1280px;
	}

	.block-type-60 .block-image {
		height: 790px;
		line-height: 790px;
		background-position: 65% 0;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-60 .dw-slider {
		height: 760px;
	}

	.block-type-60 .block-info-column:first-child {
		margin-top: 0;
	}

	.block-type-60 .dw-slider .buttons-container {
		max-width: 1170px;
	}
}

@media screen and (max-width: 1366px) {
	.block-type-60 .block-heading-sub {
		margin-top: 24px;
		font-size: 20px;
		line-height: 24px;
	}

	.block-type-60 .block-description {
		margin-top: 12px;
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-60 .block-spec .button {
		height: 48px;
		padding: 0 48px;
		line-height: 48px;
		border-radius: 40px / 40px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-60 {
		padding-bottom: 48px;
	}

	.block-type-60 .dw-slider {
		height: 620px;
	}

	.block-type-60 .dw-slider .buttons-container {
		max-width: 960px;
	}

	.block-type-60 .block-image {
		height: 620px;
		line-height: 620px;
	}

	.block-type-60 .block-image img {
		max-width: 100%;
	}

	.block-type-60 .block-heading {
		font-size: 46px;
		line-height: 46px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-60 {
		margin-top: -150px;
		padding-top: 150px;
		padding-bottom: 24px;
	}

	.block-type-60 .dw-slider {
		height: 420px;
	}

	.block-type-60 .dw-slider .buttons-container {
		max-width: 700px;
	}

	.block-type-60 .dw-slider .buttons-container,
	.block-type-60 .dw-slider .dw-slider-pager-container,
	.block-type-60 .first-slider-button-left,
	.block-type-60 .first-slider-button-right {
		display: none;
	}

	.block-type-60 .block-image {
		height: 480px;
		line-height: 480px;
	}

	.block-type-60 .block-info-columns .block-info-column:first-child {
		margin-top: 40px;
	}

	.block-type-60 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-60 .block-heading-sub {
		margin-top: 12px;
		font-size: 18px;
		line-height: 18px;
	}

	.block-type-60 .block-spec .button {
		height: 34px;
		padding: 0 18px;
		line-height: 34px;
		border-radius: 34px / 34px;
	}

	.block-type-60 .block-image-mobile {
		display: block;
		height: 390px;
		margin-top: 0;
		line-height: 390px;
		text-align: center;
	}

	.block-type-60 .block-image-mobile img {
		max-width: 100%;
		max-height: 100%;
		margin-top: 0;
		vertical-align: middle;
	}

	.block-type-60 .block-image {
		display: none;
	}
}

@media screen and (max-width: 760px) {
	.block-type-60 {
		margin-top: -164px;
		padding-top: 164px;
		background: radial-gradient(circle closest-corner at 75% 50%, #e52f6c, #14000c) !important;
	}

	.block-type-60 .dw-slider {
		height: 580px;
	}

	.block-type-60 .block-info-columns {
		padding-left: 12px;
	}

	.block-type-60 .block-info-columns .block-info-column:first-child {
		position: relative;
		z-index: 1;
		display: block;
		max-width: 440px;
		margin: 0 auto;
		margin-top: 24px;
	}

	.block-type-60 .block-heading {
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-60 .block-description {
		display: none;
	}

	.block-type-60 .block-spec {
		margin-top: 12px;
	}

	.block-type-60 .block-spec > div {
		display: inline-block;
		margin-right: 12px;
	}
}

@media screen and (max-width: 500px) {
	.block-type-60 {
		margin-top: -172px;
		padding-top: 172px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-60 {
	}

	.block-type-60 .block-info-columns .block-info-column:first-child {
		max-width: 330px;
	}

	.block-type-60 .dw-slider {
		height: 440px;
	}

	.block-type-60 .block-heading {
		font-size: 21px;
		line-height: 21px;
	}

	.block-type-60 .block-heading-sub {
		font-size: 16px;
		line-height: 18px;
	}

	.block-type-60 .block-image-mobile {
		height: 240px;
		line-height: 240px;
		text-align: center;
	}
}

@media screen and (max-width: 420px) {
	.block-type-60 {
		margin-top: -158px;
		padding-top: 158px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-60 .block-info-columns .block-info-column:first-child {
		max-width: 285px;
	}

	.block-type-60 .block-image-mobile {
		height: 280px;
		line-height: 280px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block61.css?17690164036054*/
.block-type-61 {
	margin-top: -162px;
}

.block-type-61 .dw-slider {
	position: relative;
	height: 1122px;
	margin-bottom: -400px;
}

.block-type-61 .slider-container {
	position: relative;
	height: 100%;
	overflow: hidden;
}

.block-type-61 .first-slider-button-left,
.block-type-61 .first-slider-button-right {
	position: absolute;
	top: 50%;
	transform: translate(0%, -50%);
	transition: opacity 0.1s ease-in-out;
}

.block-type-61 .first-slider-button-left {
	left: 0;
}

.block-type-61 .first-slider-button-right {
	right: 0;
}

.block-type-61 .dw-slider .buttons-container {
	position: relative;
	max-width: 1470px;
	margin: 0 auto;
	font-size: 0;
}

.block-type-61 .dw-slider .dw-slider-pager-container {
	position: absolute;
	bottom: -500px;
	display: inline-block;
	vertical-align: middle;
}

.block-type-61 .block-info-column {
	display: inline-block;
	font-size: 14px;
	vertical-align: top;
}

.block-type-61 .block-image {
	position: relative;
	height: 945px;
	line-height: 945px;
	background-repeat: no-repeat;
	background-position: 100% 0;
	background-size: contain;
	transition: all 0.3s;
}

.block-type-61 .block-info-container {
	height: 965px;
	line-height: 965px;
}

.block-type-61 .block-adv-container {
	position: relative;

	/* z-index: 10; */
}

.block-type-61 .block-image-mobile {
	display: none;
}

@media screen and (max-width: 1650px) {
	.block-type-61 {
		margin-top: -144px;
		padding-top: 144px;
	}

	.block-type-61 .dw-slider {
		height: 1040px;
	}

	.block-type-61 .dw-slider .buttons-container {
		max-width: 1280px;
	}

	.block-type-61 .block-image {
		height: 860px;
		line-height: 860px;
	}

	.block-type-61 .block-heading {
		font-size: 64px;
		line-height: 64px;
	}

	.block-type-61 .block-spec .button {
		padding: 0 48px;
	}

	.block-type-61 .block-image .button,
	.block-type-61 .block-image .item-video {
		left: 75%;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-61 .dw-slider {
		height: 900px;
	}

	.block-type-61 .dw-slider .buttons-container {
		max-width: 1170px;
	}

	.block-type-61 .block-image {
		height: 720px;
		line-height: 720px;
	}

	.block-type-61 .block-info-column:first-child {
		margin-top: 96px;
	}
}

@media screen and (max-width: 1366px) {
	.block-type-61 .block-heading-sub {
		margin-top: 24px;
		font-size: 20px;
		line-height: 24px;
	}

	.block-type-61 .block-description {
		margin-top: 12px;
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-61 .block-spec .button {
		height: 48px;
		padding: 0 48px;
		line-height: 48px;
		border-radius: 40px / 40px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-61 {
	}

	.block-type-61 {
		padding-bottom: 48px;
	}

	.block-type-61 .dw-slider {
		height: 680px;
		margin-bottom: -220px;
	}

	.block-type-61 .dw-slider .buttons-container {
		max-width: 960px;
	}

	.block-type-61 .block-heading {
		font-size: 46px;
		line-height: 46px;
	}

	.block-type-61 .block-image {
		height: 660px;
		line-height: 660px;
	}

	.block-type-61 .block-image img {
		max-width: 100%;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-61 {
		margin-top: -164px;
		padding-top: 164px;
		padding-bottom: 24px;
	}

	.block-type-61 .dw-slider {
		height: 360px;
		margin-bottom: 0;
	}

	.block-type-61 .dw-slider .buttons-container {
		max-width: 700px;
	}

	.block-type-61 .dw-slider .buttons-container,
	.block-type-61 .dw-slider .dw-slider-pager-container,
	.block-type-61 .first-slider-button-left,
	.block-type-61 .first-slider-button-right {
		display: none;
	}

	.block-type-61 .block-info-columns .block-info-column:first-child {
		margin-top: 72px;
	}

	.block-type-61 .block-image {
		height: 610px;
		line-height: 610px;
	}

	.block-type-61 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-61 .block-heading-sub {
		margin-top: 12px;
	}

	.block-type-61 .block-spec .button {
		height: 34px;
		padding: 0 18px;
		line-height: 34px;
		border-radius: 34px / 34px;
	}

	.block-type-61 .block-image-mobile {
		display: block;
		height: 390px;
		margin-top: 0;
		line-height: 390px;
		text-align: center;
	}

	.block-type-61 .block-image-mobile img {
		max-width: 100%;
		max-height: 100%;
		margin-top: 0;
		vertical-align: middle;
	}

	.block-type-61 .block-image {
		display: none;
	}
}

@media screen and (max-width: 760px) {
	.block-type-61 {
		margin-top: -164px;
		padding-top: 164px;
		background: radial-gradient(circle closest-corner at 75% 50%, #003885, #01112a) !important;
	}

	.block-type-61 .dw-slider {
		height: 580px;
		margin-bottom: 0;
	}

	.block-type-61 .block-info-columns {
		padding-right: 12px;
		padding-left: 12px;
	}

	.block-type-61 .block-info-columns .block-info-column:first-child {
		position: relative;
		z-index: 1;
		display: block;
		max-width: 440px;
		margin: 0 auto;
		margin-top: 24px;
	}

	.block-type-61 .block-heading-sub {
		font-size: 16px;
		line-height: 21px;
	}

	.block-type-61 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-61 .block-description {
		display: none;
	}

	.block-type-61 .block-spec {
		margin-top: 12px;
	}

	.block-type-61 .block-spec > div {
		display: inline-block;
		margin-right: 12px;
	}
}

@media screen and (max-width: 500px) {
	.block-type-61 {
		margin-top: -172px;
		padding-top: 172px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-61 {
	}

	.block-type-61 .dw-slider {
		height: 500px;
	}

	.block-type-61 .block-heading {
		font-size: 21px;
		line-height: 21px;
	}

	.block-type-61 .block-heading-sub {
		font-size: 16px;
		line-height: 18px;
	}

	.block-type-61 .block-image-mobile {
		height: 240px;
		line-height: 240px;
		text-align: center;
	}

	.block-type-61 .block-spec .button {
		margin-bottom: 12px;
	}
}

@media screen and (max-width: 420px) {
	.block-type-61 {
		margin-top: -158px;
		padding-top: 158px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-61 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-61 .dw-slider {
		height: 530px;
	}

	.block-type-61 .block-image-mobile {
		height: 280px;
		line-height: 280px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block62.css?17690162905646*/
.block-type-62 {
	margin-top: -162px;
	background-color: #f5f5f5;
	background-position: 50% 50%;
	background-size: cover;
}

.block-type-62 .dw-slider {
	position: relative;
	height: 1122px;
	margin-bottom: -400px;
}

.block-type-62 .slider-container {
	position: relative;
	height: 100%;
	overflow: hidden;
}

.block-type-62 .first-slider-button-left,
.block-type-62 .first-slider-button-right {
	position: absolute;
	top: 50%;
	transform: translate(0%, -50%);
	transition: opacity 0.1s ease-in-out;
}

.block-type-62 .first-slider-button-left {
	left: 0;
}

.block-type-62 .first-slider-button-right {
	right: 0;
}

.block-type-62 .dw-slider .buttons-container {
	position: relative;
	max-width: 1470px;
	margin: 0 auto;
	font-size: 0;
}

.block-type-62 .dw-slider .dw-slider-pager-container {
	position: absolute;
	bottom: 90px;
	display: inline-block;
	vertical-align: middle;
}

.block-type-62 .dw-slider .buttons-container li {
}

.block-type-62 .block-info-columns {
}

.block-type-62 .block-info-column {
	display: inline-block;
	font-size: 14px;
	vertical-align: top;
}

.block-type-62 .block-image-mobile {
	display: none;
}

@media screen and (max-width: 1650px) {
	.block-type-62 {
		margin-top: -144px;
		padding-top: 144px;
		padding-bottom: 48px;
	}

	.block-type-62 .block-heading {
		font-size: 64px;
		line-height: 64px;
	}

	.block-type-62 .block-heading-sub {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-62 .block-spec .button {
		padding: 0 48px;
	}

	.block-type-62 .block-image {
		text-align: right;
	}

	.block-type-62 .block-image img {
		max-width: 85%;
	}

	.block-type-62 .dw-slider {
		height: 980px;
	}

	.block-type-62 .dw-slider .buttons-container {
		max-width: 1280px;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-62 .dw-slider {
		height: 1000px;
	}

	.block-type-62 .dw-slider .buttons-container {
		max-width: 1170px;
	}

	.block-type-62 .first-slider-button-left,
	.block-type-62 .first-slider-button-right {
		display: none;
	}

	.block-type-62 .block-info-column:first-child {
		margin-top: 96px;
	}

	.block-type-62 .block-image img {
		max-width: 100%;
	}
}

@media screen and (max-width: 1366px) {
	.block-type-62 .block-heading-sub {
		font-size: 20px;
		line-height: 24px;
	}

	.block-type-62 .block-description {
		margin-top: 12px;
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-62 .block-spec .button {
		height: 48px;
		padding: 0 48px;
		line-height: 48px;
		border-radius: 40px / 40px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-62 {
	}

	.block-type-62 .dw-slider {
		height: 920px;
	}

	.block-type-62 .dw-slider .buttons-container {
		max-width: 960px;
	}

	.block-type-62 .block-image {
		height: 520px;
		line-height: 520px;
	}

	.block-type-62 .block-image img {
		max-width: 100%;
	}

	.block-type-62 .block-heading {
		font-size: 46px;
		line-height: 46px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-62 {
		margin-top: -164px;
		padding-top: 164px;
		padding-bottom: 28px;
	}

	.block-type-62 .dw-slider .dw-slider-pager-container,
	.block-type-62 .first-slider-button-left,
	.block-type-62 .first-slider-button-right {
		display: none;
	}

	.block-type-62 .block-info-columns .block-info-column:first-child {
		margin-top: 48px;
	}

	.block-type-62 .block-info-columns .block-info-column:last-child {
		margin-top: 0;
	}

	.block-type-62 .dw-slider {
		height: 740px;
	}

	.block-type-62 .dw-slider .buttons-container {
		max-width: 700px;
	}

	.block-type-62 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-62 .block-heading-sub {
		margin-top: 12px;
	}

	.block-type-62 .block-spec .button {
		height: 34px;
		padding: 0 18px;
		line-height: 34px;
		border-radius: 34px / 34px;
	}

	.block-type-62 .block-image-mobile {
		display: block;
		height: 390px;
		margin-top: 0;
		line-height: 390px;
		text-align: center;
	}

	.block-type-62 .block-image-mobile img {
		max-width: 100%;
		max-height: 100%;
		margin-top: 0;
		vertical-align: middle;
	}

	.block-type-62 .block-image {
		display: none;
	}
}

@media screen and (max-width: 760px) {
	.block-type-62 {
		margin-top: -164px;
		padding-top: 164px;
	}

	.block-type-62 .dw-slider {
		height: 480px;
		margin-bottom: 0;
	}

	.block-type-62 .block-info-columns {
		padding-right: 12px;
		padding-left: 12px;
	}

	.block-type-62 .block-info-columns .block-info-column:first-child {
		position: relative;
		z-index: 1;
		display: block;
		max-width: 440px;
		margin: 0 auto;
		margin-top: 24px;
	}

	.block-type-62 .block-heading-sub {
		font-size: 18px;
		line-height: 18px;
	}

	.block-type-62 .block-heading {
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-62 .block-description {
		display: none;
	}

	.block-type-62 .block-spec {
		margin-top: 12px;
	}

	.block-type-62 .block-spec > div {
		display: inline-block;
		margin-right: 12px;
	}
}

@media screen and (max-width: 500px) {
	.block-type-62 {
		margin-top: -172px;
		padding-top: 172px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-62 {
		padding-bottom: 0;
	}

	.block-type-62 .dw-slider {
		height: 450px;
	}

	.block-type-62 .block-heading {
		font-size: 21px;
		line-height: 21px;
	}

	.block-type-62 .block-heading-sub {
		font-size: 16px;
		line-height: 18px;
	}

	.block-type-62 .block-image-mobile {
		height: 240px;
		line-height: 240px;
		text-align: center;
	}
}

@media screen and (max-width: 420px) {
	.block-type-62 {
		margin-top: -158px;
		padding-top: 158px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-62 .dw-slider {
		height: 380px;
	}

	.block-type-62 .block-image-mobile {
		height: 280px;
		line-height: 280px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block63.css?17690162786763*/
.block-type-63 {
	margin-top: -162px;
	background-color: #f5f5f5;
	background-repeat: no-repeat;
	background-position: 50% 50%;
	background-size: cover;
}

.block-type-63 .dw-slider {
	position: relative;
	height: 1122px;
	margin-bottom: -400px;
}

.block-type-63 .slider-container {
	position: relative;
	height: 100%;
	overflow: hidden;
}

.block-type-63 .first-slider-button-left,
.block-type-63 .first-slider-button-right {
	position: absolute;
	top: 50%;
	transform: translate(0%, -50%);
	transition: opacity 0.1s ease-in-out;
}

.block-type-63 .first-slider-button-left {
	left: 0;
}

.block-type-63 .first-slider-button-right {
	right: 0;
}

.block-type-63 .dw-slider .buttons-container {
	position: relative;
	max-width: 1470px;
	margin: 0 auto;
	font-size: 0;
}

.block-type-63 .dw-slider .dw-slider-pager-container {
	position: absolute;
	bottom: 90px;
	display: inline-block;
	vertical-align: middle;
}

.block-type-63 .block-info-column {
	display: inline-block;
	font-size: 14px;
	vertical-align: top;
}

.block-type-63 .input {
	min-width: 170px;
	margin-right: 12px;
}

.block-type-63 .block-phone {
	width: 590px;
	height: 570px;
	line-height: 570px;
	background-repeat: no-repeat;
	background-position: 50% 50%;
	transition: all 0.3s;
}

.block-type-63 .block-phone:hover {
	opacity: 0.8;
}

.block-type-63 .block-image-mobile {
	display: none;
}

.block-type-63 .block-adv-container {
	position: relative;
	z-index: 10;
}

@media screen and (max-width: 1650px) {
	.block-type-63 {
		margin-top: -144px;
		padding-top: 144px;
	}

	.block-type-63 .dw-slider .buttons-container {
		max-width: 1280px;
	}

	.block-type-63 .block-heading {
		font-size: 3.8rem;
		line-height: 3.8rem;
	}

	.block-type-63 .block-spec .button {
		padding: 0 48px;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-63 .dw-slider {
		height: 1000px;
	}

	.block-type-63 .dw-slider .buttons-container {
		max-width: 1170px;
	}

	.block-type-63 .block-info-column:first-child {
		margin-top: 96px;
	}

	.block-type-63 .block-heading-sub {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-63 .block-image img {
		max-width: 100%;
	}
}

@media screen and (max-width: 1366px) {
	.block-type-63 .block-heading-sub {
		font-size: 1.1rem;
		line-height: 1.25rem;
	}

	.block-type-63 .block-description {
		margin-top: 12px;
		font-size: 0.8rem;
		line-height: 0.9rem;
	}

	.block-type-63 .block-spec .button {
		height: 48px;
		padding: 0 48px;
		line-height: 2.875rem;
		border-radius: 40px / 40px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-63 .input {
		min-width: 282px;
		margin-right: 0;
		margin-bottom: 12px;
	}

	.block-type-63 .dw-slider .buttons-container {
		max-width: 960px;
	}

	.block-type-63 form .button {
		min-width: 360px;
	}

	.block-type-63 .block-image {
		height: 620px;
		line-height: 620px;
	}

	.block-type-63 .block-heading {
		font-size: 2.75rem;
		line-height: 2.75rem;
	}

	.block-type-63 .block-image img {
		max-width: 100%;
	}

	.block-type-63 .block-form .form div {
		margin-top: 12px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-63 {
		margin-top: -164px;
		padding-top: 164px;
		padding-bottom: 24px;
	}

	.block-type-63 .block-info-columns .block-info-column:first-child {
		margin-top: 40px;
	}

	.block-type-63.form-only .dw-slider {
		height: auto;
	}

	.block-type-63 .dw-slider {
		height: 370px;
		margin-bottom: 0;
	}

	.block-type-63.form-only .dw-slider {
		height: auto;
	}

	.block-type-63 .dw-slider .buttons-container {
		max-width: 700px;
	}

	.block-type-63 .dw-slider .buttons-container,
	.block-type-63 .dw-slider .dw-slider-pager-container,
	.block-type-63 .first-slider-button-left,
	.block-type-63 .first-slider-button-right {
		display: none;
	}

	.block-type-63 .block-heading {
		font-size: 2.125rem;
		line-height: 2.125rem;
	}

	.block-type-63 .block-heading-sub {
		margin-top: 12px;
	}

	.block-type-63 .block-spec .button {
		height: 34px;
		padding: 0 18px;
		line-height: 2.125rem;
		border-radius: 34px / 34px;
	}

	.block-type-63 .block-image-mobile {
		display: block;
		height: 390px;
		margin-top: 0;
		line-height: 390px;
		text-align: center;
	}

	.block-type-63 .block-image-mobile img {
		max-width: 100%;
		max-height: 100%;
		margin-top: 0;
		vertical-align: middle;
	}

	.block-type-63 .block-image {
		display: none;
	}
}

@media screen and (max-width: 760px) {
	.block-type-63 {
		margin-top: -164px;
		padding-top: 164px;
		background: radial-gradient(circle farthest-corner at 65% 50%, #00d1ff, #0265dc) !important;
	}

	.block-type-63 .dw-slider {
		height: 680px;
		margin-bottom: 0;
	}

	.block-type-63 .first-slider-button-left,
	.block-type-63 .first-slider-button-right {
		display: none;
	}

	.block-type-63 .block-info-columns {
		padding-right: 12px;
		padding-left: 12px;
	}

	.block-type-63 .block-info-columns .block-info-column:first-child {
		position: relative;
		z-index: 1;
		display: block;
		max-width: 440px;
		margin: 0 auto;
		margin-top: 24px;
	}

	.block-type-63 .block-heading-sub {
		font-size: 1rem;
		line-height: 1rem;
	}

	.block-type-63 .block-heading {
		font-size: 1.75rem;
		line-height: 1.75rem;
	}

	.block-type-63 .block-description {
		display: none;
	}

	.block-type-63 .block-image-mobile {
		margin: 24px 0;
	}

	.block-type-63 .block-spec {
		margin-top: 12px;
	}

	.block-type-63 .block-spec > div {
		display: inline-block;
		margin-right: 12px;
	}

	.block-type-63 form .input {
		min-width: 340px;
	}

	.block-type-63 form .button {
		min-width: 420px;
	}
}

@media screen and (max-width: 500px) {
	.block-type-63 {
		margin-top: -172px;
		padding-top: 172px;
	}

	.block-type-63 .block-adv-container {
		margin-bottom: 20px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-63 .dw-slider {
		height: 600px;
	}

	.block-type-63 .block-heading {
		font-size: 1.1rem;
		line-height: 1.1rem;
	}

	.block-type-63 .block-heading-sub {
		font-size: 0.8rem;
		line-height: 1rem;
	}

	.block-type-63 .block-image-mobile {
		height: 240px;
		line-height: 240px;
		text-align: center;
	}

	.block-type-63 form .input {
		width: 75%;
		min-width: auto;
		margin-right: 0;
	}

	.block-type-63 form .button {
		width: 100%;
		min-width: auto;
		margin-right: 0;
	}
}

@media screen and (max-width: 420px) {
	.block-type-63 {
		margin-top: -158px;
		padding-top: 158px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-63 .dw-slider {
		height: 570px;
	}

	.block-type-63 .block-image-mobile {
		margin: 0;
	}

	.block-type-63 form .input {
		width: 70%;
	}

	.block-type-63 .block-heading {
		font-size: 1.75rem;
		line-height: 1.8rem;
	}

	.block-type-63 .block-image-mobile {
		height: 280px;
		line-height: 280px;
	}

	.block-type-63 .block-button .button {
		width: 70%;
		padding: 0;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block64.css?17690164985976*/
.block-type-64 {
	margin-top: -162px;
	background-color: #f5f5f5;
}

.block-type-64 .dw-slider {
	position: relative;
	height: 854px;
}

.block-type-64 .slider-container {
	position: relative;
	height: 100%;
	overflow: hidden;
}

.block-type-64 .first-slider-button-left,
.block-type-64 .first-slider-button-right {
	position: absolute;
	top: 50%;
	transform: translate(0%, -50%);
	transition: opacity 0.1s ease-in-out;
}

.block-type-64 .first-slider-button-left {
	left: 0;
}

.block-type-64 .first-slider-button-right {
	right: 0;
}

.block-type-64 .dw-slider .buttons-container {
	position: relative;
	max-width: 1470px;
	margin: 0 auto;
	font-size: 0;
}

.block-type-64 .dw-slider .dw-slider-pager-container {
	position: absolute;
	bottom: 90px;
	display: inline-block;
	vertical-align: middle;
}

.block-type-64 .block-info-column {
	display: inline-block;
	font-size: 14px;
	vertical-align: top;
}

.block-type-64 .block-image-mobile {
	display: none;
}

.block-type-64 .block-adv-container {
	position: relative;
	z-index: 10;
}

@media screen and (max-width: 1650px) {
	.block-type-64 {
		margin-top: -144px;
		padding-top: 144px;
	}

	.block-type-64 .dw-slider .buttons-container {
		max-width: 1280px;
	}

	.block-type-64 .block-heading {
		font-size: 64px;
		line-height: 64px;
	}

	.block-type-64 .block-spec .button {
		padding: 0 48px;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-64 .dw-slider {
		height: 650px;
	}

	.block-type-64 .dw-slider .buttons-container {
		max-width: 1170px;
	}

	.block-type-64 .block-info-column:first-child {
		margin-top: 96px;
	}

	.block-type-64 .block-heading-sub {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-64 .block-image img {
		max-width: 100%;
	}
}

@media screen and (max-width: 1366px) {
	.block-type-64 .block-heading-sub {
		font-size: 20px;
		line-height: 24px;
	}

	.block-type-64 .block-description {
		margin-top: 12px;
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-64 .block-spec .button {
		height: 48px;
		padding: 0 48px;
		line-height: 48px;
		border-radius: 40px / 40px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-64 .block-image {
		position: relative;
		height: 650px;
		line-height: 650px;
	}

	.block-type-64 .block-heading {
		font-size: 46px;
		line-height: 46px;
	}

	.block-type-64 .block-heading-sub {
		font-size: 20px;
		line-height: 22px;
	}

	.block-type-64 .block-image img {
		position: absolute;
		bottom: 0;
		max-width: 100%;
	}

	.block-type-64 .block-info-column .block-parts-6 {
		margin-top: 72px;
	}

	.block-type-64 .block-parts-6-item {
		width: 60%;
	}

	.block-type-64 .dw-slider .buttons-container {
		max-width: 960px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-64 {
		margin-top: -164px;
		padding-top: 164px;
	}

	.block-type-64 .block-info-column {
		vertical-align: middle;
	}

	.block-type-64 .block-info-column:first-child {
		margin-top: 36px;
	}

	.block-type-64 .dw-slider {
		height: 400px;
	}

	.block-type-64 .dw-slider .buttons-container {
		max-width: 700px;
	}

	.block-type-64 .dw-slider .buttons-container,
	.block-type-64 .dw-slider .dw-slider-pager-container,
	.block-type-64 .first-slider-button-left,
	.block-type-64 .first-slider-button-right {
		display: none;
	}

	.block-type-64 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-64 .block-heading-sub {
		margin-top: 12px;
	}

	.block-type-64 .block-image {
		height: 540px;
		margin-bottom: -22px;
		line-height: 540px;
	}

	.block-type-64 .block-button .button {
		height: 34px;
		padding: 0 18px;
		line-height: 34px;
		border-radius: 34px / 34px;
	}

	.block-type-64 .block-info-column .block-parts-6 {
		margin-top: 0;
	}

	.block-type-64 .block-image-mobile {
		display: block;
		height: 390px;
		margin-top: 0;
		line-height: 390px;
		text-align: center;
	}

	.block-type-64 .block-image-mobile img {
		max-width: 100%;
		max-height: 100%;
		margin-top: 0;
		vertical-align: middle;
	}

	.block-type-64 .block-image {
		display: none;
	}
}

@media screen and (max-width: 760px) {
	.block-type-64 {
		margin-top: -164px;
		padding-top: 164px;
		padding-bottom: 24px;
		background: radial-gradient(circle closest-corner at 75% 75%, #fff6bb, #e9b901) !important;
	}

	.block-type-64 .dw-slider {
		height: 660px;
		margin-bottom: 0;
	}

	.block-type-64 .block-info-columns {
		padding-right: 12px;
		padding-left: 12px;
	}

	.block-type-64 .block-info-columns .block-info-column:first-child {
		position: relative;
		z-index: 1;
		display: block;
		max-width: 440px;
		margin: 0 auto;
		margin-top: 24px;
	}

	.block-type-64 .block-info-columns .block-info-column:last-child {
		position: relative;
		bottom: auto;
		left: auto;
	}

	.block-type-64 .block-heading-sub {
		font-size: 18px;
		line-height: 18px;
	}

	.block-type-64 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-64 .block-description {
		display: none;
	}

	.block-type-64 .block-info-column .block-parts-6 {
		margin-top: 6px;
	}

	.block-type-64 .block-button {
		margin-top: 12px;
	}
}

@media screen and (max-width: 500px) {
	.block-type-64 {
		margin-top: -172px;
		padding-top: 172px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-64 .dw-slider {
		height: 540px;
	}

	.block-type-64 .block-heading {
		font-size: 21px;
		line-height: 21px;
	}

	.block-type-64 .block-heading-sub {
		font-size: 16px;
		line-height: 18px;
	}

	.block-type-64 .block-image-mobile {
		height: 240px;
		line-height: 240px;
		text-align: center;
	}

	.block-type-64 form .input {
		min-width: auto;
	}

	.block-type-64 form .button {
		min-width: auto;
	}
}

@media screen and (max-width: 420px) {
	.block-type-64 {
		margin-top: -158px;
		padding-top: 158px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-64 .dw-slider {
		height: 590px;
	}

	.block-type-64 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-64 .block-image-mobile {
		height: 280px;
		line-height: 280px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block65.css?17690163015512*/
.block-type-65 {
	margin-top: -162px;
	background-color: #f5f5f5;
}

.block-type-65 .dw-slider {
	position: relative;
	height: 852px;
}

.block-type-65 .slider-container {
	position: relative;
	height: 100%;
	overflow: hidden;
}

.block-type-65 .first-slider-button-left,
.block-type-65 .first-slider-button-right {
	position: absolute;
	top: 50%;
	transform: translate(0%, -50%);
	transition: opacity 0.1s ease-in-out;
}

.block-type-65 .first-slider-button-left {
	left: 0;
}

.block-type-65 .first-slider-button-right {
	right: 0;
}

.block-type-65 .dw-slider .buttons-container {
	position: relative;
	max-width: 1470px;
	margin: 0 auto;
	font-size: 0;
}

.block-type-65 .dw-slider .dw-slider-pager-container {
	position: absolute;
	bottom: 90px;
	display: inline-block;
	vertical-align: middle;
}

.block-type-65 .block-info-columns {
	height: 852px;
	line-height: 852px;
	background-repeat: no-repeat;
	background-position: 100% 0;
}

.block-type-65 .block-info-column {
	display: inline-block;
	font-size: 14px;
	line-height: normal;
	vertical-align: top;
}

.block-type-65 .block-image-mobile {
	display: none;
}

@media screen and (max-width: 1650px) {
	.block-type-65 {
		margin-top: -144px;
		padding-top: 144px;
	}

	.block-type-65 .dw-slider .buttons-container {
		max-width: 1280px;
	}

	.block-type-65 .block-heading {
		font-size: 64px;
		line-height: 64px;
	}

	.block-type-65 .block-spec .button {
		padding: 0 48px;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-65 .dw-slider {
		height: 650px;
	}

	.block-type-65 .block-adv-container {
		margin-top: 30px;
	}

	.block-type-65 .dw-slider .buttons-container {
		max-width: 1170px;
	}

	.block-type-65 .block-info-column:first-child {
		margin-top: 96px;
	}

	.block-type-65 .block-heading-sub {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-65 .block-image img {
		max-width: 100%;
	}
}

@media screen and (max-width: 1366px) {
	.block-type-65 .block-heading-sub {
		font-size: 20px;
		line-height: 24px;
	}

	.block-type-65 .block-description {
		margin-top: 12px;
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-65 .block-spec .button {
		height: 48px;
		padding: 0 48px;
		line-height: 48px;
		border-radius: 40px / 40px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-65 .dw-slider {
		height: 536px;
	}

	.block-type-65 .dw-slider .buttons-container {
		max-width: 960px;
	}

	.block-type-65 .block-info-columns {
		height: 600px;
		line-height: 600px;
		background-position: 100% 100%;
		background-size: 50%;
	}

	.block-type-65 .block-heading {
		font-size: 46px;
		line-height: 46px;
	}

	.block-type-65 .block-adv-container {
		display: none;
		width: min(1000px, 90vw);
		margin-top: 0;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-65 {
		margin-top: -164px;
		padding-top: 164px;
	}

	.block-type-65 .dw-slider {
		height: 380px;
	}

	.block-type-65 .dw-slider .buttons-container {
		max-width: 700px;
	}

	.block-type-65 .dw-slider .buttons-container,
	.block-type-65 .dw-slider .dw-slider-pager-container,
	.block-type-65 .first-slider-button-left,
	.block-type-65 .first-slider-button-right {
		display: none;
	}

	.block-type-65 .block-info-columns {
		height: 380px;
		line-height: 380px;
		background-size: 45%;
	}

	.block-type-65 .block-info-columns .block-info-column:first-child {
		margin-top: 40px;
	}

	.block-type-65 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-65 .block-heading-sub {
		margin-top: 12px;
	}

	.block-type-65 .block-description {
		margin-top: 12px;
	}

	.block-type-65 .block-button .button {
		height: 34px;
		padding: 0 18px;
		line-height: 34px;
		border-radius: 34px / 34px;
	}
}

@media screen and (max-width: 760px) {
	.block-type-65 {
		margin-top: -164px;
		padding-top: 164px;
	}

	.block-type-65 .dw-slider {
		height: 550px;
		margin-bottom: 0;
	}

	.block-type-65 .first-slider-button-left,
	.block-type-65 .first-slider-button-right {
		display: none;
	}

	.block-type-65 .block-info-columns {
		height: 550px;
		padding-right: 12px;
		padding-left: 12px;
		line-height: 550px;
		background-size: 400px;
	}

	.block-type-65 .block-info-columns .block-info-column:first-child {
		position: relative;
		z-index: 1;
		display: block;
		max-width: 440px;
		margin: 0 auto;
		margin-top: 24px;
	}

	.block-type-65 .block-info-columns .block-info-column {
		position: relative;
		z-index: 1;
		margin-top: 32px;
	}

	.block-type-65 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-65 .block-heading-sub {
		font-size: 18px;
		line-height: 18px;
	}

	.block-type-65 .block-description {
		display: none;
	}

	.block-type-65 .block-spec {
		margin-top: 12px;
	}

	.block-type-65 .block-spec > div {
		display: inline-block;
		margin-right: 12px;
	}
}

@media screen and (max-width: 500px) {
	.block-type-65 {
		margin-top: -172px;
		padding-top: 172px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-65 .block-info-columns {
		background-size: 300px;
	}

	.block-type-65 .block-heading {
		font-size: 21px;
		line-height: 21px;
	}

	.block-type-65 .block-heading-sub {
		font-size: 16px;
		line-height: 18px;
	}
}

@media screen and (max-width: 420px) {
	.block-type-65 {
		margin-top: -158px;
		padding-top: 158px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-65 .dw-slider {
		height: 540px;
	}

	.block-type-65 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-65 .block-image-mobile {
		height: 280px;
		line-height: 280px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block66.css?17690163026743*/
.block-type-66 {
	margin-top: -162px;
}

.block-type-66 .dw-slider {
	position: relative;
	height: 1028px;
}

.block-type-66 .slider-container {
	position: relative;
	height: 100%;
	overflow: hidden;
}

.block-type-66 .first-slider-button-left,
.block-type-66 .first-slider-button-right {
	position: absolute;
	top: 50%;
	transform: translate(0%, -50%);
	transition: opacity 0.1s ease-in-out;
}

.block-type-66 .first-slider-button-left {
	left: 0;
}

.block-type-66 .first-slider-button-right {
	right: 0;
}

.block-type-66 .dw-slider .buttons-container {
	position: relative;
	max-width: 1470px;
	margin: 0 auto;
	font-size: 0;
}

.block-type-66 .dw-slider .dw-slider-pager-container {
	position: absolute;
	bottom: 90px;
	display: inline-block;
	vertical-align: middle;
}

.block-type-66 .dw-slider .buttons-container li {
}

.block-type-66 .block-breadcrumbs span,
.block-type-66 .block-breadcrumbs a {
	color: #ffffff;
}

.block-type-66 .block-breadcrumbs span::after,
.block-type-66 .block-breadcrumbs a::after {
	margin: 0 5px;
	color: #ffffff;
	content: "-";
}

.block-type-66 .block-breadcrumbs span:last-child::after {
	content: "";
}

.block-type-66 .block-info-container {
	background-repeat: repeat-x;
	background-position: 50% 100%;
}

.block-type-66 .block-info-column {
	display: inline-block;
	font-size: 14px;
	line-height: normal;
	vertical-align: top;
}

.block-type-66 .block-image {
	position: relative;
	height: 945px;
	line-height: 945px;
	background-repeat: no-repeat;
	background-position: 100% 0;
	background-size: contain;
	transition: all 0.3s;
}

.block-type-66 .block-image-mobile {
	display: none;
}

@media screen and (max-width: 1650px) {
	.block-type-66 {
		margin-top: -144px;
		padding-top: 144px;
	}

	.block-type-66 .dw-slider .buttons-container {
		max-width: 1280px;
	}

	.block-type-66 .block-heading {
		font-size: 64px;
		line-height: 64px;
	}

	.block-type-66 .block-spec .button {
		padding: 0 48px;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-66 .dw-slider {
		height: 860px;
	}

	.block-type-66 .dw-slider .buttons-container {
		max-width: 1170px;
	}

	.block-type-66 .block-info-column:first-child {
		margin-top: 48px;
	}

	.block-type-66 .block-heading-sub {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-66 .block-image {
		height: 780px;
		line-height: 780px;
	}

	.block-type-66 .block-image img {
		max-width: 100%;
	}
}

@media screen and (max-width: 1366px) {
	.block-type-66 .block-heading {
		font-size: 38px;
		line-height: 38px;
	}

	.block-type-66 .block-heading-sub {
		margin-top: 12px;
		font-size: 20px;
		line-height: 24px;
	}

	.block-type-66 .block-description {
		margin-top: 12px;
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-66 .block-button .button {
		height: 48px;
		padding: 0 48px;
		line-height: 48px;
		border-radius: 40px / 40px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-66 .dw-slider {
		height: 684px;
	}

	.block-type-66 .dw-slider .buttons-container {
		max-width: 960px;
	}

	.block-type-66 .block-image {
		height: 684px;
		line-height: 684px;
	}

	.block-type-66 .block-heading {
		font-size: 46px;
		line-height: 46px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-66 {
		margin-top: -164px;
		padding-top: 164px;
	}

	.block-type-66 .dw-slider {
		height: 460px;
	}

	.block-type-66 .dw-slider .buttons-container {
		max-width: 700px;
	}

	.block-type-66 .dw-slider .buttons-container,
	.block-type-66 .dw-slider .dw-slider-pager-container,
	.block-type-66 .first-slider-button-left,
	.block-type-66 .first-slider-button-right {
		display: none;
	}

	.block-type-66 .block-info-container {
		padding-bottom: 24px;
		background-image: inherit !important;
	}

	.block-type-66 .block-image {
		height: 460px;
		line-height: 460px;
	}

	.block-type-66 .block-info-columns {
		height: 380px;
		line-height: 380px;
	}

	.block-type-66 .block-info-columns .block-info-column:first-child {
		margin-top: 40px;
	}

	.block-type-66 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-66 .block-heading-sub {
		margin-top: 12px;
	}

	.block-type-66 .block-description {
		margin-top: 12px;
	}

	.block-type-66 .block-button .button {
		height: 34px;
		padding: 0 18px;
		line-height: 34px;
		border-radius: 34px / 34px;
	}

	.block-type-66 .block-image-mobile {
		display: block;
		height: 390px;
		margin-top: 0;
		line-height: 390px;
		text-align: center;
	}

	.block-type-66 .block-image-mobile img {
		max-width: 100%;
		max-height: 100%;
		margin-top: 0;
		vertical-align: middle;
	}

	.block-type-66 .block-image {
		display: none;
	}

	.block-type-66 .block-breadcrumbs {
		height: 24px;
		margin-bottom: 12px;
		overflow: hidden;
	}

	.block-type-66 .block-breadcrumbs .breadcrumbs-content {
		height: 48px;
		overflow: auto;
		white-space: nowrap;
	}
}

@media screen and (max-width: 760px) {
	.block-type-66 {
		margin-top: -164px;
		padding-top: 164px;
	}

	.block-type-66 .dw-slider {
		height: 580px;
		margin-bottom: 0;
	}

	.block-type-66 .first-slider-button-left,
	.block-type-66 .first-slider-button-right {
		display: none;
	}

	.block-type-66 .block-info-columns {
		height: 320px;
		padding-right: 12px;
		padding-left: 12px;
		line-height: 320px;
	}

	.block-type-66 .block-info-columns .block-info-column:first-child {
		position: relative;
		z-index: 1;
		display: block;
		max-width: 440px;
		margin: 0 auto;
		margin-top: 24px;
	}

	.block-type-66 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-66 .block-heading-sub {
		font-size: 18px;
		line-height: 18px;
	}

	.block-type-66 .block-description {
		display: none;
	}

	.block-type-66 .block-spec {
		margin-top: 12px;
	}

	.block-type-66 .block-spec > div {
		display: inline-block;
		margin-right: 12px;
	}
}

@media screen and (max-width: 500px) {
	.block-type-66 {
		margin-top: -172px;
		padding-top: 172px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-66 .dw-slider {
		height: 510px;
	}

	.block-type-66 .block-heading {
		font-size: 21px;
		line-height: 21px;
	}

	.block-type-66 .block-heading-sub {
		font-size: 16px;
		line-height: 18px;
	}

	.block-type-66 .block-info-columns {
		height: 350px;
		padding-left: 12px;
		line-height: 350px;
		background-image: inherit !important;
	}

	.block-type-66 .block-image-mobile {
		height: 240px;
		line-height: 240px;
		text-align: center;
	}
}

@media screen and (max-width: 420px) {
	.block-type-66 {
		margin-top: -158px;
		padding-top: 158px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-66 .dw-slider {
		height: 510px;
	}

	.block-type-66 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-66 .block-image-mobile {
		height: 280px;
		line-height: 280px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block67.css?17690164976964*/
.block-type-67 {
	margin-top: -162px;
	background-color: #f5f5f5;
	background-position: 50% 50%;
	background-size: cover;
}

.block-type-67 .dw-slider {
	position: relative;
	height: 852px;
}

.block-type-67 .slider-container {
	position: relative;
	height: 100%;
	overflow: hidden;
}

.block-type-67 .first-slider-button-left,
.block-type-67 .first-slider-button-right {
	position: absolute;
	top: 50%;
	transform: translate(0%, -50%);
	transition: opacity 0.1s ease-in-out;
}

.block-type-67 .first-slider-button-left {
	left: 0;
}

.block-type-67 .first-slider-button-right {
	right: 0;
}

.block-type-67 .dw-slider .buttons-container {
	position: relative;
	max-width: 1470px;
	margin: 0 auto;
	font-size: 0;
}

.block-type-67 .dw-slider .dw-slider-pager-container {
	position: absolute;
	bottom: 90px;
	display: inline-block;
	vertical-align: middle;
}

.block-type-67 .dw-slider .buttons-container li {
}

.block-type-67 .block-info-columns {
}

.block-type-67 .block-info-column {
	display: inline-block;
	font-size: 14px;
	vertical-align: top;
}

.block-type-67 .block-image {
	position: relative;
	height: 750px;
	line-height: 750px;
	background-repeat: no-repeat;
	background-position: 100% 0;
	background-size: contain;
	transition: all 0.3s;
}

.block-type-67 .block-image-mobile {
	display: none;
}

@media screen and (max-width: 1650px) {
	.block-type-67 {
		margin-top: -144px;
		padding-top: 144px;
	}

	.block-type-67 .dw-slider {
		height: 700px;
	}

	.block-type-67 .dw-slider .buttons-container {
		max-width: 1280px;
	}

	.block-type-67 .block-heading {
		font-size: 64px;
		line-height: 64px;
	}

	.block-type-67 .block-button .button {
		padding: 0 48px;
	}

	.block-type-67 .block-image {
		height: 700px;
		line-height: 700px;
	}

	.block-type-67 .block-info-column .block-parts-6 {
		margin-top: 72px;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-67 .dw-slider {
		height: 600px;
	}

	.block-type-67 .dw-slider .buttons-container {
		max-width: 1170px;
	}

	.block-type-67 .block-image {
		height: 600px;
		line-height: 600px;
	}

	.block-type-67 .block-info-column:first-child {
		margin-top: 48px;
	}

	.block-type-67 .block-heading-sub {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-67 .block-image img {
		max-width: 100%;
	}
}

@media screen and (max-width: 1366px) {
	.block-type-67 .block-heading-sub {
		margin-top: 12px;
		font-size: 20px;
		line-height: 24px;
	}

	.block-type-67 .block-description {
		margin-top: 12px;
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-67 .block-button .button {
		height: 48px;
		padding: 0 48px;
		line-height: 48px;
		border-radius: 40px / 40px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-67 .dw-slider {
		height: 500px;
	}

	.block-type-67 .dw-slider .buttons-container {
		max-width: 960px;
	}

	.block-type-67 .block-image {
		height: 500px;
		line-height: 500px;
	}

	.block-type-67 .block-heading {
		font-size: 46px;
		line-height: 46px;
	}

	.block-type-67 .block-base-price span {
		font-size: 1.5rem;
	}

	.block-type-67 .block-discount-price span {
		font-size: 1.2rem;
	}

	.block-type-67 .block-spec .button {
		height: 42px;
		padding: 0 24px;
		line-height: 42px;
	}

	.block-type-67 .block-info-column .block-parts-6 {
		margin-top: 36px;
	}

	.block-type-67 .block-parts-6-item {
		width: 60%;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-67 {
		margin-top: -164px;
		padding-top: 164px;
	}

	.block-type-67 .dw-slider {
		height: 400px;
	}

	.block-type-67 .dw-slider .buttons-container {
		max-width: 700px;
	}

	.block-type-67 .dw-slider .buttons-container,
	.block-type-67 .dw-slider .dw-slider-pager-container,
	.block-type-67 .first-slider-button-left,
	.block-type-67 .first-slider-button-right {
		display: none;
	}

	.block-type-67 .block-image {
		height: 400px;
		line-height: 400px;
	}

	.block-type-67 .block-info-columns .block-info-column:first-child {
		margin-top: 40px;
		line-height: normal;
	}

	.block-type-67 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-67 .block-heading-sub {
		margin-top: 12px;
	}

	.block-type-67 .block-description {
		margin-top: 12px;
	}

	.block-type-67 .block-button .button {
		height: 34px;
		padding: 0 18px;
		line-height: 34px;
		border-radius: 34px / 34px;
	}

	.block-type-67 .block-info-column .block-parts-6 {
		margin-top: 0;
	}

	.block-type-67 .block-parts-6-item {
		width: 70%;
	}

	.block-type-67 .block-image-mobile {
		display: block;
		height: 390px;
		margin-top: 0;
		line-height: 390px;
		text-align: center;
	}

	.block-type-67 .block-image-mobile img {
		max-width: 100%;
		max-height: 100%;
		margin-top: 0;
		vertical-align: middle;
	}

	.block-type-67 .block-image {
		display: none;
	}
}

@media screen and (max-width: 760px) {
	.block-type-67 {
		margin-top: -164px;
		padding-top: 164px;
	}

	.block-type-67 .dw-slider {
		height: 720px;
		margin-bottom: 24px;
	}

	.block-type-67 .first-slider-button-left,
	.block-type-67 .first-slider-button-right {
		display: none;
	}

	.block-type-67 .slider-container .middle-wrapper {
		max-width: 100%;
	}

	.block-type-67 .block-info-columns {
		height: 320px;
		padding-right: 12px;
		padding-left: 12px;
		line-height: 320px;
	}

	.block-type-67 .block-info-columns .block-info-column {
		position: relative;
		z-index: 1;
	}

	.block-type-67 .block-info-columns .block-info-column:first-child {
		display: block;
		max-width: 440px;
		margin: 0 auto;
		margin-top: 24px;
	}

	.block-type-67 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-67 .block-heading-sub {
		font-size: 18px;
		line-height: 18px;
	}

	.block-type-67 .block-description {
		display: none;
	}

	.block-type-67 .block-button {
		margin-top: 12px;
	}

	.block-type-67 .block-info-column .block-parts-6 {
		margin-top: 0;
	}
}

@media screen and (max-width: 500px) {
	.block-type-67 {
		margin-top: -172px;
		padding-top: 172px;
	}

	.block-type-67 .dw-slider {
		height: 680px;
		margin-bottom: 24px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-67 {
	}

	.block-type-67 .dw-slider {
		height: 570px;
	}

	.block-type-67 .block-heading {
		font-size: 21px;
		line-height: 21px;
	}

	.block-type-67 .block-heading-sub {
		font-size: 16px;
		line-height: 18px;
	}

	.block-type-67 .block-info-columns {
		height: 350px;
		padding-left: 12px;
		line-height: 350px;
		background-image: inherit !important;
	}

	.block-type-67 .block-image-mobile {
		height: 240px;
		line-height: 240px;
		text-align: center;
	}

	.block-type-67 .block-base-price span {
		font-size: 1.2rem;
	}

	.block-type-67 .block-discount-price span {
		font-size: 1rem;
	}
}

@media screen and (max-width: 420px) {
	.block-type-67 {
		margin-top: -158px;
		padding-top: 158px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-67 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-67 .block-image-mobile {
		height: 280px;
		line-height: 280px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block68.css?17690162837001*/
.block-type-68 {
	position: relative;
	width: 100%;
	margin-top: -162px;
	overflow: hidden;
	background-color: #f5f5f5;
}

.block-type-68-paralax-picture {
	position: absolute;
	top: 0;
	left: 0;
	z-index: 10;
	width: 100%;
	height: 100%;
	background-repeat: no-repeat;
	background-position: 50% 50%;
	background-size: cover;
	pointer-events: none;
}

.block-type-68 .block-info-column:first-child {
	position: relative;
	z-index: 11;
}

.block-type-68 .dw-slider {
	position: relative;
	height: 1122px;
	margin-bottom: -400px;
}

.block-type-68 .slider-container {
	position: relative;
	height: 100%;
	overflow: hidden;
}

.block-type-68 .first-slider-button-left,
.block-type-68 .first-slider-button-right {
	position: absolute;
	top: 50%;
	display: none;
	transform: translate(0%, -50%);
	transition: opacity 0.1s ease-in-out;
}

.block-type-68 .first-slider-button-left {
	left: 0;
}

.block-type-68 .first-slider-button-right {
	right: 0;
}

.block-type-68 .dw-slider .buttons-container {
	position: relative;
	max-width: 1470px;
	margin: 0 auto;
	font-size: 0;
}

.block-type-68 .dw-slider .dw-slider-pager-container {
	position: absolute;
	bottom: 90px;
	display: inline-block;
	vertical-align: middle;
}

.block-type-68 .block-info-column {
	display: inline-block;
	font-size: 14px;
	vertical-align: top;
}

.block-type-68 .input {
	min-width: 175px;
	margin-right: 12px;
}

.block-type-68 .block-phone {
	width: 590px;
	height: 570px;
	line-height: 570px;
	background-repeat: no-repeat;
	background-position: 50% 50%;
	transition: all 0.3s;
}

.block-type-68 .block-phone:hover {
	opacity: 0.8;
}

.block-type-68 .block-image {
	position: relative;
	height: 750px;
	line-height: 750px;
	background-repeat: no-repeat;
	background-position: 100% 0;
	background-size: contain;
	transition: all 0.3s;
}

.block-type-68 .block-parts-14-item,
.block-type-68 .block-parts-14-item:first-child {
	border-right: 0;
	border-left: 0;
}

.block-type-68 .block-image-mobile {
	display: none;
}

.block-type-68 .block-adv-container {
	position: relative;
	z-index: 10;
}

@media screen and (max-width: 1650px) {
	.block-type-68 {
		margin-top: -144px;
		padding-top: 144px;
		padding-bottom: 12px;
	}

	.block-type-68 .block-heading {
		font-size: 64px;
		line-height: 64px;
	}

	.block-type-68 .dw-slider {
		height: 880px;
	}

	.block-type-68 .dw-slider .buttons-container {
		max-width: 1280px;
	}

	.block-type-68 .block-info-column {
		margin-top: 0;
		vertical-align: middle;
	}

	.block-type-68 .block-image {
		height: 520px;
		line-height: 520px;
	}

	.block-type-68 .input {
		min-width: 142px;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-68 .dw-slider {
		height: 900px;
	}

	.block-type-68 .dw-slider .buttons-container {
		max-width: 1170px;
	}

	.block-type-68 .first-slider-button-left,
	.block-type-68 .first-slider-button-right {
		display: none;
	}

	.block-type-68 .block-info-column:first-child {
		margin-top: 0;
	}

	.block-type-68 .block-heading-sub {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-68 .block-image img {
		max-width: 100%;
	}
}

@media screen and (max-width: 1366px) {
	.block-type-68 .block-heading-sub {
		font-size: 20px;
		line-height: 24px;
	}

	.block-type-68 .block-description {
		margin-top: 12px;
		font-size: 14px;
		line-height: 16px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-68 {
		padding-bottom: 6px;
	}

	.block-type-68 .input {
		min-width: 282px;
		margin-right: 0;
		margin-bottom: 12px;
	}

	.block-type-68 form .button {
		min-width: 360px;
	}

	.block-type-68 .block-image {
		height: 620px;
		line-height: 620px;
	}

	.block-type-68 .block-image img {
		max-width: 100%;
	}

	.block-type-68 .block-heading {
		font-size: 46px;
		line-height: 46px;
	}

	.block-type-68 .dw-slider {
		height: 920px;
	}

	.block-type-68 .dw-slider .buttons-container {
		max-width: 960px;
	}
}

@media screen and (max-width: 1024px) {
	.block-type-68-paralax-picture {
		display: none;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-68 {
		margin-top: -164px;
		padding-top: 164px;
		padding-bottom: 24px;
	}

	.block-type-68 .block-image {
		height: 480px;
		line-height: 480px;
	}

	.block-type-68 .block-info-columns .block-info-column:first-child {
		margin-top: 40px;
	}

	.block-type-68 .dw-slider {
		height: 760px;
		margin-bottom: -300px;
	}

	.block-type-68 .dw-slider .buttons-container {
		max-width: 700px;
	}

	.block-type-68 .dw-slider .buttons-container,
	.block-type-68 .dw-slider .dw-slider-pager-container,
	.block-type-68 .first-slider-button-left,
	.block-type-68 .first-slider-button-right {
		display: none;
	}

	.block-type-68 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-68 .block-heading-sub {
		margin-top: 12px;
	}

	.block-type-68 .block-adv-container {
		margin-bottom: 0;
	}

	.block-type-68 .block-image-mobile {
		display: block;
		height: 390px;
		margin-top: 0;
		line-height: 390px;
		text-align: center;
	}

	.block-type-68 .block-image-mobile img {
		max-width: 100%;
		max-height: 100%;
		margin-top: 0;
		vertical-align: middle;
	}

	.block-type-68 .block-image {
		display: none;
	}
}

@media screen and (max-width: 760px) {
	.block-type-68 {
		margin-top: -164px;
		padding-top: 164px;
	}

	.block-type-68 .dw-slider {
		height: 700px;
		margin-bottom: 0;
	}

	.block-type-68 .first-slider-button-left,
	.block-type-68 .first-slider-button-right {
		display: none;
	}

	.block-type-68 .block-info-columns {
		padding-right: 12px;
		padding-left: 12px;
	}

	.block-type-68 .block-info-columns .block-info-column:first-child {
		position: relative;
		z-index: 1;
		display: block;
		max-width: 440px;
		margin: 0 auto;
		margin-top: 24px;
	}

	.block-type-68 .block-heading-sub {
		font-size: 18px;
		line-height: 18px;
	}

	.block-type-68 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-68 .block-description {
		display: none;
	}

	.block-type-68 form .input {
		min-width: 340px;
	}

	.block-type-68 form .button {
		min-width: 420px;
	}

	.block-type-68 .block-adv-container {
		margin-top: 0;
	}
}

@media screen and (max-width: 500px) {
	.block-type-68 {
		margin-top: -172px;
		padding-top: 172px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-68 .dw-slider {
		height: 570px;
	}

	.block-type-68 .block-heading {
		font-size: 21px;
		line-height: 21px;
	}

	.block-type-68 .block-heading-sub {
		font-size: 16px;
		line-height: 18px;
	}

	.block-type-68 .block-image-mobile {
		height: 240px;
		line-height: 240px;
		text-align: center;
	}

	.block-type-68 form .input {
		width: 75%;
		min-width: auto;
		margin-right: 0;
	}

	.block-type-68 form .button {
		width: 100%;
		min-width: auto;
		margin-right: 0;
	}
}

@media screen and (max-width: 420px) {
	.block-type-68 {
		margin-top: -158px;
		padding-top: 158px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-68 form .input {
		width: 70%;
	}

	.block-type-68 .block-image-mobile {
		height: 280px;
		line-height: 280px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block69.css?17690164026906*/
.block-type-69 {
	margin-top: -162px;
	background-color: #f5f5f5;
}

.block-type-69 .dw-slider {
	position: relative;
	height: 1122px;
	margin-bottom: -370px;
}

.block-type-69 .slider-container {
	position: relative;
	height: 100%;
	overflow: hidden;
}

.block-type-69 .first-slider-button-left,
.block-type-69 .first-slider-button-right {
	position: absolute;
	top: 50%;
	transform: translate(0%, -50%);
	transition: opacity 0.1s ease-in-out;
}

.block-type-69 .first-slider-button-left {
	left: 0;
}

.block-type-69 .first-slider-button-right {
	right: 0;
}

.block-type-69 .dw-slider .buttons-container {
	position: relative;
	max-width: 1470px;
	margin: 0 auto;
	font-size: 0;
}

.block-type-69 .dw-slider .dw-slider-pager-container {
	position: absolute;
	bottom: 90px;
	display: inline-block;
	vertical-align: middle;
}

.block-type-69 .dw-slider .buttons-container li {
}

.block-type-69 .block-breadcrumbs span,
.block-type-69 .block-breadcrumbs a {
	color: #ffffff;
}

.block-type-69 .block-breadcrumbs span::after,
.block-type-69 .block-breadcrumbs a::after {
	margin: 0 5px;
	color: #ffffff;
	content: "-";
}

.block-type-69 .block-breadcrumbs span:last-child::after {
	content: "";
}

.block-type-69 .block-info-columns {
}

.block-type-69 .block-info-column {
	display: inline-block;
	font-size: 14px;
	vertical-align: top;
}

.block-type-69 .block-image {
	position: relative;
	height: 950px;
	padding-top: 60px;
	line-height: 950px;
	background-repeat: no-repeat;
	background-position: 0 100%;
	background-size: contain;
	transition: all 0.3s;
}

.block-type-69 .block-info-container {
	height: 850px;
	line-height: 850px;
}

.block-type-69 .block-adv-container {
	position: relative;
	z-index: 10;
	margin-top: -160px;
	padding-bottom: 60px;
}

.block-type-69 .block-image-mobile {
	display: none;
}

@media screen and (max-width: 1650px) {
	.block-type-69 {
		margin-top: -144px;
		padding-top: 144px;
	}

	.block-type-69 .dw-slider {
		height: 880px;
	}

	.block-type-69 .dw-slider .buttons-container {
		max-width: 1280px;
	}

	.block-type-69 .block-info-column:first-child {
		margin-top: 24px;
	}

	.block-type-69 .block-heading {
		font-size: 64px;
		line-height: 64px;
	}

	.block-type-69 .block-image {
		height: 710px;
		line-height: 710px;
	}

	.block-type-69 .block-button .button {
		padding: 0 48px;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-69 .dw-slider {
		height: 860px;
	}

	.block-type-69 .dw-slider .buttons-container {
		max-width: 1170px;
	}

	.block-type-69 .block-info-column:first-child {
		margin-top: 48px;
	}

	.block-type-69 .block-image {
		height: 690px;
		line-height: 690px;
	}

	.block-type-69 .block-spec .button {
		height: 48px;
		padding: 0 48px;
		line-height: 48px;
		border-radius: 40px / 40px;
	}
}

@media screen and (max-width: 1366px) {
	.block-type-69 .block-heading-sub {
		font-size: 20px;
		line-height: 24px;
	}

	.block-type-69 .block-description {
		margin-top: 12px;
		font-size: 14px;
		line-height: 16px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-69 {
	}

	.block-type-69 {
		padding-bottom: 48px;
	}

	.block-type-69 .dw-slider {
		height: 722px;
	}

	.block-type-69 .dw-slider .buttons-container {
		max-width: 960px;
	}

	.block-type-69 .block-image {
		height: 600px;
		line-height: 600px;
	}

	.block-type-69 .block-image img {
		max-width: 100%;
	}

	.block-type-69 .block-heading {
		font-size: 46px;
		line-height: 46px;
	}

	.block-type-69 .block-adv-container {
		padding-top: 60px;
		padding-bottom: 0;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-69 {
		margin-top: -164px;
		padding-top: 164px;
		padding-bottom: 28px;
	}

	.block-type-69 .dw-slider {
		height: 690px;
		margin-bottom: -364px;
	}

	.block-type-69 .dw-slider .buttons-container {
		max-width: 700px;
	}

	.block-type-69 .dw-slider .buttons-container,
	.block-type-69 .dw-slider .dw-slider-pager-container,
	.block-type-69 .first-slider-button-left,
	.block-type-69 .first-slider-button-right {
		display: none;
	}

	.block-type-69 .block-image {
		height: 570px;
		padding-top: 44px;
		line-height: 570px;
	}

	.block-type-69 .block-info-columns .block-info-column:first-child {
		margin-top: 40px;
	}

	.block-type-69 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-69 .block-heading-sub {
		margin-top: 12px;
	}

	.block-type-69 .block-spec .button {
		height: 34px;
		padding: 0 18px;
		line-height: 34px;
		border-radius: 34px / 34px;
	}

	.block-type-69 .block-adv-container {
		padding-bottom: 0;
	}

	.block-type-69 .block-image-mobile {
		display: block;
		height: 390px;
		margin-top: 0;
		line-height: 390px;
		text-align: center;
	}

	.block-type-69 .block-image-mobile img {
		max-width: 100%;
		max-height: 100%;
		margin-top: 0;
		vertical-align: middle;
	}

	.block-type-69 .block-image {
		display: none;
	}

	.block-type-69 .block-breadcrumbs {
		height: 24px;
		margin-bottom: 12px;
		overflow: hidden;
	}

	.block-type-69 .block-breadcrumbs .breadcrumbs-content {
		height: 48px;
		overflow: auto;
		white-space: nowrap;
	}
}

@media screen and (max-width: 760px) {
	.block-type-69 {
		margin-top: -164px;
		padding-top: 164px;
	}

	.block-type-69 .dw-slider {
		height: 530px;
		margin-bottom: 0;
	}

	.block-type-69 .block-info-columns {
		padding-right: 12px;
		padding-left: 12px;
	}

	.block-type-69 .block-info-columns .block-info-column:first-child {
		position: relative;
		z-index: 1;
		display: block;
		max-width: 440px;
		margin: 0 auto;
		margin-top: 24px;
	}

	.block-type-69 .block-heading-sub {
		font-size: 18px;
		line-height: 18px;
	}

	.block-type-69 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-69 .block-description {
		display: none;
	}

	.block-type-69 .block-spec {
		margin-top: 12px;
	}

	.block-type-69 .block-spec > div {
		display: inline-block;
		margin-right: 12px;
	}

	.block-type-69 .block-adv-container {
		margin-top: 0;
		padding-top: 0;
	}
}

@media screen and (max-width: 500px) {
	.block-type-69 {
		margin-top: -172px;
		padding-top: 172px;
	}

	.block-type-69 .dw-slider {
		height: 520px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-69 {
	}

	.block-type-69 .dw-slider {
		height: 440px;
	}

	.block-type-69 .block-heading {
		font-size: 21px;
		line-height: 21px;
	}

	.block-type-69 .block-heading-sub {
		font-size: 16px;
		line-height: 18px;
	}

	.block-type-69 .block-image-mobile {
		height: 240px;
		line-height: 240px;
		text-align: center;
	}

	.block-type-69 .block-spec .button {
		margin-bottom: 12px;
	}
}

@media screen and (max-width: 420px) {
	.block-type-69 {
		margin-top: -158px;
		padding-top: 158px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-69 .dw-slider {
		height: 460px;
	}

	.block-type-69 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-69 .block-image-mobile {
		height: 280px;
		line-height: 280px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block70.css?17690164974279*/
.block-type-70 {
	margin-top: -162px;
	background-color: #000000;
	background-position: 0 90px;
	background-size: 100% auto;
}

.block-type-70 .block-breadcrumbs span,
.block-type-70 .block-breadcrumbs a {
	color: #ffffff;
}

.block-type-70 .block-breadcrumbs span::after,
.block-type-70 .block-breadcrumbs a::after {
	margin: 0 5px;
	color: #ffffff;
	content: "-";
}

.block-type-70 .block-breadcrumbs span:last-child::after {
	content: "";
}

.block-type-70 .block-info-columns {
}

.block-type-70 .block-info-column {
	display: inline-block;
	font-size: 14px;
	vertical-align: middle;
}

.block-type-70 .block-info-container {
	height: 960px;
	line-height: 960px;
}

.block-type-70 .block-adv-container {
	position: relative;
	z-index: 10;
	margin-top: -160px;
}

.block-type-70 .block-button {
	line-height: normal;
}

.block-type-70 .block-picture-link img {
	width: 100%;
	box-shadow: 0 0 10px rgb(255 255 255 / 50%);
}

.block-type-70 .block-container-picture:not(:first-child) {
	padding-left: 24px;
}

@media screen and (max-width: 1650px) {
	.block-type-70 {
		margin-top: -144px;
		padding-top: 144px;
	}

	.block-type-70 .block-info-container {
		height: 760px;
		line-height: 760px;
	}

	.block-type-70 .block-heading {
		font-size: 64px;
		line-height: 64px;
	}

	.block-type-70 .block-inform {
		padding-top: 144px;
	}
}

@media screen and (max-width: 1425px) {
}

@media screen and (max-width: 1366px) {
	.block-type-70 .block-heading-sub {
		font-size: 20px;
		line-height: 24px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-70 {
	}

	.block-type-70 .block-info-container {
		height: 660px;
		line-height: 660px;
	}

	.block-type-70 .block-inform {
		padding-top: 106px;
	}

	.block-type-70 .block-heading {
		font-size: 46px;
		line-height: 46px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-70 {
		margin-top: -150px;
		padding-top: 150px;
	}

	.block-type-70 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-70 .block-info-container {
		height: 530px;
		line-height: 530px;
	}

	.block-type-70 .block-inform {
		padding-top: 72px;
	}

	.block-type-70 .block-button .button {
		height: 42px;
		padding: 0 24px;
		line-height: 42px;
		border-radius: 40px / 40px;
	}

	.block-type-70 .block-breadcrumbs {
		height: 24px;
		margin-bottom: 12px;
		overflow: hidden;
	}

	.block-type-70 .block-breadcrumbs .breadcrumbs-content {
		height: 48px;
		overflow: auto;
		white-space: nowrap;
	}
}

@media screen and (max-width: 760px) {
	.block-type-70 {
		margin-top: -164px;
		padding-top: 164px;
	}

	.block-type-70 .block-info-container {
		height: 520px;
		line-height: 520px;
	}

	.block-type-70 .block-heading {
		font-size: 52px;
		line-height: 52px;
	}

	.block-type-70 .block-heading-sub {
		font-size: 18px;
		line-height: 18px;
	}

	.block-type-70 .block-description {
		display: none;
	}

	.block-type-70 .block-inform {
		padding-top: 60px;
	}

	.block-type-70 .block-adv-container {
		margin-top: -190px;
	}

	.block-type-70 .block-adv-container .block-line-container {
		padding: 0;
	}

	.block-type-70 .block-adv-container .block-container {
		display: block;
	}

	.block-type-70 .block-adv-container .block-container-picture {
		display: block;
	}

	.block-type-70 .block-adv-container .block-container-picture:not(:first-child) {
		padding-top: 24px;
	}
}

@media screen and (max-width: 500px) {
	.block-type-70 {
		margin-top: -172px;
		padding-top: 172px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-70 {
	}

	.block-type-70 .block-heading {
		font-size: 21px;
		line-height: 21px;
	}

	.block-type-70 .block-heading-sub {
		font-size: 16px;
		line-height: 18px;
	}

	.block-type-70 .block-info-container {
		height: 460px;
		line-height: 460px;
	}

	.block-type-70 .block-inform {
		padding-top: 36px;
	}

	.block-type-70 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-70 .block-description {
		line-height: normal;
	}

	.block-type-70 .block-button .button {
		height: 34px;
		padding: 0 18px;
		line-height: 34px;
		border-radius: 34px / 34px;
	}
}

@media screen and (max-width: 420px) {
	.block-type-70 {
		margin-top: -158px;
		padding-top: 158px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-70 .block-button {
		margin-top: 24px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block71.css?17690163654034*/
.block-type-71 .block-type-71-items {
	margin: 48px -12px 0;
}

.block-type-71 .block-type-71-item {
	position: relative;
	box-sizing: border-box;
	padding: 0 12px;
}

.block-type-71 .block-type-71-item-container {
	display: inline-block;
	box-sizing: border-box;
	height: 100%;
	line-height: normal;
	vertical-align: middle;
}

.block-type-71 .block-item-heading {
}

.block-type-71 .item-picture {
	margin-top: -70px;
}

.block-type-71 .item-table {
}

.block-type-71 .item-table table {
	width: 100%;
	border-spacing: 0;
}

.block-type-71 .item-table table td {
	padding: 12px 24px;
}

.block-type-71 .item-table table tr:first-child td {
	border-left: 0;
}

.block-type-71 .item-table table td:not(:first-child) {
	width: 15%;
	text-align: center;
	border-left: 1px #f2f2f2 solid;
}

.block-type-71 .item-table table tr:last-child td {
	padding: 12px 24px;
	border-top: 1px #f2f2f2 solid;
}

.block-type-71 .item-table table tr:last-child td:not(:first-child) {
	padding: 24px 0;
	vertical-align: bottom;
}

@media screen and (max-width: 2100px) {
}

@media screen and (max-width: 1650px) {
	.block-type-71 .block-type-71-items {
		margin-top: 36px;
	}

	.block-type-71 .block-special-timer {
		padding-top: 12px;
		padding-bottom: 12px;
	}

	.block-type-71 .special-timer-delimiter-label,
	.block-type-71 .special-timer-item-value,
	.block-type-71 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-71 .block-heading {
		margin-bottom: 12px;
	}

	.block-type-71 .item-table table .item-table-price {
		font-size: 20px;
		line-height: 24px;
	}
}

@media screen and (max-width: 1450px) {
	.block-type-71 .item-table table .item-table-price {
		font-size: 18px;
		line-height: 24px;
	}
}

@media screen and (max-width: 1366px) {
	.block-type-71 .item-table table td:not(:first-child) {
		width: 16%;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-71 .special-timer-delimiter-label,
	.block-type-71 .special-timer-item-value,
	.block-type-71 .block-heading {
		font-size: 40px;
		line-height: 40px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-71 {
		padding-top: 36px;
		padding-bottom: 36px;
	}

	.block-type-71 .special-timer-delimiter-label,
	.block-type-71 .special-timer-item-value,
	.block-type-71 .block-heading {
		font-size: 34px;
		line-height: 34px;
	}

	.block-type-71 .block-description {
		margin-bottom: 24px;
	}

	.block-type-71 .block-info-container,
	.block-type-71 .block-tools-container {
		display: inline-block;
	}

	.block-type-71 .item-table table {
		display: inline-block;
		max-width: 100%;
		overflow-x: auto;
	}

	.block-type-71 .item-table table tr:first-child {
		font-size: 14px;
		white-space: nowrap;
	}

	.block-type-71 .item-table table tr:last-child td:not(:first-child),
	.block-type-71 .item-table table tr:last-child td,
	.block-type-71 .item-table table td {
		padding: 12px;
	}

	.block-type-71 .item-table table tr:last-child td {
		white-space: normal;
	}

	.block-type-71 .item-table table tr:not(:last-child) td {
		white-space: nowrap;
	}

	.block-type-71 .item-table table .item-table-price {
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-71 .item-table table .item-table-discount {
		font-size: 12px;
		line-height: 16px;
	}

	.block-type-71 .item-table table .button {
		height: 36px;
		margin-top: 12px;
		line-height: 36px;
	}
}

@media screen and (max-width: 760px) {
	.block-type-71 .special-timer-delimiter-label,
	.block-type-71 .special-timer-item-value,
	.block-type-71 .block-heading {
		font-size: 28px;
		line-height: 28px;
	}

	.block-type-71 .item-table table tr:not(:first-child) {
		font-size: 13px;
		line-height: 13px;
	}

	.block-type-71 .item-table table tr:last-child td:not(:first-child),
	.block-type-71 .item-table table tr:last-child td,
	.block-type-71 .item-table table td {
		padding: 12px;
	}

	.block-type-71 .item-table table .item-table-discount {
		font-size: 11px;
		line-height: 16px;
	}

	.block-type-71 .item-table table .item-table-price {
		font-size: 13px;
		line-height: 16px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block73.css?1769016371604*/
.block-type-73 {
}

@media screen and (max-width: 2100px) {
}

@media screen and (max-width: 1650px) {
	.block-type-73 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-73 .block-heading {
		font-size: 40px;
		line-height: 40px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-73 {
		padding-top: 36px;
		padding-bottom: 24px;
	}

	.block-type-73 .block-heading {
		font-size: 34px;
		line-height: 34px;
	}
}

@media screen and (max-width: 760px) {
	.block-type-73 .block-heading {
		font-size: 28px;
		line-height: 28px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block75.css?17690161652102*/
.block-type-75 blockquote {
	position: relative;
	text-align: center;
}

.block-type-75 blockquote::before {
	position: absolute;
	top: 35%;
	left: -70px;
	display: block;
	width: 57px;
	height: 47px;
	background-image: url("/local/templates/dw/assets/css/blocks/../../images/75-1_blockquote.png");
	content: "";
}

.block-type-75 blockquote::after {
	position: absolute;
	top: 35%;
	right: -70px;
	display: block;
	width: 57px;
	height: 47px;
	background-image: url("/local/templates/dw/assets/css/blocks/../../images/75-2_blockquote.png");
	content: "";
}

.block-type-75 blockquote p {
	margin-top: 0;
	margin-right: 60px;
	margin-left: 60px;
	font-size: 21px;
}

.block-type-75 blockquote p + p {
	font-size: 14px;
}

.block-type-75 blockquote cite {
	color: rgb(0 0 0 / 45%);
	font-size: 14px;
	font-style: normal;
}

@media screen and (max-width: 1000px) {
	.block-type-75 {
		padding-top: 36px;
		padding-bottom: 36px;
	}

	.block-type-75 .block-main-container {
		padding-right: 12px;
		padding-left: 12px;
	}

	.block-type-75 blockquote::before {
		top: 15%;
		left: 0;
		width: 32px;
		height: 26px;
		background-size: cover;
	}

	.block-type-75 blockquote::after {
		top: auto;
		right: 0;
		bottom: 10%;
		width: 32px;
		height: 26px;
		background-size: cover;
	}
}

@media screen and (max-width: 760px) {
	.block-type-75 blockquote {
		padding-top: 6px;
		padding-bottom: 6px;
		text-align: left;
	}

	.block-type-75 blockquote p {
		margin-right: 25px;
		margin-left: 25px;
	}

	.block-type-75 blockquote cite {
		margin-left: 25px;
	}

	.block-type-75 blockquote::before {
		top: -24px;
		left: -5px;
	}

	.block-type-75 blockquote::after {
		right: -5px;
		bottom: -24px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-75 .block-main-container {
		padding-right: 36px;
		padding-left: 36px;
	}

	.block-type-75 blockquote p {
		margin-right: 0;
		margin-left: 0;
	}

	.block-type-75 blockquote cite {
		margin-left: 0;
	}

	.block-type-75 blockquote::before {
		left: -28px;
	}

	.block-type-75 blockquote::after {
		right: -28px;
	}
}

@media screen and (max-width: 360px) {
	.block-type-75 blockquote p {
		font-size: 18px;
		text-align: left;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block77.css?1769016497143*/
.block-type-77 {
}

.block-type-77 .snippet-type-8 {
	position: absolute;
	top: 90px;
	left: 45%;
}

@media screen and (max-width: 2100px) {
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block78.css?1769016300143*/
.block-type-78 {
}

.block-type-78 .snippet-type-8 {
	position: absolute;
	top: 90px;
	left: 45%;
}

@media screen and (max-width: 2100px) {
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block79.css?1769016165143*/
.block-type-79 {
}

.block-type-79 .snippet-type-8 {
	position: absolute;
	top: 90px;
	left: 45%;
}

@media screen and (max-width: 2100px) {
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block80.css?17690161661668*/
.block-type-80 {
	height: 650px;
	margin-top: -162px;
	line-height: 650px;
	background-color: #f5f5f5;
	background-position: top center;
}

.block-type-80 .block-info-columns {
	display: inline-block;
	font-size: 14px;
	vertical-align: bottom;
}

.block-type-80 .block-info-column {
	line-height: normal;
}

@media screen and (max-width: 2100px) {
}

@media screen and (max-width: 1650px) {
	.block-type-80 {
		margin-top: -146px;
		padding-top: 146px;
	}
}
@media screen and (max-width: 1366px) {
	.block-type-80 .block-info-columns {
		vertical-align: middle;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-80 {
		margin-top: -150px;
		padding-top: 150px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-80 {
		margin-top: -154px;
		padding-top: 154px;
	}

	.block-type-80 .block-info-columns {
		vertical-align: middle;
	}

	.block-type-80 .block-info-column {
		width: 100%;
	}

	.block-type-80 .block-info-column img {
		width: 100%;
	}
}

@media screen and (max-width: 760px) {
	.block-type-80 {
		height: 400px;
		margin-top: -168px;
		padding-top: 168px;
		line-height: 400px;
	}

	.block-type-80 .block-image {
		margin-top: 36px;
	}
}

@media screen and (max-width: 500px) {
	.block-type-80 {
		height: 360px;
		margin-top: -166px;
		padding-top: 166px;
		line-height: 360px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-80 {
	}

	.block-type-80 .block-heading {
		font-size: 22px;
		line-height: 24px;
	}
}

@media screen and (max-width: 420px) {
	.block-type-80 {
		margin-top: -160px;
		padding-top: 160px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-80 {
		margin-top: -150px;
		padding-top: 150px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block81.css?17690164973839*/
.block-type-81 {
	margin-top: -162px;
	background-color: #000000;
	background-position: 0 0;
	background-size: 100% auto;
}

.block-type-81 .block-breadcrumbs span,
.block-type-81 .block-breadcrumbs a {
	color: #ffffff;
}

.block-type-81 .block-breadcrumbs span::after,
.block-type-81 .block-breadcrumbs a::after {
	margin: 0 5px;
	color: #ffffff;
	content: "-";
}

.block-type-81 .block-breadcrumbs span:last-child::after {
	content: "";
}

.block-type-81 .block-info-columns {
}

.block-type-81 .block-info-column {
	display: inline-block;
	font-size: 14px;
	vertical-align: top;
}

.block-type-81 .block-image {
	position: relative;
	height: 750px;
	line-height: 750px;
	background-repeat: no-repeat;
	background-position: 50% 0;
	background-size: contain;
	transition: all 0.3s;
}

.block-type-81 .block-info-container {
	height: 860px;
	line-height: 860px;
}

.block-type-81 .block-adv-container {
	position: relative;
	z-index: 10;
	margin-top: -160px;
}

.block-type-81 .block-button {
	line-height: normal;
}

.block-type-81 .block-picture-link img {
	width: 100%;
	box-shadow: 0 0 10px #ffffff;
}

.block-type-81 .block-container-picture {
	vertical-align: top;
}

.block-type-81 .block-container-picture:not(:first-child) {
	padding-left: 24px;
}

.block-type-81 .block-container-picture .block-picture-link {
}

@media screen and (max-width: 1650px) {
	.block-type-81 {
		margin-top: -146px;
		padding-top: 146px;
	}

	.block-type-81 .block-info-container {
		height: 720px;
		line-height: 720px;
	}

	.block-type-81 .block-heading {
		font-size: 60px;
		line-height: 60px;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-81 .block-info-container {
		height: 640px;
		line-height: 640px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-81 {
		margin-top: -150px;
		padding-top: 150px;
	}

	.block-type-81 .block-heading {
		font-size: 52px;
		line-height: 52px;
	}

	.block-type-81 .block-sub-heading {
		font-size: 30px;
		line-height: 30px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-81 {
		margin-top: -154px;
		padding-top: 154px;
	}

	.block-type-81 .block-info-container {
		height: 600px;
		line-height: 600px;
	}

	.block-type-81 .block-info-column {
		margin-top: 48px;
	}

	.block-type-81 .block-inform {
		padding-top: 72px;
	}

	.block-type-81 .block-button .button {
		height: 42px;
		padding: 0 24px;
		line-height: 42px;
		border-radius: 40px / 40px;
	}
}

@media screen and (max-width: 760px) {
	.block-type-81 {
		margin-top: -168px;
		padding-top: 168px;
	}

	.block-type-81 .block-info-container {
		height: 580px;
		line-height: 580px;
	}

	.block-type-81 .block-info-column {
		margin-top: 36px;
	}

	.block-type-81 .block-heading {
		font-size: 42px;
		line-height: 42px;
	}

	.block-type-81 .block-sub-heading {
		font-size: 24px;
		line-height: 28px;
	}

	.block-type-81 .block-adv-container .block-line-container {
		padding: 0;
	}

	.block-type-81 .block-adv-container .block-container {
		display: block;
	}

	.block-type-81 .block-adv-container .block-container-picture {
		display: block;
	}

	.block-type-81 .block-adv-container .block-container-picture:not(:first-child) {
		padding-top: 24px;
		padding-left: 0;
	}
}

@media screen and (max-width: 500px) {
	.block-type-81 {
		margin-top: -164px;
		padding-top: 164px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-81 {
		margin-top: -150px;
	}

	.block-type-81 .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-81 .block-sub-heading {
		font-size: 18px;
		line-height: 18px;
	}

	.block-type-81 .block-description {
		line-height: normal;
	}

	.block-type-81 .block-button .button {
		height: 34px;
		padding: 0 18px;
		line-height: 34px;
		border-radius: 34px / 34px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-81 .block-button {
		margin-top: 24px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block83.css?17690163756249*/
.block-type-83 {
	margin-top: -162px;
	background-color: #f5f5f5;
	background-position: top center;
}

.block-type-83 .dw-slider {
	position: relative;
	height: 920px;
}

.block-type-83 .slider-container {
	position: relative;
	height: 100%;
	overflow: hidden;
}

.block-type-83 .first-slider-button-left,
.block-type-83 .first-slider-button-right {
	position: absolute;
	top: 50%;
	transform: translate(0%, -50%);
	transition: opacity 0.1s ease-in-out;
}

.block-type-83 .first-slider-button-left {
	left: 0;
}

.block-type-83 .first-slider-button-right {
	right: 0;
}

.block-type-83 .dw-slider .buttons-container {
	position: relative;
	max-width: 1470px;
	margin: 0 auto;
	font-size: 0;
}

.block-type-83 .dw-slider .dw-slider-pager-container {
	position: absolute;
	bottom: 170px;
	display: inline-block;
	vertical-align: middle;
}

.block-type-83 .dw-slider .buttons-container li {
	cursor: pointer;
}

.block-type-83 .block-info-columns {
}

.block-type-83 .block-info-column {
	display: inline-block;
	font-size: 14px;
	vertical-align: middle;
}

.block-type-83 .block-image {
	display: none;
}

.block-type-83 .block-video {
	position: relative;
	height: 919px;
	line-height: 919px;
	background-repeat: no-repeat;
	background-position: 65% 0;
	transition: all 0.3s;
}

.block-type-83 .block-video:hover {
	opacity: 0.95;
}

.block-type-83 .block-video .item-video {
	position: absolute;
	top: 45%;
	left: 50%;
	z-index: 10;
	transform: translate(-50%, -50%);
}

.block-type-83 .snippet-circle-wrap {
	margin-right: auto;
	margin-left: auto;
}

@media screen and (max-width: 1650px) {
	.block-type-83 .block-heading {
		font-size: 80px;
		line-height: 80px;
	}

	.block-type-83 .block-spec .button {
		padding: 0 48px;
	}

	.block-type-83 .block-video {
		height: 820px;
		line-height: 820px;
		background-size: contain;
	}

	.block-type-83 .dw-slider .buttons-container {
		max-width: 1280px;
	}

	.block-type-83 .dw-slider .dw-slider-pager-container {
		bottom: 220px;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-83 .dw-slider {
		height: 650px;
	}

	.block-type-83 .dw-slider .buttons-container {
		max-width: 1170px;
	}

	.block-type-83 .dw-slider .dw-slider-pager-container {
		bottom: 60px;
	}

	.block-type-83 .block-heading {
		font-size: 64px;
		line-height: 64px;
	}

	.block-type-83 .block-video {
		height: 650px;
		line-height: 650px;
	}

	.block-type-83 .block-base-price span {
		font-size: 30px;
		line-height: 36px;
	}

	.block-type-83 .block-discount-price span {
		font-size: 18px;
		line-height: 22px;
	}

	.block-type-83 .block-description {
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-83 .block-spec .button {
		height: 48px;
		padding: 0 48px;
		line-height: 48px;
		border-radius: 40px / 40px;
	}
}

@media (max-width: 1650px) and (width >= 1251px) {
	.block-type-83 {
		margin-top: -146px;
		padding-top: 146px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-83 {
		margin-top: -170px;
		padding-top: 170px;
	}

	.block-type-83 .dw-slider .buttons-container {
		max-width: 960px;
	}

	.block-type-83 .dw-slider .dw-slider-pager-container {
		bottom: 60px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-83 {
		margin-top: -190px;
		padding-top: 190px;
		padding-bottom: 24px;
	}

	.block-type-83 .block-info-columns {
		padding-left: 24px;
	}

	.block-type-83 .block-info-columns .block-info-column:first-child {
		margin-top: 80px;
	}

	.block-type-83 .dw-slider {
		height: 480px;
	}

	.block-type-83 .dw-slider .buttons-container,
	.block-type-83 .first-slider-button-left,
	.block-type-83 .first-slider-button-right {
		display: none;
	}

	.block-type-83 .block-video {
		display: block;
		height: 480px;
		line-height: 480px;
	}

	.block-type-83 .block-heading {
		font-size: 48px;
		line-height: 48px;
	}

	.block-type-83 .block-base-price span {
		font-size: 18px;
		line-height: 22px;
	}

	.block-type-83 .block-discount-price span {
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-83 .snippet-type-6 .snippet-circle-wrap {
		width: 400px;
		height: 400px;
		margin-top: 0;
	}

	.block-type-83 .block-spec .button {
		height: 34px;
		padding: 0 18px;
		line-height: 34px;
		border-radius: 34px / 34px;
	}
}

@media screen and (max-width: 760px) {
	.block-type-83 {
		background: radial-gradient(circle farthest-corner at 65% 50%, #00d1ff, #0265dc) !important;
	}

	.block-type-83 .dw-slider {
		height: 580px;
	}

	.block-type-83 .slider-container .middle-wrapper {
		max-width: 100%;
	}

	.block-type-83 .block-info-columns {
		padding-left: 12px;
	}

	.block-type-83 .block-info-columns .block-info-column {
		width: 100%;
	}

	.block-type-83 .block-info-columns .block-info-column:first-child {
		position: relative;
		z-index: 1;
		display: block;
		max-width: 440px;
		margin: 0 auto;
		margin-top: 24px;
	}

	.block-type-83 .block-heading-sub {
		font-size: 18px;
		line-height: 22px;
	}

	.block-type-83 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-83 .block-price {
		margin-top: 6px;
	}

	.block-type-83 .block-base-price {
		display: inline-block;
		margin-right: 12px;
		font-size: 18px;
		line-height: 22px;
	}

	.block-type-83 .block-discount-price {
		display: inline-block;
		font-size: 14px;
		line-height: 16px;
	}

	.block-type-83 .block-image {
		display: block;
		height: 390px;
		line-height: 390px;
	}

	.block-type-83 .block-spec {
		margin-top: 12px;
	}

	.block-type-83 .block-spec > div {
		display: inline-block;
		margin-right: 12px;
	}

	.block-type-83 .block-image img {
		max-width: 100%;
		margin-top: -80px;
	}

	.block-type-83 .block-video {
		display: none;
	}
}

@media screen and (max-width: 460px) {
	.block-type-83 {
		margin-top: -164px;
	}

	.block-type-83 .block-info-columns .block-info-column:first-child {
		max-width: 330px;
	}
}

@media screen and (max-width: 420px) {
	.block-type-83 {
		margin-top: -150px;
		padding-top: 150px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-83 .dw-slider {
		height: 500px;
	}

	.block-type-83 .block-info-columns .block-info-column:first-child {
		max-width: 285px;
	}

	.block-type-83 .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-83 .block-image {
		height: 280px;
		line-height: 280px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/blocks/block84.css?17690164022379*/
.block-type-84 {
	margin-top: -162px;
	background-color: #f5f5f5;
}

.block-type-84 .block-info-column {
	display: inline-block;
	font-size: 14px;
	vertical-align: top;
}

.block-type-84 .block-button .button {
	margin-right: 24px;
}

.block-type-84 .block-button .button:last-child {
	margin-right: 0;
}

@media screen and (max-width: 1650px) {
	.block-type-84 {
		padding-bottom: 48px;
	}

	.block-type-84 .block-info-column {
		margin-top: 48px;
	}
}

@media screen and (max-width: 1425px) {
	.block-type-84 .block-info-column .block-heading {
		font-size: 46px;
		line-height: 46px;
	}

	.block-type-84 .block-button .button {
		margin-right: 12px;
	}
}

@media (max-width: 1650px) and (width >= 1251px) {
	.block-type-84 {
		margin-top: -140px;
		padding-top: 140px;
	}
}

@media screen and (max-width: 1250px) {
	.block-type-84 {
		margin-top: -148px;
		padding-top: 148px;
	}

	.block-type-84 .block-info-column .block-heading {
		font-size: 32px;
		line-height: 32px;
	}
}

@media screen and (max-width: 1000px) {
	.block-type-84 {
		margin-top: -165px;
		padding-top: 165px;
	}

	.block-type-84 .block-info-column .block-heading {
		margin-top: 12px;
		font-size: 24px;
		line-height: 24px;
	}

	.block-type-84 .block-info-column .block-description {
		margin-top: 12px;
		font-size: 14px;
		line-height: 18px;
	}

	.block-type-84 .block-button .button {
		height: 36px;
		margin-right: 12px;
		padding: 0 18px;
		line-height: 36px;
		border-radius: 36px / 36px;
	}
}

@media screen and (max-width: 760px) {
	.block-type-84 {
		margin-top: -170px;
		padding-top: 170px;
		padding-bottom: 24px;
	}

	.block-type-84 .block-info-column {
		margin-top: 24px;
	}

	.block-type-84 .block-info-column .block-heading {
		font-size: 36px;
		line-height: 36px;
	}

	.block-type-84 .block-button .button {
		margin-bottom: 12px;
	}
}

@media screen and (max-width: 460px) {
	.block-type-84 {
		margin-top: -164px;
	}

	.block-type-84 .block-info-column .block-heading {
		font-size: 30px;
		line-height: 30px;
	}

	.block-type-84 .block-button .button {
		width: 100%;
		height: 30px;
		margin-right: 0;
		padding: 0;
		line-height: 30px;
		border-radius: 30px / 30px;
	}
}

@media screen and (max-width: 420px) {
	.block-type-84 {
		margin-top: -150px;
		padding-top: 150px;
	}
}

@media screen and (max-width: 350px) {
	.block-type-84 .block-button .button {
		width: 100%;
	}
}

/* End */


/* Start:/local/templates/dw/assets/css/animations/animation1.css?17690161651750*/
.animation1 {
	position: relative;
	display: flex;
	width: 736px;
	height: 750px;
}

.animation1-image {
	position: absolute;
	top: 0;
	left: 0;
	opacity: 0;
	animation-name: animation-animation1;
	animation-timing-function: ease;
	animation-fill-mode: forwards;
}

.animation1-image img {
	max-width: 100%;
	max-height: 100%;
	vertical-align: middle;
}

.animation1-image-1 {
	animation-duration: 1s;
	animation-delay: 0s;
}

.animation1-image-2 {
	animation-duration: 2s;
	animation-delay: 0.5s;
}

.animation1-image-3 {
	animation-duration: 3s;
	animation-delay: 0.6s;
}

.animation1-image-4 {
	animation-duration: 2.8s;
	animation-delay: 0.7s;
}

.animation1-image-5 {
	animation-duration: 2.6s;
	animation-delay: 0.8s;
}

.animation1-image-6 {
	animation-duration: 2.4s;
	animation-delay: 0.9s;
}

.animation1-image-7 {
	animation-duration: 2.2s;
	animation-delay: 1s;
}

.animation1-image-8 {
	animation-duration: 2s;
	animation-delay: 1.1s;
}

.animation1-image-9 {
	animation-duration: 1.8s;
	animation-delay: 1.2s;
}

.animation1-image-10 {
	animation-duration: 1.6s;
	animation-delay: 1.3s;
}

.animation1-image-11 {
	animation-duration: 1.4s;
	animation-delay: 1.4s;
}

.animation1-image-12 {
	animation-duration: 2s;
	animation-delay: 1s;
}

.animation1-image-13 {
	animation-duration: 2s;
	animation-delay: 1.5s;
}

.animation1-image-14 {
	animation-duration: 2s;
	animation-delay: 2s;
}

.animation1-image-15 {
	animation-duration: 2s;
	animation-delay: 2.5s;
}

@keyframes animation-animation1 {
	from {
		opacity: 0;
	}

	to {
		opacity: 1;
	}
}

@media screen and (max-width: 1650px) {
	.animation1 {
		width: 486px;
		height: 500px;
	}
}

@media screen and (max-width: 1250px) {
	.animation1 {
		width: 416px;
		height: 430px;
	}
}

/* End */


/* Start:/local/templates/dw/assets/libs/photoswipe/photoswipe.min.css?17689970534507*/
/*! PhotoSwipe main CSS by Dmytro Semenov | photoswipe.com */.pswp,.pswp:focus,.pswp__icn:focus{outline:0}.pswp,.pswp__button,.pswp__icn,.pswp__item,.pswp__scroll-wrap{overflow:hidden}.pswp{--pswp-bg:#000;--pswp-placeholder-bg:#222;--pswp-root-z-index:100000;--pswp-preloader-color:rgba(79, 79, 79, 0.4);--pswp-preloader-color-secondary:rgba(255, 255, 255, 0.9);--pswp-icon-color:#fff;--pswp-icon-color-secondary:#4f4f4f;--pswp-icon-stroke-color:#4f4f4f;--pswp-icon-stroke-width:2px;--pswp-error-text-color:var(--pswp-icon-color);position:fixed;top:0;left:0;width:100%;height:100%;z-index:var(--pswp-root-z-index);display:none;touch-action:none;opacity:.003;contain:layout style size;-webkit-tap-highlight-color:transparent}.pswp *{box-sizing:border-box}.pswp img{max-width:none;max-height:none}.pswp--open{display:block}.pswp,.pswp__bg{transform:translateZ(0);will-change:opacity}.pswp__bg{opacity:.005;background:var(--pswp-bg)}.pswp__bg,.pswp__container,.pswp__content,.pswp__img,.pswp__item,.pswp__scroll-wrap,.pswp__zoom-wrap{position:absolute;top:0;left:0;width:100%;height:100%}.pswp--click-to-zoom.pswp--zoom-allowed .pswp__img{cursor:-webkit-zoom-in;cursor:-moz-zoom-in;cursor:zoom-in}.pswp--click-to-zoom.pswp--zoomed-in .pswp__img{cursor:move;cursor:-webkit-grab;cursor:-moz-grab;cursor:grab}.pswp--click-to-zoom.pswp--zoomed-in .pswp__img:active{cursor:-webkit-grabbing;cursor:-moz-grabbing;cursor:grabbing}.pswp--no-mouse-drag.pswp--zoomed-in .pswp__img,.pswp--no-mouse-drag.pswp--zoomed-in .pswp__img:active,.pswp__img{cursor:-webkit-zoom-out;cursor:-moz-zoom-out;cursor:zoom-out}.pswp__button,.pswp__container,.pswp__counter,.pswp__img{-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.pswp__item{z-index:1}.pswp__hidden{display:none!important}.pswp__content{pointer-events:none}.pswp__content>*{pointer-events:auto}.pswp__error-msg-container{display:grid}.pswp__error-msg{margin:auto;font-size:1em;line-height:1;color:var(--pswp-error-text-color)}.pswp .pswp__hide-on-close{opacity:.005;will-change:opacity;transition:opacity var(--pswp-transition-duration) cubic-bezier(.4, 0, .22, 1);z-index:10;pointer-events:none}.pswp--ui-visible .pswp__hide-on-close{opacity:1;pointer-events:auto}.pswp__button{position:relative;display:block;width:50px;height:60px;padding:0;margin:0;cursor:pointer;background:0 0;border:0;box-shadow:none;opacity:.85;-webkit-appearance:none;-webkit-touch-callout:none}.pswp__button:active,.pswp__button:focus,.pswp__button:hover{transition:none;padding:0;background:0 0;border:0;box-shadow:none;opacity:1}.pswp__button:disabled{opacity:.3;cursor:auto}.pswp__icn{fill:var(--pswp-icon-color);color:var(--pswp-icon-color-secondary);position:absolute;top:14px;left:9px;width:32px;height:32px;pointer-events:none}.pswp__icn-shadow{stroke:var(--pswp-icon-stroke-color);stroke-width:var(--pswp-icon-stroke-width);fill:none}.pswp__img--with-bg,div.pswp__img--placeholder{background:var(--pswp-placeholder-bg)}.pswp__top-bar{position:absolute;left:0;top:0;width:100%;height:60px;display:flex;flex-direction:row;justify-content:flex-end;z-index:10;pointer-events:none!important}.pswp--one-slide .pswp__button--arrow,.pswp--zoomed-in .pswp__zoom-icn-bar-v,.pswp__button--zoom{display:none}.pswp__top-bar>*{pointer-events:auto;will-change:opacity}.pswp__button--close{margin-right:6px}.pswp__button--arrow{position:absolute;width:75px;height:100px;top:50%;margin-top:-50px}.pswp__button--arrow:disabled{display:none;cursor:default}.pswp__button--arrow .pswp__icn{top:50%;margin-top:-30px;width:60px;height:60px;background:0 0;border-radius:0}.pswp--touch .pswp__button--arrow{visibility:hidden}.pswp--has_mouse .pswp__button--arrow{visibility:visible}.pswp__button--arrow--prev{right:auto;left:0}.pswp__button--arrow--next{right:0}.pswp__button--arrow--next .pswp__icn{left:auto;right:14px;transform:scale(-1,1)}.pswp--zoom-allowed .pswp__button--zoom{display:block}.pswp__preloader{position:relative;overflow:hidden;width:50px;height:60px;margin-right:auto}.pswp__preloader .pswp__icn{opacity:0;transition:opacity .2s linear;animation:.6s linear infinite pswp-clockwise}.pswp__preloader--active .pswp__icn{opacity:.85}@keyframes pswp-clockwise{0%{transform:rotate(0)}100%{transform:rotate(360deg)}}.pswp__counter{height:30px;margin-top:15px;margin-inline-start:20px;font-size:14px;line-height:30px;color:var(--pswp-icon-color);text-shadow:1px 1px 3px var(--pswp-icon-color-secondary);opacity:.85}.pswp--one-slide .pswp__counter{display:none}

/* End */


/* Start:/local/templates/dw/assets/libs/splide/splide.min.css?17690081551965*/
@keyframes splide-loading{0%{transform:rotate(0)}to{transform:rotate(1turn)}}.splide__track--draggable{-webkit-touch-callout:none;-webkit-user-select:none;-ms-user-select:none;user-select:none}.splide__track--fade>.splide__list>.splide__slide{margin:0!important;opacity:0;z-index:0}.splide__track--fade>.splide__list>.splide__slide.is-active{opacity:1;z-index:1}.splide--rtl{direction:rtl}.splide__track--ttb>.splide__list{display:block}.splide__container{box-sizing:border-box;position:relative}.splide__list{backface-visibility:hidden;display:-ms-flexbox;display:flex;height:100%;margin:0!important;padding:0!important}.splide.is-initialized:not(.is-active) .splide__list{display:block}.splide__pagination{-ms-flex-align:center;align-items:center;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-pack:center;justify-content:center;margin:0;pointer-events:none}.splide__pagination li{display:inline-block;line-height:1;list-style-type:none;margin:0;pointer-events:auto}.splide:not(.is-overflow) .splide__pagination{display:none}.splide__progress__bar{width:0}.splide{position:relative;visibility:hidden}.splide.is-initialized,.splide.is-rendered{visibility:visible}.splide__slide{backface-visibility:hidden;box-sizing:border-box;-ms-flex-negative:0;flex-shrink:0;list-style-type:none!important;margin:0;position:relative}.splide__slide img{vertical-align:bottom}.splide__spinner{animation:splide-loading 1s linear infinite;border:2px solid #999;border-left-color:transparent;border-radius:50%;bottom:0;contain:strict;display:inline-block;height:20px;left:0;margin:auto;position:absolute;right:0;top:0;width:20px}.splide__sr{clip:rect(0 0 0 0);border:0;height:1px;margin:-1px;overflow:hidden;padding:0;position:absolute;width:1px}.splide__toggle.is-active .splide__toggle__play,.splide__toggle__pause{display:none}.splide__toggle.is-active .splide__toggle__pause{display:inline}.splide__track{overflow:hidden;position:relative;z-index:0}

/* End */


/* Start:/local/components/dw/sale.geo.positiion/templates/.default/style.css?176898915411794*/
.user-geo-position-label {
	margin-right: 6px;
}

.user-geo-position-label,
.user-geo-position-value {
	vertical-align: middle;
	display: inline-block;
	font-size: 13px;
}

#geo-location-window {
	-webkit-transition: 0.1s all ease-in-out;
	-o-transition: 0.1s all ease-in-out;
	transition: 0.1s all ease-in-out;
	background: rgba(0, 0, 0, 0.4);
	position: fixed;
	color: #000000;
	overflow: auto;
	z-index: 1000;
	height: 100%;
	width: 100%;
	left: 0px;
	top: 0px;
}

#geo-location-window.hidden {
	display: none;
}

#geo-location-window a {
	transition: none;
}

#geo-location-window .geo-location-window-container {
	-moz-transform: translateY(-50%) translateX(-50%);
	-o-transform: translateY(-50%) translateX(-50%);
	-webkit-transform: translateY(-50%) translateX(-50%);
	transform: translateY(-50%) translateX(-50%);
	-webkit-animation-duration: 0.2s;
	animation-duration: 0.2s;
	-webkit-animation-fill-mode: backwards;
	animation-fill-mode: backwards;
	-webkit-animation-name: zoomInLocation;
	animation-name: zoomInLocation;
	-webkit-box-sizing: border-box;
	-moz-box-sizing: border-box;
	box-sizing: border-box;
	position: absolute;
	min-height: 276px;
	max-height: 500px;
	padding: 0 24px;
	width: 800px;
	left: 50%;
	top: 50%;
}

#geo-location-window .geo-location-window-container-bg {
	box-shadow: 1px 1px 12px rgba(60, 60, 60, 0.3);
	background-color: #ffffff;
}

.geo-location-window-wp {
	vertical-align: middle;
	display: inline-block;
	line-height: 21px;
	width: 100%;
}

#geo-location-window .geo-location-window-heading {
	border-bottom: 1px solid #e7e8ea;
	background-color: #ffffff;
	position: relative;
	text-align: center;
	line-height: 60px;
	font-size: 18px;
	color: #000000;
}

#geo-location-window .geo-location-window-list {
	max-height: 180px;
	margin-top: 24px;
	padding: 0 24px;
	overflow: auto;
}

#geo-location-window .geo-location-window-list-item {
	/*text-transform: uppercase;*/
	overflow: hidden;
	float: left;
	width: 25%;
}

#geo-location-window .geo-location-window-list-item a {
	-webkit-transition: all 0.2s ease-in-out;
	-o-transition: all 0.2s ease-in-out;
	transition: all 0.2s ease-in-out;
	display: inline-block;
	text-decoration: none;
	line-height: 37px;
	overflow: hidden;
	color: #000000;
	height: 37px;
}

#geo-location-window .geo-location-window-list-item a:active {
	position: relative;
	top: 1px;
}

#geo-location-window .geo-location-window-list-item span {
	vertical-align: middle;
	display: inline-block;
	line-height: 21px;
}

.geo-location-window-search {
	margin-top: 24px;
	padding: 0 24px;
}

.geo-location-window-search-input {
	background: url(/local/components/dw/sale.geo.positiion/templates/.default/images/geo-search.png) 12px 50% no-repeat #f6f6f6;
	-webkit-transition: all 0.2s ease-in-out;
	-o-transition: all 0.2s ease-in-out;
	transition: all 0.2s ease-in-out;
	border: 1px solid #e6e6e6;
	-webkit-box-sizing: border-box;
	-moz-box-sizing: border-box;
	box-sizing: border-box;
	border-radius: 2px;
	padding: 0 42px;
	font-size: 14px;
	height: 48px;
	width: 100%;
}

.geo-location-window-search-input:focus {
	border: 1px solid #aaaaaa;
}

.geo-location-window-city-container {
	text-align: center;
	margin-top: 24px;
}

.geo-location-window-city-label,
.geo-location-window-city-value {
	display: inline-block;
}

.geo-location-window-button-container {
	margin-bottom: 24px;
	text-align: center;
	margin-top: 18px;
}

.geo-location-window-button {
	-webkit-transition: all 0.2s ease-in-out;
	-o-transition: all 0.2s ease-in-out;
	transition: all 0.2s ease-in-out;
	/*text-transform: uppercase;*/
	color: #ffffff !important;
	vertical-align: middle;
	display: inline-block;
	text-decoration: none;
	border-radius: 2px;
	text-align: center;
	position: relative;
	line-height: 50px;
	padding: 0 36px;
	font-size: 14px;
	opacity: 0.9;
	height: 50px;
}

.geo-location-window-button:active {
	position: relative;
	top: 1px;
}

.geo-location-window-button.modifed {
	opacity: 1;
}

.geo-location-window-button.disabled {
	pointer-events: none;
	opacity: 0.5;
}

.geo-location-window-button.loading {
	opacity: 0.5;
}

.geo-location-window-button.loading #geo-location-window-fast-loader {
	display: block;
	opacity: 1;
}

.geo-location-window-search-values-cn {
	position: relative;
}

.geo-location-window-search-values {
	position: absolute;
	max-height: 141px;
	overflow: auto;
	z-index: 99;
	width: 100%;
	left: 0px;
	top: 0px;
}

.geo-location-window-search-values .geo-location-list-item {
	-webkit-transition: all 0.2s ease-in-out;
	-o-transition: all 0.2s ease-in-out;
	transition: all 0.2s ease-in-out;
	border-top: 1px solid #e6e6e6;
	background-color: #eeeeee;
}

.geo-location-window-search-values .geo-location-list-item:hover {
	background-color: #e1e1e1;
}

.geo-location-window-search-values .geo-location-list-item:first-child {
	border: none;
}

.geo-location-window-search-values .geo-location-list-item a {
	-webkit-transition: all 0.2s ease-in-out;
	-o-transition: all 0.2s ease-in-out;
	transition: all 0.2s ease-in-out;
	color: #000000 !important;
	text-decoration: none;
	line-height: 35px;
	padding: 0 24px;
	display: block;
	height: 35px;
}

.geo-location-window-search-values .geo-location-list-item a:hover {
	opacity: 0.8;
}

.geo-location-window-search-values .geo-location-list-item a:active {
	position: relative;
	top: 1px;
}

#geo-location-window .geo-location-window-exit {
	position: absolute;
	display: block;
	height: 24px;
	width: 24px;
	right: 24px;
	top: 6px;
}

#geo-location-window .geo-location-window-exit:active span {
	transform: scale(0.9);
}

#geo-location-ref-window {
	box-shadow: 0px 0px 25px rgba(0, 0, 0, 0.15);
	background-color: #ffffff;
	box-sizing: border-box;
	position: absolute;
	border-radius: 4px;
	text-align: center;
	line-height: 14px;
	padding: 24px;
	display: none;
	width: 280px;
	z-index: 99;
	right: 0px;
	top: 0px;
}

#geo-location-ref-window.visible {
	display: block;
}

#geo-location-ref-window.centred {
	background-color: rgba(0, 0, 0, 0.45);
	border-radius: 0px;
	box-shadow: none;
	position: fixed;
	padding: 0px;
	height: 100%;
	width: 100%;
}

#geo-location-ref-window.centred .geo-location-ref-window-city-container {
	box-shadow: 0px 0px 25px rgba(0, 0, 0, 0.15);
	transform: translate(-50%, -50%);
	background-color: #ffffff;
	box-sizing: border-box;
	border-radius: 4px;
	position: absolute;
	padding: 24px;
	width: 280px;
	left: 50%;
	top: 50%;
}

.geo-location-ref-window-city-label {
	margin-bottom: 12px;
	line-height: normal;
	font-size: 14px;
}

.geo-location-ref-window-city-value {
	margin-bottom: 12px;
	line-height: 21px;
	font-size: 18px;
}

.get-location-ref-window-confirm-button {
	width: 100%;
}

.get-location-ref-window-confirm-button.loading {
	background-image: url(/local/components/dw/sale.geo.positiion/templates/.default/images/loader-38px.svg);
	background-position: 50% 50%;
	background-repeat: no-repeat;
	pointer-events: none;
	transition: none;
	opacity: 0.9;
}

.get-location-ref-window-confirm {
	margin-bottom: 12px;
}

@media all and (max-width: 850px) {
	#geo-location-window .geo-location-window-container {
		transform: translateX(0) translateY(-50%);
		width: 100%;
		left: 0px;
	}
}

@media all and (max-width: 700px) {
	#geo-location-window .geo-location-window-list-item {
		width: 33.333%;
	}

	#geo-location-window .geo-location-window-container {
		padding: 0 12px;
	}
}

@media all and (max-width: 500px) {
	#geo-location-window .geo-location-window-list-item {
		width: 50%;
	}
}

@media all and (max-width: 400px) {
	#geo-location-window .geo-location-window-list-item {
		width: 100%;
	}
}

/*loader*/
#geo-location-window-fast-loader {
	-webkit-transition: opacity 0.2s ease-in-out;
	-o-transition: opacity 0.2s ease-in-out;
	transition: opacity 0.2s ease-in-out;
	position: absolute;
	transform: scale(0.6);
	-o-transform: scale(0.6);
	-ms-transform: scale(0.6);
	-webkit-transform: scale(0.6);
	-moz-transform: scale(0.6);
	margin-left: -24px;
	display: none;
	height: 48px;
	width: 48px;
	opacity: 0;
	left: 50%;
	top: 0px;
}

.f_circleG {
	position: absolute;
	background-color: rgb(255, 255, 255);
	height: 9px;
	width: 9px;
	display: block;
	border-radius: 4px;
	-o-border-radius: 4px;
	-ms-border-radius: 4px;
	-webkit-border-radius: 4px;
	-moz-border-radius: 4px;
	animation-name: f_fadeG;
	-o-animation-name: f_fadeG;
	-ms-animation-name: f_fadeG;
	-webkit-animation-name: f_fadeG;
	-moz-animation-name: f_fadeG;
	animation-duration: 0.522s;
	-o-animation-duration: 0.522s;
	-ms-animation-duration: 0.522s;
	-webkit-animation-duration: 0.522s;
	-moz-animation-duration: 0.522s;
	animation-iteration-count: infinite;
	-o-animation-iteration-count: infinite;
	-ms-animation-iteration-count: infinite;
	-webkit-animation-iteration-count: infinite;
	-moz-animation-iteration-count: infinite;
	animation-direction: normal;
	-o-animation-direction: normal;
	-ms-animation-direction: normal;
	-webkit-animation-direction: normal;
	-moz-animation-direction: normal;
}

#frotateG_01 {
	left: 0;
	top: 19px;
	animation-delay: 0.1995s;
	-o-animation-delay: 0.1995s;
	-ms-animation-delay: 0.1995s;
	-webkit-animation-delay: 0.1995s;
	-moz-animation-delay: 0.1995s;
}

#frotateG_02 {
	left: 6px;
	top: 6px;
	animation-delay: 0.256s;
	-o-animation-delay: 0.256s;
	-ms-animation-delay: 0.256s;
	-webkit-animation-delay: 0.256s;
	-moz-animation-delay: 0.256s;
}

#frotateG_03 {
	left: 19px;
	top: 0;
	animation-delay: 0.3225s;
	-o-animation-delay: 0.3225s;
	-ms-animation-delay: 0.3225s;
	-webkit-animation-delay: 0.3225s;
	-moz-animation-delay: 0.3225s;
}

#frotateG_04 {
	right: 6px;
	top: 6px;
	animation-delay: 0.389s;
	-o-animation-delay: 0.389s;
	-ms-animation-delay: 0.389s;
	-webkit-animation-delay: 0.389s;
	-moz-animation-delay: 0.389s;
}

#frotateG_05 {
	right: 0;
	top: 19px;
	animation-delay: 0.4555s;
	-o-animation-delay: 0.4555s;
	-ms-animation-delay: 0.4555s;
	-webkit-animation-delay: 0.4555s;
	-moz-animation-delay: 0.4555s;
}

#frotateG_06 {
	right: 6px;
	bottom: 6px;
	animation-delay: 0.522s;
	-o-animation-delay: 0.522s;
	-ms-animation-delay: 0.522s;
	-webkit-animation-delay: 0.522s;
	-moz-animation-delay: 0.522s;
}

#frotateG_07 {
	left: 19px;
	bottom: 0;
	animation-delay: 0.5885s;
	-o-animation-delay: 0.5885s;
	-ms-animation-delay: 0.5885s;
	-webkit-animation-delay: 0.5885s;
	-moz-animation-delay: 0.5885s;
}

#frotateG_08 {
	left: 6px;
	bottom: 6px;
	animation-delay: 0.645s;
	-o-animation-delay: 0.645s;
	-ms-animation-delay: 0.645s;
	-webkit-animation-delay: 0.645s;
	-moz-animation-delay: 0.645s;
}

@keyframes f_fadeG {
	0% {
		background-color: rgb(0, 0, 0);
	}

	100% {
		background-color: rgb(255, 255, 255);
	}
}

@-o-keyframes f_fadeG {
	0% {
		background-color: rgb(0, 0, 0);
	}

	100% {
		background-color: rgb(255, 255, 255);
	}
}

@-ms-keyframes f_fadeG {
	0% {
		background-color: rgb(0, 0, 0);
	}

	100% {
		background-color: rgb(255, 255, 255);
	}
}

@-webkit-keyframes f_fadeG {
	0% {
		background-color: rgb(0, 0, 0);
	}

	100% {
		background-color: rgb(255, 255, 255);
	}
}

@-moz-keyframes f_fadeG {
	0% {
		background-color: rgb(0, 0, 0);
	}

	100% {
		background-color: rgb(255, 255, 255);
	}
}

@-webkit-keyframes zoomInLocation {
	from {
		opacity: 0;
		-webkit-transform: translateY(-50%) translateX(-50%) scale3d(0.3, 0.3, 0.3);
		transform: translateY(-50%) translateX(-50%) scale3d(0.3, 0.3, 0.3);
		-moz-transform: translateY(-50%) translateX(-50%) scale3d(0.3, 0.3, 0.3);
		-o-transform: translateY(-50%) translateX(-50%) scale3d(0.3, 0.3, 0.3);
	}

	50% {
		opacity: 1;
	}
}

@keyframes zoomInLocation {
	from {
		opacity: 0;
		-webkit-transform: translateY(-50%) translateX(-50%) scale3d(0.3, 0.3, 0.3);
		transform: translateY(-50%) translateX(-50%) scale3d(0.3, 0.3, 0.3);
		-moz-transform: translateY(-50%) translateX(-50%) scale3d(0.3, 0.3, 0.3);
		-o-transform: translateY(-50%) translateX(-50%) scale3d(0.3, 0.3, 0.3);
	}

	50% {
		opacity: 1;
	}
}

/* End */


/* Start:/local/templates/dw/components/dweb/uni.form/form-type-7/style.css?176901616410647*/
.header-callback .gUniFormModalWindow {
	position: fixed;
	top: 0;
	left: 0;
	z-index: 1000;
	display: none;
	width: 100%;
	height: 100%;
	overflow: hidden;
	line-height: 100vh;
	text-align: center;
	background: rgb(0 5 10 / 75%);
	transition: 0.1s all ease-in-out;
}

.header-callback .gUniFormModalWindowContainer {
	position: relative;
	display: inline-block;
	box-sizing: border-box;
	width: 500px;
	padding: 24px;
	line-height: 21px;
	text-align: left;
	vertical-align: middle;
	background-color: #ffffff;
	border-radius: 14px;
	box-shadow: 1px 1px 12px rgb(60 60 60 / 30%);
	animation-name: zoomIn;
	animation-duration: 0.2s;
	animation-fill-mode: both;
}

.header-callback .gUniFormHideScrollBar {
	position: relative;
	width: 120%;
	height: 100%;
	overflow: auto;
}

.header-callback .gUniFormCn100 {
	position: relative;
	width: 100vw;
	height: 100%;
}

.header-callback .gUniFormModalWindowExit {
	position: absolute;
	top: 24px;
	right: 24px;
	display: block;
	width: 24px;
	height: 24px;
	background: none;
	transition: none;
}

.header-callback .gUniFormModalWindowExit:active {
	transform: scale(0.8);
}

.header-callback .gUniFormModalWindow .uFormHeading {
	box-sizing: border-box;
	padding-right: 36px;
	padding-left: 36px;
	font-weight: 600;
	font-size: 24px;
	line-height: 28px;
	text-align: center;
}

.header-callback .gUniFormModalWindow .uFormDescription {
	margin: 6px 0 12px;
	color: #222222;
	font-size: 16px;
	line-height: 21px;
	text-align: center;
}

.header-callback .uLabel {
	margin: 12px 0;
	overflow: hidden;
}

.header-callback .uLabel .uName,
.header-callback .uLabel .uIcon {
	display: inline-block;
	vertical-align: middle;
}

.header-callback .uLabel .uName {
	margin-top: 3px;
}

.header-callback .uLabel .uIcon {
	margin-right: 6px;
}

.header-callback .uLabel .uIcon img {
	max-width: 100%;
	max-height: 100%;
	vertical-align: middle;
}

.header-callback .uLabel .uHint {
	float: right;
	margin-top: 3px;
	color: #888888;
}

.header-callback .uError,
.header-callback .uFormGlobalErrors {
	color: #ff0000;
}

.header-callback .uError,
.header-callback .uFormGlobalErrors {
	line-height: 28px;
}

.header-callback .uCaptchaContainer {
	height: 40px;
	margin-top: 12px;
	margin-bottom: 12px;
}

.header-callback .uCaptchaImage {
	max-width: 100%;
	height: 40px;
}

.header-callback .gUniForm input,
.header-callback .gUniForm textarea,
.header-callback .gUniForm select {
	box-sizing: border-box;
	width: 100%;
	margin: 0;
	padding: 0;
	color: #000000;
	font-size: 14px;
	background-color: #fdfdfd;
	border: 1px solid #e7e7e7;
	border-radius: 2px;
	outline: none;
	transition: all 0.2s ease-in-out;
}

.header-callback .gUniForm input:focus,
.header-callback .gUniForm textarea:focus,
.header-callback .gUniForm select:focus {
	background-color: #fcfcfc;
	border: 1px solid #cccccc;
}

.header-callback .gUniForm input[type="text"] {
	height: 50px;
	padding: 0 6px;
}

.header-callback .gUniForm input[type="file"] {
	margin: 4px;
	background-color: transparent;
	border: 0;
}

.header-callback .gUniForm input[type="checkbox"] {
	display: inline-block;
	width: auto;
	margin: 0 12px;
	vertical-align: middle;
}

.header-callback .gUniForm input[type="checkbox"] + label,
.header-callback .gUniForm input[type="radio"] + label {
	margin-right: 12px;
	cursor: pointer;
}

.header-callback .gUniForm input[type="checkbox"]:not(checked),
.header-callback .gUniForm input[type="radio"]:not(checked) {
	position: absolute;
	opacity: 0;
}

.header-callback .gUniForm input[type="checkbox"]:not(checked) + label,
.header-callback .gUniForm input[type="radio"]:not(checked) + label {
	position: relative;
	padding-left: 28px;
}

.header-callback .gUniForm input[type="checkbox"] + label::before {
	background: url("/local/templates/dw/components/dweb/uni.form/form-type-7/images/checkBox.png") 0 0 no-repeat transparent;
}

.header-callback .gUniForm input[type="radio"] + label::before {
	background: url("/local/templates/dw/components/dweb/uni.form/form-type-7/images/radio.png") 0 0 no-repeat transparent;
}

.header-callback .gUniForm input[type="checkbox"].error + label::before,
.header-callback .gUniForm input[type="radio"].error + label::before {
	border: 1px solid #ff0000;
	border-radius: 5px;
}

.header-callback .gUniForm input[type="checkbox"]:not(checked) + label::before,
.header-callback .gUniForm input[type="radio"]:not(checked) + label::before {
	position: absolute;
	top: 0;
	left: 0;
	width: 17px;
	height: 17px;
	content: " ";
}

.header-callback .gUniForm input[type="checkbox"]:not(checked) + label:hover::before,
.header-callback .gUniForm input[type="radio"]:not(checked) + label:hover::before {
	background-position: 0 -17px;
}

.header-callback .gUniForm input[type="checkbox"]:checked + label::before,
.header-callback .gUniForm input[type="radio"]:checked + label::before {
	background-position: 0 -34px;
}

.header-callback .gUniForm input[type="checkbox"]:checked + label:hover::before,
.header-callback .gUniForm input[type="radio"]:checked + label:hover::before {
	background-position: 0 -51px;
}

.header-callback .gUniForm input[type="checkbox"]:disabled + label,
.header-callback .gUniForm input[type="radio"]:disabled + label {
	cursor: default;
}

.header-callback .gUniForm input[type="checkbox"]:disabled + label::before,
.header-callback .gUniForm input[type="radio"]:disabled + label::before {
	background-position: 0 -68px !important;
}

.header-callback .gUniForm textarea {
	height: 120px;
	padding: 12px 6px;
}

.header-callback .gUniForm select {
	padding: 12px 6px;
}

.header-callback .gUniForm .error {
	position: relative;
	border: 1px solid #ff0000 !important;
}

.header-callback .gUniForm .error:focus {
	border: 1px solid #ff0000;
}

.header-callback .gUniForm .uformTools {
	margin-top: 12px;
	padding-bottom: 1px;
	overflow: hidden;
}

.header-callback .gUniForm .uFormButton {
	float: left;
	box-sizing: border-box;
	width: 50%;
}

.header-callback .gUniForm .uFormButton:first-child {
	padding-right: 6px;
}

.header-callback .gUniForm .uFormButton:last-child {
	padding-left: 6px;
}

.header-callback .gUniForm .uRequired {
	display: inline-block;
	color: #ff0000;
	vertical-align: middle;
}

.header-callback .gUniForm .uFormSubmit,
.header-callback .gUniForm .uFormReset {
	display: inline-block;
	box-sizing: border-box;
	width: 100%;
	height: 55px;
	line-height: 55px;
	text-align: center;
	border-radius: 2px;
	transition:
		border 0.2s ease-in-out,
		background-color 0.2s ease-in-out;
}

.header-callback .gUniForm .uFormSubmit.loading {
	transition: none;
}

.header-callback .gUniForm .uFormSubmit {
	color: #ffffff;
	background-color: #0d7cca;
}

.header-callback .gUniForm .uFormSubmit:hover {
	background-color: #068ae6;
}

.header-callback .gUniForm .uFormSubmit:active {
	position: relative;
	top: 1px;
}

.header-callback .gUniForm .uFormSubmit.loading {
	color: #dddddd;
	background-color: #000000 !important;
	background-image: url("/local/templates/dw/components/dweb/uni.form/form-type-7/images/loading.gif");
	background-repeat: no-repeat;
	background-position: 50% 50%;
	border: 1px solid #000000;
	opacity: 0.1;
	pointer-events: none;
}

.header-callback .gUniForm .uFormReset {
	color: #888888;
	border: 1px solid #e5e5e5;
}

.header-callback .gUniForm .uFormReset:hover {
	border: 1px solid #cfcfcf;
}

.header-callback .gUniForm .uFormReset:active {
	position: relative;
	top: 1px;
}

.header-callback .gUniForm .uToolsIcon {
	display: inline-block;
	margin-top: -1px;
	margin-right: 12px;
	vertical-align: middle;
}

.header-callback .gUniForm .eFormHidden {
	display: none;
}

.header-callback .gUniFormSuccess {
	position: fixed;
	top: 0;
	left: 0;
	z-index: 1000;
	display: none;
	width: 100%;
	height: 100%;
	overflow: auto;
	color: #000000;
	background: rgb(0 5 10 / 75%);
	transition: 0.1s all ease-in-out;
}

.header-callback .gUniFormSuccessContainer {
	position: absolute;
	top: 50%;
	left: 50%;
	box-sizing: border-box;
	width: 500px;
	max-width: 100%;
	height: 300px;
	margin-top: -150px;
	margin-left: -250px;
	line-height: 270px;
	background-color: transparent;

	/* box-shadow: 1px 1px 12px rgba(60, 60, 60, 0.3); */
	border: 14px solid rgb(255 255 255 / 12%);
	border-radius: 14px;
	animation-name: zoomIn;
	animation-duration: 0.2s;
	animation-fill-mode: both;
}

.header-callback .gUniFormSuccessBg {
	background-color: #ffffff;
	border-radius: 4px;
}

.header-callback .gUniFormSuccessMiddler {
	display: inline-block;
	line-height: 21px;
	vertical-align: middle;
}

.header-callback .gUniFormSuccessHeading {
	padding: 0 24px;
	font-weight: 600;
	font-size: 24px;
	line-height: 30px;
	text-align: center;
	text-transform: uppercase;
}

.header-callback .gUniFormSuccessText {
	margin-top: 12px;
	padding: 0 24px;
	line-height: 21px;
	text-align: center;
}

.header-callback .gUniFormButtonContainter {
	text-align: center;
}

.header-callback .gUniFormSuccessButton {
	display: inline-block;
	height: 40px;
	margin-top: 18px;
	padding: 0 24px;
	color: #ffffff;
	line-height: 40px;
	text-align: center;
	vertical-align: middle;
	background-color: #000000;
	border-radius: 4px;
	transition: all 0.2s ease-in-out;
}

.header-callback .gUniFormSuccessButton:hover {
	color: #ffffff;
	opacity: 0.85;
}

.header-callback .gUniFormSuccessButton:active {
	position: relative;
	top: 1px;
}

.header-callback .gUniFormSuccessExit {
	position: absolute;
	top: 24px;
	right: 24px;
	display: block;
	width: 24px;
	height: 24px;
	background: none;
	transition: none;
}

.header-callback .gUniFormModalWindowExit:active {
	transform: scale(0.8);
}

.header-callback .eFormRequired {
	margin-top: 12px;
}

.header-callback .eFormBlur {
	filter: blur(3px);
}

@keyframes zoomIn {
	0% {
		transform: scale3d(0.3, 0.3, 0.3);
		opacity: 0;
	}

	50% {
		opacity: 1;
	}
}

@keyframes zoomIn {
	0% {
		transform: scale3d(0.3, 0.3, 0.3);
		opacity: 0;
	}

	50% {
		opacity: 1;
	}
}

@media all and (max-width: 650px) {
	.header-callback .gUniFormModalWindowContainer {
		width: 400px;
	}

	.header-callback .gUniFormSuccessContainer {
		width: 300px;
		margin-left: -150px;
	}
}

@media all and (max-width: 450px) {
	.header-callback .gUniFormModalWindowContainer {
		width: 340px;
	}

	.header-callback .gUniForm .uFormButton:first-child {
		width: 100%;
		padding: 0;
	}

	.header-callback .gUniForm .uFormButton:last-child {
		display: none;
	}
}

@media all and (max-width: 350px) {
	.header-callback .gUniFormModalWindow .uFormDescription {
		display: none;
	}

	.header-callback .gUniFormModalWindowContainer {
		width: 300px;
		padding: 12px;
	}

	.header-callback .gUniFormModalWindow .uFormHeading {
		box-sizing: border-box;
		margin-top: 6px;
		padding-right: 36px;
		line-height: normal;
		text-align: left;
	}

	.header-callback .gUniFormModalWindowExit {
		top: 22px;
		right: 12px;
	}
}

/* End */


/* Start:/local/templates/dw/components/dweb/uni.form/form-type-6/style.css?17690163572509*/
.block-advice .input.error,
.block-advice .textarea.error {
	border-top-color: transparent;
	border-right-color: transparent;
	border-bottom: 1px solid #ff0000;
	border-left-color: transparent;
}

.gUniFormSuccess {
	position: fixed;
	top: 0;
	left: 0;
	z-index: 1000;
	display: none;
	width: 100%;
	height: 100%;
	overflow: auto;
	background: rgb(0 5 10 / 75%);
	transition: 0.1s all ease-in-out;
}

.gUniFormSuccessContainer {
	position: absolute;
	top: 50%;
	left: 50%;
	box-sizing: border-box;
	width: 500px;
	max-width: 100%;
	height: 270px;
	margin-top: -125px;
	margin-left: -250px;
	line-height: 270px;
	background-color: transparent;

	/* box-shadow: 1px 1px 12px rgba(60, 60, 60, 0.3); */
	border: 14px solid rgb(255 255 255 / 12%);
	border-radius: 14px;
	animation-name: zoomIn;
	animation-duration: 0.2s;
	animation-fill-mode: both;
}

.gUniFormSuccessBg {
	background-color: #ffffff;
	border-radius: 4px;
}

.gUniFormSuccessMiddler {
	display: inline-block;
	line-height: 21px;
	vertical-align: middle;
}

.gUniFormSuccessHeading {
	padding: 0 24px;
	font-weight: bold;
	font-size: 24px;
	line-height: 30px;
	text-align: center;
	text-transform: uppercase;
}

.gUniFormSuccessText {
	margin-top: 12px;
	padding: 0 24px;
	line-height: 21px;
	text-align: center;
}

.gUniFormButtonContainter {
	text-align: center;
}

.gUniFormSuccessButton {
	display: inline-block;
	height: 40px;
	margin-top: 18px;
	padding: 0 24px;
	color: #ffffff;
	line-height: 40px;
	text-align: center;
	vertical-align: middle;
	background-color: #000000;
	border-radius: 4px;
	transition: all 0.2s ease-in-out;
}

.gUniFormSuccessButton:hover {
	color: #ffffff;
	opacity: 0.85;
}

.gUniFormSuccessButton:active {
	position: relative;
	top: 1px;
}

.gUniFormSuccessExit {
	position: absolute;
	top: -24px;
	right: -24px;
	display: block;
	width: 54px;
	height: 54px;
	background: url("/local/templates/dw/components/dweb/uni.form/form-type-6/images/exit.png") 0 0 no-repeat transparent;
	transition: none;
}

.gUniFormSuccessExit:hover {
	background-position: -54px 0;
}

.gUniFormSuccessExit:active {
	background-position: -108px 0;
}

.eFormBlur {
	filter: blur(3px);
}

.eFormRequired {
	margin-top: 12px;
}

.gUniForm .eFormHidden {
	display: none;
}

@keyframes zoomIn {
	0% {
		transform: scale3d(0.3, 0.3, 0.3);
		opacity: 0;
	}

	50% {
		opacity: 1;
	}
}

@keyframes zoomIn {
	0% {
		transform: scale3d(0.3, 0.3, 0.3);
		opacity: 0;
	}

	50% {
		opacity: 1;
	}
}

@media all and (max-width: 650px) {
	.gUniFormSuccessContainer {
		width: 300px;
		margin-left: -150px;
	}
}

/* End */


/* Start:/local/templates/dw/components/dweb/uni.form/form-type-9/style.css?176901636210647*/
.header-callback .gUniFormModalWindow {
	position: fixed;
	top: 0;
	left: 0;
	z-index: 1000;
	display: none;
	width: 100%;
	height: 100%;
	overflow: hidden;
	line-height: 100vh;
	text-align: center;
	background: rgb(0 5 10 / 75%);
	transition: 0.1s all ease-in-out;
}

.header-callback .gUniFormModalWindowContainer {
	position: relative;
	display: inline-block;
	box-sizing: border-box;
	width: 500px;
	padding: 24px;
	line-height: 21px;
	text-align: left;
	vertical-align: middle;
	background-color: #ffffff;
	border-radius: 14px;
	box-shadow: 1px 1px 12px rgb(60 60 60 / 30%);
	animation-name: zoomIn;
	animation-duration: 0.2s;
	animation-fill-mode: both;
}

.header-callback .gUniFormHideScrollBar {
	position: relative;
	width: 120%;
	height: 100%;
	overflow: auto;
}

.header-callback .gUniFormCn100 {
	position: relative;
	width: 100vw;
	height: 100%;
}

.header-callback .gUniFormModalWindowExit {
	position: absolute;
	top: 24px;
	right: 24px;
	display: block;
	width: 24px;
	height: 24px;
	background: none;
	transition: none;
}

.header-callback .gUniFormModalWindowExit:active {
	transform: scale(0.8);
}

.header-callback .gUniFormModalWindow .uFormHeading {
	box-sizing: border-box;
	padding-right: 36px;
	padding-left: 36px;
	font-weight: 600;
	font-size: 24px;
	line-height: 28px;
	text-align: center;
}

.header-callback .gUniFormModalWindow .uFormDescription {
	margin: 6px 0 12px;
	color: #222222;
	font-size: 16px;
	line-height: 21px;
	text-align: center;
}

.header-callback .uLabel {
	margin: 12px 0;
	overflow: hidden;
}

.header-callback .uLabel .uName,
.header-callback .uLabel .uIcon {
	display: inline-block;
	vertical-align: middle;
}

.header-callback .uLabel .uName {
	margin-top: 3px;
}

.header-callback .uLabel .uIcon {
	margin-right: 6px;
}

.header-callback .uLabel .uIcon img {
	max-width: 100%;
	max-height: 100%;
	vertical-align: middle;
}

.header-callback .uLabel .uHint {
	float: right;
	margin-top: 3px;
	color: #888888;
}

.header-callback .uError,
.header-callback .uFormGlobalErrors {
	color: #ff0000;
}

.header-callback .uError,
.header-callback .uFormGlobalErrors {
	line-height: 28px;
}

.header-callback .uCaptchaContainer {
	height: 40px;
	margin-top: 12px;
	margin-bottom: 12px;
}

.header-callback .uCaptchaImage {
	max-width: 100%;
	height: 40px;
}

.header-callback .gUniForm input,
.header-callback .gUniForm textarea,
.header-callback .gUniForm select {
	box-sizing: border-box;
	width: 100%;
	margin: 0;
	padding: 0;
	color: #000000;
	font-size: 14px;
	background-color: #fdfdfd;
	border: 1px solid #e7e7e7;
	border-radius: 2px;
	outline: none;
	transition: all 0.2s ease-in-out;
}

.header-callback .gUniForm input:focus,
.header-callback .gUniForm textarea:focus,
.header-callback .gUniForm select:focus {
	background-color: #fcfcfc;
	border: 1px solid #cccccc;
}

.header-callback .gUniForm input[type="text"] {
	height: 50px;
	padding: 0 6px;
}

.header-callback .gUniForm input[type="file"] {
	margin: 4px;
	background-color: transparent;
	border: 0;
}

.header-callback .gUniForm input[type="checkbox"] {
	display: inline-block;
	width: auto;
	margin: 0 12px;
	vertical-align: middle;
}

.header-callback .gUniForm input[type="checkbox"] + label,
.header-callback .gUniForm input[type="radio"] + label {
	margin-right: 12px;
	cursor: pointer;
}

.header-callback .gUniForm input[type="checkbox"]:not(checked),
.header-callback .gUniForm input[type="radio"]:not(checked) {
	position: absolute;
	opacity: 0;
}

.header-callback .gUniForm input[type="checkbox"]:not(checked) + label,
.header-callback .gUniForm input[type="radio"]:not(checked) + label {
	position: relative;
	padding-left: 28px;
}

.header-callback .gUniForm input[type="checkbox"] + label::before {
	background: url("/local/templates/dw/components/dweb/uni.form/form-type-9/images/checkBox.png") 0 0 no-repeat transparent;
}

.header-callback .gUniForm input[type="radio"] + label::before {
	background: url("/local/templates/dw/components/dweb/uni.form/form-type-9/images/radio.png") 0 0 no-repeat transparent;
}

.header-callback .gUniForm input[type="checkbox"].error + label::before,
.header-callback .gUniForm input[type="radio"].error + label::before {
	border: 1px solid #ff0000;
	border-radius: 5px;
}

.header-callback .gUniForm input[type="checkbox"]:not(checked) + label::before,
.header-callback .gUniForm input[type="radio"]:not(checked) + label::before {
	position: absolute;
	top: 0;
	left: 0;
	width: 17px;
	height: 17px;
	content: " ";
}

.header-callback .gUniForm input[type="checkbox"]:not(checked) + label:hover::before,
.header-callback .gUniForm input[type="radio"]:not(checked) + label:hover::before {
	background-position: 0 -17px;
}

.header-callback .gUniForm input[type="checkbox"]:checked + label::before,
.header-callback .gUniForm input[type="radio"]:checked + label::before {
	background-position: 0 -34px;
}

.header-callback .gUniForm input[type="checkbox"]:checked + label:hover::before,
.header-callback .gUniForm input[type="radio"]:checked + label:hover::before {
	background-position: 0 -51px;
}

.header-callback .gUniForm input[type="checkbox"]:disabled + label,
.header-callback .gUniForm input[type="radio"]:disabled + label {
	cursor: default;
}

.header-callback .gUniForm input[type="checkbox"]:disabled + label::before,
.header-callback .gUniForm input[type="radio"]:disabled + label::before {
	background-position: 0 -68px !important;
}

.header-callback .gUniForm textarea {
	height: 120px;
	padding: 12px 6px;
}

.header-callback .gUniForm select {
	padding: 12px 6px;
}

.header-callback .gUniForm .error {
	position: relative;
	border: 1px solid #ff0000 !important;
}

.header-callback .gUniForm .error:focus {
	border: 1px solid #ff0000;
}

.header-callback .gUniForm .uformTools {
	margin-top: 12px;
	padding-bottom: 1px;
	overflow: hidden;
}

.header-callback .gUniForm .uFormButton {
	float: left;
	box-sizing: border-box;
	width: 50%;
}

.header-callback .gUniForm .uFormButton:first-child {
	padding-right: 6px;
}

.header-callback .gUniForm .uFormButton:last-child {
	padding-left: 6px;
}

.header-callback .gUniForm .uRequired {
	display: inline-block;
	color: #ff0000;
	vertical-align: middle;
}

.header-callback .gUniForm .uFormSubmit,
.header-callback .gUniForm .uFormReset {
	display: inline-block;
	box-sizing: border-box;
	width: 100%;
	height: 55px;
	line-height: 55px;
	text-align: center;
	border-radius: 2px;
	transition:
		border 0.2s ease-in-out,
		background-color 0.2s ease-in-out;
}

.header-callback .gUniForm .uFormSubmit.loading {
	transition: none;
}

.header-callback .gUniForm .uFormSubmit {
	color: #ffffff;
	background-color: #0d7cca;
}

.header-callback .gUniForm .uFormSubmit:hover {
	background-color: #068ae6;
}

.header-callback .gUniForm .uFormSubmit:active {
	position: relative;
	top: 1px;
}

.header-callback .gUniForm .uFormSubmit.loading {
	color: #dddddd;
	background-color: #000000 !important;
	background-image: url("/local/templates/dw/components/dweb/uni.form/form-type-9/images/loading.gif");
	background-repeat: no-repeat;
	background-position: 50% 50%;
	border: 1px solid #000000;
	opacity: 0.1;
	pointer-events: none;
}

.header-callback .gUniForm .uFormReset {
	color: #888888;
	border: 1px solid #e5e5e5;
}

.header-callback .gUniForm .uFormReset:hover {
	border: 1px solid #cfcfcf;
}

.header-callback .gUniForm .uFormReset:active {
	position: relative;
	top: 1px;
}

.header-callback .gUniForm .uToolsIcon {
	display: inline-block;
	margin-top: -1px;
	margin-right: 12px;
	vertical-align: middle;
}

.header-callback .gUniForm .eFormHidden {
	display: none;
}

.header-callback .gUniFormSuccess {
	position: fixed;
	top: 0;
	left: 0;
	z-index: 1000;
	display: none;
	width: 100%;
	height: 100%;
	overflow: auto;
	color: #000000;
	background: rgb(0 5 10 / 75%);
	transition: 0.1s all ease-in-out;
}

.header-callback .gUniFormSuccessContainer {
	position: absolute;
	top: 50%;
	left: 50%;
	box-sizing: border-box;
	width: 500px;
	max-width: 100%;
	height: 300px;
	margin-top: -150px;
	margin-left: -250px;
	line-height: 270px;
	background-color: transparent;

	/* box-shadow: 1px 1px 12px rgba(60, 60, 60, 0.3); */
	border: 14px solid rgb(255 255 255 / 12%);
	border-radius: 14px;
	animation-name: zoomIn;
	animation-duration: 0.2s;
	animation-fill-mode: both;
}

.header-callback .gUniFormSuccessBg {
	background-color: #ffffff;
	border-radius: 4px;
}

.header-callback .gUniFormSuccessMiddler {
	display: inline-block;
	line-height: 21px;
	vertical-align: middle;
}

.header-callback .gUniFormSuccessHeading {
	padding: 0 24px;
	font-weight: 600;
	font-size: 24px;
	line-height: 30px;
	text-align: center;
	text-transform: uppercase;
}

.header-callback .gUniFormSuccessText {
	margin-top: 12px;
	padding: 0 24px;
	line-height: 21px;
	text-align: center;
}

.header-callback .gUniFormButtonContainter {
	text-align: center;
}

.header-callback .gUniFormSuccessButton {
	display: inline-block;
	height: 40px;
	margin-top: 18px;
	padding: 0 24px;
	color: #ffffff;
	line-height: 40px;
	text-align: center;
	vertical-align: middle;
	background-color: #000000;
	border-radius: 4px;
	transition: all 0.2s ease-in-out;
}

.header-callback .gUniFormSuccessButton:hover {
	color: #ffffff;
	opacity: 0.85;
}

.header-callback .gUniFormSuccessButton:active {
	position: relative;
	top: 1px;
}

.header-callback .gUniFormSuccessExit {
	position: absolute;
	top: 24px;
	right: 24px;
	display: block;
	width: 24px;
	height: 24px;
	background: none;
	transition: none;
}

.header-callback .gUniFormModalWindowExit:active {
	transform: scale(0.8);
}

.header-callback .eFormRequired {
	margin-top: 12px;
}

.header-callback .eFormBlur {
	filter: blur(3px);
}

@keyframes zoomIn {
	0% {
		transform: scale3d(0.3, 0.3, 0.3);
		opacity: 0;
	}

	50% {
		opacity: 1;
	}
}

@keyframes zoomIn {
	0% {
		transform: scale3d(0.3, 0.3, 0.3);
		opacity: 0;
	}

	50% {
		opacity: 1;
	}
}

@media all and (max-width: 650px) {
	.header-callback .gUniFormModalWindowContainer {
		width: 400px;
	}

	.header-callback .gUniFormSuccessContainer {
		width: 300px;
		margin-left: -150px;
	}
}

@media all and (max-width: 450px) {
	.header-callback .gUniFormModalWindowContainer {
		width: 340px;
	}

	.header-callback .gUniForm .uFormButton:first-child {
		width: 100%;
		padding: 0;
	}

	.header-callback .gUniForm .uFormButton:last-child {
		display: none;
	}
}

@media all and (max-width: 350px) {
	.header-callback .gUniFormModalWindow .uFormDescription {
		display: none;
	}

	.header-callback .gUniFormModalWindowContainer {
		width: 300px;
		padding: 12px;
	}

	.header-callback .gUniFormModalWindow .uFormHeading {
		box-sizing: border-box;
		margin-top: 6px;
		padding-right: 36px;
		line-height: normal;
		text-align: left;
	}

	.header-callback .gUniFormModalWindowExit {
		top: 22px;
		right: 12px;
	}
}

/* End */


/* Start:/local/components/dw/cookie.notice/templates/.default/style.css?17512338671149*/
.cookie-notice {
	position: fixed;
	right: 18px;
	bottom: 24px;
	z-index: 9999;
	width: min(100%, 400px);
	color: #000000;
	background-color: #ffffff;
	box-shadow: 0 0 25px rgb(0 0 0 / 15%);
}

.cookie-notice:not(.cookie-notice--visible) {
	display: none;
}

.cookie-notice__inner {
	box-sizing: border-box;
	padding: 36px;
}

.cookie-notice__inner,
.cookie-notice__content {
	display: flex;
	flex-direction: column;
	gap: 18px;
}

.cookie-notice__text {
	margin: 0;
	font-size: 13px;
	line-height: 1.5;
}

.cookie-notice__heading {
	font-size: 24px;
	line-height: 1.4;
}

.cookie-notice__confirm-button {
	width: 100%;
}

@media (min-width: 1025px) {
	.cookie-notice {
		border-radius: 10px;
	}
}

@media (max-width: 1024px) and (min-width: 800px) {
	.cookie-notice__inner {
		flex-direction: row;
		align-items: center;
	}
}

@media (max-width: 1024px) {
	.cookie-notice {
		right: 0;
		bottom: 0;
		width: 100%;
		border-top-left-radius: 10px;
		border-top-right-radius: 10px;
	}

	.cookie-notice__inner {
		padding: 24px;
	}

	.cookie-notice__inner,
	.cookie-notice__content {
		gap: 12px;
	}

	.cookie-notice__heading {
		font-size: 16px;
	}
}

/* End */


/* Start:/local/templates/dw/styles.css?1769016536249*/
input:-webkit-autofill,
input:-webkit-autofill:hover,
input:-webkit-autofill:focus,
input:-webkit-autofill:active {
	box-shadow: 0 0 0 30px white inset !important;
}

select,
textarea,
input {
	outline: none;
	box-shadow: none;
	appearance: none;
}

/* End */


/* Start:/local/templates/dw/template_styles.css?176926856327993*/
:root {
	--header-height: 134px;
}

@media (max-width: 1250px) {
	:root {
		--header-height: 136px;
	}
}

@media (max-width: 1000px) {
	:root {
		--header-height: 164px;
	}
}

@media (max-width: 500px) {
	:root {
		--header-height: 152px;
	}
}

/* header-line */
.header-line {
	/*	position: relative; */
	z-index: 800;
}

.header-line .block-logo a {
	display: block;
}

.header-line .block-logo img {
	max-width: 295px;
	max-height: 109px;
	vertical-align: middle;
}

.header-line .callback-container,
.header-line .basket-ajax-container {
	display: inline-block;
	vertical-align: middle;
}

.header-line .basket-ajax-container {
	margin-left: 24px;
}

.header-line .block-basket .button {
	width: 150px;
}

.header-line .block-basket .button,
.header-line .block-callback .button {
	position: relative;
}

.header-line .block-basket .button .callback-counts,
.header-line .block-callback .button .callback-counts {
	display: none;
}

.header-line .block-callback .button span,
.header-line .block-basket .button span {
	margin-right: 2px;
	margin-bottom: -2px;
}

.header-line .block-basket .button span {
	margin-bottom: -4px;
}

.header-line .block-basket .button span {
	margin-right: 8px;
}

.header-line .block-city-item .city-name,
.header-line .block-contact-email {
	border: 0;
}

.header-line .block-city-item .city-name:hover,
.header-line .block-contact-email:hover {
	border-width: 0;
}

.header-line .block-city-item .sprite {
	display: inline-block;
	margin-top: -2px;
	margin-right: 6px;
	vertical-align: middle;
}

/* header-small */
.header-small .header-line {
	padding-bottom: 46px;
	background-size: cover;
}

.header-small .header-line + .menu-top-block {
	z-index: 800;
	margin-top: -44px;
}

.block-breadcrumbs span,
.block-breadcrumbs a {
	color: #ffffff;
}

.block-breadcrumbs.text-black span,
.block-breadcrumbs.text-black a {
	color: #000000;
}

.block-breadcrumbs span::after,
.block-breadcrumbs a::after {
	margin: 0 5px;
	color: #ffffff;
	content: "-";
}

.block-breadcrumbs.text-black span::after,
.block-breadcrumbs.text-black a::after {
	color: #000000;
}

.block-breadcrumbs span:last-child::after {
	content: "";
}

.not-visible {
	display: none;
}

@media screen and (max-width: 1650px) {
	.header-line .block-logo img {
		max-width: 219px;
		max-height: 94px;
	}

	.header-line .basket-ajax-container {
		margin-left: 12px;
	}
}

@media screen and (max-width: 1425px) {
	.header-line .block-contact-phone {
		font-size: 16px;
		line-height: 18px;
	}

	.header-line .block-basket .button,
	.header-line .block-callback .button {
		height: 40px;
		padding: 0 12px;
		line-height: 40px;
		border-radius: 34px / 34px;
	}

	.header-line .block-basket .button {
		padding: 0 18px;
	}
}

@media screen and (max-width: 1250px) {
	.header-line .block-city-item {
		margin-left: 30px;
	}

	.header-line .block-basket .button,
	.header-line .block-callback .button {
		width: 32px;
		height: 32px;
		padding: 6px;
		line-height: 32px;
		text-align: center;
		background-color: rgb(255 255 255 / 10%);
	}

	.header-line .block-basket .button .callback-counts,
	.header-line .block-callback .button .callback-counts {
		position: absolute;
		top: 0;
		left: 30px;
		display: block;
		width: 14px;
		height: 14px;
		margin-right: 0;
		margin-bottom: 0;
		line-height: 14px;
		text-align: center;
		border-radius: 50%;
	}

	.header-line .block-callback .button .callback-counts {
		color: #ffffff;
		font-weight: bold;
		font-size: 16px;
		background-color: #4dd130;
	}

	.header-line .block-basket .button .callback-counts {
		color: #000000;
		font-weight: bold;
		font-size: 10px;
		background-color: #ffffff;
	}

	.header-line .block-basket .button .sprite,
	.header-line .block-callback .button .sprite {
		margin-right: 0;
	}

	.header-line .block-basket .button .sprite + .basket-text,
	.header-line .block-callback .button .sprite + .callback-text {
		display: none;
	}
}

@media screen and (max-width: 1000px) {
	.header-line .block-logo img {
		max-width: 190px;
		max-height: 82px;
	}

	.header-small .header-line {
		padding-bottom: 60px;
	}

	.header-line {
		position: relative;
	}

	.header-line .block-button,
	.header-line .block-logo {
		padding-top: 24px;
	}

	.header-line .block-city-item .city-name {
		font-size: 13px;
	}

	.header-line .block-contacts {
		position: absolute;
		top: 6px;
		left: 0;
		padding-top: 0;

		/* 6px */
		text-align: left;
	}

	.block-contact--secondary {
		display: none;
	}

	.header-line .block-contact-item {
		margin: 0;
		text-align: right;
	}

	.header-line .block-contact-phone {
		margin-right: 18px;
	}

	.header-line .block-basket .button,
	.header-line .block-callback .button {
		width: auto;
		height: 56px;
		padding: 0;
		line-height: 56px;
		background-color: inherit;
	}

	.header-line .block-basket .button .callback-counts,
	.header-line .block-callback .button .callback-counts {
		top: 12px;
		left: 30px;
	}

	.header-line .block-basket .button .sprite,
	.header-line .block-callback .button .sprite {
		width: 44px;
		height: 44px;
		padding: 0;
		line-height: 44px;
		text-align: center;
		vertical-align: middle;
		background-color: rgb(255 255 255 / 10%);
		border-radius: 34px / 34px;
	}

	.header-line .block-callback .button .sprite.ui-21.type-6 {
		background-position: -228px -3108px;
	}

	.header-line .block-basket .button .sprite.ui-21.type-5 {
		background-position: -182px -3108px;
	}

	.header-line .block-basket .button .sprite + .basket-text,
	.header-line .block-callback .button .sprite + .callback-text {
		display: inline-block;
		margin: 6px 0 0 6px;
	}

	.header-line .block-basket .button span {
		margin-bottom: 0;
	}

	.header-line .block-city-item {
		margin-left: 0;
	}

	.header-line .block-contact-phone {
		margin-left: 24px;
		font-size: 13px;
		line-height: 16px;
	}

	.header-line .block-contact:last-child .block-contact-phone {
		margin-left: 48px;
	}

	.header-line .block-contact-email {
		float: right;

		/* margin-right: 48px; */
		margin-top: 4px;
		font-size: 14px;
		line-height: 14px;
	}

	.header-line .block-contact:last-child .block-contact-email {
		margin-right: 0;
	}
}

@media screen and (max-width: 760px) {
	.header-line .block-button {
		width: 120px;
	}

	.header-line .block-basket,
	.header-line .block-callback {
		width: 48px;
	}

	.header-line .block-basket .button,
	.header-line .block-callback .button {
		height: 44px;
		line-height: 44px;
	}

	.header-line .block-basket .button .callback-counts,
	.header-line .block-callback .button .callback-counts {
		top: 0;
		left: 30px;
	}

	.header-line .block-contacts .block-contact:first-child {
		padding-right: 12px;
	}

	.header-line .block-contacts > div .block-contact:first-child > .block-contact-email,
	.header-line .block-contacts .block-city,
	.header-line .block-basket .button .sprite + .basket-text,
	.header-line .block-callback .button .sprite + .callback-text {
		display: none;
	}

	.header-line .block-contact-item {
		width: 100%;
		text-align: left;
	}

	.header-line .block-contact:last-child .block-contact-phone {
		margin-right: 12px;
		margin-left: 0;
		text-align: left;
	}

	.header-line .block-contact:last-child .block-contact-email {
		width: 50%;
		margin-right: 0;
		margin-left: 0;
		text-align: right;
	}

	.header-line .empty-block {
		display: none;
	}
}

@media screen and (max-width: 460px) {
	.header-line .block-contact-phone {
		margin-left: 0;
	}

	.header-line .block-contact:last-child .block-contact-phone {
		margin-left: 6px;
	}
}

@media screen and (max-width: 350px) {
	.header-line .block-contact-email,
	.header-line .block-contact-phone {
		font-size: 12px;
	}
}

/* menu top */
.menu-top-block {
	position: relative;
	z-index: 700;
}

.menu-top-block .menu-top {
	margin: 0;
	padding: 0;
}

.menu-top-block .menu-top li {
	display: inline-block;
	height: 42px;
	line-height: 42px;
}

.menu-top-block .menu-top > li > a {
	font-weight: 600;
}

.menu-top-block .menu-top-item.selected > a {
	border-color: #ffffff;
	border-style: solid;
	border-width: 0 0 3px;
	transition: none;
}

.menu-top-block .menu-top-item.selected:hover > a {
	border-color: #87d531;
}

.menu-top-block .menu-top li > a {
	padding: 12px 24px;
}

.menu-top-block .menu-top .menu-burger {
	display: none;
}

.menu-top-block .menu-top li:hover > a {
	border-color: #ffffff;
	border-style: solid;
	border-width: 0 0 3px;
	transition: none;
}

.menu-top-block .menu-top li > .menu-top-dropdown {
	position: absolute;
	top: 44px;
	left: 0;
	z-index: 100;
	display: none;
	width: 100%;
	padding: 0;
	background-color: #ffffff;
	visibility: hidden;
	opacity: 0;
	transition: 0.2s;
}

.menu-top-block .menu-top li:hover > .menu-top-dropdown {
	display: block;
	box-shadow: 3px 0 6px rgb(0 0 0 / 20%) inset;
	visibility: visible;
	opacity: 1;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-drop {
	z-index: 100;
	padding: 0;
	text-align: center;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-drop > li,
.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-drop > li:hover {
	border-bottom-width: 0;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-drop > li {
	line-height: normal;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-drop > li .item-sub-link a {
	line-height: 16px;
}

/* menu top 1 */
.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-1 {
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-1 > li {
	width: 33%;
	height: 100%;
	padding: 36px 0;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-1 > li:hover {
	padding: 36px 0;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-1 > li:last-child {
	border-right-width: 0;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-1 > li .item-basic-link a {
	border-style: dashed;
	border-width: 0 0 2px;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-1 > li .block-image img {
	max-width: 100%;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-1 > li .block-link {
	padding-right: 60px;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-1 > li:last-child .block-link {
	padding-right: 12px;
}

.menu-top-block
	.menu-top
	li
	> .menu-top-dropdown
	.menu-top-1
	> li:last-child
	.block-link
	.item-sub-link {
	margin-top: 10px;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-1 > li .block-link .item-sub-link a {
	display: inline-block;
	margin-top: 10px;
	padding: 6px 12px;
	border-radius: 16px;
}

/* menu top 2 */
.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-2 {
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-2 > li {
	width: 33%;
	height: 100%;
	padding: 36px 0;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-2 > li:hover {
	padding: 36px 0;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-2 > li:last-child {
	border-right-width: 0;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-2 > li .block-image img {
	max-width: 100%;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-2 > li .item-basic-link a {
	border-style: dashed;
	border-width: 0 0 2px;
}

/* menu top 3 */
.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 {
	padding-bottom: 24px;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li {
	width: 49%;
	height: 100%;
	padding: 0;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li:first-child {
	width: 50%;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li:hover {
	padding: 0;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li:last-child {
	border-right-width: 0;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li .block-image img {
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li .item-basic-link a {
	border-style: dashed;
	border-width: 0 0 2px;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li .block-link {
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li:last-child .block-link {
	padding-right: 0;
}

.menu-top-block
	.menu-top
	li
	> .menu-top-dropdown
	.menu-top-3
	> li:last-child
	.block-link
	.item-sub-link {
	margin-top: 10px;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li .block-link .item-sub-link a {
	display: inline-block;
	margin-top: 6px;
	padding: 6px 12px;
	border-radius: 16px;
}

.menu-top-block
	.menu-top
	li
	> .menu-top-dropdown
	.menu-top-3
	> li
	.block-support
	.block-support-link {
	display: block;
	width: 100%;
	padding: 14px 0;
}

.menu-top-block
	.menu-top
	li
	> .menu-top-dropdown
	.menu-top-3
	> li
	.block-support
	.block-support-link:hover {
	color: #0273e0;
}

.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li .block-support .image-supp {
	display: inline-block;
	height: 24px;
	margin-right: 12px;
	vertical-align: middle;
}

.menu-top-block
	.menu-top
	li
	> .menu-top-dropdown
	.menu-top-3
	> li
	.block-support
	.sprite:last-child {
	float: right;
	margin-right: 0;
}

@media screen and (max-width: 1650px) {
	.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li {
		width: 44%;
	}

	.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li:first-child {
		width: 55%;
	}

	.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li .block-link {
		padding-bottom: 0;
	}

	.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li .block-support {
		padding-left: 0;
	}

	.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li .block-support > div {
		padding-left: 10px;
	}

	.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li .block-image img {
		max-width: 100%;
	}

	.menu-top-block .menu-top li > a {
		padding: 12px 22px;
	}

	.menu-top-block .menu-top li:hover > a {
	}
}

@media screen and (max-width: 1425px) {
	.menu-top-block .menu-top li > a {
		padding: 12px 16px;
	}

	.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li .block-image {
		vertical-align: middle;
	}

	.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li {
		width: 49%;
	}

	.menu-top-block .menu-top li > .menu-top-dropdown .menu-top-3 > li:first-child {
		width: 50%;
	}
}

@media screen and (max-width: 1250px) {
	.menu-top-block {
		position: relative;
		height: 44px;
		overflow: hidden;
	}

	.menu-top-block .menu-top {
		max-width: 100%;
		height: 72px;
		margin: 0 auto;
		padding-left: 24px;
		overflow: auto;
		white-space: nowrap;
	}

	.menu-top-block .menu-top .menu-burger {
		display: inline-block;
		padding: 0;
	}

	.menu-top-block .menu-top li.menu-burger > a {
		padding: 8px 12px;
		background-color: #87d531;
		border-radius: 16px;
	}

	.menu-top-block .menu-top li.menu-burger:hover > a {
		padding: 8px 12px;
		border-bottom: 0;
	}

	.menu-top-block .menu-top li:hover > a:active {
		top: 0;
	}

	.menu-top-block .menu-top li > .menu-top-dropdown {
		top: 44px;
	}

	.menu-top-block .menu-top li:hover > a {
		border-bottom-width: 0;
	}
}

@media screen and (max-width: 1000px) {
	.header-line + .menu-top-block {
		z-index: 100;
		max-width: 700px;
		margin: 12px auto 0;
		border-color: rgb(255 255 255 / 0%);
	}

	.header-small .header-line {
		padding-bottom: 72px;
	}

	.header-small .header-line + .menu-top-block {
		z-index: 1000;
		margin-top: -60px;
	}

	.menu-top-block .menu-top {
		padding-left: 0;
	}

	.menu-top-block .menu-top-item.selected > a {
		font-weight: 600;
		border-bottom-width: 0;
	}
}

@media screen and (max-width: 760px) {
	.header-line + .menu-top-block {
		max-width: 440px;
	}
}

@media screen and (max-width: 500px) {
	.header-line .middle-wrapper {
		max-width: 95%;
		margin: 0 auto;
	}

	.header-line .block-contact:last-child .block-contact-phone {
		margin-left: 3%;
	}

	.header-line + .menu-top-block {
		max-width: 100%;
		margin-top: 0;
	}

	.menu-top-block .menu-top {
		padding-left: 12px;
	}

	.menu-top-block .menu-top-item.selected > a {
		color: #ffffff;
		font-weight: 400;
		background-color: #87d531;
	}

	.menu-top-block .menu-top li:last-child {
		margin-right: 12px;
	}

	.menu-top-block .menu-top li {
		padding: 6px 2px;
	}

	.menu-top-block .menu-top li:hover {
		border-bottom: 0;
	}

	.menu-top-block .menu-top li a {
		padding: 8px 16px;
		color: #000000;
		font-size: 13px;
		background-color: #ffffff;
		border-radius: 20px;
	}
}

@media screen and (max-width: 460px) {
	.header-line .block-contact:last-child .block-contact-phone {
		margin-left: 5.5%;
	}
}

/* mobile menu */
.mobile-overflow {
	position: static;
	z-index: 1000;
	margin: 0;
	padding: 0;
	overflow: hidden;
	visibility: hidden;
	opacity: 0;
	transition:
		opacity 0s,
		visibility 0.2s linear 0.2s;
}

.mobile-overlay {
	position: fixed;
	top: 0;
	left: 0;
	z-index: 2000;
	width: 100%;
	height: 100%;
	background-color: #000000;
	visibility: hidden;
	opacity: 0;
	transition:
		opacity 0.2s,
		visibility 0.2s linear 0.2s;
}

.mobile-block {
	position: fixed;
	top: 0;
	bottom: 0;
	left: -270px;
	z-index: 3000;
	width: 270px;
	max-width: 100%;
	overflow: hidden;
	overflow-y: auto;
	background-color: #f2f4f8;
	visibility: hidden;
	transition:
		left 0.2s,
		visibility 0.2s linear 0.2s;
}

.mobile-overflow.open {
	visibility: visible;
	opacity: 1;
	transition-delay: 0.3s;
}

.mobile-overflow.open .mobile-overlay {
	visibility: visible;
	opacity: 0.15;
	transition-delay: 0.3s;
}

.mobile-overflow.open .mobile-block {
	left: 0;
	visibility: visible;
	transition-delay: 0.3s;
}

.mobile-block .mobile-menu-sub .back-block {
	position: relative;
	display: block;
	width: 85%;
	padding: 16px 20px;
	background-color: #ffffff;
	border-bottom: 1px solid rgb(0 0 0 / 5%);
}

.mobile-block .block-city .back-block {
	background-color: #f2f4f8;
	border-width: 0;
}

.mobile-block .mobile-menu-sub .back-block .back-link {
	font-size: 12px;
	line-height: 16px;
}

.mobile-block .mobile-title {
	position: relative;
	width: 85%;
	padding: 16px 20px;
	background-color: #ffffff;
}

.mobile-block .block-city .mobile-title {
	background-color: #f2f4f8;
}

.mobile-block .mobile-title .title-link {
	display: inline-block;
	width: 75%;
}

.mobile-block .mobile-title .shift-link,
.mobile-block .mobile-title .close {
	position: absolute;
	top: 16px;
	right: 20px;
}

.mobile-block .mobile-title .shift-link {
	top: 50%;
	margin-top: -10px;
}

.mobile-block .mobile-menu .mobile-menu-list {
	margin: 0;
	padding: 0;
}

.mobile-block .mobile-menu .mobile-menu-item {
	position: relative;
	display: block;
	width: 85%;
	padding: 16px 20px;
	background-color: #ffffff;
	border-top: 1px solid rgb(0 0 0 / 5%);
}

.mobile-block .callback-counts {
	display: none;
}

.mobile-block .header-callback .ui-21.type-6 {
	display: inline-block;
	margin-top: -4px;
	vertical-align: middle;
}

.mobile-block .block-city-item .arrow-menu,
.mobile-block .mobile-menu .arrow-menu {
	position: absolute;
	top: 18px;
	right: 22px;
}

.mobile-block .block-city-item .arrow-menu {
	right: 14px;
}

.mobile-block .mobile-menu .mobile-menu-sub {
	position: fixed;
	top: 0;
	bottom: 0;
	left: -100%;
	z-index: 4000;
	width: 270px;
	max-width: 100%;
	overflow: hidden;
	overflow-y: auto;
	background-color: #f2f4f8;
	visibility: hidden;
	transition:
		left 0.2s,
		visibility 0.2s linear 0.2s;
}

.mobile-block .mobile-menu .mobile-menu-sub.open-sub {
	left: 0;
	visibility: visible;
	transition-delay: 0.2s;
}

.mobile-block .block-login {
	position: relative;
	display: block;
	width: 85%;
	padding: 16px 20px;
	border-top: 1px solid rgb(0 0 0 / 5%);
}

.mobile-block .block-login a {
	display: inline-block;
	width: auto;
	padding: 0 3px;
	background-color: inherit;
	border-top: 0 solid rgb(0 0 0 / 5%);
}

.mobile-block .block-login .sprite {
	margin-right: 2px;
	margin-bottom: -4px;
}

.mobile-block .block-city .mobile-menu-sub .mobile-menu-list .mobile-menu-item {
	background-color: #ffffff;
}

.mobile-block .mobile-menu .block-city .mobile-menu-item {
	background-color: #f2f4f8;
}

.mobile-block .block-city .mobile-menu .mobile-menu-list li {
	list-style: inherit;
}

.mobile-block .block-city-item {
	margin-left: -5px;
}

.mobile-block .block-city .mobile-menu-list .selected-item {
	padding: 16px 20px;
}

.mobile-block .block-city .mobile-menu-list .selected-item span {
	display: block;
	width: 100%;
}

.mobile-block .block-city .city-form .city-field {
	width: 90%;
	padding: 8px 12px;
	border-radius: 0 34px 34px 0 / 0 34px 34px 0;
}

.mobile-block .block-city .city-form .button-city {
	position: absolute;
	top: 4px;
	right: 4px;
	width: 24px;
	height: 24px;
	padding: 0;
	line-height: 24px;
	text-align: center;
}

.mobile-block .block-city-item .sprite {
	margin-right: 2px;
	margin-bottom: -2px;
}

.mobile-block .block-call {
	padding: 16px 20px;
	border-top: 1px solid rgb(0 0 0 / 5%);
}

.mobile-block .block-call > div {
	display: block;
	margin-bottom: 6px;
}

@media screen and (max-width: 1250px) {
	.mobile-overflow {
	}
}

.add-cart.added {
	color: #ffffff;
	background-color: #ff0000;
}

/* zoomer global styles */
#appZoomWindow .appZoomContainerExit {
	position: absolute;
	top: -30px;
	right: -30px;
	display: block;
	width: 30px;
	height: 30px;
}

#appZoomWindow .appZoomContainerExit:active,
#appZoomWindow .appZoomContainerExit:focus,
#appZoomWindow .appZoomContainerExit:hover {
	background-position: -60px -20px;
}

#appZoomWindow .appZoomContainer.loading {
	min-width: 100px;
	min-height: 100px;
	background: url("/local/templates/dw/images/windowLoader.gif") 50% 50% no-repeat transparent;
}

.block-adv-container .block-heading,
.block-adv-container .block-description {
	text-align: center;
}

/* footer-line */
.footer-line .block-logo img {
	max-width: 100%;
}

.footer-line .block-contacts .ui-21.type-6 {
	padding: 10px 5px;
	background-position: -234px -3112px;
	border-radius: 25px;
}

.footer-line .block-form input {
	width: 100%;
}

.footer-line .block-form .button {
	position: absolute;
	top: 5px;
	right: 0;
	padding: 0;
}

.footer-line .block-foot-menu {
	vertical-align: top;
}

.footer-line .menu-footer .menu-footer-list {
	margin: 0;
	padding: 0;
}

.footer-line .menu-footer .menu-footer-list li {
	margin: 8px 0;
	list-style: none;
}

.footer-line .menu-footer .menu-footer-item-link {
	color: #000000;
}

.footer-line .menu-footer .menu-footer-item-link:hover {
	color: #2e87e4;
}

.footer-line .menu-footer .menu-footer-item-link.selected {
	color: #2e87e4;
}

.footer-line .menu-footer .title-toogle {
	display: block;
	cursor: default;
	pointer-events: none;
}

.footer-line .menu-footer .title-toogle .sprite {
	display: none;
}

.footer-line .menu-footer .list-toogle {
	display: block;
}

.add-cart.loading {
	opacity: 0.7;
}

@media screen and (width >= 1001px) {
	.footer-line .menu-footer .list-toogle {
		display: block !important;
	}
}

@media screen and (max-width: 1650px) {
	.footer-line .block-reward .block-description {
		padding-right: 36px;
	}
}

@media screen and (max-width: 1425px) {
	.block-adv-container .block-heading {
		font-size: 40px;
		line-height: 36px;
	}

	.footer-line .block-logo {
		padding-right: 24px;
	}

	.footer-line .block-reward .block-description {
		padding-right: 12px;
	}
}

@media screen and (max-width: 1250px) {
	.footer-line .block-logo {
		padding-right: 48px;
	}

	.footer-line .block-contacts:last-child {
		display: none;
	}

	.footer-line .block-reward {
		text-align: center;
	}

	.footer-line .block-reward .block-image {
		display: block;
	}

	.footer-line .block-foot-menu .menu-footer-block {
		padding-left: 32px;
	}

	.footer-line .block-advice + .empty-block {
		display: none;
	}

	.footer-line .block-form .ui-17:not(checked) + label,
	.footer-line .block-form .ui-18:not(checked) + label {
		font-size: 12px;
		line-height: 16px;
	}
}

@media screen and (max-width: 1000px) {
	.block-adv-container .block-heading {
		font-size: 24px;
		line-height: 24px;
	}

	.block-adv-container .block-description {
		margin-top: 12px;
	}

	.block-adv-container .block-heading,
	.block-adv-container .block-description {
		text-align: left;
	}

	.footer-line.p-t-b-48 {
		padding-top: 0;
		padding-bottom: 0;
	}

	.footer-line .middle-wrapper > div {
		padding-top: 24px;
		padding-bottom: 24px;
	}

	.footer-line .block-spec {
		display: none;
	}

	.footer-line .block-contacts:last-child {
		display: table-cell;
	}

	.footer-line .block-reward-container {
		position: relative;
		width: 100%;
		height: 65px;
		overflow: hidden;
	}

	.footer-line .block-reward {
		display: block;
		height: 89px;
		overflow-x: auto;
		white-space: nowrap;
	}

	.footer-line .block-reward .block-reward-item {
		display: inline-block;
		height: 70px;
		padding: 0 12px;
		vertical-align: top;
	}

	.footer-line .block-reward .block-reward-item:first-child {
		padding-left: 0;
	}

	.footer-line .block-reward .block-image {
		display: inline-block;
	}

	.footer-line .block-reward .block-image img {
		margin-right: 0;
	}

	.footer-line .block-reward .block-description {
		display: inline-block;
		padding-right: 0;
		white-space: normal;
		text-align: left;
	}

	.footer-line .block-foot-menu .menu-footer-block {
		display: block;
		padding-left: 0;
	}

	.footer-line .block-foot-menu {
		padding-left: 36px;
		vertical-align: top;
	}

	.footer-line .menu-footer-title {
		position: relative;
		display: block;
		width: 85%;
		padding: 12px 24px;
		color: #0265dc;
		font-weight: bold;
		font-size: 14px;
		background-color: #ffffff;
		border-radius: 25px;
		box-shadow: 0 0 25px rgb(0 0 0 / 10%);
		cursor: pointer;
	}

	.footer-line .menu-footer .title-toogle {
		cursor: pointer;
		pointer-events: inherit;
	}

	.footer-line .menu-footer .title-toogle .sprite {
		position: absolute;
		top: 30%;
		right: 12px;
		display: block;
	}

	.footer-line .title-toogle.opened .sprite {
		background-position: -340px -200px;
	}

	.footer-line .menu-footer .list-toogle {
		box-sizing: border-box;
		max-height: 0;
		margin-top: -10px;
		padding: 0 10px 10px;
		overflow: hidden;
		opacity: 0;
		transition: none;
	}

	.footer-line .menu-footer .list-toogle.opened {
		max-height: 900px;
		margin: 0;
		opacity: 1;
		transition: max-height 0.25s ease-in-out;
	}

	.footer-line .menu-footer .menu-footer-list li {
		display: inline-block;
		background: rgb(2 101 220 / 10%);
		border-radius: 25px;
		box-shadow: 0 0 25px rgb(255 255 255 / 20%);
	}

	.footer-line .menu-footer .menu-footer-list li:not(:first-child) {
		margin-right: 6px;
	}

	.footer-line .menu-footer .menu-footer-list li a {
		display: block;
		padding: 12px 16px;
		color: #0265dc;
		font-size: 13px;
		line-height: 14px;
	}
}

@media screen and (max-width: 760px) {
	.footer-line.p-t-b-48 {
		padding-bottom: 24px;
	}

	.footer-line .footer-center {
		display: block;
	}

	.footer-line .footer-center .block-advice,
	.footer-line .footer-center .block-foot-menu {
		display: block;
	}

	.footer-line .middle-wrapper > div:last-child {
		padding-bottom: 0;
	}

	.footer-line .block-logo {
		padding-right: 0;
	}

	.footer-line .block-foot-menu {
		margin-top: 24px;
		padding-left: 0;
	}

	.footer-line .block-contacts:last-child {
		display: none;
	}

	.footer-line .block-contacts > div > .tc:first-child {
		display: none;
	}

	.footer-line .block-contacts > div > div {
		text-align: right;
	}

	.footer-line .menu-footer-title {
		width: 90%;
		padding: 12px 22px;
	}

	.footer-line .block-contacts .sprite {
		display: none;
	}

	.footer-line .block-title {
		font-size: 21px;
		line-height: 24px;
	}
}

@media screen and (max-width: 460px) {
	.footer-line .block-contact-phone {
		font-size: 14px;
		line-height: 16px;
	}

	.footer-line .block-contact-email {
		font-size: 13px;
		line-height: 14px;
	}

	.footer-line .menu-footer-title {
		width: 85%;
		padding: 12px 24px;
	}

	.footer-line .menu-footer-title {
		padding: 12px 20px;
	}
}

.util-header {
	margin-top: 72px;
}

.util-container {
	margin-top: 72px;
	background: #285986;
}

.dw-slider ol {
	margin: 0;
	padding: 0;
	list-style: none;
}

::selection {
	color: #ffffff;
	background: #0273e0;
}

[hidden] {
	display: none;
}

/* End */
/* /local/templates/dw/assets/css/snippets.css?17689893435812 */
/* /local/templates/dw/assets/css/buttons.css?17690161661227 */
/* /local/templates/dw/assets/css/colors.css?17696147975739 */
/* /local/templates/dw/assets/css/forms.css?17690161075225 */
/* /local/templates/dw/assets/css/reset.css?17690161071187 */
/* /local/templates/dw/assets/css/text.css?17693621916064 */
/* /local/templates/dw/assets/css/util.css?176901616659203 */
/* /local/templates/dw/assets/css/grid.css?17690163084718 */
/* /local/templates/dw/assets/css/ui.css?176901209417750 */
/* /local/templates/dw/assets/css/parts/1.css?17690164362127 */
/* /local/templates/dw/assets/css/parts/2.css?17690164091752 */
/* /local/templates/dw/assets/css/parts/3.css?17690164011644 */
/* /local/templates/dw/assets/css/parts/4.css?17690164012082 */
/* /local/templates/dw/assets/css/parts/5.css?17690164372049 */
/* /local/templates/dw/assets/css/parts/6.css?17690164351968 */
/* /local/templates/dw/assets/css/parts/7.css?17690164011624 */
/* /local/templates/dw/assets/css/parts/8.css?17690164362147 */
/* /local/templates/dw/assets/css/parts/9.css?17690164012280 */
/* /local/templates/dw/assets/css/parts/11.css?17690164021782 */
/* /local/templates/dw/assets/css/parts/12.css?17690164021786 */
/* /local/templates/dw/assets/css/parts/13.css?17690164361814 */
/* /local/templates/dw/assets/css/parts/14.css?17690164371971 */
/* /local/templates/dw/assets/css/parts/15.css?17690164171709 */
/* /local/templates/dw/assets/css/blocks/block9.css?17690162723773 */
/* /local/templates/dw/assets/css/blocks/block10.css?17690162854058 */
/* /local/templates/dw/assets/css/blocks/block11.css?17690164034003 */
/* /local/templates/dw/assets/css/blocks/block12.css?17690163012528 */
/* /local/templates/dw/assets/css/blocks/block13.css?17690164012618 */
/* /local/templates/dw/assets/css/blocks/block14.css?17690162892773 */
/* /local/templates/dw/assets/css/blocks/block15.css?17690164982660 */
/* /local/templates/dw/assets/css/blocks/block3.css?17690164977002 */
/* /local/templates/dw/assets/css/blocks/block4.css?17690164613842 */
/* /local/templates/dw/assets/css/blocks/block5.css?17690163856067 */
/* /local/templates/dw/assets/css/blocks/block6.css?17690163004055 */
/* /local/templates/dw/assets/css/blocks/block7.css?17690163014373 */
/* /local/templates/dw/assets/css/blocks/block16.css?17690163811850 */
/* /local/templates/dw/assets/css/blocks/block17.css?17690163003599 */
/* /local/templates/dw/assets/css/blocks/block20.css?17690161651503 */
/* /local/templates/dw/assets/css/blocks/block21.css?17690164991867 */
/* /local/templates/dw/assets/css/blocks/block23.css?17690164021659 */
/* /local/templates/dw/assets/css/blocks/block24.css?17690163802832 */
/* /local/templates/dw/assets/css/blocks/block45.css?17690161663479 */
/* /local/templates/dw/assets/css/blocks/block49.css?17690162993302 */
/* /local/templates/dw/assets/css/blocks/block53.css?17690163005543 */
/* /local/templates/dw/assets/css/blocks/block58.css?17690162667982 */
/* /local/templates/dw/assets/css/blocks/block59.css?17690164367119 */
/* /local/templates/dw/assets/css/blocks/block60.css?17690163006067 */
/* /local/templates/dw/assets/css/blocks/block61.css?17690164036054 */
/* /local/templates/dw/assets/css/blocks/block62.css?17690162905646 */
/* /local/templates/dw/assets/css/blocks/block63.css?17690162786763 */
/* /local/templates/dw/assets/css/blocks/block64.css?17690164985976 */
/* /local/templates/dw/assets/css/blocks/block65.css?17690163015512 */
/* /local/templates/dw/assets/css/blocks/block66.css?17690163026743 */
/* /local/templates/dw/assets/css/blocks/block67.css?17690164976964 */
/* /local/templates/dw/assets/css/blocks/block68.css?17690162837001 */
/* /local/templates/dw/assets/css/blocks/block69.css?17690164026906 */
/* /local/templates/dw/assets/css/blocks/block70.css?17690164974279 */
/* /local/templates/dw/assets/css/blocks/block71.css?17690163654034 */
/* /local/templates/dw/assets/css/blocks/block73.css?1769016371604 */
/* /local/templates/dw/assets/css/blocks/block75.css?17690161652102 */
/* /local/templates/dw/assets/css/blocks/block77.css?1769016497143 */
/* /local/templates/dw/assets/css/blocks/block78.css?1769016300143 */
/* /local/templates/dw/assets/css/blocks/block79.css?1769016165143 */
/* /local/templates/dw/assets/css/blocks/block80.css?17690161661668 */
/* /local/templates/dw/assets/css/blocks/block81.css?17690164973839 */
/* /local/templates/dw/assets/css/blocks/block83.css?17690163756249 */
/* /local/templates/dw/assets/css/blocks/block84.css?17690164022379 */
/* /local/templates/dw/assets/css/animations/animation1.css?17690161651750 */
/* /local/templates/dw/assets/libs/photoswipe/photoswipe.min.css?17689970534507 */
/* /local/templates/dw/assets/libs/splide/splide.min.css?17690081551965 */
/* /local/components/dw/sale.geo.positiion/templates/.default/style.css?176898915411794 */
/* /local/templates/dw/components/dweb/uni.form/form-type-7/style.css?176901616410647 */
/* /local/templates/dw/components/dweb/uni.form/form-type-6/style.css?17690163572509 */
/* /local/templates/dw/components/dweb/uni.form/form-type-9/style.css?176901636210647 */
/* /local/components/dw/cookie.notice/templates/.default/style.css?17512338671149 */
/* /local/templates/dw/styles.css?1769016536249 */
/* /local/templates/dw/template_styles.css?176926856327993 */